[iep] 01/03: Imported Upstream version 3.5
Ghislain Vaillant
ghisvail-guest at moszumanska.debian.org
Mon Dec 15 16:35:00 UTC 2014
This is an automated email from the git hooks/post-receive script.
ghisvail-guest pushed a commit to branch master
in repository iep.
commit ca2752ec080a7f752df91a7723a8d210cc9bd970
Author: Ghislain Antony Vaillant <ghisvail at gmail.com>
Date: Thu Dec 11 10:53:13 2014 +0000
Imported Upstream version 3.5
---
PKG-INFO | 61 +
iep.egg-info/PKG-INFO | 61 +
iep.egg-info/SOURCES.txt | 248 +++
iep.egg-info/dependency_links.txt | 1 +
iep.egg-info/entry_points.txt | 3 +
iep.egg-info/not-zip-safe | 1 +
iep.egg-info/requires.txt | 1 +
iep.egg-info/top_level.txt | 1 +
iep/__init__.py | 302 +++
iep/__main__.py | 51 +
iep/codeeditor/__init__.py | 72 +
iep/codeeditor/_test.py | 50 +
iep/codeeditor/base.py | 837 ++++++++
iep/codeeditor/extensions/__init__.py | 0
iep/codeeditor/extensions/appearance.py | 925 +++++++++
iep/codeeditor/extensions/autocompletion.py | 286 +++
iep/codeeditor/extensions/behaviour.py | 209 ++
iep/codeeditor/extensions/calltip.py | 137 ++
iep/codeeditor/highlighter.py | 134 ++
iep/codeeditor/manager.py | 292 +++
iep/codeeditor/misc.py | 101 +
iep/codeeditor/parsers/__init__.py | 205 ++
iep/codeeditor/parsers/c_parser.py | 212 ++
iep/codeeditor/parsers/cython_parser.py | 74 +
iep/codeeditor/parsers/python_parser.py | 347 ++++
iep/codeeditor/parsers/tokens.py | 145 ++
iep/codeeditor/qt.py | 19 +
iep/codeeditor/style.py | 255 +++
iep/codeeditor/textutils.py | 184 ++
iep/contributors.txt | 27 +
iep/iepcore/__init__.py | 8 +
iep/iepcore/about.py | 166 ++
iep/iepcore/baseTextCtrl.py | 619 ++++++
iep/iepcore/codeparser.py | 767 +++++++
iep/iepcore/commandline.py | 180 ++
iep/iepcore/compactTabWidget.py | 513 +++++
iep/iepcore/editor.py | 711 +++++++
iep/iepcore/editorTabs.py | 1543 ++++++++++++++
iep/iepcore/icons.py | 713 +++++++
iep/iepcore/iepLogging.py | 142 ++
iep/iepcore/kernelbroker.py | 823 ++++++++
iep/iepcore/license.py | 317 +++
iep/iepcore/main.py | 644 ++++++
iep/iepcore/menu.py | 2171 ++++++++++++++++++++
iep/iepcore/shell.py | 1507 ++++++++++++++
iep/iepcore/shellInfoDialog.py | 711 +++++++
iep/iepcore/shellStack.py | 599 ++++++
iep/iepcore/splash.py | 125 ++
iep/iepkernel/__init__.py | 24 +
iep/iepkernel/_nope.py | 126 ++
iep/iepkernel/debug.py | 483 +++++
iep/iepkernel/guiintegration.py | 460 +++++
iep/iepkernel/guisupport.py | 148 ++
iep/iepkernel/interpreter.py | 1119 ++++++++++
iep/iepkernel/introspection.py | 408 ++++
iep/iepkernel/magic.py | 475 +++++
iep/iepkernel/pipper.py | 79 +
iep/iepkernel/start.py | 165 ++
iep/license.txt | 25 +
iep/resources/appicons/ieplogo.icns | Bin 0 -> 53820 bytes
iep/resources/appicons/ieplogo.ico | Bin 0 -> 104785 bytes
iep/resources/appicons/ieplogo128.png | Bin 0 -> 1819 bytes
iep/resources/appicons/ieplogo16.png | Bin 0 -> 219 bytes
iep/resources/appicons/ieplogo256.png | Bin 0 -> 4549 bytes
iep/resources/appicons/ieplogo32.png | Bin 0 -> 593 bytes
iep/resources/appicons/ieplogo48.png | Bin 0 -> 825 bytes
iep/resources/appicons/ieplogo64.png | Bin 0 -> 1088 bytes
iep/resources/appicons/py.icns | Bin 0 -> 11492 bytes
iep/resources/appicons/py.ico | Bin 0 -> 19790 bytes
iep/resources/appicons/pyzologo128.png | Bin 0 -> 3376 bytes
iep/resources/appicons/pyzologo16.png | Bin 0 -> 602 bytes
iep/resources/appicons/pyzologo256.png | Bin 0 -> 6653 bytes
iep/resources/appicons/pyzologo32.png | Bin 0 -> 973 bytes
iep/resources/appicons/pyzologo48.png | Bin 0 -> 1349 bytes
iep/resources/appicons/pyzologo64.png | Bin 0 -> 1791 bytes
iep/resources/defaultConfig.ssdf | 124 ++
iep/resources/fonts/DejaVuSansMono-Bold.ttf | Bin 0 -> 313856 bytes
iep/resources/fonts/DejaVuSansMono-BoldOblique.ttf | Bin 0 -> 235848 bytes
iep/resources/fonts/DejaVuSansMono-Oblique.ttf | Bin 0 -> 241972 bytes
iep/resources/fonts/DejaVuSansMono.ttf | Bin 0 -> 333636 bytes
iep/resources/fonts/SourceCodePro-Bold.otf | Bin 0 -> 92248 bytes
iep/resources/fonts/SourceCodePro-Regular.otf | Bin 0 -> 89600 bytes
iep/resources/icons/accept.png | Bin 0 -> 781 bytes
iep/resources/icons/add.png | Bin 0 -> 733 bytes
iep/resources/icons/application.png | Bin 0 -> 464 bytes
iep/resources/icons/application_add.png | Bin 0 -> 619 bytes
iep/resources/icons/application_delete.png | Bin 0 -> 610 bytes
iep/resources/icons/application_double.png | Bin 0 -> 533 bytes
iep/resources/icons/application_edit.png | Bin 0 -> 703 bytes
iep/resources/icons/application_eraser.png | Bin 0 -> 558 bytes
iep/resources/icons/application_go.png | Bin 0 -> 634 bytes
iep/resources/icons/application_lightning.png | Bin 0 -> 656 bytes
iep/resources/icons/application_link.png | Bin 0 -> 701 bytes
iep/resources/icons/application_refresh.png | Bin 0 -> 698 bytes
iep/resources/icons/application_shell.png | Bin 0 -> 658 bytes
iep/resources/icons/application_view_tile.png | Bin 0 -> 465 bytes
iep/resources/icons/application_wrench.png | Bin 0 -> 733 bytes
iep/resources/icons/arrow_left.png | Bin 0 -> 345 bytes
iep/resources/icons/arrow_redo.png | Bin 0 -> 625 bytes
iep/resources/icons/arrow_refresh.png | Bin 0 -> 685 bytes
iep/resources/icons/arrow_rotate_anticlockwise.png | Bin 0 -> 608 bytes
iep/resources/icons/arrow_rotate_clockwise.png | Bin 0 -> 602 bytes
iep/resources/icons/arrow_undo.png | Bin 0 -> 631 bytes
iep/resources/icons/bug.png | Bin 0 -> 774 bytes
iep/resources/icons/bug_delete.png | Bin 0 -> 836 bytes
iep/resources/icons/bug_error.png | Bin 0 -> 841 bytes
iep/resources/icons/bullet_yellow.png | Bin 0 -> 287 bytes
iep/resources/icons/cancel.png | Bin 0 -> 587 bytes
iep/resources/icons/cog.png | Bin 0 -> 512 bytes
iep/resources/icons/comment_add.png | Bin 0 -> 530 bytes
iep/resources/icons/comment_delete.png | Bin 0 -> 548 bytes
iep/resources/icons/comments.png | Bin 0 -> 557 bytes
iep/resources/icons/cross.png | Bin 0 -> 655 bytes
iep/resources/icons/cut.png | Bin 0 -> 648 bytes
iep/resources/icons/debug_continue.png | Bin 0 -> 436 bytes
iep/resources/icons/debug_next.png | Bin 0 -> 601 bytes
iep/resources/icons/debug_quit.png | Bin 0 -> 609 bytes
iep/resources/icons/debug_return.png | Bin 0 -> 527 bytes
iep/resources/icons/debug_step.png | Bin 0 -> 508 bytes
iep/resources/icons/delete.png | Bin 0 -> 715 bytes
iep/resources/icons/disk.png | Bin 0 -> 620 bytes
iep/resources/icons/disk_as.png | Bin 0 -> 801 bytes
iep/resources/icons/disk_multiple.png | Bin 0 -> 691 bytes
iep/resources/icons/drive.png | Bin 0 -> 346 bytes
iep/resources/icons/error_add.png | Bin 0 -> 710 bytes
iep/resources/icons/filter.png | Bin 0 -> 629 bytes
iep/resources/icons/find.png | Bin 0 -> 659 bytes
iep/resources/icons/flag_green.png | Bin 0 -> 672 bytes
iep/resources/icons/folder.png | Bin 0 -> 537 bytes
iep/resources/icons/folder_hg.png | Bin 0 -> 618 bytes
iep/resources/icons/folder_page.png | Bin 0 -> 688 bytes
iep/resources/icons/folder_parent.png | Bin 0 -> 667 bytes
iep/resources/icons/folder_svn.png | Bin 0 -> 633 bytes
iep/resources/icons/help.png | Bin 0 -> 786 bytes
iep/resources/icons/information.png | Bin 0 -> 778 bytes
iep/resources/icons/keyboard.png | Bin 0 -> 570 bytes
iep/resources/icons/layout.png | Bin 0 -> 480 bytes
iep/resources/icons/link.png | Bin 0 -> 343 bytes
iep/resources/icons/magifier_zoom_out.png | Bin 0 -> 657 bytes
iep/resources/icons/magnifier.png | Bin 0 -> 615 bytes
iep/resources/icons/magnifier_zoom_in.png | Bin 0 -> 680 bytes
iep/resources/icons/monitor.png | Bin 0 -> 612 bytes
iep/resources/icons/overlay_disk.png | Bin 0 -> 338 bytes
iep/resources/icons/overlay_hg.png | Bin 0 -> 130 bytes
iep/resources/icons/overlay_link.png | Bin 0 -> 397 bytes
iep/resources/icons/overlay_star.png | Bin 0 -> 304 bytes
iep/resources/icons/overlay_svn.png | Bin 0 -> 132 bytes
iep/resources/icons/overlay_thumbnail.png | Bin 0 -> 145 bytes
iep/resources/icons/page_add.png | Bin 0 -> 739 bytes
iep/resources/icons/page_delete.png | Bin 0 -> 740 bytes
iep/resources/icons/page_delete_all.png | Bin 0 -> 778 bytes
iep/resources/icons/page_save.png | Bin 0 -> 774 bytes
iep/resources/icons/page_white.png | Bin 0 -> 354 bytes
iep/resources/icons/page_white_copy.png | Bin 0 -> 309 bytes
iep/resources/icons/page_white_dirty.png | Bin 0 -> 328 bytes
iep/resources/icons/page_white_gear.png | Bin 0 -> 402 bytes
iep/resources/icons/page_white_py.png | Bin 0 -> 412 bytes
iep/resources/icons/page_white_pyx.png | Bin 0 -> 415 bytes
iep/resources/icons/page_white_text.png | Bin 0 -> 342 bytes
iep/resources/icons/paste_plain.png | Bin 0 -> 605 bytes
iep/resources/icons/plugin.png | Bin 0 -> 591 bytes
iep/resources/icons/plugin_refresh.png | Bin 0 -> 756 bytes
iep/resources/icons/report.png | Bin 0 -> 649 bytes
iep/resources/icons/run_cell.png | Bin 0 -> 604 bytes
iep/resources/icons/run_file.png | Bin 0 -> 612 bytes
iep/resources/icons/run_file_script.png | Bin 0 -> 589 bytes
iep/resources/icons/run_lines.png | Bin 0 -> 595 bytes
iep/resources/icons/run_mainfile.png | Bin 0 -> 740 bytes
iep/resources/icons/run_mainfile_script.png | Bin 0 -> 746 bytes
iep/resources/icons/script.png | Bin 0 -> 748 bytes
iep/resources/icons/star.png | Bin 0 -> 670 bytes
iep/resources/icons/star2.png | Bin 0 -> 612 bytes
iep/resources/icons/star3.png | Bin 0 -> 683 bytes
iep/resources/icons/style.png | Bin 0 -> 813 bytes
iep/resources/icons/sum.png | Bin 0 -> 289 bytes
iep/resources/icons/text_align_justify.png | Bin 0 -> 209 bytes
iep/resources/icons/text_align_right.png | Bin 0 -> 209 bytes
iep/resources/icons/text_indent.png | Bin 0 -> 353 bytes
iep/resources/icons/text_indent_remove.png | Bin 0 -> 351 bytes
iep/resources/icons/text_padding_right.png | Bin 0 -> 271 bytes
iep/resources/icons/text_replace.png | Bin 0 -> 691 bytes
iep/resources/icons/tick.png | Bin 0 -> 537 bytes
iep/resources/icons/wand.png | Bin 0 -> 570 bytes
iep/resources/icons/wrench.png | Bin 0 -> 610 bytes
iep/resources/icons/wrench_orange.png | Bin 0 -> 584 bytes
iep/resources/images/iep_editor.png | Bin 0 -> 53367 bytes
iep/resources/images/iep_run1.png | Bin 0 -> 51018 bytes
iep/resources/images/iep_shell1.png | Bin 0 -> 38812 bytes
iep/resources/images/iep_shell2.png | Bin 0 -> 20379 bytes
iep/resources/images/iep_tools1.png | Bin 0 -> 20156 bytes
iep/resources/images/iep_tools2.png | Bin 0 -> 26240 bytes
iep/resources/images/iep_two_components.png | Bin 0 -> 45277 bytes
iep/resources/style_scintilla.ssdf | 0
iep/resources/style_solarizeddark.ssdf | 0
iep/resources/style_solarizedlight.ssdf | 0
iep/resources/translations/iep_ca_ES.tr | 1139 ++++++++++
iep/resources/translations/iep_ca_ES.tr.qm | Bin 0 -> 41107 bytes
iep/resources/translations/iep_de_DE.tr | 1114 ++++++++++
iep/resources/translations/iep_de_DE.tr.qm | Bin 0 -> 42378 bytes
iep/resources/translations/iep_es_ES.tr | 1139 ++++++++++
iep/resources/translations/iep_es_ES.tr.qm | Bin 0 -> 42188 bytes
iep/resources/translations/iep_fr_FR.tr | 1143 +++++++++++
iep/resources/translations/iep_fr_FR.tr.qm | Bin 0 -> 43818 bytes
iep/resources/translations/iep_nl_NL.tr | 1124 ++++++++++
iep/resources/translations/iep_nl_NL.tr.qm | Bin 0 -> 38946 bytes
iep/resources/translations/iep_pt_PT.tr | 1112 ++++++++++
iep/resources/translations/iep_pt_PT.tr.qm | Bin 0 -> 41472 bytes
iep/resources/translations/iep_ru_RU.tr | 1146 +++++++++++
iep/resources/translations/iep_ru_RU.tr.qm | Bin 0 -> 36544 bytes
iep/resources/translations/iep_sk_SK.tr | 1111 ++++++++++
iep/resources/translations/iep_sk_SK.tr.qm | Bin 0 -> 27 bytes
iep/resources/translations/iep_zh_CN.tr | 1111 ++++++++++
iep/resources/translations/iep_zh_CN.tr.qm | 1 +
.../translations/notes_on_translating.txt | 58 +
iep/resources/tutorial.py | 202 ++
iep/tools/__init__.py | 390 ++++
iep/tools/iepFileBrowser/__init__.py | 144 ++
iep/tools/iepFileBrowser/browser.py | 680 ++++++
iep/tools/iepFileBrowser/importwizard.py | 559 +++++
iep/tools/iepFileBrowser/proxies.py | 447 ++++
iep/tools/iepFileBrowser/tasks.py | 344 ++++
iep/tools/iepFileBrowser/tree.py | 949 +++++++++
iep/tools/iepFileBrowser/utils.py | 39 +
iep/tools/iepInteractiveHelp.py | 375 ++++
iep/tools/iepLogger.py | 108 +
iep/tools/iepSourceStructure.py | 255 +++
iep/tools/iepWebBrowser.py | 277 +++
iep/tools/iepWorkspace.py | 309 +++
iep/util/__init__.py | 0
iep/util/iepwizard.py | 409 ++++
iep/util/locale.py | 285 +++
iep/yoton/__init__.py | 95 +
iep/yoton/channels/__init__.py | 21 +
iep/yoton/channels/channels_base.py | 365 ++++
iep/yoton/channels/channels_file.py | 165 ++
iep/yoton/channels/channels_pubsub.py | 409 ++++
iep/yoton/channels/channels_reqrep.py | 916 +++++++++
iep/yoton/channels/channels_state.py | 139 ++
iep/yoton/channels/message_types.py | 318 +++
iep/yoton/clientserver.py | 321 +++
iep/yoton/connection.py | 437 ++++
iep/yoton/connection_itc.py | 33 +
iep/yoton/connection_tcp.py | 739 +++++++
iep/yoton/context.py | 557 +++++
iep/yoton/core.py | 309 +++
iep/yoton/events.py | 644 ++++++
iep/yoton/misc.py | 603 ++++++
iep/yotonloader.py | 15 +
setup.cfg | 5 +
setup.py | 83 +
250 files changed, 43280 insertions(+)
diff --git a/PKG-INFO b/PKG-INFO
new file mode 100644
index 0000000..52375a7
--- /dev/null
+++ b/PKG-INFO
@@ -0,0 +1,61 @@
+Metadata-Version: 1.1
+Name: iep
+Version: 3.5
+Summary: the interactive editor for Python
+Home-page: http://www.iep-project.org
+Author: Almar Klein
+Author-email: almar.klein at gmail.com
+License: (new) BSD
+Download-URL: http://www.iep-project.org/downloads.html
+Description: Package iep
+
+ IEP (pronounced as 'eep') is a cross-platform Python IDE focused on
+ interactivity and introspection, which makes it very suitable for
+ scientific computing. Its practical design is aimed at simplicity and
+ efficiency.
+
+ IEP is written in Python 3 and Qt. Binaries are available for Windows,
+ Linux, and Mac. For questions, there is a discussion group.
+
+ Two components + tools
+ ----------------------
+
+ IEP consists of two main components, the editor and the shell, and uses
+ a set of pluggable tools to help the programmer in various ways. Some
+ example tools are source structure, project manager, interactive help,
+ and workspace.
+
+ Some key features
+ -----------------
+
+ * Powerful *introspection* (autocompletion, calltips, interactive help)
+ * Allows various ways to *run code interactively* or to run a file as a
+ script.
+ * The shells runs in a *subprocess* and can therefore be interrupted or
+ killed.
+ * *Multiple shells* can be used at the same time, and can be of different
+ Python versions (from v2.4 to 3.x, including pypy)
+ * Support for using several *GUI toolkits* interactively: PySide, PyQt4,
+ wx, fltk, GTK, Tk.
+ * Run IPython shell or native shell.
+ * *Full Unicode support* in both editor and shell.
+ * Various handy *tools*, plus the ability to make your own.
+ * Matlab-style *cell notation* to mark code sections (by starting a line
+ with '##').
+ * Highly customizable.
+
+
+Keywords: Python interactive IDE Qt science
+Platform: any
+Classifier: Development Status :: 5 - Production/Stable
+Classifier: Intended Audience :: Science/Research
+Classifier: Intended Audience :: Education
+Classifier: Intended Audience :: Developers
+Classifier: Topic :: Scientific/Engineering
+Classifier: Topic :: Software Development
+Classifier: License :: OSI Approved :: BSD License
+Classifier: Operating System :: MacOS :: MacOS X
+Classifier: Operating System :: Microsoft :: Windows
+Classifier: Operating System :: POSIX
+Classifier: Programming Language :: Python :: 3
+Provides: iep
diff --git a/iep.egg-info/PKG-INFO b/iep.egg-info/PKG-INFO
new file mode 100644
index 0000000..52375a7
--- /dev/null
+++ b/iep.egg-info/PKG-INFO
@@ -0,0 +1,61 @@
+Metadata-Version: 1.1
+Name: iep
+Version: 3.5
+Summary: the interactive editor for Python
+Home-page: http://www.iep-project.org
+Author: Almar Klein
+Author-email: almar.klein at gmail.com
+License: (new) BSD
+Download-URL: http://www.iep-project.org/downloads.html
+Description: Package iep
+
+ IEP (pronounced as 'eep') is a cross-platform Python IDE focused on
+ interactivity and introspection, which makes it very suitable for
+ scientific computing. Its practical design is aimed at simplicity and
+ efficiency.
+
+ IEP is written in Python 3 and Qt. Binaries are available for Windows,
+ Linux, and Mac. For questions, there is a discussion group.
+
+ Two components + tools
+ ----------------------
+
+ IEP consists of two main components, the editor and the shell, and uses
+ a set of pluggable tools to help the programmer in various ways. Some
+ example tools are source structure, project manager, interactive help,
+ and workspace.
+
+ Some key features
+ -----------------
+
+ * Powerful *introspection* (autocompletion, calltips, interactive help)
+ * Allows various ways to *run code interactively* or to run a file as a
+ script.
+ * The shells runs in a *subprocess* and can therefore be interrupted or
+ killed.
+ * *Multiple shells* can be used at the same time, and can be of different
+ Python versions (from v2.4 to 3.x, including pypy)
+ * Support for using several *GUI toolkits* interactively: PySide, PyQt4,
+ wx, fltk, GTK, Tk.
+ * Run IPython shell or native shell.
+ * *Full Unicode support* in both editor and shell.
+ * Various handy *tools*, plus the ability to make your own.
+ * Matlab-style *cell notation* to mark code sections (by starting a line
+ with '##').
+ * Highly customizable.
+
+
+Keywords: Python interactive IDE Qt science
+Platform: any
+Classifier: Development Status :: 5 - Production/Stable
+Classifier: Intended Audience :: Science/Research
+Classifier: Intended Audience :: Education
+Classifier: Intended Audience :: Developers
+Classifier: Topic :: Scientific/Engineering
+Classifier: Topic :: Software Development
+Classifier: License :: OSI Approved :: BSD License
+Classifier: Operating System :: MacOS :: MacOS X
+Classifier: Operating System :: Microsoft :: Windows
+Classifier: Operating System :: POSIX
+Classifier: Programming Language :: Python :: 3
+Provides: iep
diff --git a/iep.egg-info/SOURCES.txt b/iep.egg-info/SOURCES.txt
new file mode 100644
index 0000000..266a81b
--- /dev/null
+++ b/iep.egg-info/SOURCES.txt
@@ -0,0 +1,248 @@
+setup.py
+iep/__init__.py
+iep/__main__.py
+iep/contributors.txt
+iep/license.txt
+iep/yotonloader.py
+iep.egg-info/PKG-INFO
+iep.egg-info/SOURCES.txt
+iep.egg-info/dependency_links.txt
+iep.egg-info/entry_points.txt
+iep.egg-info/not-zip-safe
+iep.egg-info/requires.txt
+iep.egg-info/top_level.txt
+iep/codeeditor/__init__.py
+iep/codeeditor/_test.py
+iep/codeeditor/base.py
+iep/codeeditor/highlighter.py
+iep/codeeditor/manager.py
+iep/codeeditor/misc.py
+iep/codeeditor/qt.py
+iep/codeeditor/style.py
+iep/codeeditor/textutils.py
+iep/codeeditor/extensions/__init__.py
+iep/codeeditor/extensions/appearance.py
+iep/codeeditor/extensions/autocompletion.py
+iep/codeeditor/extensions/behaviour.py
+iep/codeeditor/extensions/calltip.py
+iep/codeeditor/parsers/__init__.py
+iep/codeeditor/parsers/c_parser.py
+iep/codeeditor/parsers/cython_parser.py
+iep/codeeditor/parsers/python_parser.py
+iep/codeeditor/parsers/tokens.py
+iep/iepcore/__init__.py
+iep/iepcore/about.py
+iep/iepcore/baseTextCtrl.py
+iep/iepcore/codeparser.py
+iep/iepcore/commandline.py
+iep/iepcore/compactTabWidget.py
+iep/iepcore/editor.py
+iep/iepcore/editorTabs.py
+iep/iepcore/icons.py
+iep/iepcore/iepLogging.py
+iep/iepcore/kernelbroker.py
+iep/iepcore/license.py
+iep/iepcore/main.py
+iep/iepcore/menu.py
+iep/iepcore/shell.py
+iep/iepcore/shellInfoDialog.py
+iep/iepcore/shellStack.py
+iep/iepcore/splash.py
+iep/iepkernel/__init__.py
+iep/iepkernel/_nope.py
+iep/iepkernel/debug.py
+iep/iepkernel/guiintegration.py
+iep/iepkernel/guisupport.py
+iep/iepkernel/interpreter.py
+iep/iepkernel/introspection.py
+iep/iepkernel/magic.py
+iep/iepkernel/pipper.py
+iep/iepkernel/start.py
+iep/resources/defaultConfig.ssdf
+iep/resources/style_scintilla.ssdf
+iep/resources/style_solarizeddark.ssdf
+iep/resources/style_solarizedlight.ssdf
+iep/resources/tutorial.py
+iep/resources/appicons/ieplogo.icns
+iep/resources/appicons/ieplogo.ico
+iep/resources/appicons/ieplogo128.png
+iep/resources/appicons/ieplogo16.png
+iep/resources/appicons/ieplogo256.png
+iep/resources/appicons/ieplogo32.png
+iep/resources/appicons/ieplogo48.png
+iep/resources/appicons/ieplogo64.png
+iep/resources/appicons/py.icns
+iep/resources/appicons/py.ico
+iep/resources/appicons/pyzologo128.png
+iep/resources/appicons/pyzologo16.png
+iep/resources/appicons/pyzologo256.png
+iep/resources/appicons/pyzologo32.png
+iep/resources/appicons/pyzologo48.png
+iep/resources/appicons/pyzologo64.png
+iep/resources/fonts/DejaVuSansMono-Bold.ttf
+iep/resources/fonts/DejaVuSansMono-BoldOblique.ttf
+iep/resources/fonts/DejaVuSansMono-Oblique.ttf
+iep/resources/fonts/DejaVuSansMono.ttf
+iep/resources/fonts/SourceCodePro-Bold.otf
+iep/resources/fonts/SourceCodePro-Regular.otf
+iep/resources/icons/accept.png
+iep/resources/icons/add.png
+iep/resources/icons/application.png
+iep/resources/icons/application_add.png
+iep/resources/icons/application_delete.png
+iep/resources/icons/application_double.png
+iep/resources/icons/application_edit.png
+iep/resources/icons/application_eraser.png
+iep/resources/icons/application_go.png
+iep/resources/icons/application_lightning.png
+iep/resources/icons/application_link.png
+iep/resources/icons/application_refresh.png
+iep/resources/icons/application_shell.png
+iep/resources/icons/application_view_tile.png
+iep/resources/icons/application_wrench.png
+iep/resources/icons/arrow_left.png
+iep/resources/icons/arrow_redo.png
+iep/resources/icons/arrow_refresh.png
+iep/resources/icons/arrow_rotate_anticlockwise.png
+iep/resources/icons/arrow_rotate_clockwise.png
+iep/resources/icons/arrow_undo.png
+iep/resources/icons/bug.png
+iep/resources/icons/bug_delete.png
+iep/resources/icons/bug_error.png
+iep/resources/icons/bullet_yellow.png
+iep/resources/icons/cancel.png
+iep/resources/icons/cog.png
+iep/resources/icons/comment_add.png
+iep/resources/icons/comment_delete.png
+iep/resources/icons/comments.png
+iep/resources/icons/cross.png
+iep/resources/icons/cut.png
+iep/resources/icons/debug_continue.png
+iep/resources/icons/debug_next.png
+iep/resources/icons/debug_quit.png
+iep/resources/icons/debug_return.png
+iep/resources/icons/debug_step.png
+iep/resources/icons/delete.png
+iep/resources/icons/disk.png
+iep/resources/icons/disk_as.png
+iep/resources/icons/disk_multiple.png
+iep/resources/icons/drive.png
+iep/resources/icons/error_add.png
+iep/resources/icons/filter.png
+iep/resources/icons/find.png
+iep/resources/icons/flag_green.png
+iep/resources/icons/folder.png
+iep/resources/icons/folder_hg.png
+iep/resources/icons/folder_page.png
+iep/resources/icons/folder_parent.png
+iep/resources/icons/folder_svn.png
+iep/resources/icons/help.png
+iep/resources/icons/information.png
+iep/resources/icons/keyboard.png
+iep/resources/icons/layout.png
+iep/resources/icons/link.png
+iep/resources/icons/magifier_zoom_out.png
+iep/resources/icons/magnifier.png
+iep/resources/icons/magnifier_zoom_in.png
+iep/resources/icons/monitor.png
+iep/resources/icons/overlay_disk.png
+iep/resources/icons/overlay_hg.png
+iep/resources/icons/overlay_link.png
+iep/resources/icons/overlay_star.png
+iep/resources/icons/overlay_svn.png
+iep/resources/icons/overlay_thumbnail.png
+iep/resources/icons/page_add.png
+iep/resources/icons/page_delete.png
+iep/resources/icons/page_delete_all.png
+iep/resources/icons/page_save.png
+iep/resources/icons/page_white.png
+iep/resources/icons/page_white_copy.png
+iep/resources/icons/page_white_dirty.png
+iep/resources/icons/page_white_gear.png
+iep/resources/icons/page_white_py.png
+iep/resources/icons/page_white_pyx.png
+iep/resources/icons/page_white_text.png
+iep/resources/icons/paste_plain.png
+iep/resources/icons/plugin.png
+iep/resources/icons/plugin_refresh.png
+iep/resources/icons/report.png
+iep/resources/icons/run_cell.png
+iep/resources/icons/run_file.png
+iep/resources/icons/run_file_script.png
+iep/resources/icons/run_lines.png
+iep/resources/icons/run_mainfile.png
+iep/resources/icons/run_mainfile_script.png
+iep/resources/icons/script.png
+iep/resources/icons/star.png
+iep/resources/icons/star2.png
+iep/resources/icons/star3.png
+iep/resources/icons/style.png
+iep/resources/icons/sum.png
+iep/resources/icons/text_align_justify.png
+iep/resources/icons/text_align_right.png
+iep/resources/icons/text_indent.png
+iep/resources/icons/text_indent_remove.png
+iep/resources/icons/text_padding_right.png
+iep/resources/icons/text_replace.png
+iep/resources/icons/tick.png
+iep/resources/icons/wand.png
+iep/resources/icons/wrench.png
+iep/resources/icons/wrench_orange.png
+iep/resources/images/iep_editor.png
+iep/resources/images/iep_run1.png
+iep/resources/images/iep_shell1.png
+iep/resources/images/iep_shell2.png
+iep/resources/images/iep_tools1.png
+iep/resources/images/iep_tools2.png
+iep/resources/images/iep_two_components.png
+iep/resources/translations/iep_ca_ES.tr
+iep/resources/translations/iep_ca_ES.tr.qm
+iep/resources/translations/iep_de_DE.tr
+iep/resources/translations/iep_de_DE.tr.qm
+iep/resources/translations/iep_es_ES.tr
+iep/resources/translations/iep_es_ES.tr.qm
+iep/resources/translations/iep_fr_FR.tr
+iep/resources/translations/iep_fr_FR.tr.qm
+iep/resources/translations/iep_nl_NL.tr
+iep/resources/translations/iep_nl_NL.tr.qm
+iep/resources/translations/iep_pt_PT.tr
+iep/resources/translations/iep_pt_PT.tr.qm
+iep/resources/translations/iep_ru_RU.tr
+iep/resources/translations/iep_ru_RU.tr.qm
+iep/resources/translations/iep_sk_SK.tr
+iep/resources/translations/iep_sk_SK.tr.qm
+iep/resources/translations/iep_zh_CN.tr
+iep/resources/translations/iep_zh_CN.tr.qm
+iep/resources/translations/notes_on_translating.txt
+iep/tools/__init__.py
+iep/tools/iepInteractiveHelp.py
+iep/tools/iepLogger.py
+iep/tools/iepSourceStructure.py
+iep/tools/iepWebBrowser.py
+iep/tools/iepWorkspace.py
+iep/tools/iepFileBrowser/__init__.py
+iep/tools/iepFileBrowser/browser.py
+iep/tools/iepFileBrowser/importwizard.py
+iep/tools/iepFileBrowser/proxies.py
+iep/tools/iepFileBrowser/tasks.py
+iep/tools/iepFileBrowser/tree.py
+iep/tools/iepFileBrowser/utils.py
+iep/util/__init__.py
+iep/util/iepwizard.py
+iep/util/locale.py
+iep/yoton/__init__.py
+iep/yoton/clientserver.py
+iep/yoton/connection.py
+iep/yoton/connection_itc.py
+iep/yoton/connection_tcp.py
+iep/yoton/context.py
+iep/yoton/core.py
+iep/yoton/events.py
+iep/yoton/misc.py
+iep/yoton/channels/__init__.py
+iep/yoton/channels/channels_base.py
+iep/yoton/channels/channels_file.py
+iep/yoton/channels/channels_pubsub.py
+iep/yoton/channels/channels_reqrep.py
+iep/yoton/channels/channels_state.py
+iep/yoton/channels/message_types.py
\ No newline at end of file
diff --git a/iep.egg-info/dependency_links.txt b/iep.egg-info/dependency_links.txt
new file mode 100644
index 0000000..8b13789
--- /dev/null
+++ b/iep.egg-info/dependency_links.txt
@@ -0,0 +1 @@
+
diff --git a/iep.egg-info/entry_points.txt b/iep.egg-info/entry_points.txt
new file mode 100644
index 0000000..3d5ca5a
--- /dev/null
+++ b/iep.egg-info/entry_points.txt
@@ -0,0 +1,3 @@
+[console_scripts]
+iep = ieplauncher
+
diff --git a/iep.egg-info/not-zip-safe b/iep.egg-info/not-zip-safe
new file mode 100644
index 0000000..8b13789
--- /dev/null
+++ b/iep.egg-info/not-zip-safe
@@ -0,0 +1 @@
+
diff --git a/iep.egg-info/requires.txt b/iep.egg-info/requires.txt
new file mode 100644
index 0000000..e1597a1
--- /dev/null
+++ b/iep.egg-info/requires.txt
@@ -0,0 +1 @@
+pyzolib
\ No newline at end of file
diff --git a/iep.egg-info/top_level.txt b/iep.egg-info/top_level.txt
new file mode 100644
index 0000000..77fe15b
--- /dev/null
+++ b/iep.egg-info/top_level.txt
@@ -0,0 +1 @@
+iep
diff --git a/iep/__init__.py b/iep/__init__.py
new file mode 100644
index 0000000..4bdfab4
--- /dev/null
+++ b/iep/__init__.py
@@ -0,0 +1,302 @@
+#!/usr/bin/env python3
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Package iep
+
+IEP (pronounced as 'eep') is a cross-platform Python IDE focused on
+interactivity and introspection, which makes it very suitable for
+scientific computing. Its practical design is aimed at simplicity and
+efficiency.
+
+IEP is written in Python 3 and Qt. Binaries are available for Windows,
+Linux, and Mac. For questions, there is a discussion group.
+
+Two components + tools
+----------------------
+
+IEP consists of two main components, the editor and the shell, and uses
+a set of pluggable tools to help the programmer in various ways. Some
+example tools are source structure, project manager, interactive help,
+and workspace.
+
+Some key features
+-----------------
+
+ * Powerful *introspection* (autocompletion, calltips, interactive help)
+ * Allows various ways to *run code interactively* or to run a file as a
+ script.
+ * The shells runs in a *subprocess* and can therefore be interrupted or
+ killed.
+ * *Multiple shells* can be used at the same time, and can be of different
+ Python versions (from v2.4 to 3.x, including pypy)
+ * Support for using several *GUI toolkits* interactively: PySide, PyQt4,
+ wx, fltk, GTK, Tk.
+ * Run IPython shell or native shell.
+ * *Full Unicode support* in both editor and shell.
+ * Various handy *tools*, plus the ability to make your own.
+ * Matlab-style *cell notation* to mark code sections (by starting a line
+ with '##').
+ * Highly customizable.
+
+"""
+
+# Set version number
+__version__ = '3.5'
+
+import os
+import sys
+
+# Check Python version
+if sys.version < '3':
+ raise RuntimeError('IEP requires Python 3.x to run.')
+
+# Check pyzolib version
+import pyzolib
+if pyzolib.__version__ < '0.2.5':
+ raise RuntimeError('IEP requires Pyzolib 0.2.5 or higher.')
+elif pyzolib.__version__ < '0.2.9':
+ print('Warning: pyzolib 0.2.9 is recommended to run IEP.')
+
+# Import yoton as an absolute package
+from iep import yotonloader
+
+# If there already is an instance of IEP, and the user is trying an
+# IEP command, we should send the command to the other process and quit.
+# We do this here, were we have not yet loaded Qt, so we are very light.
+from iep.iepcore import commandline
+if commandline.is_our_server_running():
+ print('Started our command server')
+else:
+ # Handle command line args now
+ res = commandline.handle_cmd_args()
+ if res:
+ print(res)
+ sys.exit()
+ else:
+ # No args, proceed with starting up
+ print('Our command server is *not* running')
+
+
+from pyzolib import ssdf, paths
+from pyzolib.qt import QtCore, QtGui
+
+# Import language/translation tools
+from iep.util.locale import translate, setLanguage
+
+# Set environ to let kernel know some stats about us
+os.environ['IEP_PREFIX'] = sys.prefix
+_is_pyqt4 = hasattr(QtCore, 'PYQT_VERSION_STR')
+os.environ['IEP_QTLIB'] = 'PyQt4' if _is_pyqt4 else 'PySide'
+
+
+class MyApp(QtGui.QApplication):
+ """ So we an open .py files on OSX.
+ OSX is smart enough to call this on the existing process.
+ """
+ def event(self, event):
+ if isinstance(event, QtGui.QFileOpenEvent):
+ fname = str(event.file())
+ if fname and fname != 'iep':
+ sys.argv[1:] = []
+ sys.argv.append(fname)
+ res = commandline.handle_cmd_args()
+ if not commandline.is_our_server_running():
+ print(res)
+ sys.exit()
+ return QtGui.QApplication.event(self, event)
+
+if not sys.platform.startswith('darwin'):
+ MyApp = QtGui.QApplication
+
+## Define some functions
+
+
+# todo: move some stuff out of this module ...
+
+def getResourceDirs():
+ """ getResourceDirs()
+ Get the directories to the resources: (iepDir, appDataDir).
+ Also makes sure that the appDataDir has a "tools" directory and
+ a style file.
+ """
+
+# # Get root of the IEP code. If frozen its in a subdir of the app dir
+# iepDir = paths.application_dir()
+# if paths.is_frozen():
+# iepDir = os.path.join(iepDir, 'source')
+ iepDir = os.path.abspath(os.path.dirname(__file__))
+ if '.zip' in iepDir:
+ raise RuntimeError('The IEP package cannot be run from a zipfile.')
+
+ # Get where the application data is stored (use old behavior on Mac)
+ # todo: quick solution until I release a new pyzolib
+ try:
+ appDataDir = paths.appdata_dir('iep', roaming=True, macAsLinux=True)
+ except Exception:
+ appDataDir = paths.appdata_dir('iep', roaming=True)
+
+ # Create tooldir if necessary
+ toolDir = os.path.join(appDataDir, 'tools')
+ if not os.path.isdir(toolDir):
+ os.mkdir(toolDir)
+
+ return iepDir, appDataDir
+
+
+def resetConfig(preserveState=True):
+ """ resetConfig()
+ Replaces the config fyle with the default and prevent IEP from storing
+ its config on the next shutdown.
+ """
+ # Get filenames
+ configFileName1 = os.path.join(iepDir, 'resources', 'defaultConfig.ssdf')
+ configFileName2 = os.path.join(appDataDir, 'config.ssdf')
+ # Read, edit, write
+ tmp = ssdf.load(configFileName1)
+ if preserveState:
+ tmp.state = config.state
+ ssdf.save(configFileName2, tmp)
+ global _saveConfigFile
+ _saveConfigFile = False
+ print("Replaced config file. Restart IEP to revert to the default config.")
+
+
+def loadConfig(defaultsOnly=False):
+ """ loadConfig(defaultsOnly=False)
+ Load default configuration file and that of the user (if it exists).
+ Any missing fields in the user config are set to the defaults.
+ """
+
+ # Function to insert names from one config in another
+ def replaceFields(base, new):
+ for key in new:
+ if key in base and isinstance(base[key], ssdf.Struct):
+ replaceFields(base[key], new[key])
+ else:
+ base[key] = new[key]
+
+ # Reset our iep.config structure
+ ssdf.clear(config)
+
+ # Load default and inject in the iep.config
+ fname = os.path.join(iepDir, 'resources', 'defaultConfig.ssdf')
+ defaultConfig = ssdf.load(fname)
+ replaceFields(config, defaultConfig)
+
+ # Platform specific keybinding: on Mac, Ctrl+Tab (actually Cmd+Tab) is a system shortcut
+ if sys.platform == 'darwin':
+ config.shortcuts2.view__select_previous_file = 'Alt+Tab,'
+
+ # Load user config and inject in iep.config
+ fname = os.path.join(appDataDir, "config.ssdf")
+ if os.path.isfile(fname):
+ userConfig = ssdf.load(fname)
+ replaceFields(config, userConfig)
+
+
+def saveConfig():
+ """ saveConfig()
+ Save all configureations to file.
+ """
+
+ # Let the editorStack save its state
+ if editors:
+ editors.saveEditorState()
+
+ # Let the main window save its state
+ if main:
+ main.saveWindowState()
+
+ # Store config
+ if _saveConfigFile:
+ ssdf.save( os.path.join(appDataDir, "config.ssdf"), config )
+
+
+def startIep():
+ """ startIep()
+ Run IEP.
+ """
+
+ # Do some imports
+ from iep.iepcore import iepLogging # to start logging asap
+ from iep.iepcore.main import MainWindow
+
+ # Set to be aware of the systems native colors, fonts, etc.
+ QtGui.QApplication.setDesktopSettingsAware(True)
+
+ # Instantiate the application
+ QtGui.qApp = MyApp([]) # QtGui.QApplication([])
+
+ # Choose language, get locale
+ locale = setLanguage(config.settings.language)
+
+ # Create main window, using the selected locale
+ frame = MainWindow(None, locale)
+
+ # Enter the main loop
+ QtGui.qApp.exec_()
+
+
+## Init
+
+# List of names that are later overriden (in main.py)
+editors = None # The editor stack instance
+shells = None # The shell stack instance
+main = None # The mainwindow
+icon = None # The icon
+parser = None # The source parser
+status = None # The statusbar (or None)
+
+# Get directories of interest
+iepDir, appDataDir = getResourceDirs()
+
+# Whether the config file should be saved
+_saveConfigFile = True
+
+# Create ssdf in module namespace, and fill it
+config = ssdf.new()
+loadConfig()
+
+# Get license info
+# Yes, you could insert your custom dict here! But who would you be fooling?
+from iep.iepcore.license import get_license_info
+license = get_license_info()
+del get_license_info
+
+# Init default style name (set in main.restoreIepState())
+defaultQtStyleName = ''
+
+# Init pyzo_mode. In pyzo_mode, IEP will use a different logo and possibly
+# expose certain features in the future.
+pyzo_mode = False
+distro_name = None
+
+# Init default exe for the executable (can be set, e.g. by Pyzo)
+_defaultInterpreterExe = None
+_defaultInterpreterGui = None
+def setDefaultInterpreter(exe, gui=None):
+ global _defaultInterpreterExe
+ global _defaultInterpreterGui
+ assert isinstance(exe, str)
+ _defaultInterpreterExe = exe
+ _defaultInterpreterGui = gui
+def defaultInterpreterExe():
+ global _defaultInterpreterExe
+ if _defaultInterpreterExe is None and sys.platform.startswith('win'):
+ try:
+ from pyzolib.interpreters import get_interpreters
+ interpreters = list(reversed(get_interpreters('2.4')))
+ if interpreters:
+ _defaultInterpreterExe = interpreters[0].path
+ except Exception as err:
+ print(err)
+ if _defaultInterpreterExe is None:
+ _defaultInterpreterExe = 'python'
+ return _defaultInterpreterExe
+def defaultInterpreterGui():
+ global _defaultInterpreterGui
+ return _defaultInterpreterGui
diff --git a/iep/__main__.py b/iep/__main__.py
new file mode 100755
index 0000000..bec4f75
--- /dev/null
+++ b/iep/__main__.py
@@ -0,0 +1,51 @@
+#!/usr/bin/env python3
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" IEP __main__ module
+
+This module takes enables staring IEP via either "python3 -m iep" or
+"python3 path/to/iep".
+
+In the first case it simply imports iep. In the latter case, that import
+will generally fail, in which case the parent directory is added to sys.path
+and the import is tried again. Then "iep.startIep()" is called.
+
+"""
+
+import os
+import sys
+
+
+# Imports that are maybe not used in IEP, but are/can be in the tools.
+# Import them now, so they are available in the frozen app.
+import shutil
+
+
+if hasattr(sys, 'frozen') and sys.frozen:
+ # Enable loading from source
+ from pyzolib import paths
+ sys.path.insert(0, os.path.join(paths.application_dir(), 'source'))
+ sys.path.insert(0, os.path.join(paths.application_dir(), 'source/more'))
+ # Import
+ import iep
+
+else:
+ # Try importing
+ try:
+ import iep
+ except ImportError:
+ # Very probably run as a script, either the package or the __main__
+ # directly. Add parent directory to sys.path and try again.
+ thisDir = os.path.abspath(os.path.dirname(__file__))
+ sys.path.insert(0, os.path.split(thisDir)[0])
+ try:
+ import iep
+ except ImportError:
+ raise ImportError('Could not import IEP in either way.')
+
+# Start IEP
+iep.startIep()
diff --git a/iep/codeeditor/__init__.py b/iep/codeeditor/__init__.py
new file mode 100644
index 0000000..8ddf5ad
--- /dev/null
+++ b/iep/codeeditor/__init__.py
@@ -0,0 +1,72 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" CodeEditor
+
+A full featured code editor component based on QPlainTextEdit.
+
+"""
+
+from .manager import Manager
+from .base import CodeEditorBase
+
+from .extensions.appearance import ( HighlightCurrentLine,
+ FullUnderlines,
+ IndentationGuides,
+ CodeFolding,
+ LongLineIndicator,
+ ShowWhitespace,
+ ShowLineEndings,
+ Wrap,
+ LineNumbers,
+ SyntaxHighlighting,
+ BreakPoints,
+ )
+from .extensions.behaviour import ( Indentation,
+ HomeKey,
+ EndKey,
+ NumpadPeriodKey,
+ AutoIndent,
+ PythonAutoIndent,
+ )
+from .extensions.autocompletion import AutoCompletion
+from .extensions.calltip import Calltip
+
+
+# Order of superclasses: first the extensions, then CodeEditorBase
+# The first superclass is the first extension that gets to handle each key
+#
+class CodeEditor(
+ HighlightCurrentLine,
+ FullUnderlines,
+ IndentationGuides,
+ CodeFolding,
+ LongLineIndicator,
+ ShowWhitespace,
+ ShowLineEndings,
+ Wrap,
+ BreakPoints,
+ LineNumbers,
+
+ AutoCompletion, #Escape: first remove autocompletion,
+ Calltip, #then calltip
+
+ Indentation,
+ HomeKey,
+ EndKey,
+ NumpadPeriodKey,
+
+ AutoIndent,
+ PythonAutoIndent,
+
+ SyntaxHighlighting,
+
+ CodeEditorBase): #CodeEditorBase must be the last one in the list
+ """
+ CodeEditor with all the extensions
+ """
+ pass
+
diff --git a/iep/codeeditor/_test.py b/iep/codeeditor/_test.py
new file mode 100644
index 0000000..d513a6a
--- /dev/null
+++ b/iep/codeeditor/_test.py
@@ -0,0 +1,50 @@
+#!/usr/bin/env python
+# -*- coding: utf-8 -*-
+
+""" This script runs a test for the code editor component.
+"""
+
+import os, sys
+from qt import QtGui, QtCore
+Qt = QtCore.Qt
+
+## Go up one directory and then import the codeeditor package
+
+os.chdir('..')
+sys.path.insert(0,'.')
+from codeeditor import CodeEditor
+
+if __name__=='__main__':
+
+ app = QtGui.QApplication([])
+
+ class TestEditor(CodeEditor):
+ def keyPressEvent(self,event):
+ key = event.key()
+ if key == Qt.Key_F1:
+ self.autocompleteShow()
+ return
+ elif key == Qt.Key_F2:
+ self.autocompleteCancel()
+ return
+ elif key == Qt.Key_F3:
+ self.calltipShow(0, 'test(foo, bar)')
+ return
+ elif key == Qt.Key_Backtab: #Shift + Tab
+ self.dedentSelection()
+ return
+
+ super(TestEditor, self).keyPressEvent(event)
+
+ # Create editor instance
+ e = TestEditor(highlightCurrentLine = True, longLineIndicatorPosition = 20,
+ showIndentationGuides = True, showWhitespace = True,
+ showLineEndings = True, wrap = True, showLineNumbers = True)
+
+ # Run application
+ e.show()
+ s=QtGui.QSplitter()
+ s.addWidget(e)
+ s.addWidget(QtGui.QLabel('test'))
+ s.show()
+ app.exec_()
diff --git a/iep/codeeditor/base.py b/iep/codeeditor/base.py
new file mode 100644
index 0000000..8675d54
--- /dev/null
+++ b/iep/codeeditor/base.py
@@ -0,0 +1,837 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+"""
+The base code editor class.
+
+
+"""
+
+"""
+WRITING EXTENSIONS FOR THE CODE EDITOR
+
+The Code Editor extension mechanism works solely based on inheritance.
+Extensions can override event handlers (e.g. paintEvent, keyPressEvent). Their
+default behaviour should be to call their super() event handler. This way,
+events propagate through the extensions following Python's method resolution
+order (http://www.python.org/download/releases/2.3/mro/).
+
+A 'fancy' code editor with extensions is created like:
+
+class FancyEditor( Extension1, Extension2, ... CodeEditorBase):
+ pass
+
+The order of the extensions does usually matter! If multiple Extensions process
+the same key press, the first one has the first chance to consume it.
+
+OVERRIDING __init__
+
+An extensions' __init__ method (if required) should look like this:
+class Extension:
+ def __init__(self, *args, extensionParam1 = 1, extensionParam2 = 3, **kwds):
+ super().__init__(*args, **kwds)
+ some_extension_init_stuff()
+
+Note the following points:
+ - All parameters have default values
+ - The use of *args passes all non-named arguments to its super(), which
+ will therefore end up at the QPlainTextEdit constructor. As a consequence,
+ the parameters of the exentsion can only be specified as named arguments
+ - The use of **kwds ensures that parametes that are not defined by this
+ extension, are passed to the next extension(s) in line.
+ - The call to super().__init__ is the first thing to do, this ensures that at
+ least the CodeEditorBase and QPlainTextEdit, of which the CodeEditorBase is
+ derived, are initialized when the initialization of the extension is done
+
+OVERRIDING keyPressEvent
+
+When overriding keyPressEvent, the extension has several options when an event
+arrives:
+ - Ignore the event
+ In this case, call super().keyPressEvent(event) for other extensions or the
+ CodeEditorBase to process the event
+ - Consume the event
+ In order to prevent other next extensions or the CodeEditorBase to react
+ on the event, return without calling the super().keyPressEvent
+ - Do something based on the event, and do not let the event propagate
+ In this case, do whatever action is defined by the extension, and do not
+ call the super().keyPressEvent
+ - Do something based on the event, and let the event propagate
+ In this case, do whatever action is defined by the extension, and do call
+ the super().keyEvent
+
+In any case, the keyPressEvent should not return a value (i.e., return None).
+Furthermore, an extension may also want to perform some action *after* the
+event has been processed by the next extensions and the CodeEditorBase. In this
+case, perform that action after calling super().keyPressEvent
+
+OVERRIDING paintEvent
+
+Then overriding the paintEvent, the extension may want to paint either behind or
+in front of the CodeEditorBase text. In order to paint behind the text, first
+perform the painting, and then call super().paintEvent. In order to paint in
+front of the text, first call super().paintEvent, then perform the painting.
+
+As a result, the total paint order is as follows for the example of the
+FancyEditor defined above:
+- First the extensions that draw behind the text (i.e. paint before calling
+ super().paintEvent, in the order Extension1, Extension2, ...
+- then the CodeEditorBase, with the text
+- then the extensions that draw in front of the text (i.e. call
+ super().paintEvent before painting), in the order ..., Extension2, Extension1
+
+OVERRIDING OTHER EVENT HANDLERS
+
+When overriding other event handlers, be sure to call the super()'s event
+handler; either before or after your own actions, as appropriate
+
+OTHER ISSUES
+
+In order to avoid namespace clashes among the extensions, take the following
+into account:
+ - Private members should start with __ to make ensure no clashes will occur
+ - Public members / methods should have names that clearly indicate which
+ extension they belong to (e.g. not cancel but autocompleteCancel)
+ - Arguments of the __init__ method should also have clearly destictive names
+
+"""
+
+import sys
+from .qt import QtGui,QtCore
+Qt = QtCore.Qt
+
+from .misc import DEFAULT_OPTION_NAME, DEFAULT_OPTION_NONE, ce_option
+from .misc import callLater, ustr
+from .manager import Manager
+from .highlighter import Highlighter
+from .style import StyleFormat, StyleElementDescription
+
+
+class CodeEditorBase(QtGui.QPlainTextEdit):
+ """ The base code editor class. Implements some basic features required
+ by the extensions.
+
+ """
+
+ # Style element for default text and editor background
+ _styleElements = [('Editor.text', 'The style of the default text. ' +
+ 'One can set the background color here.',
+ 'fore:#000,back:#fff',)]
+
+ # Signal emitted after style has changed
+ styleChanged = QtCore.Signal()
+
+ # Signal emitted after font (or font size) has changed
+ fontChanged = QtCore.Signal()
+
+ # Signal to indicate a change in breakpoints. Only emitted if the
+ # appropriate extension is in use
+ breakPointsChanged = QtCore.Signal(object)
+
+
+ def __init__(self,*args, **kwds):
+ super(CodeEditorBase, self).__init__(*args)
+
+ # Set font (always monospace)
+ self.__zoom = 0
+ self.setFont()
+
+ # Create highlighter class
+ self.__highlighter = Highlighter(self, self.document())
+
+ # Set some document options
+ option = self.document().defaultTextOption()
+ option.setFlags( option.flags() | option.IncludeTrailingSpaces |
+ option.AddSpaceForLineAndParagraphSeparators )
+ self.document().setDefaultTextOption(option)
+
+ # When the cursor position changes, invoke an update, so that
+ # the hihghlighting etc will work
+ self.cursorPositionChanged.connect(self.viewport().update)
+
+ # Init styles to default values
+ self.__style = {}
+ for element in self.getStyleElementDescriptions():
+ self.__style[element.key] = element.defaultFormat
+
+ # Connext style update
+ self.styleChanged.connect(self.__afterSetStyle)
+ self.__styleChangedPending = False
+
+ # Init margins
+ self._leftmargins = []
+
+ # Init options now.
+ # NOTE TO PEOPLE DEVELOPING EXTENSIONS:
+ # If an extension has an __init__ in which it first calls the
+ # super().__init__, this __initOptions() function will be called,
+ # while the extension's init is not yet finished.
+ self.__initOptions(kwds)
+
+ # Define solarized colors
+ base03 = "#002b36"
+ base02 = "#073642"
+ base01 = "#586e75"
+ base00 = "#657b83"
+ base0 = "#839496"
+ base1 = "#93a1a1"
+ base2 = "#eee8d5"
+ base3 = "#fdf6e3"
+ yellow = "#b58900"
+ orange = "#cb4b16"
+ red = "#dc322f"
+ magenta = "#d33682"
+ violet = "#6c71c4"
+ blue = "#268bd2"
+ cyan = "#2aa198"
+ green = "#859900"
+
+ if True: # Light vs dark
+ #back1, back2, back3 = base3, base2, base1 # real solarised
+ back1, back2, back3 = "#fff", base2, base1 # crispier
+ fore1, fore2, fore3, fore4 = base00, base01, base02, base03
+ else:
+ back1, back2, back3 = base03, base02, base01
+ fore1, fore2, fore3, fore4 = base0, base1, base2, base3
+
+ test_numbers = 90 + 0000 + 1
+ # todo: proper testing of syntax style
+
+ # Define style
+ S = {}
+ S["Editor.text"] = "back:%s, fore:%s" % (back1, fore1)
+ S['Syntax.identifier'] = "fore:%s, bold:no, italic:no, underline:no" % fore1
+ S["Syntax.nonidentifier"] = "fore:%s, bold:no, italic:no, underline:no" % fore2
+ S["Syntax.keyword"] = "fore:%s, bold:yes, italic:no, underline:no" % fore2
+
+
+ S["Syntax.functionname"] = "fore:%s, bold:yes, italic:no, underline:no" % fore3
+ S["Syntax.classname"] = "fore:%s, bold:yes, italic:no, underline:no" % orange
+
+ S["Syntax.string"] = "fore:%s, bold:no, italic:no, underline:no" % violet
+ S["Syntax.unterminatedstring"] = "fore:%s, bold:no, italic:no, underline:dotted" % violet
+ S["Syntax.python.multilinestring"] = "fore:%s, bold:no, italic:no, underline:no" % blue
+
+ S["Syntax.number"] = "fore:%s, bold:no, italic:no, underline:no" % cyan
+ S["Syntax.comment"] ="fore:%s, bold:no, italic:no, underline:no" % yellow
+ S["Syntax.todocomment"] = "fore:%s, bold:no, italic:yes, underline:no" % magenta
+ S["Syntax.python.cellcomment"] = "fore:%s, bold:yes, italic:no, underline:full" % yellow
+
+
+ S["Editor.Long line indicator"] = "linestyle:solid, fore:%s" % back2
+ S["Editor.Highlight current line"] = "back:%s" % back2
+ S["Editor.Indentation guides"] = "linestyle:solid, fore:%s" % back2
+ S["Editor.Line numbers"] = "back:%s, fore:%s" % (back2, back3)
+
+ # Apply style
+ self.setStyle(S)
+
+
+ def _setHighlighter(self, highlighterClass):
+ self.__highlighter = highlighterClass(self, self.document())
+
+ ## Options
+
+ def __getOptionSetters(self):
+ """ Get a dict that maps (lowercase) option names to the setter
+ methods.
+ """
+
+ # Get all names that can be options
+ allNames = set(dir(self))
+ nativeNames = set(dir(QtGui.QPlainTextEdit))
+ names = allNames.difference(nativeNames)
+
+ # Init dict of setter members
+ setters = {}
+
+ for name in names:
+ # Get name without set
+ if name.lower().startswith('set'):
+ name = name[3:]
+ # Get setter and getter name
+ name_set = 'set' + name[0].upper() + name[1:]
+ name_get = name[0].lower() + name[1:]
+ # Check if both present
+ if not (name_set in names and name_get in names):
+ continue
+ # Get members
+ member_set = getattr(self, name_set)
+ member_get = getattr(self, name_get)
+ # Check if option decorator was used and get default value
+ for member in [member_set, member_get]:
+ if hasattr(member, DEFAULT_OPTION_NAME):
+ defaultValue = member.__dict__[DEFAULT_OPTION_NAME]
+ break
+ else:
+ continue
+ # Set default on both
+ member_set.__dict__[DEFAULT_OPTION_NAME] = defaultValue
+ member_get.__dict__[DEFAULT_OPTION_NAME] = defaultValue
+ # Add to list
+ setters[name.lower()] = member_set
+
+ # Done
+ return setters
+
+
+ def __setOptions(self, setters, options):
+ """ Sets the options, given the list-of-tuples methods and an
+ options dict.
+ """
+
+ # List of invalid keys
+ invalidKeys = []
+
+ # Set options
+ for key1 in options:
+ key2 = key1.lower()
+ # Allow using the setter name
+ if key2.startswith('set'):
+ key2 = key2[3:]
+ # Check if exists. If so, call!
+ if key2 in setters:
+ fun = setters[key2]
+ val = options[key1]
+ fun(val)
+ else:
+ invalidKeys.append(key1)
+
+ # Check if invalid keys were given
+ if invalidKeys:
+ print("Warning, invalid options given: " + ', '.join(invalidKeys))
+
+
+ def __initOptions(self, options=None):
+ """ Init the options with their default values.
+ Also applies the docstrings of one to the other.
+ """
+
+ # Make options an empty dict if not given
+ if not options:
+ options = {}
+
+ # Get setters
+ setters = self.__getOptionSetters()
+
+ # Set default value
+ for member_set in setters.values():
+ defaultVal = member_set.__dict__[DEFAULT_OPTION_NAME]
+ if defaultVal != DEFAULT_OPTION_NONE:
+ try:
+ member_set(defaultVal)
+ except Exception as why:
+ print('Error initing option ', member_set.__name__)
+
+ # Also set using given opions?
+ if options:
+ self.__setOptions(setters, options)
+
+
+ def setOptions(self, options=None, **kwargs):
+ """ setOptions(options=None, **kwargs)
+
+ Set the code editor options (e.g. highlightCurrentLine) using
+ a dict-like object, or using keyword arguments (options given
+ in the latter overrule opions in the first).
+
+ The keys in the dict are case insensitive and one can use the
+ option's setter or getter name.
+
+ """
+
+ # Process options
+ if options:
+ D = {}
+ for key in options:
+ D[key] = options[key]
+ D.update(kwargs)
+ else:
+ D = kwargs
+
+ # Get setters
+ setters = self.__getOptionSetters()
+
+ # Go
+ self.__setOptions(setters, D)
+
+
+ ## Font
+
+ def setFont(self, font=None):
+ """ setFont(font=None)
+
+ Set the font for the editor. Should be a monospace font. If not,
+ Qt will select the best matching monospace font.
+
+ """
+
+ defaultFont = Manager.defaultFont()
+
+ # Get font object
+ if font is None:
+ font = defaultFont
+ elif isinstance(font, QtGui.QFont):
+ pass
+ elif isinstance(font, str):
+ font = QtGui.QFont(font)
+ else:
+ raise ValueError("setFont accepts None, QFont or string.")
+
+ # Hint Qt that it should be monospace
+ font.setStyleHint(font.TypeWriter, font.PreferDefault)
+
+ # Get family, fall back to default if qt could not produce monospace
+ fontInfo = QtGui.QFontInfo(font)
+ if fontInfo.fixedPitch():
+ family = fontInfo.family()
+ else:
+ family = defaultFont.family()
+
+ # Get size: default size + zoom
+ size = defaultFont.pointSize() + self.__zoom
+
+ # Create font instance
+ font = QtGui.QFont(family, size)
+
+ # Set, emit and return
+ QtGui.QPlainTextEdit.setFont(self, font)
+ self.fontChanged.emit()
+ return font
+
+
+ def setZoom(self, zoom):
+ """ setZoom(zoom)
+
+ Set the zooming of the document. The font size is always the default
+ font size + the zoom factor.
+
+ The final zoom is returned, this may not be the same as the given
+ zoom factor if the given factor is too small.
+
+ """
+ # Set zoom (limit such that final pointSize >= 1)
+ size = Manager.defaultFont().pointSize()
+ self.__zoom = int(max(1-size,zoom))
+ # Set font
+ self.setFont(self.fontInfo().family())
+ # Return zoom
+ return self.__zoom
+
+
+ ## Syntax / styling
+
+
+ @classmethod
+ def getStyleElementDescriptions(cls):
+ """ getStyleElementDescriptions()
+
+ This classmethod returns a list of the StyleElementDescription
+ instances used by this class. This includes the descriptions for
+ the syntax highlighting of all parsers.
+
+ """
+
+ # Collect members by walking the class bases
+ elements = []
+ def collectElements(cls, iter=1):
+ # Valid class?
+ if cls is object or cls is QtGui.QPlainTextEdit:
+ return
+ # Check members
+ if hasattr(cls, '_styleElements'):
+ for element in cls._styleElements:
+ elements.append(element)
+ # Recurse
+ for c in cls.__bases__:
+ collectElements(c, iter+1)
+ collectElements(cls)
+
+ # Make style element descriptions
+ # (Use a dict to ensure there are no duplicate keys)
+ elements2 = {}
+ for element in elements:
+ # Check
+ if isinstance(element, StyleElementDescription):
+ pass
+ elif isinstance(element, tuple):
+ element = StyleElementDescription(*element)
+ else:
+ print('Warning: invalid element: ' + repr(element))
+ # Store using the name as a key to prevent duplicates
+ elements2[element.key] = element
+
+ # Done
+ return list(elements2.values())
+
+
+ def getStyleElementFormat(self, name):
+ """ getStyleElementFormat(name)
+
+ Get the style format for the style element corresponding with
+ the given name. The name is case insensitive and invariant to
+ the use of spaces.
+
+ """
+ key = name.replace(' ','').lower()
+ try:
+ return self.__style[key]
+ except KeyError:
+ raise KeyError('Not a known style element name: "%s".' % name)
+
+
+ def setStyle(self, style=None, **kwargs):
+ """ setStyle(style=None, **kwargs)
+
+ Updates the formatting per style element.
+
+ The style consists of a dictionary that maps style names to
+ style formats. The style names are case insensitive and invariant
+ to the use of spaces.
+
+ For convenience, keyword arguments may also be used. In this case,
+ underscores are interpreted as dots.
+
+ This function can also be called without arguments to force the
+ editor to restyle (and rehighlight) itself.
+
+ Use getStyleElementDescriptions() to get information about the
+ available styles and their default values.
+
+ Examples
+ --------
+ # To make the classname in underline, but keep the color and boldness:
+ setStyle(syntax_classname='underline')
+ # To set all values for function names:
+ setStyle(syntax_functionname='#883,bold:no,italic:no')
+ # To set line number and indent guides colors
+ setStyle({ 'editor.LineNumbers':'fore:#000,back:#777',
+ 'editor.indentationGuides':'#f88' })
+
+ """
+
+ # Combine user input
+ D = {}
+ if style:
+ for key in style:
+ D[key] = style[key]
+ if True:
+ for key in kwargs:
+ key2 = key.replace('_', '.')
+ D[key2] = kwargs[key]
+
+ # List of given invalid style element names
+ invalidKeys = []
+
+ # Set style elements
+ for key in D:
+ normKey = key.replace(' ', '').lower()
+ if normKey in self.__style:
+ #self.__style[normKey] = StyleFormat(D[key])
+ self.__style[normKey].update(D[key])
+ else:
+ invalidKeys.append(key)
+
+ # Give warning for invalid keys
+ if invalidKeys:
+ print("Warning, invalid style names given: " +
+ ','.join(invalidKeys))
+
+ # Notify that style changed, adopt a lazy approach to make loading
+ # quicker.
+ if self.isVisible():
+ callLater(self.styleChanged.emit)
+ self.__styleChangedPending = False
+ else:
+ self.__styleChangedPending = True
+
+
+ def showEvent(self, event):
+ super(CodeEditorBase, self).showEvent(event)
+ # Does the style need updating?
+ if self.__styleChangedPending:
+ callLater(self.styleChanged.emit)
+ self.__styleChangedPending = False
+
+
+ def __afterSetStyle(self):
+ """ _afterSetStyle()
+
+ Method to call after the style has been set.
+
+ """
+
+ # Set text style using editor style sheet
+ format = self.getStyleElementFormat('editor.text')
+ ss = 'QPlainTextEdit{ color:%s; background-color:%s; }' % (
+ format['fore'], format['back'])
+ self.setStyleSheet(ss)
+
+ # Make sure the style is applied
+ self.viewport().update()
+
+ # Re-highlight
+ callLater(self.__highlighter.rehighlight)
+
+
+ ## Some basic options
+
+
+ @ce_option(4)
+ def indentWidth(self):
+ """ Get the width of a tab character, and also the amount of spaces
+ to use for indentation when indentUsingSpaces() is True.
+ """
+ return self.__indentWidth
+
+ def setIndentWidth(self, value):
+ value = int(value)
+ if value<=0:
+ raise ValueError("indentWidth must be >0")
+ self.__indentWidth = value
+ self.setTabStopWidth(self.fontMetrics().width('i'*self.__indentWidth))
+
+
+ @ce_option(False)
+ def indentUsingSpaces(self):
+ """Get whether to use spaces (if True) or tabs (if False) to indent
+ when the tab key is pressed
+ """
+ return self.__indentUsingSpaces
+
+ def setIndentUsingSpaces(self, value):
+ self.__indentUsingSpaces = bool(value)
+ self.__highlighter.rehighlight()
+
+
+ ## Misc
+
+ def gotoLine(self, lineNumber):
+ """ gotoLine(lineNumber)
+
+ Move the cursor to the block given by the line number
+ (first line is number 1) and show that line.
+
+ """
+ return self.gotoBlock(lineNumber-1)
+
+
+ def gotoBlock(self, blockNumber):
+ """ gotoBlock(blockNumber)
+
+ Move the cursor to the block given by the block number
+ (first block is number 0) and show that line.
+
+ """
+ # Two implementatios. I know that the latter works, so lets
+ # just use that.
+
+ cursor = self.textCursor()
+ #block = self.document().findBlockByNumber( blockNumber )
+ #cursor.setPosition(block.position())
+ cursor.movePosition(cursor.Start) # move to begin of the document
+ cursor.movePosition(cursor.NextBlock,n=blockNumber) # n blocks down
+
+ try:
+ self.setTextCursor(cursor)
+ except Exception:
+ pass # File is smaller then the caller thought
+ self.centerCursor()
+
+ def doForSelectedBlocks(self, function):
+ """ doForSelectedBlocks(function)
+
+ Call the given function(cursor) for all blocks in the current selection
+ A block is considered to be in the current selection if a part of it is in
+ the current selection
+
+ The supplied cursor will be located at the beginning of each block. This
+ cursor may be modified by the function as required
+
+ """
+
+ #Note: a 'TextCursor' does not represent the actual on-screen cursor, so
+ #movements do not move the on-screen cursor
+
+ #Note 2: when the text is changed, the cursor and selection start/end
+ #positions of all cursors are updated accordingly, so the screenCursor
+ #stays in place even if characters are inserted at the editCursor
+
+ screenCursor = self.textCursor() #For maintaining which region is selected
+ editCursor = self.textCursor() #For inserting the comment marks
+
+ #Use beginEditBlock / endEditBlock to make this one undo/redo operation
+ editCursor.beginEditBlock()
+
+ editCursor.setPosition(screenCursor.selectionStart())
+ editCursor.movePosition(editCursor.StartOfBlock)
+ # < :if selection end is at beginning of the block, don't include that
+ #one, except when the selectionStart is same as selectionEnd
+ while editCursor.position()<screenCursor.selectionEnd() or \
+ editCursor.position()<=screenCursor.selectionStart():
+ #Create a copy of the editCursor and call the user-supplied function
+ editCursorCopy = QtGui.QTextCursor(editCursor)
+ function(editCursorCopy)
+
+ #Move to the next block
+ if not editCursor.block().next().isValid():
+ break #We reached the end of the document
+ editCursor.movePosition(editCursor.NextBlock)
+
+ editCursor.endEditBlock()
+
+ def doForVisibleBlocks(self, function):
+ """ doForVisibleBlocks(function)
+
+ Call the given function(cursor) for all blocks that are currently
+ visible. This is used by several appearence extensions that
+ paint per block.
+
+ The supplied cursor will be located at the beginning of each block. This
+ cursor may be modified by the function as required
+
+ """
+
+ # Start cursor at top line.
+ cursor = self.cursorForPosition(QtCore.QPoint(0,0))
+ cursor.movePosition(cursor.StartOfBlock)
+
+ while True:
+ # Call the function with a copy of the cursor
+ function(QtGui.QTextCursor(cursor))
+
+ # Go to the next block (or not if we are done)
+ y = self.cursorRect(cursor).bottom()
+ if y > self.height():
+ break #Reached end of the repaint area
+ if not cursor.block().next().isValid():
+ break #Reached end of the text
+ cursor.movePosition(cursor.NextBlock)
+
+ def indentBlock(self, cursor, amount=1):
+ """ indentBlock(cursor, amount=1)
+
+ Indent the block given by cursor.
+
+ The cursor specified is used to do the indentation; it is positioned
+ at the beginning of the first non-whitespace position after completion
+ May be overridden to customize indentation.
+
+ """
+ text = ustr(cursor.block().text())
+ leadingWhitespace = text[:len(text)-len(text.lstrip())]
+
+ #Select the leading whitespace
+ cursor.movePosition(cursor.StartOfBlock)
+ cursor.movePosition(cursor.Right,cursor.KeepAnchor,len(leadingWhitespace))
+
+ #Compute the new indentation length, expanding any existing tabs
+ indent = len(leadingWhitespace.expandtabs(self.indentWidth()))
+ if self.indentUsingSpaces():
+ # Determine correction, so we can round to multiples of indentation
+ correction = indent % self.indentWidth()
+ if correction and amount<0:
+ correction = - (self.indentWidth() - correction) # Flip
+ # Add the indentation tabs
+ indent += (self.indentWidth() * amount) - correction
+ cursor.insertText(' '*max(indent,0))
+ else:
+ # Convert indentation to number of tabs, and add one
+ indent = (indent // self.indentWidth()) + amount
+ cursor.insertText('\t' * max(indent,0))
+
+
+ def dedentBlock(self, cursor):
+ """ dedentBlock(cursor)
+
+ Dedent the block given by cursor.
+
+ Calls indentBlock with amount = -1.
+ May be overridden to customize indentation.
+
+ """
+ self.indentBlock(cursor, amount = -1)
+
+
+ def indentSelection(self):
+ """ indentSelection()
+
+ Called when the current line/selection is to be indented.
+ Calls indentLine(cursor) for each line in the selection.
+ May be overridden to customize indentation.
+
+ See also doForSelectedBlocks and indentBlock.
+
+ """
+ self.doForSelectedBlocks(self.indentBlock)
+
+
+ def dedentSelection(self):
+ """ dedentSelection()
+
+ Called when the current line/selection is to be dedented.
+ Calls dedentLine(cursor) for each line in the selection.
+ May be overridden to customize indentation.
+
+ See also doForSelectedBlocks and dedentBlock.
+
+ """
+ self.doForSelectedBlocks(self.dedentBlock)
+
+
+ def justifyText(self, linewidth=70):
+ """ justifyText(linewidth=70)
+ """
+ from .textutils import TextReshaper
+
+ # Get cursor
+ cursor = self.textCursor()
+
+ # Make selection include whole lines
+ pos1, pos2 = cursor.position(), cursor.anchor()
+ pos1, pos2 = min(pos1, pos2), max(pos1, pos2)
+ cursor.setPosition(pos1, cursor.MoveAnchor)
+ cursor.movePosition(cursor.StartOfBlock, cursor.MoveAnchor)
+ cursor.setPosition(pos2, cursor.KeepAnchor)
+ cursor.movePosition(cursor.EndOfBlock, cursor.KeepAnchor)
+
+ # Use reshaper to create replacement text
+ reshaper = TextReshaper(linewidth)
+ reshaper.pushText(cursor.selectedText())
+ newText = reshaper.popText()
+
+ # Update the selection
+ #self.setTextCursor(cursor) for testing
+ cursor.insertText(newText)
+
+
+ def addLeftMargin(self, des, func):
+ """ Add a margin to the left. Specify a description for the margin,
+ and a function to get that margin. For internal use.
+ """
+ assert des is not None
+ self._leftmargins.append((des, func))
+
+
+ def getLeftMargin(self, des=None):
+ """ Get the left margin, relative to the given description (which
+ should be the same as given to addLeftMargin). If des is omitted
+ or None, the full left margin is returned.
+ """
+ margin = 0
+ for d, func in self._leftmargins:
+ if d == des:
+ break
+ margin += func()
+ return margin
+
+
+ def updateMargins(self):
+ """ Force the margins to be recalculated and set the viewport
+ accordingly.
+ """
+ leftmargin = self.getLeftMargin()
+ self.setViewportMargins(leftmargin , 0, 0, 0)
diff --git a/iep/codeeditor/extensions/__init__.py b/iep/codeeditor/extensions/__init__.py
new file mode 100644
index 0000000..e69de29
diff --git a/iep/codeeditor/extensions/appearance.py b/iep/codeeditor/extensions/appearance.py
new file mode 100644
index 0000000..0d8c8f1
--- /dev/null
+++ b/iep/codeeditor/extensions/appearance.py
@@ -0,0 +1,925 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+"""
+Code editor extensions that change its appearance
+"""
+
+from ..qt import QtGui,QtCore
+Qt = QtCore.Qt
+
+from ..misc import ce_option
+from ..manager import Manager
+
+# todo: what about calling all extensions. CE_HighlightCurrentLine,
+# or EXT_HighlightcurrentLine?
+
+class HighlightCurrentLine(object):
+ """
+ Highlight the current line
+ """
+
+ # Register style element
+ _styleElements = [ ( 'Editor.Highlight current line',
+ 'The background color of the current line highlight.',
+ 'back:#ffff99',
+ ) ]
+
+ def highlightCurrentLine(self):
+ """ highlightCurrentLine()
+
+ Get whether to highlight the current line.
+
+ """
+ return self.__highlightCurrentLine
+
+ @ce_option(True)
+ def setHighlightCurrentLine(self,value):
+ """ setHighlightCurrentLine(value)
+
+ Set whether to highlight the current line.
+
+ """
+ self.__highlightCurrentLine = bool(value)
+ self.viewport().update()
+
+
+ def paintEvent(self,event):
+ """ paintEvent(event)
+
+ Paints a rectangle spanning the current block (in case of line wrapping, this
+ means multiple lines)
+
+ Paints behind its super()
+ """
+ if not self.highlightCurrentLine():
+ super(HighlightCurrentLine, self).paintEvent(event)
+ return
+
+ # Get color
+ color = self.getStyleElementFormat('editor.highlightCurrentLine').back
+
+ #Find the top of the current block, and the height
+ cursor = self.textCursor()
+ cursor.movePosition(cursor.StartOfBlock)
+ top = self.cursorRect(cursor).top()
+ cursor.movePosition(cursor.EndOfBlock)
+ height = self.cursorRect(cursor).bottom() - top + 1
+
+ margin = self.document().documentMargin()
+ painter = QtGui.QPainter()
+ painter.begin(self.viewport())
+ painter.fillRect(QtCore.QRect(margin, top,
+ self.viewport().width() - 2*margin, height),
+ color)
+ painter.end()
+
+ super(HighlightCurrentLine, self).paintEvent(event)
+
+ # for debugging paint events
+ #if 'log' not in self.__class__.__name__.lower():
+ # print(height, event.rect().width())
+
+
+class IndentationGuides(object):
+
+ # Register style element
+ _styleElements = [ ( 'Editor.Indentation guides',
+ 'The color and style of the indentation guides.',
+ 'fore:#DDF,linestyle:solid',
+ ) ]
+
+ def showIndentationGuides(self):
+ """ showIndentationGuides()
+
+ Get whether to show indentation guides.
+
+ """
+ return self.__showIndentationGuides
+
+ @ce_option(True)
+ def setShowIndentationGuides(self, value):
+ """ setShowIndentationGuides(value)
+
+ Set whether to show indentation guides.
+
+ """
+ self.__showIndentationGuides = bool(value)
+ self.viewport().update()
+
+
+ def paintEvent(self,event):
+ """ paintEvent(event)
+
+ Paint the indentation guides, using the indentation info calculated
+ by the highlighter.
+ """
+ super(IndentationGuides, self).paintEvent(event)
+
+ if not self.showIndentationGuides():
+ return
+
+ # Get doc and viewport
+ doc = self.document()
+ viewport = self.viewport()
+
+ # Get multiplication factor and indent width
+ indentWidth = self.indentWidth()
+ if self.indentUsingSpaces():
+ factor = 1
+ else:
+ factor = indentWidth
+
+ # Init painter
+ painter = QtGui.QPainter()
+ painter.begin(viewport)
+
+ # Prepare pen
+ format = self.getStyleElementFormat('editor.IndentationGuides')
+ pen = QtGui.QPen(format.fore)
+ pen.setStyle(format.linestyle)
+ painter.setPen(pen)
+ offset = doc.documentMargin() + self.contentOffset().x()
+
+ def paintIndentationGuides(cursor):
+ y3=self.cursorRect(cursor).top()
+ y4=self.cursorRect(cursor).bottom()
+
+ bd = cursor.block().userData()
+ if bd and hasattr(bd, 'indentation') and bd.indentation:
+ for x in range(indentWidth, bd.indentation * factor, indentWidth):
+ w = self.fontMetrics().width('i'*x) + offset
+ w += 1 # Put it more under the block
+ if w > 0: # if scrolled horizontally it can become < 0
+ painter.drawLine(QtCore.QLine(w, y3, w, y4))
+
+ self.doForVisibleBlocks(paintIndentationGuides)
+
+ # Done
+ painter.end()
+
+
+
+class FullUnderlines(object):
+
+ def paintEvent(self,event):
+ """ paintEvent(event)
+
+ Paint a horizontal line for the blocks for which there is a
+ syntax format that has underline:full. Whether this is the case
+ is stored at the blocks user data.
+
+ """
+ super(FullUnderlines, self).paintEvent(event)
+
+ painter = QtGui.QPainter()
+ painter.begin(self.viewport())
+
+ margin = self.document().documentMargin()
+ w = self.viewport().width()
+
+ def paintUnderline(cursor):
+ y = self.cursorRect(cursor).bottom()
+
+ bd = cursor.block().userData()
+ try:
+ fullUnderlineFormat = bd.fullUnderlineFormat
+ except AttributeError:
+ pass # fullUnderlineFormat may not be an attribute
+ else:
+ if fullUnderlineFormat is not None:
+ # Apply pen
+ pen = QtGui.QPen(fullUnderlineFormat.fore)
+ pen.setStyle(fullUnderlineFormat.linestyle)
+ painter.setPen(pen)
+ # Paint
+ painter.drawLine(QtCore.QLine(margin, y, w - 2*margin, y))
+
+ self.doForVisibleBlocks(paintUnderline)
+
+ painter.end()
+
+
+
+class CodeFolding(object):
+ def paintEvent(self,event):
+ """ paintEvent(event)
+
+ """
+ super(CodeFolding, self).paintEvent(event)
+
+ return # Code folding code is not yet complete
+
+ painter = QtGui.QPainter()
+ painter.begin(self.viewport())
+
+ margin = self.document().documentMargin()
+ w = self.viewport().width()
+
+
+ def paintCodeFolders(cursor):
+ y = self.cursorRect(cursor).top()
+ h = self.cursorRect(cursor).height()
+ rect = QtCore.QRect(margin, y, h, h)
+ text = cursor.block().text()
+ if text.rstrip().endswith(':'):
+ painter.drawRect(rect)
+ painter.drawText(rect, QtCore.Qt.AlignVCenter | QtCore.Qt.AlignHCenter, "-")
+ # Apply pen
+
+ # Paint
+ #painter.drawLine(QtCore.QLine(margin, y, w - 2*margin, y))
+
+ self.doForVisibleBlocks(paintCodeFolders)
+
+ painter.end()
+
+
+
+class LongLineIndicator(object):
+
+ # Register style element
+ _styleElements = [ ( 'Editor.Long line indicator',
+ 'The color and style of the long line indicator.',
+ 'fore:#BBB,linestyle:solid',
+ ) ]
+
+ def longLineIndicatorPosition(self):
+ """ longLineIndicatorPosition()
+
+ Get the position of the long line indicator (aka edge column).
+ A value of 0 or smaller means that no indicator is shown.
+
+ """
+ return self.__longLineIndicatorPosition
+
+ @ce_option(80)
+ def setLongLineIndicatorPosition(self, value):
+ """ setLongLineIndicatorPosition(value)
+
+ Set the position of the long line indicator (aka edge column).
+ A value of 0 or smaller means that no indicator is shown.
+
+ """
+ self.__longLineIndicatorPosition = int(value)
+ self.viewport().update()
+
+
+ def paintEvent(self, event):
+ """ paintEvent(event)
+
+ Paint the long line indicator. Paints behind its super()
+ """
+ if self.longLineIndicatorPosition()<=0:
+ super(LongLineIndicator, self).paintEvent(event)
+ return
+
+ # Get doc and viewport
+ doc = self.document()
+ viewport = self.viewport()
+
+ # Get position of long line
+ fm = self.fontMetrics()
+ # width of ('i'*length) not length * (width of 'i') b/c of
+ # font kerning and rounding
+ x = fm.width('i' * self.longLineIndicatorPosition())
+ x += doc.documentMargin() + self.contentOffset().x()
+ x += 1 # Move it a little next to the cursor
+
+ # Prepate painter
+ painter = QtGui.QPainter()
+ painter.begin(viewport)
+
+ # Prepare pen
+ format = self.getStyleElementFormat('editor.LongLineIndicator')
+ pen = QtGui.QPen(format.fore)
+ pen.setStyle(format.linestyle)
+ painter.setPen(pen)
+
+ # Draw line and end painter
+ painter.drawLine(QtCore.QLine(x, 0, x, viewport.height()) )
+ painter.end()
+
+ # Propagate event
+ super(LongLineIndicator, self).paintEvent(event)
+
+
+
+
+class ShowWhitespace(object):
+
+ def showWhitespace(self):
+ """Show or hide whitespace markers"""
+ option=self.document().defaultTextOption()
+ return bool(option.flags() & option.ShowTabsAndSpaces)
+
+ @ce_option(False)
+ def setShowWhitespace(self,value):
+ option=self.document().defaultTextOption()
+ if value:
+ option.setFlags(option.flags() | option.ShowTabsAndSpaces)
+ else:
+ option.setFlags(option.flags() & ~option.ShowTabsAndSpaces)
+ self.document().setDefaultTextOption(option)
+
+
+class ShowLineEndings(object):
+
+ @ce_option(False)
+ def showLineEndings(self):
+ """ Get whether line ending markers are shown.
+ """
+ option=self.document().defaultTextOption()
+ return bool(option.flags() & option.ShowLineAndParagraphSeparators)
+
+
+ def setShowLineEndings(self,value):
+ option=self.document().defaultTextOption()
+ if value:
+ option.setFlags(option.flags() | option.ShowLineAndParagraphSeparators)
+ else:
+ option.setFlags(option.flags() & ~option.ShowLineAndParagraphSeparators)
+ self.document().setDefaultTextOption(option)
+
+
+
+class LineNumbers(object):
+
+ # Margin on both side of the line numbers
+ _LineNumberAreaMargin = 3
+
+ # Register style element
+ _styleElements = [ ( 'Editor.Line numbers',
+ 'The text- and background-color of the line numbers.',
+ 'fore:#222,back:#DDD',
+ ) ]
+
+ class __LineNumberArea(QtGui.QWidget):
+ """ This is the widget reponsible for drawing the line numbers.
+ """
+
+ def __init__(self, codeEditor):
+ QtGui.QWidget.__init__(self, codeEditor)
+ self.setCursor(QtCore.Qt.PointingHandCursor)
+ self._pressedY = None
+ self._lineNrChoser = None
+
+ def _getY(self, pos):
+ tmp = self.mapToGlobal(pos)
+ return self.parent().viewport().mapFromGlobal(tmp).y()
+
+ def mousePressEvent(self, event):
+ self._pressedY = self._getY(event.pos())
+
+ def mouseReleaseEvent(self, event):
+ self._handleWholeBlockSelection( self._getY(event.pos()) )
+
+ def mouseMoveEvent(self, event):
+ self._handleWholeBlockSelection( self._getY(event.pos()) )
+
+ def _handleWholeBlockSelection(self, y2):
+ # Get y1 and sort (y1, y2)
+ y1 = self._pressedY
+ if y1 is None: y1 = y2
+ y1, y2 = min(y1, y2), max(y1, y2)
+
+ # Get cursor and two cursors corresponding to selected blocks
+ editor = self.parent()
+ cursor = editor.textCursor()
+ c1 = editor.cursorForPosition(QtCore.QPoint(0,y1))
+ c2 = editor.cursorForPosition(QtCore.QPoint(0,y2))
+
+ # Make these two cursors select the whole block
+ c1.movePosition(c1.StartOfBlock, c1.MoveAnchor)
+ c2.movePosition(c2.EndOfBlock, c2.MoveAnchor)
+
+ # Apply selection
+ cursor.setPosition(c1.position(), cursor.MoveAnchor)
+ cursor.setPosition(c2.position(), cursor.KeepAnchor)
+ editor.setTextCursor(cursor)
+
+ def mouseDoubleClickEvent(self, event):
+ self.showLineNumberChoser()
+
+ def showLineNumberChoser(self):
+ # Create line number choser if needed
+ if self._lineNrChoser is None:
+ self._lineNrChoser = LineNumbers.LineNumberChoser(self.parent())
+ # Get editor and cursor
+ editor = self.parent()
+ cursor = editor.textCursor()
+ # Get (x,y) pos and apply
+ x, y = self.width()+4, editor.cursorRect(cursor).y()
+ self._lineNrChoser.move(QtCore.QPoint(x,y))
+ # Show/reset line number choser
+ self._lineNrChoser.reset(cursor.blockNumber()+1)
+
+ def paintEvent(self, event):
+ editor = self.parent()
+
+ if not editor.showLineNumbers():
+ return
+
+ # Get doc and viewport
+ doc = editor.document()
+ viewport = editor.viewport()
+
+ # Get format and margin
+ format = editor.getStyleElementFormat('editor.LineNumbers')
+ margin = editor._LineNumberAreaMargin
+
+ # Init painter
+ painter = QtGui.QPainter()
+ painter.begin(self)
+
+ # Get which part to paint. Just do all to avoid glitches
+ w = editor.getLineNumberAreaWidth()
+ y1, y2 = 0, editor.height()
+ #y1, y2 = event.rect().top()-10, event.rect().bottom()+10
+
+ # Get offset
+ tmp = self.mapToGlobal(QtCore.QPoint(0,0))
+ offset = viewport.mapFromGlobal(tmp).y()
+
+ #Draw the background
+ painter.fillRect(QtCore.QRect(0, y1, w, y2), format.back)
+
+ # Get cursor
+ cursor = editor.cursorForPosition(QtCore.QPoint(0,y1))
+
+ # Prepare fonts
+ font1 = editor.font()
+ font2 = editor.font()
+ font2.setBold(True)
+ currentBlockNumber = editor.textCursor().block().blockNumber()
+
+ # Init painter with font and color
+ painter.setFont(font1)
+ painter.setPen(format.fore)
+
+ #Repainting always starts at the first block in the viewport,
+ #regardless of the event.rect().y(). Just to keep it simple
+ while True:
+ blockNumber = cursor.block().blockNumber()
+
+ y = editor.cursorRect(cursor).y()
+
+ # Set font to bold if line number is the current
+ if blockNumber == currentBlockNumber:
+ painter.setFont(font2)
+
+ painter.drawText(0, y-offset, w-margin, 50,
+ Qt.AlignRight, str(blockNumber+1))
+
+ # Set font back
+ if blockNumber == currentBlockNumber:
+ painter.setFont(font1)
+
+ if y>y2:
+ break #Reached end of the repaint area
+ if not cursor.block().next().isValid():
+ break #Reached end of the text
+
+ cursor.movePosition(cursor.NextBlock)
+
+ # Done
+ painter.end()
+
+ class LineNumberChoser(QtGui.QSpinBox):
+ def __init__(self, parent):
+ QtGui.QSpinBox.__init__(self, parent)
+
+ self._editor = parent
+
+ ss = "QSpinBox { border: 2px solid #789; border-radius: 3px; padding: 4px; }"
+ self.setStyleSheet(ss)
+
+ self.setPrefix('Go to line: ')
+ self.setAccelerated (True)
+ self.setButtonSymbols(self.NoButtons)
+ self.setCorrectionMode(self.CorrectToNearestValue)
+
+ # Signal for when value changes, and flag to disbale it once
+ self._ignoreSignalOnceFlag = False
+ self.valueChanged.connect(self.onValueChanged)
+
+ def reset(self, currentLineNumber):
+ # Set value to (given) current line number
+ self._ignoreSignalOnceFlag = True
+ self.setRange(1, self._editor.blockCount())
+ self.setValue(currentLineNumber)
+ # Select text and focus so that the user can simply start typing
+ self.selectAll()
+ self.setFocus()
+ # Make visible
+ self.show()
+ self.raise_()
+
+ def focusOutEvent(self, event):
+ self.hide()
+
+ def keyPressEvent(self, event):
+ if event.key() in [QtCore.Qt.Key_Escape, QtCore.Qt.Key_Enter, QtCore.Qt.Key_Return]:
+ self._editor.setFocus() # Moves focus away, thus hiding self
+ else:
+ QtGui.QSpinBox.keyPressEvent(self, event)
+
+ def onValueChanged(self, nr):
+ if self._ignoreSignalOnceFlag:
+ self._ignoreSignalOnceFlag = False
+ else:
+ self._editor.gotoLine(nr)
+
+ def __init__(self, *args, **kwds):
+ self.__lineNumberArea = None
+ super(LineNumbers, self).__init__(*args, **kwds)
+ # Create widget that draws the line numbers
+ self.__lineNumberArea = self.__LineNumberArea(self)
+ # Issue an update when the font or amount of line numbers changes
+ self.blockCountChanged.connect(self.__onBlockCountChanged)
+ self.fontChanged.connect(self.__onBlockCountChanged)
+ self.__onBlockCountChanged()
+ self.addLeftMargin(LineNumbers, self.getLineNumberAreaWidth)
+
+
+ def gotoLinePopup(self):
+ """ Popup the little widget to quickly goto a certain line.
+ Can also be achieved by double-clicking the line number area.
+ """
+ self.__lineNumberArea.showLineNumberChoser()
+
+ def showLineNumbers(self):
+ return self.__showLineNumbers
+
+ @ce_option(True)
+ def setShowLineNumbers(self, value):
+ self.__showLineNumbers = bool(value)
+ # Note that this method is called before the __init__ is finished,
+ # so that the __lineNumberArea is not yet created.
+ if self.__lineNumberArea:
+ if self.__showLineNumbers:
+ self.__onBlockCountChanged()
+ self.__lineNumberArea.show()
+ else:
+ self.__lineNumberArea.hide()
+ self.updateMargins()
+
+
+ def getLineNumberAreaWidth(self):
+ """
+ Count the number of lines, compute the length of the longest line number
+ (in pixels)
+ """
+ if not self.__showLineNumbers:
+ return 0
+ lastLineNumber = self.blockCount()
+ margin = self._LineNumberAreaMargin
+ return self.fontMetrics().width(str(lastLineNumber)) + 2*margin
+
+
+ def __onBlockCountChanged(self,count = None):
+ """
+ Update the line number area width. This requires to set the
+ viewport margins, so there is space to draw the linenumber area
+ """
+ if self.__showLineNumbers:
+ self.updateMargins()
+
+
+ def resizeEvent(self,event):
+ super(LineNumbers, self).resizeEvent(event)
+
+ #On resize, resize the lineNumberArea, too
+ rect=self.contentsRect()
+ m = self.getLeftMargin(LineNumbers)
+ w = self.getLineNumberAreaWidth()
+ self.__lineNumberArea.setGeometry( rect.x()+m, rect.y(),
+ w, rect.height())
+
+ def paintEvent(self,event):
+ super(LineNumbers, self).paintEvent(event)
+ #On repaint, update the complete line number area
+ w = self.getLineNumberAreaWidth()
+ self.__lineNumberArea.update(0, 0, w, self.height() )
+
+
+
+class BreakPoints(object):
+
+ _breakPointWidth = 11 # With of total bar, actual points are smaller
+
+ # Register style element
+ _styleElements = [ ( 'Editor.BreakPoints',
+ 'The fore- and background-color of the breakpoints.',
+ 'fore:#F66,back:#dfdfe1',
+ ) ]
+
+ class __BreakPointArea(QtGui.QWidget):
+ """ This is the widget reponsible for drawing the break points.
+ """
+
+ def __init__(self, codeEditor):
+ QtGui.QWidget.__init__(self, codeEditor)
+ self.setCursor(QtCore.Qt.PointingHandCursor)
+ self.setMouseTracking(True)
+ self._virtualBreakpoint = 0
+
+ def _getY(self, pos):
+ tmp = self.mapToGlobal(pos)
+ return self.parent().viewport().mapFromGlobal(tmp).y()
+
+ def mousePressEvent(self, event):
+ self._toggleBreakPoint( self._getY(event.pos()))
+
+ def mouseMoveEvent(self, event):
+ y = self._getY(event.pos())
+ editor = self.parent()
+ cursor = editor.textCursor()
+ c1 = editor.cursorForPosition(QtCore.QPoint(0,y))
+ self._virtualBreakpoint = c1.blockNumber() + 1
+ self.update()
+
+ def leaveEvent(self, event):
+ self._virtualBreakpoint = 0
+ self.update()
+
+ def _toggleBreakPoint(self, y):
+ # Get breakpoint corresponding to pressed pos
+ editor = self.parent()
+ cursor = editor.textCursor()
+ c1 = editor.cursorForPosition(QtCore.QPoint(0,y))
+ linenr = c1.blockNumber() + 1
+
+ # Toggle
+ bps = self.parent()._breakPoints
+ if linenr in bps:
+ bps.discard(linenr)
+ else:
+ bps.add(linenr)
+
+ # Emit signal
+ editor.breakPointsChanged.emit(editor)
+ self.update()
+
+ def paintEvent(self, event):
+ editor = self.parent()
+
+ if not editor.showBreakPoints():
+ return
+
+ # Get doc and viewport
+ doc = editor.document()
+ viewport = editor.viewport()
+
+ # Get format and margin
+ format = editor.getStyleElementFormat('editor.breakpoints')
+ margin = 1
+ w = editor._breakPointWidth
+ bulletWidth = w - 2*margin
+
+ # Init painter
+ painter = QtGui.QPainter()
+ painter.begin(self)
+
+ # Get which part to paint. Just do all to avoid glitches
+ y1, y2 = 0, editor.height()
+
+ # Get offset
+ tmp = self.mapToGlobal(QtCore.QPoint(0,0))
+ offset = viewport.mapFromGlobal(tmp).y()
+
+ #Draw the background
+ painter.fillRect(QtCore.QRect(0, y1, w, y2), format.back)
+
+ # Get debug indicator and list of sorted breakpoints
+ debugBlockIndicator = editor._debugLineIndicator-1
+ virtualBreakpoint = self._virtualBreakpoint-1
+ blocknumbers = [i-1 for i in sorted(self.parent()._breakPoints)]
+ if not (blocknumbers or
+ editor._debugLineIndicator or
+ editor._debugLineIndicators or
+ virtualBreakpoint > 0):
+ return
+
+ # Get cursor
+ cursor = editor.cursorForPosition(QtCore.QPoint(0,y1))
+
+ # Get start block number and bullet offset in pixels
+ startBlockNumber = cursor.block().blockNumber()
+ bulletOffset = editor.contentOffset().y() + bulletWidth * 0.25
+
+ # Prepare painter
+ painter.setPen(QtGui.QColor('#777'))
+ painter.setBrush(format.fore)
+ painter.setRenderHint(painter.Antialiasing)
+
+
+ # Draw breakpoints
+ for blockNumber in blocknumbers:
+ if blockNumber < startBlockNumber:
+ continue
+ # Get block
+ block = editor.document().findBlockByNumber(blockNumber)
+ if block.isValid():
+ y = editor.blockBoundingGeometry(block).y() + bulletOffset
+ painter.drawEllipse(margin, y, bulletWidth, bulletWidth)
+
+ # Draw *the* debug marker
+ if debugBlockIndicator > 0:
+ painter.setBrush(QtGui.QColor('#6F6'))
+ # Get block
+ block = editor.document().findBlockByNumber(debugBlockIndicator)
+ if block.isValid():
+ y = editor.blockBoundingGeometry(block).y() + bulletOffset
+ y += 0.25 * bulletWidth
+ painter.drawEllipse(margin, y, bulletWidth, 0.5*bulletWidth)
+
+ # Draw other debug markers
+ for debugLineIndicator in editor._debugLineIndicators:
+ debugBlockIndicator = debugLineIndicator - 1
+ painter.setBrush(QtGui.QColor('#DDD'))
+ # Get block
+ block = editor.document().findBlockByNumber(debugBlockIndicator)
+ if block.isValid():
+ y = editor.blockBoundingGeometry(block).y() + bulletOffset
+ y += 0.25 * bulletWidth
+ painter.drawEllipse(margin, y, bulletWidth, 0.5*bulletWidth)
+
+ # Draw virtual break point
+ if virtualBreakpoint > 0:
+ painter.setBrush(QtGui.QColor(0,0,0,0))
+ # Get block
+ block = editor.document().findBlockByNumber(virtualBreakpoint)
+ if block.isValid():
+ y = editor.blockBoundingGeometry(block).y() + bulletOffset
+ painter.drawEllipse(margin, y, bulletWidth, bulletWidth)
+
+ # Done
+ painter.end()
+
+
+ def __init__(self, *args, **kwds):
+ self.__breakPointArea = None
+ super(BreakPoints, self).__init__(*args, **kwds)
+ # Create widget that draws the breakpoints
+ self.__breakPointArea = self.__BreakPointArea(self)
+ self.addLeftMargin(BreakPoints, self.getBreakPointAreaWidth)
+ self._breakPoints = set()
+ self._debugLineIndicator = 0
+ self._debugLineIndicators = set()
+
+
+ def breakPoints(self):
+ """ A list of breakpoints for this editor.
+ """
+ return list(sorted(self._breakPoints))
+
+
+ def clearBreakPoints(self):
+ """ Remove all breakpoints for this editor.
+ """
+ self._breakPoints = set()
+ self.breakPointsChanged.emit(self)
+
+
+ def setDebugLineIndicator(self, linenr, active=True):
+ """ Set the debug line indicator to the given line number.
+ If None or 0, the indicator is hidden.
+ """
+ linenr = int(linenr or 0)
+ if not linenr:
+ # Remove all indicators
+ if self._debugLineIndicator or self._debugLineIndicators:
+ self._debugLineIndicator = 0
+ self._debugLineIndicators = set()
+ self.__breakPointArea.update()
+ elif active:
+ # Set *the* indicator
+ if linenr != self._debugLineIndicator:
+ self._debugLineIndicators.discard(linenr)
+ self._debugLineIndicator = linenr
+ self.__breakPointArea.update()
+ else:
+ # Add to set of indicators
+ if linenr not in self._debugLineIndicators:
+ self._debugLineIndicators.add(linenr)
+ self.__breakPointArea.update()
+
+
+ def getBreakPointAreaWidth(self):
+ if not self.__showBreakPoints:
+ return 0
+ else:
+ return self._breakPointWidth
+
+
+ def showBreakPoints(self):
+ return self.__showBreakPoints
+
+ @ce_option(True)
+ def setShowBreakPoints(self, value):
+ self.__showBreakPoints = bool(value)
+ # Note that this method is called before the __init__ is finished,
+ # so that the area is not yet created.
+ if self.__breakPointArea:
+ if self.__showBreakPoints:
+ self.__breakPointArea.show()
+ else:
+ self.__breakPointArea.hide()
+ self.clearBreakPoints()
+ self.updateMargins()
+
+
+ def resizeEvent(self,event):
+ super(BreakPoints, self).resizeEvent(event)
+
+ #On resize, resize the breakpointArea, too
+ rect=self.contentsRect()
+ m = self.getLeftMargin(BreakPoints)
+ w = self.getBreakPointAreaWidth()
+ self.__breakPointArea.setGeometry( rect.x()+m, rect.y(),
+ w, rect.height())
+
+ def paintEvent(self,event):
+ super(BreakPoints, self).paintEvent(event)
+ #On repaint, update the complete breakPointArea
+ w = self.getBreakPointAreaWidth()
+ self.__breakPointArea.update(0, 0, w, self.height() )
+
+
+
+class Wrap(object):
+
+ def wrap(self):
+ """Enable or disable wrapping"""
+ option=self.document().defaultTextOption()
+ return not bool(option.wrapMode() == option.NoWrap)
+
+ @ce_option(True)
+ def setWrap(self,value):
+ option=self.document().defaultTextOption()
+ if value:
+ option.setWrapMode(option.WrapAtWordBoundaryOrAnywhere)
+ else:
+ option.setWrapMode(option.NoWrap)
+ self.document().setDefaultTextOption(option)
+
+
+# todo: move this bit to base class?
+# This functionality embedded in the highlighter and even has a designated
+# subpackage. I feel that it should be a part of the base editor.
+# Note: if we do this, remove the hasattr call in the highlighter.
+class SyntaxHighlighting(object):
+ """ Notes on syntax highlighting.
+
+ The syntax highlighting/parsing is performed using three "components".
+
+ The base component are the token instances. Each token simply represents
+ a row of characters in the text the belong to each-other and should
+ be styled in the same way. There is a token class for each particular
+ "thing" in the code, such as comments, strings, keywords, etc. Some
+ tokens are specific to a particular language.
+
+ There is a function that produces a set of tokens, when given a line of
+ text and a state parameter. There is such a function for each language.
+ These "parsers" are defined in the parsers subpackage.
+
+ And lastly, there is the Highlighter class, that applies the parser function
+ to obtain the set of tokens and using the names of these tokens applies
+ styling. The styling can be defined by giving a dict that maps token names
+ to style representations.
+
+ """
+
+ # Register all syntax style elements
+ _styleElements = Manager.getStyleElementDescriptionsForAllParsers()
+
+ def parser(self):
+ """ parser()
+
+ Get the parser instance currently in use to parse the code for
+ syntax highlighting and source structure. Can be None.
+
+ """
+ try:
+ return self.__parser
+ except AttributeError:
+ return None
+
+
+ @ce_option(None)
+ def setParser(self, parserName=''):
+ """ setParser(parserName='')
+
+ Set the current parser by giving the parser name.
+
+ """
+ # Set parser
+ self.__parser = Manager.getParserByName(parserName)
+
+ # Restyle, use setStyle for lazy updating
+ self.setStyle()
+
diff --git a/iep/codeeditor/extensions/autocompletion.py b/iep/codeeditor/extensions/autocompletion.py
new file mode 100644
index 0000000..f4ba071
--- /dev/null
+++ b/iep/codeeditor/extensions/autocompletion.py
@@ -0,0 +1,286 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+"""
+Code editor extensions that provides autocompleter functionality
+"""
+
+
+from ..qt import QtGui,QtCore
+Qt = QtCore.Qt
+
+import keyword
+
+#TODO: use this CompletionListModel to style the completion suggestions (class names, method names, keywords etc)
+class CompletionListModel(QtGui.QStringListModel):
+ def data(self, index, role):
+ if role == Qt.ForegroundRole:
+ # data = str(QtGui.QStringListModel.data(self, index, QtCore.Qt.DisplayRole))
+ # return QtGui.QBrush(Qt.red)
+ return None
+ else:
+ return QtGui.QStringListModel.data(self, index, role)
+
+# todo: use keywords from the parser
+class AutoCompletion(object):
+ def __init__(self,*args, **kwds):
+ super(AutoCompletion, self).__init__(*args, **kwds)
+ # Autocompleter
+ self.__completerModel = QtGui.QStringListModel(keyword.kwlist)
+ self.__completer = QtGui.QCompleter(self)
+ self.__completer.setModel(self.__completerModel)
+ self.__completer.setCaseSensitivity(Qt.CaseInsensitive)
+ self.__completer.setWidget(self)
+ self.__completerNames = []
+ self.__recentCompletions = [] #List of recently selected completions
+
+ # geometry
+ self.__popupSize = 300, 100
+
+ # Text position corresponding to first charcter of the word being completed
+ self.__autocompleteStart = None
+
+ self.__autocompleteDebug = False
+
+ self.__autocompletionAcceptKeys = (Qt.Key_Tab,)
+
+ #Connect signals
+ self.__highlightedCompletion = None
+ self.__completer.activated.connect(self.onAutoComplete)
+ self.__completer.highlighted.connect(self._setHighlightedCompletion)
+
+ def _setHighlightedCompletion(self, value):
+ """ Keeping track of the highlighted item allows us
+ to 'manually' perform an autocompletion.
+ """
+ self.__highlightedCompletion = value
+
+ ## Properties
+ def recentCompletionsList(self):
+ """
+ The list of recent auto-completions. This property may be set to a
+ list that is shared among several editors, in order to share the notion
+ of recent auto-completions
+ """
+ return self.__recentCompletions
+
+ def setRecentCompletionsList(self,value):
+ self.__recentCompletions = value
+
+ def completer(self):
+ return self.__completer
+
+
+ def setAutoCompletionAcceptKeys(self, *keys):
+ """ Set the keys that can accept an autocompletion.
+ Like Tab, or Enter. Defaut Tab.
+ """
+ self.__autocompletionAcceptKeys = keys
+
+
+ ## Autocompletion
+
+ def setAutocompletPopupSize(self, width, height):
+ """
+ Set the size (width, heigth) of the automcompletion popup window.
+ """
+ self.__popupSize = width, height
+
+
+ def autocompleteShow(self,offset = 0,names = None):
+ """
+ Pop-up the autocompleter (if not already visible) and position it at current
+ cursor position minus offset. If names is given and not None, it is set
+ as the list of possible completions.
+ """
+ #Pop-up the autocompleteList
+ startcursor=self.textCursor()
+ startcursor.movePosition(startcursor.Left, n=offset)
+
+ if self.__autocompleteDebug:
+ print('autocompleteShow called')
+
+ if not self.autocompleteActive() or \
+ startcursor.position() != self.__autocompleteStart.position():
+
+ self.__autocompleteStart=startcursor
+ self.__autocompleteStart.setKeepPositionOnInsert(True)
+
+ #Popup the autocompleter. Don't use .complete() since we want to
+ #position the popup manually
+ self.__positionAutocompleter()
+ self.__updateAutocompleterPrefix()
+ self.__completer.popup().show()
+
+ if self.__autocompleteDebug:
+ print('self.__completer.popup().show() called')
+
+ if names is not None:
+ #TODO: a more intelligent implementation that adds new items and removes
+ #old ones
+ if names != self.__completerNames:
+ self.__completerModel.setStringList(names)
+ self.__completerNames = names
+ self.__updateAutocompleterPrefix()
+
+ def autocompleteAccept(self):
+ pass
+
+ def autocompleteCancel(self):
+ self.__completer.popup().hide()
+ self.__autocompleteStart = None
+
+ def onAutoComplete(self, text=None):
+ if text is None:
+ text = self.__highlightedCompletion
+ #Select the text from autocompleteStart until the current cursor
+ cursor=self.textCursor()
+ cursor.setPosition(self.__autocompleteStart.position(),cursor.KeepAnchor)
+ #Replace it with the selected text
+ cursor.insertText(text)
+ self.autocompleteCancel() #Reset the completer
+
+ #Update the recent completions list
+ if text in self.__recentCompletions:
+ self.__recentCompletions.remove(text)
+ self.__recentCompletions.append(text)
+
+ def autocompleteActive(self):
+ """ Returns whether an autocompletion list is currently shown.
+ """
+ return self.__autocompleteStart is not None
+
+
+ def __positionAutocompleter(self):
+ """Move the autocompleter list to a proper position"""
+ #Find the start of the autocompletion and move the completer popup there
+ cur=QtGui.QTextCursor(self.__autocompleteStart) #Copy __autocompleteStart
+
+ # Set size
+ geometry = self.__completer.popup().geometry()
+ geometry.setWidth(self.__popupSize[0])
+ geometry.setHeight(self.__popupSize[1])
+ self.__completer.popup().setGeometry(geometry)
+
+ # Initial choice for position of the completer
+ position = self.cursorRect(cur).bottomLeft() + self.viewport().pos()
+
+ # Check if the completer is going to go off the screen
+ desktop_geometry = QtGui.qApp.desktop().geometry()
+ global_position = self.mapToGlobal(position)
+ if global_position.y() + geometry.height() > desktop_geometry.height():
+ # Move the completer to above the current line
+ position = self.cursorRect(cur).topLeft() + self.viewport().pos()
+ global_position = self.mapToGlobal(position)
+ global_position -= QtCore.QPoint(0, geometry.height())
+
+ self.__completer.popup().move(global_position)
+
+
+ def __updateAutocompleterPrefix(self):
+ """
+ Find the autocompletion prefix (the part of the word that has been
+ entered) and send it to the completer. Update the selected completion
+ (out of several possiblilties) which is best suited
+ """
+ if not self.autocompleteActive():
+ self.__completer.popup().hide() #TODO: why is this required?
+ return
+
+ #Select the text from autocompleteStart until the current cursor
+ cursor=self.textCursor()
+ cursor.setPosition(self.__autocompleteStart.position(),cursor.KeepAnchor)
+
+ prefix=cursor.selectedText()
+ self.__completer.setCompletionPrefix(prefix)
+ model = self.__completer.completionModel()
+ if model.rowCount():
+ # Create a list of all possible completions, and select the one
+ # which is best suited. Use the one which is highest in the
+ # __recentCompletions list, but prefer completions with matching
+ # case if they exists
+
+ # Create a list of (row, value) tuples of all possible completions
+ completions = [
+ (row, model.data(model.index(row,0),self.__completer.completionRole()))
+ for row in range(model.rowCount())
+ ]
+
+ # Define a function to get the position in the __recentCompletions
+ def completionIndex(data):
+ try:
+ return self.__recentCompletions.index(data)
+ except ValueError:
+ return -1
+
+ # Sort twice; the last sort has priority over the first
+
+ # Sort on most recent completions
+ completions.sort(key = lambda c: completionIndex(c[1]), reverse = True)
+ # Sort on matching case (prefer matching case)
+ completions.sort(key = lambda c: c[1].startswith(prefix), reverse = True)
+
+ # apply the best match
+ bestMatchRow = completions[0][0]
+ self.__completer.popup().setCurrentIndex(model.index(bestMatchRow,0));
+
+
+ else:
+ #No match, just hide
+ self.autocompleteCancel()
+
+
+ def potentiallyAutoComplete(self, event):
+ """ potentiallyAutoComplete(event)
+ Given a keyEvent, check if we should perform an autocompletion.
+ Returns 0 if no autocompletion was performed. Return 1 if
+ autocompletion was performed, but the key event should be processed
+ as normal. Return 2 if the autocompletion was performed, and the key
+ should be consumed.
+ """
+ if self.autocompleteActive():
+ if event.key() in self.__autocompletionAcceptKeys:
+ if event.key() <= 128:
+ self.onAutoComplete() # No arg: select last highlighted
+ self.autocompleteCancel()
+ event.ignore()
+ return 1 # Let key have effect as normal
+ elif event.modifiers() == Qt.NoModifier:
+ # The key
+ self.onAutoComplete() # No arg: select last highlighted
+ self.autocompleteCancel()
+ return 2 # Key should be consumed
+ return 0
+
+
+ def keyPressEvent(self, event):
+ key = event.key()
+ modifiers = event.modifiers()
+ if key == Qt.Key_Escape and modifiers == Qt.NoModifier and \
+ self.autocompleteActive():
+ self.autocompleteCancel()
+ return #Consume the key
+
+ if self.potentiallyAutoComplete(event) > 1:
+ return #Consume
+
+ #Allowed keys that do not close the autocompleteList:
+ # alphanumeric and _ ans shift
+ # Backspace (until start of autocomplete word)
+ if self.autocompleteActive() and \
+ not event.text().isalnum() and event.text() != '_' and \
+ key != Qt.Key_Shift and not (
+ (key==Qt.Key_Backspace) and self.textCursor().position()>self.__autocompleteStart.position()):
+ self.autocompleteCancel()
+
+ # Apply the key that was pressed
+ super(AutoCompletion, self).keyPressEvent(event)
+
+ if self.autocompleteActive():
+ #While we type, the start of the autocompletion may move due to line
+ #wrapping, so reposition after every key stroke
+ self.__positionAutocompleter()
+ self.__updateAutocompleterPrefix()
diff --git a/iep/codeeditor/extensions/behaviour.py b/iep/codeeditor/extensions/behaviour.py
new file mode 100644
index 0000000..cc541ab
--- /dev/null
+++ b/iep/codeeditor/extensions/behaviour.py
@@ -0,0 +1,209 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+"""
+Code editor extensions that change its behaviour (i.e. how it reacts to keys)
+"""
+
+
+from ..qt import QtGui,QtCore
+Qt = QtCore.Qt
+
+from ..misc import ustr, ce_option
+from ..parsers.tokens import (CommentToken,UnterminatedStringToken)
+from ..parsers import BlockState
+
+class HomeKey(object):
+
+ def keyPressEvent(self,event):
+ # Home or shift + home
+ if event.key() == Qt.Key_Home and \
+ event.modifiers() in (Qt.NoModifier, Qt.ShiftModifier):
+ # Prepare
+ cursor = self.textCursor()
+ shiftDown = event.modifiers() == Qt.ShiftModifier
+ moveMode = [cursor.MoveAnchor, cursor.KeepAnchor][shiftDown]
+ # Get leading whitespace
+ text = ustr(cursor.block().text())
+ leadingWhitespace = text[:len(text)-len(text.lstrip())]
+ # Get current position and move to start of whitespace
+ i = cursor.positionInBlock()
+ cursor.movePosition(cursor.StartOfBlock, moveMode)
+ cursor.movePosition(cursor.Right, moveMode, len(leadingWhitespace))
+ # If we were alread there, move to start of block
+ if cursor.positionInBlock() == i:
+ cursor.movePosition(cursor.StartOfBlock, moveMode)
+ # Done
+ self.setTextCursor(cursor)
+ else:
+ super(HomeKey, self).keyPressEvent(event)
+
+class EndKey(object):
+
+ def keyPressEvent(self,event):
+ if event.key() == Qt.Key_End and \
+ event.modifiers() in (Qt.NoModifier, Qt.ShiftModifier):
+ # Prepare
+ cursor = self.textCursor()
+ shiftDown = event.modifiers() == Qt.ShiftModifier
+ moveMode = [cursor.MoveAnchor, cursor.KeepAnchor][shiftDown]
+ # Get current position and move to end of line
+ i = cursor.positionInBlock()
+ cursor.movePosition(cursor.EndOfLine, moveMode)
+ # If alread at end of line, move to end of block
+ if cursor.positionInBlock() == i:
+ cursor.movePosition(cursor.EndOfBlock, moveMode)
+ # Done
+ self.setTextCursor(cursor)
+ else:
+ super(EndKey, self).keyPressEvent(event)
+
+class NumpadPeriodKey(object):
+ """
+ If the numpad decimal separator key is pressed, always insert
+ a period (.) even if due to localization that key is mapped to a
+ comma (,). When editing code, period is the decimal separator
+ independent of localization
+ """
+ def keyPressEvent(self,event):
+ # Check for numpad comma
+ if event.key() == QtCore.Qt.Key_Comma and \
+ event.modifiers() & QtCore.Qt.KeypadModifier:
+
+ # Create a new QKeyEvent to substitute the original one
+ event = QtGui.QKeyEvent(event.type(), QtCore.Qt.Key_Period,
+ event.modifiers(), '.', event.isAutoRepeat(), event.count())
+
+ super(NumpadPeriodKey, self).keyPressEvent(event)
+
+
+class Indentation(object):
+
+ def __cursorIsInLeadingWhitespace(self,cursor = None):
+ """
+ Checks wether the given cursor is in the leading whitespace of a block, i.e.
+ before the first non-whitespace character. The cursor is not modified.
+ If the cursor is not given or is None, the current textCursor is used
+ """
+ if cursor is None:
+ cursor = self.textCursor()
+
+ # Get the text of the current block up to the cursor
+ textBeforeCursor = ustr(cursor.block().text())[:cursor.positionInBlock()]
+ return textBeforeCursor.lstrip() == '' #If we trim it and it is empty, it's all whitespace
+
+ def keyPressEvent(self,event):
+ key = event.key()
+ modifiers = event.modifiers()
+ #Tab key
+ if key == Qt.Key_Tab:
+ if modifiers == Qt.NoModifier:
+ if self.textCursor().hasSelection(): #Tab pressed while some area was selected
+ self.indentSelection()
+ return
+ elif self.__cursorIsInLeadingWhitespace():
+ #If the cursor is in the leading whitespace, indent and move cursor to end of whitespace
+ cursor = self.textCursor()
+ self.indentBlock(cursor)
+ self.setTextCursor(cursor)
+ return
+
+ elif self.indentUsingSpaces():
+ #Insert space-tabs
+ cursor=self.textCursor()
+ w = self.indentWidth()
+ cursor.insertText(' '*(w-((cursor.positionInBlock() + w ) % w)))
+ return
+ #else: default behaviour, insert tab character
+ else: #Some other modifiers + Tab: ignore
+ return
+
+ # If backspace is pressed in the leading whitespace, (except for at the first
+ # position of the line), and there is no selection
+ # dedent that line and move cursor to end of whitespace
+ if key == Qt.Key_Backspace and modifiers == Qt.NoModifier and \
+ self.__cursorIsInLeadingWhitespace() and not self.textCursor().atBlockStart() \
+ and not self.textCursor().hasSelection():
+ # Create a cursor, dedent the block and move screen cursor to the end of the whitespace
+ cursor = self.textCursor()
+ self.dedentBlock(cursor)
+ self.setTextCursor(cursor)
+ return
+
+ # todo: Same for delete, I think not (what to do with the cursor?)
+
+ # Auto-unindent
+ if event.key() == Qt.Key_Delete:
+ cursor = self.textCursor()
+ if not cursor.hasSelection():
+ cursor.movePosition(cursor.EndOfBlock, cursor.KeepAnchor)
+ if not cursor.hasSelection() and cursor.block().next().isValid():
+ cursor.beginEditBlock()
+ cursor.movePosition(cursor.NextBlock)
+ self.indentBlock(cursor, -99) # dedent as much as we can
+ cursor.deletePreviousChar()
+ cursor.endEditBlock()
+ return
+
+ super(Indentation, self).keyPressEvent(event)
+
+class AutoIndent(object):
+ """
+ Auto indentation. This extension only adds the autoIndent property, for the
+ actual indentation, the editor should derive from some AutoIndenter object
+ """
+
+ def autoIndent(self):
+ """ autoIndent()
+
+ Get whether auto indentation is enabled.
+
+ """
+ return self.__autoIndent
+
+ @ce_option(True)
+ def setAutoIndent(self,value):
+ """ setAutoIndent(value)
+
+ Set whether to enable auto indentation.
+
+ """
+ self.__autoIndent = bool(value)
+
+
+class PythonAutoIndent(object):
+
+ def keyPressEvent(self,event):
+ super(PythonAutoIndent, self).keyPressEvent(event)
+ if not self.autoIndent():
+ return
+
+ #This extension code is run *after* key is processed by QPlainTextEdit
+
+ if event.key() in (Qt.Key_Enter,Qt.Key_Return):
+ cursor=self.textCursor()
+ previousBlock=cursor.block().previous()
+ if previousBlock.isValid():
+ line = ustr(previousBlock.text())
+ indent=line[:len(line)-len(line.lstrip())]
+ if line.endswith(':'):
+ # We only need to add indent if the : is not in a (multiline)
+ # string or comment. Therefore, find out what the syntax
+ # highlighter thinks of the previous line.
+ ppreviousBlock = previousBlock.previous() # the block before previous
+ ppreviousState = ppreviousBlock.userState() if previousBlock.isValid() else 0
+ lastElementToken = list(self.parser().parseLine(previousBlock.text(),ppreviousState))[-1]
+ # Because there's at least a : on that line, the list is never empty
+
+ if (not isinstance(lastElementToken, (CommentToken, UnterminatedStringToken, BlockState))):
+ #TODO: check correct identation (no mixed space/tabs)
+ if self.indentUsingSpaces():
+ indent+=' '*self.indentWidth()
+ else:
+ indent+='\t'
+ cursor.insertText(indent)
+ #This prevents jump to start of line when up key is pressed
+ self.setTextCursor(cursor)
diff --git a/iep/codeeditor/extensions/calltip.py b/iep/codeeditor/extensions/calltip.py
new file mode 100644
index 0000000..61b7970
--- /dev/null
+++ b/iep/codeeditor/extensions/calltip.py
@@ -0,0 +1,137 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+from ..qt import QtCore, QtGui
+Qt = QtCore.Qt
+
+class Calltip(object):
+ _styleElements = [('Editor.calltip', 'The style of the calltip. ',
+ 'fore:#555, back:#ff9, border:1')]
+
+ class __CalltipLabel(QtGui.QLabel):
+ def __init__(self):
+ QtGui.QLabel.__init__(self)
+
+ # Start hidden
+ self.hide()
+ # Accept rich text
+ self.setTextFormat(QtCore.Qt.RichText)
+ # Show as tooltip
+ self.setIndent(2)
+ self.setWindowFlags(QtCore.Qt.ToolTip)
+
+ def enterEvent(self, event):
+ # Act a bit like a tooltip
+ self.hide()
+
+
+ def __init__(self, *args, **kwds):
+ super(Calltip, self).__init__(*args, **kwds)
+ # Create label for call tips
+ self.__calltipLabel = self.__CalltipLabel()
+ # Be notified of style updates
+ self.styleChanged.connect(self.__afterSetStyle)
+
+ # Prevents calltips from being shown immediately after pressing
+ # the escape key.
+ self.__noshow = False
+
+
+ def __afterSetStyle(self):
+ format = self.getStyleElementFormat('editor.calltip')
+ ss = "QLabel { color:%s; background:%s; border:%ipx solid %s; }" % (
+ format['fore'], format['back'],
+ int(format['border']), format['fore'] )
+ self.__calltipLabel.setStyleSheet(ss)
+
+
+ def calltipShow(self, offset=0, richText='', highlightFunctionName=False):
+ """ calltipShow(offset=0, richText='', highlightFunctionName=False)
+
+ Shows the given calltip.
+
+ Parameters
+ ----------
+ offset : int
+ The character offset to show the tooltip.
+ richText : str
+ The text to show (may contain basic html for markup).
+ highlightFunctionName : bool
+ If True the text before the first opening brace is made bold.
+ default False.
+
+ """
+
+ # Do not show the calltip if it was deliberately hidden by the
+ # user.
+ if self.__noshow:
+ return
+
+ # Process calltip text?
+ if highlightFunctionName:
+ i = richText.find('(')
+ if i>0:
+ richText = '<b>{}</b>{}'.format(richText[:i], richText[i:])
+
+ # Get a cursor to establish the position to show the calltip
+ startcursor = self.textCursor()
+ startcursor.movePosition(startcursor.Left, n=offset)
+
+ # Get position in pixel coordinates
+ rect = self.cursorRect(startcursor)
+ pos = rect.topLeft()
+ pos.setY( pos.y() - rect.height() - 1 ) # Move one above line
+ pos.setX( pos.x() - 3) # Correct for border and indent
+ pos = self.viewport().mapToGlobal(pos)
+
+ # Set text and update font
+ self.__calltipLabel.setText(richText)
+ self.__calltipLabel.setFont(self.font())
+
+ # Use a qt tooltip to show the calltip
+ if richText:
+ self.__calltipLabel.move(pos)
+ self.__calltipLabel.show()
+ else:
+ self.__calltipLabel.hide()
+
+
+ def calltipCancel(self):
+ """ calltipCancel()
+
+ Hides the calltip.
+
+ """
+ self.__calltipLabel.hide()
+
+
+ def calltipActive(self):
+ """ calltipActive()
+
+ Get whether the calltip is currently active.
+
+ """
+ return self.__calltipLabel.isVisible()
+
+
+ def focusOutEvent(self, event):
+ super(Calltip, self).focusOutEvent(event)
+ self.__calltipLabel.hide()
+
+
+ def keyPressEvent(self,event):
+ # If the user presses Escape and the calltip is active, hide it
+ if event.key() == Qt.Key_Escape and event.modifiers() == Qt.NoModifier \
+ and self.calltipActive():
+ self.calltipCancel()
+ self.__noshow = True
+ return
+
+ if event.key() in [Qt.Key_ParenLeft, Qt.Key_ParenRight]:
+ self.__noshow = False
+
+ # Proceed processing the keystrike
+ super(Calltip, self).keyPressEvent(event)
diff --git a/iep/codeeditor/highlighter.py b/iep/codeeditor/highlighter.py
new file mode 100644
index 0000000..3ce0654
--- /dev/null
+++ b/iep/codeeditor/highlighter.py
@@ -0,0 +1,134 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module highlighter
+
+Defines the highlighter class for the base code editor class. It will do
+the styling when syntax highlighting is enabled. If it is not, will only
+check out indentation.
+
+"""
+
+import time
+
+from .qt import QtGui, QtCore
+Qt = QtCore.Qt
+
+from . import parsers
+from .misc import ustr
+
+
+class BlockData(QtGui.QTextBlockUserData):
+ """ Class to represent the data for a block.
+ """
+ def __init__(self):
+ QtGui.QTextBlockUserData.__init__(self)
+ self.indentation = None
+ self.fullUnderlineFormat = None
+
+
+# The highlighter should be part of the base class, because
+# some extensions rely on them (e.g. the indent guuides).
+class Highlighter(QtGui.QSyntaxHighlighter):
+
+ def __init__(self,codeEditor,*args):
+ QtGui.QSyntaxHighlighter.__init__(self,*args)
+
+ # Store reference to editor
+ self._codeEditor = codeEditor
+
+
+ def getCurrentBlockUserData(self):
+ """ getCurrentBlockUserData()
+
+ Gets the BlockData object. Creates one if necesary.
+
+ """
+ bd = self.currentBlockUserData()
+ if not isinstance(bd, BlockData):
+ bd = BlockData()
+ self.setCurrentBlockUserData(bd)
+ return bd
+
+
+ def highlightBlock(self, line):
+ """ highlightBlock(line)
+
+ This method is automatically called when a line must be
+ re-highlighted.
+
+ If the code editor has an active parser. This method will use
+ it to perform syntax highlighting. If not, it will only
+ check out the indentation.
+
+ """
+
+ # Make sure this is a Unicode Python string
+ line = ustr(line)
+
+ # Get previous state
+ previousState = self.previousBlockState()
+
+ # Get parser
+ parser = None
+ if hasattr(self._codeEditor, 'parser'):
+ parser = self._codeEditor.parser()
+
+ # Get function to get format
+ nameToFormat = self._codeEditor.getStyleElementFormat
+
+ fullLineFormat = None
+ if parser:
+ self.setCurrentBlockState(0)
+ for token in parser.parseLine(line, previousState):
+ # Handle block state
+ if isinstance(token, parsers.BlockState):
+ self.setCurrentBlockState(token.state)
+ else:
+ # Get format
+ try:
+ styleFormat = nameToFormat(token.name)
+ charFormat = styleFormat.textCharFormat
+ except KeyError:
+ #print(repr(nameToFormat(token.name)))
+ continue
+ # Set format
+ self.setFormat(token.start,token.end-token.start,charFormat)
+ # Is this a cell?
+ if (fullLineFormat is None) and styleFormat._parts.get('underline','') == 'full':
+ fullLineFormat = styleFormat
+
+ # Get user data
+ bd = self.getCurrentBlockUserData()
+
+ # Handle underlines
+ bd.fullUnderlineFormat = fullLineFormat
+
+ # Get the indentation setting of the editors
+ indentUsingSpaces = self._codeEditor.indentUsingSpaces()
+
+ leadingWhitespace=line[:len(line)-len(line.lstrip())]
+ if '\t' in leadingWhitespace and ' ' in leadingWhitespace:
+ #Mixed whitespace
+ bd.indentation = 0
+ format=QtGui.QTextCharFormat()
+ format.setUnderlineStyle(QtGui.QTextCharFormat.SpellCheckUnderline)
+ format.setUnderlineColor(QtCore.Qt.red)
+ format.setToolTip('Mixed tabs and spaces')
+ self.setFormat(0,len(leadingWhitespace),format)
+ elif ('\t' in leadingWhitespace and indentUsingSpaces) or \
+ (' ' in leadingWhitespace and not indentUsingSpaces):
+ #Whitespace differs from document setting
+ bd.indentation = 0
+ format=QtGui.QTextCharFormat()
+ format.setUnderlineStyle(QtGui.QTextCharFormat.SpellCheckUnderline)
+ format.setUnderlineColor(QtCore.Qt.blue)
+ format.setToolTip('Whitespace differs from document setting')
+ self.setFormat(0,len(leadingWhitespace),format)
+ else:
+ # Store info for indentation guides
+ # amount of tabs or spaces
+ bd.indentation = len(leadingWhitespace)
diff --git a/iep/codeeditor/manager.py b/iep/codeeditor/manager.py
new file mode 100644
index 0000000..a36e112
--- /dev/null
+++ b/iep/codeeditor/manager.py
@@ -0,0 +1,292 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# Codeeditor is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module manager
+
+This module contains a static class that can be used for some
+management tasks.
+
+"""
+
+import os, sys
+
+from .qt import QtGui, QtCore
+Qt = QtCore.Qt
+
+from . import parsers
+
+
+class Manager:
+ """ Manager
+
+ Static class to do some management tasks:
+ * It manages the parsers
+ * Getting style element descriptions of all parsers
+ * Linking file extensions to parsers
+ * Font information
+
+ """
+
+ _defaultFontFamily = 'dummy_font_family_name'
+
+ # Static dict of all parsers
+ _parserInstances = {}
+ _fileExtensions = {}
+
+ ## Parsers
+
+# @classmethod
+# def collectParsersDynamically(cls):
+# """ insert the function is this module's namespace.
+# """
+#
+# # Get the path of this subpackage
+# path = __file__
+# path = os.path.dirname( os.path.abspath(path) )
+#
+# # Determine if we're in a zipfile
+# i = path.find('.zip')
+# if i>0:
+# # get list of files from zipfile
+# path = path[:i+4]
+# z = zipfile.ZipFile(path)
+# files = [os.path.split(i)[-1] for i in z.namelist()
+# if 'codeeditor' in i and 'parsers' in i]
+# else:
+# # get list of files from file system
+# files = os.listdir(path)
+#
+# # Extract all parsers
+# parserModules = []
+# for file in files:
+#
+# # Only python files
+# if file.endswith('.pyc'):
+# if file[:-1] in files:
+# continue # Only try import once
+# elif not file.endswith('.py'):
+# continue
+# # Only syntax files
+# if '_parser.' not in file:
+# continue
+#
+# # Import module
+# fullfile = os.path.join(path, file)
+# modname = os.path.splitext(file)[0]
+# print('modname', modname)
+# mod = __import__("codeeditor.parsers."+modname, fromlist=[modname])
+# parserModules.append(mod)
+#
+# print(parserModules)
+
+
+
+ @classmethod
+ def _collectParsers(cls):
+ """ _collectParsers()
+
+ Collect all parser classes. This function is called on startup.
+
+ """
+
+ # Prepare (use a set to prevent duplicates)
+ foundParsers = set()
+ G = parsers.__dict__
+ ModuleClass = os.__class__
+
+ # Collect parser classes
+ for module_name in G:
+ # Check if it is indeed a module, and if it has the right name
+ if not isinstance(G[module_name], ModuleClass):
+ continue
+ if not module_name.endswith('_parser'):
+ continue
+ # Collect all valid classes from the module
+ moduleDict = G[module_name].__dict__
+ for name_in_module in moduleDict:
+ ob = moduleDict[name_in_module]
+ if isinstance(ob, type) and issubclass(ob, parsers.Parser):
+ foundParsers.add(ob)
+
+ # Put in list with the parser names as keys
+ parserInstances = {}
+ for parserClass in foundParsers:
+ name = parserClass.__name__
+ if name.endswith('Parser') and len(name)>6:
+
+ # Get parser identifier name
+ name = name[:-6].lower()
+
+ # Try instantiating the parser
+ try:
+ parserInstances[name] = parserInstance = parserClass()
+ except Exception:
+ # We cannot get the exception object in a Python2/Python3
+ # compatible way
+ print('Could not instantiate parser "%s".'%name)
+ continue
+
+ # Register extensions for this parser
+ for ext in parserInstance.filenameExtensions():
+ cls._fileExtensions[ext] = name
+
+ # Store
+ cls._parserInstances = parserInstances
+
+
+ @classmethod
+ def getParserNames(cls):
+ """ getParserNames()
+
+ Get a list of all available parsers.
+
+ """
+ return list(cls._parserInstances.keys())
+
+
+ @classmethod
+ def getParserByName(cls, parserName):
+ """ getParserByName(parserName)
+
+ Get the parser object corresponding to the given name.
+ If no parser is known by the given name, a warning message
+ is printed and None is returned.
+
+ """
+ if not parserName:
+ return parsers.Parser() #Default dummy parser
+
+ # Case insensitive
+ parserName = parserName.lower()
+
+ # Return instantiated parser object.
+ if parserName in cls._parserInstances:
+ return cls._parserInstances[parserName]
+ else:
+ print('Warning: no parser known by the name "%s".'%parserName)
+ print('I know these: ', cls._parserInstances.keys())
+ return parsers.Parser() #Default dummy parser
+
+
+ @classmethod
+ def getStyleElementDescriptionsForAllParsers(cls):
+ """ getStyleElementDescriptionsForAllParsers()
+
+ Get all style element descriptions corresponding to
+ the tokens of all parsers.
+
+ This function is used by the code editor to register all syntax
+ element styles to the code editor class.
+
+ """
+ descriptions = {}
+ for parser in cls._parserInstances.values():
+ for token in parser.getUsedTokens():
+ description = token.description
+ descriptions[description.key] = description
+
+ return list(descriptions.values())
+
+
+ ## File extensions
+
+
+ @classmethod
+ def suggestParserfromFilenameExtension(cls, ext):
+ """ suggestParserfromFilenameExtension(ext)
+
+ Given a filename extension, rerurns the name of the suggested
+ parser corresponding to the language of the file.
+
+ See also registerFilenameExtension()
+ """
+
+ # Normalize ext
+ ext = '.' + ext.lstrip('.').lower()
+
+ # Get parser
+ if ext in cls._fileExtensions:
+ return cls._fileExtensions[ext]
+ else:
+ return ''
+
+
+ @classmethod
+ def registerFilenameExtension(cls, ext, parser):
+ """ registerFilenameExtension(ext, parser)
+
+ Registers the given filename extension to the given parser.
+ The parser can be a Parser instance or its name.
+
+ This function can be used to register extensions to parsers
+ that are not registered by default.
+
+ """
+ # Normalize ext
+ ext = '.' + ext.lstrip('.').lower()
+ # Check parser
+ if isinstance(parser, parsers.Parser):
+ parser = parser.name()
+ # Register
+ cls._fileExtensions[ext] = parser
+
+
+ ## Fonts
+
+
+ @classmethod
+ def fontNames(cls):
+ """ fontNames()
+
+ Get a list of all monospace fonts available on this system.
+
+ """
+ db = QtGui.QFontDatabase()
+ QFont, QFontInfo = QtGui.QFont, QtGui.QFontInfo
+ # fn = font_name (str)
+ return [fn for fn in db.families() if QFontInfo(QFont(fn)).fixedPitch()]
+
+
+ @classmethod
+ def setDefaultFontFamily(cls, name):
+ """ setDefaultFontFamily(name)
+
+ Set the default (monospace) font family name for this system.
+ This should be set only once during startup.
+
+ """
+ cls._defaultFontFamily = name
+
+
+ @classmethod
+ def defaultFont(cls):
+ """ defaultFont()
+
+ Get the default (monospace) font for this system. Returns a QFont
+ object.
+
+ """
+
+ # Get font size that makes sense for this system
+ f = QtGui.QFont()
+ size = f.pointSize()
+
+ # Get font family
+ f = QtGui.QFont(cls._defaultFontFamily)
+ f.setStyleHint(f.TypeWriter, f.PreferDefault)
+ fi = QtGui.QFontInfo(f)
+ family = fi.family()
+
+ # Done
+ return QtGui.QFont(family, size)
+
+
+# Init
+try:
+ Manager._collectParsers()
+except Exception as why:
+ print('Error collecting parsers')
+ print(why)
diff --git a/iep/codeeditor/misc.py b/iep/codeeditor/misc.py
new file mode 100644
index 0000000..aac7517
--- /dev/null
+++ b/iep/codeeditor/misc.py
@@ -0,0 +1,101 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module misc
+
+Defined ustr (Unicode string) class and the option property decorator.
+
+"""
+
+import sys
+from .qt import QtGui, QtCore
+
+
+# Set Python version and get some names
+PYTHON_VERSION = sys.version_info[0]
+if PYTHON_VERSION < 3:
+ ustr = unicode
+ bstr = str
+ from Queue import Queue, Empty
+else:
+ ustr = str
+ bstr = bytes
+ from queue import Queue, Empty
+
+
+
+DEFAULT_OPTION_NAME = '_ce_default_value'
+DEFAULT_OPTION_NONE = '_+_just some absurd value_+_'
+
+def ce_option(arg1):
+ """ Decorator for properties of the code editor.
+
+ It should be used on the setter function, with its default value
+ as an argument. The default value is then stored on the function
+ object.
+
+ At the end of the initialization, the base codeeditor class will
+ check all members and (by using the default-value-attribute as a
+ flag) select the ones that are options. These are then set to
+ their default values.
+
+ Similarly this information is used by the setOptions method to
+ know which members are "options".
+
+ """
+
+ # If the decorator is used without arguments, arg1 is the function
+ # being decorated. If arguments are used, arg1 is the argument, and
+ # we should return a callable that is then used as a decorator.
+
+ # Create decorator function.
+ def decorator_fun(f):
+ f.__dict__[DEFAULT_OPTION_NAME] = default
+ return f
+
+ # Handle
+ default = DEFAULT_OPTION_NONE
+ if hasattr(arg1, '__call__'):
+ return decorator_fun(arg1)
+ else:
+ default = arg1
+ return decorator_fun
+
+
+class _CallbackEventHandler(QtCore.QObject):
+ """ Helper class to provide the callLater function.
+ """
+
+ def __init__(self):
+ QtCore.QObject.__init__(self)
+ self.queue = Queue()
+
+ def customEvent(self, event):
+ while True:
+ try:
+ callback, args = self.queue.get_nowait()
+ except Empty:
+ break
+ try:
+ callback(*args)
+ except Exception as why:
+ print('callback failed: {}:\n{}'.format(callback, why))
+
+ def postEventWithCallback(self, callback, *args):
+ self.queue.put((callback, args))
+ QtGui.qApp.postEvent(self, QtCore.QEvent(QtCore.QEvent.User))
+
+
+def callLater(callback, *args):
+ """ callLater(callback, *args)
+
+ Post a callback to be called in the main thread.
+
+ """
+ _callbackEventHandler.postEventWithCallback(callback, *args)
+
+# Create callback event handler instance and insert function in IEP namespace
+_callbackEventHandler = _CallbackEventHandler()
diff --git a/iep/codeeditor/parsers/__init__.py b/iep/codeeditor/parsers/__init__.py
new file mode 100644
index 0000000..572815b
--- /dev/null
+++ b/iep/codeeditor/parsers/__init__.py
@@ -0,0 +1,205 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# Codeeditor is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Subpackage parsers
+
+This subpackage contains all the syntax parsers for the
+different languages.
+
+"""
+
+
+""" CREATING PARSERS
+
+Making a parser requires these things:
+ * Place a module in the parsers directory, which has a name
+ ending in "_parser.py"
+ * In the module implement one or more classes that inherit
+ from ..parsers.Parser (or a derived class), and
+ implement the parseLine method.
+ * The module should import all the tokens in whiches to use
+ from ..parsers.tokens. New tokens can also be
+ defined by subclassing one of the token classes.
+ * In codeeditor/parsers/__init__.py, add the new module to the
+ list of imported parsers.
+
+"""
+
+# Normal imports
+import os, sys
+#import zipfile
+from . import tokens
+
+if sys.version_info[0] >= 3:
+ text_type = str
+else:
+ text_type = unicode
+
+
+class BlockState(object):
+ """ BlockState(state=0, info=None)
+
+ The blockstate object should be used by parsers to
+ return the block state of the processed line.
+
+ This would typically be the last item to be yielded, but this
+ it may also be yielded befor the last yielded token. One can even
+ yield multiple of these items, in which case the last one considered
+ valid.
+
+ """
+ isToken = False
+ def __init__(self, state=0, info=None):
+ self._state = int(state)
+ self._info = info
+
+ @property
+ def state(self):
+ """ The integer value representing the block state.
+ """
+ return self._state
+
+ @property
+ def info(self):
+ """ Get the information corresponding to the block.
+ """
+ return self._info
+
+
+# Base parser class (needs to be defined before importing parser modules)
+class Parser(object):
+ """ Base parser class.
+ All parsers should inherit from this class.
+ This base class generates a 'TextToken' for each line
+ """
+ _extensions = []
+ _keywords = []
+
+
+ def parseLine(self, line, previousState=0):
+ """ parseLine(line, previousState=0)
+
+ The method that should be implemented by the parser. The
+ previousState argument can be used to determine how
+ the previous block ended (e.g. for multiline comments). It
+ is an integer, the meaning of which is only known to the
+ specific parser.
+
+ This method should yield token instances. The last token can
+ be a BlockState to specify the previousState for the
+ next block.
+
+ """
+
+ yield tokens.TextToken(line,0,len(line))
+
+ def name(self):
+ """ name()
+
+ Get the name of the parser.
+
+ """
+ name = self.__class__.__name__.lower()
+ if name.endswith('parser'):
+ name = name[:-6]
+ return name
+
+
+ def __repr__(self):
+ """ String representation of the parser.
+ """
+ return '<Parser for "%s">' % self.name()
+
+
+ def keywords(self):
+ """ keywords()
+
+ Get a list of keywords valid for this parser.
+
+ """
+ return [k for k in self._keywords]
+
+
+ def filenameExtensions(self):
+ """ filenameExtensions()
+
+ Get a list of filename extensions for which this parser
+ is appropriate.
+
+ """
+ return ['.'+e.lstrip('.').lower() for e in self._extensions]
+
+
+ def getStyleElementDescriptions(cls):
+ """ getStyleElementDescriptions()
+
+ This method returns a list of the StyleElementDescription
+ instances used by this parser.
+
+ """
+ descriptions = {}
+ for token in self.getUsedTokens():
+ descriptions[token.description.key] = token.description
+
+ return list(descriptions.values())
+
+
+ def getUsedTokens(self):
+ """ getUsedTokens()
+
+ Get a a list of token instances used by this parser.
+
+ """
+
+ # Get module object of the parser
+ try:
+ mod = sys.modules[self.__module__]
+ except KeyError:
+ return []
+
+ # Get token classes from module
+ tokenClasses = []
+ for name in mod.__dict__:
+ member = mod.__dict__[name]
+ if isinstance(member, type) and \
+ issubclass(member, tokens.Token):
+ if member is not tokens.Token:
+ tokenClasses.append(member)
+
+ # Return as instances
+ return [t() for t in tokenClasses]
+
+
+ def _isTodoItem(self, text):
+ """ _isTodoItem(text)
+
+ Get whether the given text (which should be a comment) represents
+ a todo item. Todo items start with "todo", "2do" or "fixme",
+ optionally with a colon at the end.
+
+ """
+ # Get first word
+ word = text.lstrip().split(' ',1)[0].rstrip(':')
+ # Test
+ if word.lower() in ['todo', '2do', 'fixme']:
+ return True
+ else:
+ return False
+
+
+## Import parsers statically
+# We could load the parser dynamically from the source files in the
+# directory, but this takes quite some effort to get righ when apps
+# are frozen. This is doable (I do it in Visvis) but it requires the
+# user to specify the parser modules by hand when freezing an app.
+#
+# In summary: it takes a lot of trouble, which can be avoided by just
+# listing all parsers here.
+from . import ( python_parser,
+ cython_parser,
+ c_parser,
+ )
+
diff --git a/iep/codeeditor/parsers/c_parser.py b/iep/codeeditor/parsers/c_parser.py
new file mode 100644
index 0000000..6a0fcef
--- /dev/null
+++ b/iep/codeeditor/parsers/c_parser.py
@@ -0,0 +1,212 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import re
+from . import tokens, Parser, BlockState, text_type
+from .tokens import ALPHANUM
+
+from .tokens import (Token, CommentToken, StringToken,
+ UnterminatedStringToken, IdentifierToken, NonIdentifierToken, KeywordToken,
+ NumberToken)
+
+# todo: compiler directives (or how do you call these things starting with #)
+
+class MultilineCommentToken(CommentToken):
+ """ Characters representing a multi-line comment. """
+ defaultStyle = 'fore:#007F00'
+
+class CharToken(Token):
+ """ Single-quoted char """
+ defaultStyle = 'fore:#7F007F'
+
+
+# This regexp is used to find special stuff, such as comments, numbers and
+# strings.
+tokenProg = re.compile(
+ '([' + ALPHANUM + '_]+)|' + # Identifiers/numbers (group 1) or
+ '(\/\/)|' + # Single line comment (group 2)
+ '(\/\*)|' + # Comment (group 3) or
+ '(\'\\\\?.\')|' + # char (group 4)
+ '(\")' # string (group 5)
+ )
+
+
+#For a string, get the RegExp
+#program that matches the end. (^|[^\\]) means: start of the line
+#or something that is not \ (since \ is supposed to escape the following
+#quote) (\\\\)* means: any number of two slashes \\ since each slash will
+#escape the next one
+stringEndProg = re.compile(r'(^|[^\\])(\\\\)*"')
+commentEndProg = re.compile(r'\*/')
+
+class CParser(Parser):
+ """ A C parser.
+ """
+ _extensions = ['.c', '.h', '.cpp', 'cxx', 'hxx']
+ _keywords = ['int', 'const', 'char', 'void', 'short', 'long', 'case']
+
+ def parseLine(self, line, previousState=0):
+ """ parseLine(line, previousState=0)
+
+ Parses a line of C code, yielding tokens.
+
+ """
+ line = text_type(line)
+
+ pos = 0 # Position following the previous match
+
+ # identifierState and previousstate values:
+ # 0: nothing special
+ # 1: string
+ # 2: multiline comment /* */
+
+ # First determine whether we should look for the end of a string,
+ # or if we should process a token.
+ if previousState == 1:
+ token = StringToken(line, 0, 0)
+ tokens = self._findEndOfString(line, token)
+ # Process tokens
+ for token in tokens:
+ yield token
+ if isinstance(token, BlockState):
+ return
+ pos = token.end
+ elif previousState == 2:
+ token = MultilineCommentToken(line, 0, 0)
+ tokens = self._findEndOfComment(line, token)
+ # Process tokens
+ for token in tokens:
+ yield token
+ if isinstance(token, BlockState):
+ return
+ pos = token.end
+
+ # Enter the main loop that iterates over the tokens and skips strings
+ while True:
+
+ # Get next tokens
+ tokens = self._findNextToken(line, pos)
+ if not tokens:
+ return
+ elif isinstance(tokens[-1], StringToken):
+ moreTokens = self._findEndOfString(line, tokens[-1])
+ tokens = tokens[:-1] + moreTokens
+ elif isinstance(tokens[-1], MultilineCommentToken):
+ moreTokens = self._findEndOfComment(line, tokens[-1])
+ tokens = tokens[:-1] + moreTokens
+
+ # Process tokens
+ for token in tokens:
+ yield token
+ if isinstance(token, BlockState):
+ return
+ pos = token.end
+
+
+ def _findEndOfComment(self, line, token):
+ """ Find the matching comment end in the rest of the line
+ """
+
+ # Do not use the start parameter of search, since ^ does not work then
+
+ endMatch = commentEndProg.search(line, token.end)
+
+ if endMatch:
+ # The comment does end on this line
+ token.end = endMatch.end()
+ return [token]
+ else:
+ # The comment does not end on this line
+ token.end = len(line)
+ return [token, BlockState(2)]
+
+
+ def _findEndOfString(self, line, token):
+ """ Find the matching string end in the rest of the line
+ """
+
+ # todo: distinguish between single and double quote strings
+
+ # Find the matching end in the rest of the line
+ # Do not use the start parameter of search, since ^ does not work then
+ endMatch = stringEndProg.search(line[token.end:])
+
+ if endMatch:
+ # The string does end on this line
+ token.end = token.end + endMatch.end()
+ return [token]
+ else:
+ # The string does not end on this line
+ if line.strip().endswith("\\"): #Multi line string
+ token = StringToken(line, token.start, len(line))
+ return [token, BlockState(1)]
+ else:
+ return [UnterminatedStringToken(line, token.start, len(line))]
+
+
+
+ def _findNextToken(self, line, pos):
+ """ _findNextToken(line, pos):
+
+ Returns a token or None if no new tokens can be found.
+
+ """
+
+ # Init tokens, if positing too large, stop now
+ if pos > len(line):
+ return None
+ tokens = []
+
+ # Find the start of the next string or comment
+ match = tokenProg.search(line, pos)
+
+ # Process the Non-Identifier between pos and match.start()
+ # or end of line
+ nonIdentifierEnd = match.start() if match else len(line)
+
+ # Return the Non-Identifier token if non-null
+ token = NonIdentifierToken(line,pos,nonIdentifierEnd)
+ if token:
+ tokens.append(token)
+
+ # If no match, we are done processing the line
+ if not match:
+ return tokens
+
+ # The rest is to establish what identifier we are dealing with
+
+ # Identifier ("a word or number") Find out whether it is a key word
+ if match.group(1) is not None:
+ identifier = match.group(1)
+ tokenArgs = line, match.start(), match.end()
+
+ if identifier in self._keywords:
+ tokens.append( KeywordToken(*tokenArgs) )
+ elif identifier[0] in '0123456789':
+ identifierState = 0
+ tokens.append( NumberToken(*tokenArgs) )
+ else:
+ tokens.append( IdentifierToken(*tokenArgs) )
+
+ # Single line comment
+ elif match.group(2) is not None:
+ tokens.append( CommentToken(line,match.start(),len(line)) )
+ elif match.group(3) is not None:
+ tokens.append( MultilineCommentToken(line,match.start(),match.end()) )
+ elif match.group(4) is not None: # Char
+ tokens.append( CharToken(line,match.start(),match.end()) )
+ else:
+ # We have matched a string-start
+ tokens.append( StringToken(line,match.start(),match.end()) )
+
+ # Done
+ return tokens
+
+
+if __name__=='__main__':
+ parser = CParser()
+ for token in parser.parseLine('void test(int i=2) /* test '):
+ print ("%s %s" % (token.name, token))
diff --git a/iep/codeeditor/parsers/cython_parser.py b/iep/codeeditor/parsers/cython_parser.py
new file mode 100644
index 0000000..56ec6f7
--- /dev/null
+++ b/iep/codeeditor/parsers/cython_parser.py
@@ -0,0 +1,74 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import re
+from . import tokens, Parser, BlockState
+from .tokens import ALPHANUM
+
+
+# Import tokens in module namespace
+from .tokens import (CommentToken, StringToken,
+ UnterminatedStringToken, IdentifierToken, NonIdentifierToken,
+ KeywordToken, NumberToken, FunctionNameToken, ClassNameToken,
+ TodoCommentToken)
+
+from .python_parser import ( PythonParser,
+ MultilineStringToken,
+ CellCommentToken,
+ pythonKeywords)
+
+# Set keywords
+cythonExtraKeywords = set(['cdef', 'cpdef', 'ctypedef', 'cimport',
+ 'float', 'double', 'int', 'long'])
+
+
+class CythonParser(PythonParser):
+ """ Parser for Cython/Pyrex.
+ """
+ _extensions = ['pyi', '.pyx' , '.pxd']
+
+ _keywords = pythonKeywords | cythonExtraKeywords
+
+
+ def _identifierState(self, identifier=None):
+ """ Given an identifier returs the identifier state:
+ 3 means the current identifier can be a function.
+ 4 means the current identifier can be a class.
+ 0 otherwise.
+
+ This method enables storing the state during the line,
+ and helps the Cython parser to reuse the Python parser's code.
+
+ This implementation keeps a counter. If the counter is 0, the
+ state is zero.
+ """
+ if identifier is None:
+ # Explicit get and reset
+ state = 0
+ try:
+ if self._idsCounter>0:
+ state = self._idsState
+ except Exception:
+ pass
+ self._idsState = 0
+ self._idsCounter = 0
+ return state
+ elif identifier in ['def', 'cdef', 'cpdef']:
+ # Set function state
+ self._idsState = 3
+ self._idsCounter = 2
+ return 3
+ elif identifier == 'class':
+ # Set class state
+ self._idsState = 4
+ self._idsCounter = 1
+ return 4
+ elif self._idsCounter>0:
+ self._idsCounter -= 1
+ return self._idsState
+ else:
+ # This one can be func or class, next one can't
+ return 0
diff --git a/iep/codeeditor/parsers/python_parser.py b/iep/codeeditor/parsers/python_parser.py
new file mode 100644
index 0000000..a20008b
--- /dev/null
+++ b/iep/codeeditor/parsers/python_parser.py
@@ -0,0 +1,347 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import re
+from . import tokens, Parser, BlockState, text_type
+from .tokens import ALPHANUM
+from ..misc import ustr, bstr
+
+# Import tokens in module namespace
+from .tokens import (CommentToken, StringToken,
+ UnterminatedStringToken, IdentifierToken, NonIdentifierToken,
+ KeywordToken, NumberToken, FunctionNameToken, ClassNameToken,
+ TodoCommentToken)
+
+# Keywords sets
+
+# Source: import keyword; keyword.kwlist (Python 2.6.6)
+python2Keywords = set(['and', 'as', 'assert', 'break', 'class', 'continue',
+ 'def', 'del', 'elif', 'else', 'except', 'exec', 'finally', 'for',
+ 'from', 'global', 'if', 'import', 'in', 'is', 'lambda', 'not', 'or',
+ 'pass', 'print', 'raise', 'return', 'try', 'while', 'with', 'yield'])
+
+# Source: import keyword; keyword.kwlist (Python 3.1.2)
+python3Keywords = set(['False', 'None', 'True', 'and', 'as', 'assert', 'break',
+ 'class', 'continue', 'def', 'del', 'elif', 'else', 'except', 'finally',
+ 'for', 'from', 'global', 'if', 'import', 'in', 'is', 'lambda',
+ 'nonlocal', 'not', 'or', 'pass', 'raise', 'return', 'try', 'while',
+ 'with', 'yield'])
+
+# Merge the two sets to get a general Python keyword list
+pythonKeywords = python2Keywords | python3Keywords
+
+
+
+class MultilineStringToken(StringToken):
+ """ Characters representing a multi-line string. """
+ defaultStyle = 'fore:#7F0000'
+
+class CellCommentToken(CommentToken):
+ """ Characters representing a cell separator comment: "##". """
+ defaultStyle = 'bold:yes, underline:yes'
+
+
+
+# This regexp is used to find special stuff, such as comments, numbers and
+# strings.
+tokenProg = re.compile(
+ '#|' + # Comment or
+ '([' + ALPHANUM + '_]+)|' + # Identifiers/numbers (group 1) or
+ '(' + # Begin of string group (group 2)
+ '([bB]|[uU])?' + # Possibly bytes or unicode (py2.x)
+ '[rR]?' + # Possibly a raw string
+ '("""|\'\'\'|"|\')' + # String start (triple qoutes first, group 4)
+ ')' # End of string group
+ )
+
+
+#For a given type of string ( ', " , ''' , """ ),get the RegExp
+#program that matches the end. (^|[^\\]) means: start of the line
+#or something that is not \ (since \ is supposed to escape the following
+#quote) (\\\\)* means: any number of two slashes \\ since each slash will
+#escape the next one
+endProgs = {
+ "'": re.compile(r"(^|[^\\])(\\\\)*'"),
+ '"': re.compile(r'(^|[^\\])(\\\\)*"'),
+ "'''": re.compile(r"(^|[^\\])(\\\\)*'''"),
+ '"""': re.compile(r'(^|[^\\])(\\\\)*"""')
+ }
+
+
+class PythonParser(Parser):
+ """ Parser for Python in general (2.x or 3.x).
+ """
+ _extensions = ['.py' , '.pyw']
+ #The list of keywords is overridden by the Python2/3 specific parsers
+ _keywords = pythonKeywords
+
+
+ def _identifierState(self, identifier=None):
+ """ Given an identifier returs the identifier state:
+ 3 means the current identifier can be a function.
+ 4 means the current identifier can be a class.
+ 0 otherwise.
+
+ This method enables storing the state during the line,
+ and helps the Cython parser to reuse the Python parser's code.
+ """
+ if identifier is None:
+ # Explicit get/reset
+ try:
+ state = self._idsState
+ except Exception:
+ state = 0
+ self._idsState = 0
+ return state
+ elif identifier == 'def':
+ # Set function state
+ self._idsState = 3
+ return 3
+ elif identifier == 'class':
+ # Set class state
+ self._idsState = 4
+ return 4
+ else:
+ # This one can be func or class, next one can't
+ state = self._idsState
+ self._idsState = 0
+ return state
+
+
+ def parseLine(self, line, previousState=0):
+ """ parseLine(line, previousState=0)
+
+ Parse a line of Python code, yielding tokens.
+ previousstate is the state of the previous block, and is used
+ to handle line continuation and multiline strings.
+
+ """
+ line = text_type(line)
+
+ # Init
+ pos = 0 # Position following the previous match
+
+ # identifierState and previousstate values:
+ # 0: nothing special
+ # 1: multiline comment single qoutes
+ # 2: multiline comment double quotes
+ # 3: a def keyword
+ # 4: a class keyword
+
+ #Handle line continuation after def or class
+ #identifierState is 3 or 4 if the previous identifier was 3 or 4
+ if previousState == 3 or previousState == 4:
+ self._identifierState({3:'def',4:'class'}[previousState])
+ else:
+ self._identifierState(None)
+
+ if previousState in [1,2]:
+ token = MultilineStringToken(line, 0, 0)
+ token._style = ['', "'''", '"""'][previousState]
+ tokens = self._findEndOfString(line, token)
+ # Process tokens
+ for token in tokens:
+ yield token
+ if isinstance(token, BlockState):
+ return
+ pos = token.end
+
+
+ # Enter the main loop that iterates over the tokens and skips strings
+ while True:
+
+ # Get next tokens
+ tokens = self._findNextToken(line, pos)
+ if not tokens:
+ return
+ elif isinstance(tokens[-1], StringToken):
+ moreTokens = self._findEndOfString(line, tokens[-1])
+ tokens = tokens[:-1] + moreTokens
+
+ # Process tokens
+ for token in tokens:
+ yield token
+ if isinstance(token, BlockState):
+ return
+ pos = token.end
+
+
+ def _findEndOfString(self, line, token):
+ """ _findEndOfString(line, token)
+
+ Find the end of a string. Returns (token, endToken). The first
+ is the given token or a replacement (UnterminatedStringToken).
+ The latter is None, or the BlockState. If given, the line is
+ finished.
+
+ """
+
+ # Set state
+ self._identifierState(None)
+
+ # Find the matching end in the rest of the line
+ # Do not use the start parameter of search, since ^ does not work then
+ style = token._style
+ endMatch = endProgs[style].search(line[token.end:])
+
+ if endMatch:
+ # The string does end on this line
+ tokenArgs = line, token.start, token.end + endMatch.end()
+ if style in ['"""', "'''"]:
+ token = MultilineStringToken(*tokenArgs)
+ else:
+ token.end = token.end + endMatch.end()
+ return [token]
+ else:
+ # The string does not end on this line
+ tokenArgs = line, token.start, token.end + len(line)
+ if style == "'''":
+ return [MultilineStringToken(*tokenArgs), BlockState(1)]
+ elif style == '"""':
+ return [MultilineStringToken(*tokenArgs), BlockState(2)]
+ else:
+ return [UnterminatedStringToken(*tokenArgs)]
+
+
+ def _findNextToken(self, line, pos):
+ """ _findNextToken(line, pos):
+
+ Returns a token or None if no new tokens can be found.
+
+ """
+
+ # Init tokens, if pos too large, were done
+ if pos > len(line):
+ return None
+ tokens = []
+
+ # Find the start of the next string or comment
+ match = tokenProg.search(line, pos)
+
+ # Process the Non-Identifier between pos and match.start()
+ # or end of line
+ nonIdentifierEnd = match.start() if match else len(line)
+
+ # Return the Non-Identifier token if non-null
+ # todo: here it goes wrong (allow returning more than one token?)
+ token = NonIdentifierToken(line,pos,nonIdentifierEnd)
+ strippedNonIdentifier = ustr(token).strip()
+ if token:
+ tokens.append(token)
+
+ # Do checks for line continuation and identifierState
+ # Is the last non-whitespace a line-continuation character?
+ if strippedNonIdentifier.endswith('\\'):
+ lineContinuation = True
+ # If there are non-whitespace characters after def or class,
+ # cancel the identifierState
+ if strippedNonIdentifier != '\\':
+ self._identifierState(None)
+ else:
+ lineContinuation = False
+ # If there are non-whitespace characters after def or class,
+ # cancel the identifierState
+ if strippedNonIdentifier != '':
+ self._identifierState(None)
+
+ # If no match, we are done processing the line
+ if not match:
+ if lineContinuation:
+ tokens.append( BlockState(self._identifierState()) )
+ return tokens
+
+ # The rest is to establish what identifier we are dealing with
+
+ # Comment
+ if match.group() == '#':
+ matchStart = match.start()
+ if ( line[matchStart:].startswith('##') and
+ not line[:matchStart].strip() ):
+ tokens.append( CellCommentToken(line,matchStart,len(line)) )
+ elif self._isTodoItem(line[matchStart+1:]):
+ tokens.append( TodoCommentToken(line,matchStart,len(line)) )
+ else:
+ tokens.append( CommentToken(line,matchStart,len(line)) )
+ if lineContinuation:
+ tokens.append( BlockState(self._identifierState()) )
+ return tokens
+
+ # If there are non-whitespace characters after def or class,
+ # cancel the identifierState (this time, also if there is just a \
+ # since apparently it was not on the end of a line)
+ if strippedNonIdentifier != '':
+ self._identifierState(None)
+
+ # Identifier ("a word or number") Find out whether it is a key word
+ if match.group(1) is not None:
+ identifier = match.group(1)
+ tokenArgs = line, match.start(), match.end()
+
+ # Set identifier state
+ identifierState = self._identifierState(identifier)
+
+ if identifier in self._keywords:
+ tokens.append( KeywordToken(*tokenArgs) )
+ elif identifier[0] in '0123456789':
+ self._identifierState(None)
+ tokens.append( NumberToken(*tokenArgs) )
+ else:
+ if (identifierState==3 and
+ line[match.end():].lstrip().startswith('(') ):
+ tokens.append( FunctionNameToken(*tokenArgs) )
+ elif identifierState==4:
+ tokens.append( ClassNameToken(*tokenArgs) )
+ else:
+ tokens.append( IdentifierToken(*tokenArgs) )
+
+ else:
+ # We have matched a string-start
+ # Find the string style ( ' or " or ''' or """)
+ token = StringToken(line, match.start(), match.end())
+ token._style = match.group(4) # The style is in match group 4
+ tokens.append( token )
+
+ # Done
+ return tokens
+
+
+class Python2Parser(PythonParser):
+ """ Parser for Python 2.x code.
+ """
+ # The application should choose whether to set the Py 2 specific parser
+ _extensions = []
+ _keywords = python2Keywords
+
+class Python3Parser(PythonParser):
+ """ Parser for Python 3.x code.
+ """
+ # The application should choose whether to set the Py 3 specific parser
+ _extensions = []
+ _keywords = python3Keywords
+
+
+if __name__=='__main__':
+ print(list(tokenizeLine('this is "String" #Comment')))
+ print(list(tokenizeLine('this is "String\' #Comment')))
+ print(list(tokenizeLine('this is "String\' #Commen"t')))
+ print(list(tokenizeLine(r'this "test\""')))
+
+ import random
+ stimulus=''
+ expect=[]
+ for i in range(10):
+ #Create a string with lots of ' and "
+ s=''.join("'\"\\ab#"[random.randint(0,5)] for i in range(10) )
+ stimulus+=repr(s)
+ expect.append('S:'+repr(s))
+ stimulus+='test'
+ expect.append('I:test')
+ result=list(tokenizeLine(stimulus))
+ print (stimulus)
+ print (expect)
+ print (result)
+
+ assert repr(result) == repr(expect)
diff --git a/iep/codeeditor/parsers/tokens.py b/iep/codeeditor/parsers/tokens.py
new file mode 100644
index 0000000..3f2f772
--- /dev/null
+++ b/iep/codeeditor/parsers/tokens.py
@@ -0,0 +1,145 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module tokens
+
+Defines the base Token class and a few generic tokens.
+Tokens are used by parsers to identify for groups of characters
+what they represent. This is in turn used by the highlighter
+to determine how these characters should be styled.
+
+"""
+
+# Many parsers need this
+ALPHANUM = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789'
+
+
+from ..style import StyleFormat, StyleElementDescription
+from ..misc import ustr, bstr
+
+
+class Token(object):
+ """ Token(line, start, end)
+
+ Base token class.
+
+ A token is a group of characters representing "something".
+ What is represented, is specified by the subclass.
+
+ Each token class should have a docstring describing the meaning
+ of the characters it is applied to.
+
+ """
+ defaultStyle = 'fore:#000, bold:no, underline:no, italic:no'
+ isToken = True # For the BlockState object, which is also returned by the parsers, this is False
+ def __init__(self, line='', start=0, end=0):
+ self.line = ustr(line)
+ self.start = start
+ self.end = end
+ self._name = self._getName()
+
+ def __str__(self): # on 2.x we use __unicode__
+ return self.line[self.start:self.end]
+
+ def __unicode__(self): # for py 2.x
+ return self.line[self.start:self.end]
+
+ def __repr__(self):
+ return repr('%s:%s' % (self.name, self))
+
+ def __len__(self):
+ # Defining a length also gives a Token a boolean value: True if there
+ # are any characters (len!=0) and False if there are none
+ return self.end - self.start
+
+ def _getName(self):
+ """ Get the name of this token. """
+ nameParts = ['Syntax']
+ if '_parser' in self.__module__:
+ language = self.__module__.split('_')[0]
+ language = language.split('.')[-1]
+ nameParts.append( language[0].upper() + language[1:] )
+ nameParts.append( self.__class__.__name__[:-5].lower() )
+ return '.'.join(nameParts)
+
+ def getDefaultStyleFormat(self):
+ elements = []
+ def collect(cls):
+ if hasattr(cls, 'defaultStyle'):
+ elements.append(cls.defaultStyle)
+ for c in cls.__bases__:
+ collect(c)
+ collect(self.__class__)
+ se = StyleFormat()
+ for e in reversed(elements):
+ se.update(e)
+ return se
+
+ @property
+ def name(self):
+ """ The name of this token. Used to identify it and attach a style.
+ """
+ return self._name
+
+ @property
+ def description(self):
+ """ description()
+
+ Returns a StyleElementDescription instance that describes the
+ style element that this token represents.
+
+ """
+ format = self.getDefaultStyleFormat()
+ des = 'syntax: ' + self.__doc__
+ return StyleElementDescription(self.name, des, str(format))
+
+
+class CommentToken(Token):
+ """ Characters representing a comment in the code. """
+ defaultStyle = 'fore:#007F00'
+
+class TodoCommentToken(CommentToken):
+ """ Characters representing a comment in the code. """
+ defaultStyle = 'fore:#E00,italic'
+
+class StringToken(Token):
+ """ Characters representing a textual string in the code. """
+ defaultStyle = 'fore:#7F007F'
+
+class UnterminatedStringToken(StringToken):
+ """ Characters belonging to an unterminated string. """
+ defaultStyle = 'underline:dotted'
+
+# todo: request from user: whitespace token
+
+class TextToken(Token):
+ """ Anything that is not a string or comment. """
+ defaultStyle = 'fore:#000'
+
+class IdentifierToken(TextToken):
+ """ Characters representing normal text (i.e. words). """
+ defaultStyle = ''
+
+class NonIdentifierToken(TextToken):
+ """ Not a word (operators, whitespace, etc.). """
+ defaultStyle = ''
+
+class KeywordToken(IdentifierToken):
+ """ A keyword is a word with a special meaning to the language. """
+ defaultStyle = 'fore:#00007F, bold:yes'
+
+class NumberToken(IdentifierToken):
+ """ Characters represening a number. """
+ defaultStyle = 'fore:#007F7F'
+
+class FunctionNameToken(IdentifierToken):
+ """ Characters represening the name of a function. """
+ defaultStyle = 'fore:#007F7F, bold:yes'
+
+class ClassNameToken(IdentifierToken):
+ """ Characters represening the name of a class. """
+ defaultStyle = 'fore:#0000FF, bold:yes'
+
diff --git a/iep/codeeditor/qt.py b/iep/codeeditor/qt.py
new file mode 100644
index 0000000..91e3347
--- /dev/null
+++ b/iep/codeeditor/qt.py
@@ -0,0 +1,19 @@
+import sys
+# Simple module to allow using both PySide and PyQt4
+
+try:
+ # This is a proper proxy
+ from pyzolib.qt import QtCore, QtGui
+except ImportError:
+ try:
+ #if sys.platform == 'darwin':
+ # raise ImportError # PySide causes crashes on Mac OS X
+
+ from PySide import QtCore, QtGui
+ except ImportError:
+ try:
+ from PyQt4 import QtCore, QtGui
+ QtCore.Signal = QtCore.pyqtSignal # Define signal as pyqtSignal
+ except ImportError:
+ raise ImportError("Both PySide and PyQt4 could not be imported.")
+
diff --git a/iep/codeeditor/style.py b/iep/codeeditor/style.py
new file mode 100644
index 0000000..61942b9
--- /dev/null
+++ b/iep/codeeditor/style.py
@@ -0,0 +1,255 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the codeeditor development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Modyule style
+
+Provides basic functionaliy for styling.
+
+Styling is done using a dictionary of StyleFormat instances. Each
+such instance reprsents a certain element being styled (e.g. keywords,
+line numbers, indentation guides).
+
+All possible style elements are represented using StyleElementDescription
+instances. These have a name, description and default format, which
+makes it easy to build a UI to allow the user to change the syle.
+
+"""
+from .qt import QtGui, QtCore
+Qt = QtCore.Qt
+
+
+class StyleElementDescription:
+ """ StyleElementDescription(name, defaultFormat, description)
+
+ Describes a style element by its name, default format, and description.
+
+ A style description is a simple placeholder for something
+ that can be styled.
+
+ """
+
+ def __init__(self, name, description, defaultFormat):
+ self._name = name
+ self._description = description
+ self._defaultFormat = StyleFormat(defaultFormat)
+
+ def __repr__(self):
+ return '<"%s": "%s">' % (self.name, self.defaultFormat)
+
+ @property
+ def name(self):
+ return self._name
+
+ @property
+ def key(self):
+ return self._name.replace(' ', '').lower()
+
+ @property
+ def description(self):
+ return self._description
+
+ @property
+ def defaultFormat(self):
+ return self._defaultFormat
+
+
+class StyleFormat:
+ """ StyleFormat(format='')
+
+ Represents the style format for a specific style element.
+ A "style" is a dictionary that maps names (of style elements)
+ to StyleFormat instances.
+
+ The given format can be a string or another StyleFormat instance.
+ Style formats can be combined using their update() method.
+
+ A style format consists of multiple parts, where each "part" consists
+ of a key and a value. The keys can be anything, depending
+ on what kind of thing is being styled. The value can be obtained using
+ the index operator (e.g. styleFomat['fore'])
+
+ For a few special keys, properties are defined that return the Qt object
+ corresponding to the value. These values are also buffered to enable
+ fast access. These keys are:
+ * fore: (QColor) the foreground color
+ * back: (QColor) the background color
+ * bold: (bool) whether the text should be bold
+ * italic: (bool) whether the text should be in italic
+ * underline: (int) whether an underline should be used (and which one)
+ * linestyle: (int) what line style to use (e.g. for indent guides)
+ * textCharFOrmat: (QTextCharFormat) for the syntax styles
+
+ The format neglects spaces and case. Parts are separated by commas
+ or semicolons. If only a key is given it's value is interpreted
+ as 'yes'. If only a color is given, its key is interpreted as 'fore'
+ and back. Colors should be given using the '#' hex formatting.
+
+ An example format string: 'fore:#334, bold, underline:dotLine'
+
+ By calling str(styleFormatInstance) the string representing of the
+ format can be obtained. By iterating over the instance, a series
+ of key-value pairs is obtained.
+
+ """
+
+ def __init__(self, format=''):
+ self._parts = {}
+ self.update(format)
+
+
+ def _resetProperties(self):
+ self._fore = None
+ self._back = None
+ self._bold = None
+ self._italic = None
+ self._underline = None
+ self._linestyle = None
+ self._textCharFormat = None
+
+
+ def __str__(self):
+ """ Get a (cleaned up) string representation of this style format.
+ """
+ parts = []
+ for key in self._parts:
+ parts.append('%s:%s' % (key, self._parts[key]))
+ return ', '.join(parts)
+
+
+ def __repr__(self):
+ return '<StyleFormat "%s">' % str(self)
+
+
+ def __getitem__(self, key):
+ try:
+ return self._parts[key]
+ except KeyError:
+ raise KeyError('Invalid part key for style format.')
+
+ def __iter__(self):
+ """ Yields a series of tuples (key, val).
+ """
+ parts = []
+ for key in self._parts:
+ parts.append( (key, self._parts[key]) )
+ return parts.__iter__()
+
+
+ def update(self, format):
+ """ update(format)
+
+ Update this style format with the given format.
+
+ """
+
+ # Reset buffered values
+ self._resetProperties()
+
+ # Make a string, so we update the format with the given one
+ if isinstance(format, StyleFormat):
+ format = str(format)
+
+ # Split on ',' and ',', ignore spaces
+ styleParts = [p for p in
+ format.replace('=',':').replace(';',',').split(',')]
+
+ for stylePart in styleParts:
+
+ # Make sure it consists of identifier and value pair
+ # e.g. fore:#xxx, bold:yes, underline:no
+ if not ':' in stylePart:
+ if stylePart.startswith('#'):
+ stylePart = 'foreandback:' + stylePart
+ else:
+ stylePart += ':yes'
+
+ # Get key value and strip and make lowecase
+ key, _, val = [i.strip().lower() for i in stylePart.partition(':')]
+
+ # Store in parts
+ if key == 'foreandback':
+ self._parts['fore'] = val
+ self._parts['back'] = val
+ elif key:
+ self._parts[key] = val
+
+ ## Properties
+
+ def _getValueSafe(self, key):
+ try:
+ return self._parts[key]
+ except KeyError:
+ return 'no'
+
+ @property
+ def fore(self):
+ if self._fore is None:
+ self._fore = QtGui.QColor(self._parts['fore'])
+ return self._fore
+
+ @property
+ def back(self):
+ if self._back is None:
+ self._back = QtGui.QColor(self._parts['back'])
+ return self._back
+
+ @property
+ def bold(self):
+ if self._bold is None:
+ if self._getValueSafe('bold') in ['yes', 'true']:
+ self._bold = True
+ else:
+ self._bold = False
+ return self._bold
+
+ @property
+ def italic(self):
+ if self._italic is None:
+ if self._getValueSafe('italic') in ['yes', 'true']:
+ self._italic = True
+ else:
+ self._italic = False
+ return self._italic
+
+ @property
+ def underline(self):
+ if self._underline is None:
+ val = self._getValueSafe('underline')
+ if val in ['yes', 'true']:
+ self._underline = QtGui.QTextCharFormat.SingleUnderline
+ elif val in ['dotted', 'dots', 'dotline']:
+ self._underline = QtGui.QTextCharFormat.DotLine
+ elif val in ['wave']:
+ self._underline = QtGui.QTextCharFormat.WaveUnderline
+ else:
+ self._underline = QtGui.QTextCharFormat.NoUnderline
+ return self._underline
+
+ @property
+ def linestyle(self):
+ if self._linestyle is None:
+ val = self._getValueSafe('linestyle')
+ if val in ['yes', 'true']:
+ self._linestyle = Qt.SolidLine
+ elif val in ['dotted', 'dot', 'dots', 'dotline']:
+ self._linestyle = Qt.DotLine
+ elif val in ['dashed', 'dash', 'dashes', 'dashline']:
+ self._linestyle = Qt.DashLine
+ else:
+ self._linestyle = Qt.SolidLine # default to solid
+ return self._linestyle
+
+ @property
+ def textCharFormat(self):
+ if self._textCharFormat is None:
+ self._textCharFormat = tcf = QtGui.QTextCharFormat()
+ self._textCharFormat.setForeground(self.fore)
+ self._textCharFormat.setUnderlineStyle(self.underline)
+ if self.bold:
+ self._textCharFormat.setFontWeight(QtGui.QFont.Bold)
+ if self.italic:
+ self._textCharFormat.setFontItalic(True)
+ return self._textCharFormat
diff --git a/iep/codeeditor/textutils.py b/iep/codeeditor/textutils.py
new file mode 100644
index 0000000..857e3b4
--- /dev/null
+++ b/iep/codeeditor/textutils.py
@@ -0,0 +1,184 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+class TextReshaper:
+ """ Object to reshape a piece of text, taking indentation, paragraphs,
+ comments and bulletpoints into account.
+ """
+
+ def __init__(self, lw, margin=3):
+ self.lw = lw
+ self.margin = margin
+
+ self._lines1 = []
+ self._lines2 = []
+
+ self._wordBuffer = []
+ self._charsInBuffer = -1 # First word ads one extra
+
+ self._pendingPrefix = None # A one-shot prefix
+ self._currentPrefix = None # The prefix used until a new prefix is set
+
+ @classmethod
+ def reshapeText(cls, text, lw):
+ tr = cls(lw)
+ tr.pushText(text)
+ return tr.popText()
+
+ def pushLine(self, line):
+ """ Push a single line to the input.
+ """
+ self._lines1.append(line.rstrip())
+
+ def pushText(self, text):
+ """ Push a (multiline) text to the input.
+ """
+ for line in text.splitlines():
+ self.pushLine(line)
+
+ def popLines(self):
+ """ Get all available lines from the output.
+ """
+ try:
+ while True:
+ self._popLine()
+ except StopIteration:
+ self._flush()
+
+ return [line for line in self._lines2]
+
+ def popText(self):
+ """ Get all text from the output (i.e. lines joined with newline).
+ """
+ return '\n'.join(self.popLines())
+
+
+ def _prefixString(self):
+ if self._pendingPrefix is not None:
+ prefix = self._pendingPrefix
+ self._pendingPrefix = None
+ return prefix
+ else:
+ return self._currentPrefix or ''
+
+ def _addWordToBuffer(self, word):
+ self._wordBuffer.append(word)
+ self._charsInBuffer += len(word) + 1 # add one for space
+
+ def _flush(self):
+ if self._wordBuffer:
+ self._lines2.append(self._prefixString() + ' '.join(self._wordBuffer))
+ self._wordBuffer, self._charsInBuffer = [], -1
+
+ def _addNewParagraph(self):
+ # Flush remaining words
+ self._flush()
+ # Create empty line
+ prefix = self._currentPrefix or ''
+ prefix = ' ' * len(prefix)
+ self._lines2.append(prefix)
+ # Allow new prefix
+ self._currentPrefix = None
+
+ def _popLine(self):
+ """ Pop a line from the input. Examine how it starts and convert it
+ to words.
+ """
+
+ # Pop line
+ try:
+ line = self._lines1.pop(0)
+ except IndexError:
+ raise StopIteration()
+
+ # Strip the line
+ strippedline1 = line.lstrip()
+ strippedline2 = line.lstrip(' \t#*')
+
+ # Analyze this line (how does it start?)
+ if not strippedline1:
+ self._addNewParagraph()
+ return
+ elif strippedline1.startswith('* '):
+ self._flush()
+ indent = len(line) - len(strippedline1)
+ linePrefix = line[:indent]
+ self._pendingPrefix = linePrefix + '* '
+ self._currentPrefix = linePrefix + ' '
+ else:
+ # Hey, an actual line! Determine prefix
+ indent = len(line) - len(strippedline1)
+ linePrefix = line[:indent]
+ # Check comments
+ if strippedline1.startswith('#'):
+ linePrefix += '# '
+ # What to do now?
+ if linePrefix != self._currentPrefix:
+ self._flush()
+ self._currentPrefix = linePrefix
+
+
+ # Process words one by one...
+ for word in strippedline2.split(' '):
+ self._addWordToBuffer(word)
+ currentLineWidth = self._charsInBuffer + len(self._currentPrefix)
+
+ if currentLineWidth < self.lw:
+ # Not enough words in buffer yet
+ pass
+ elif len(self._wordBuffer) > 1:
+ # Enough words to compose a line
+ marginWith = currentLineWidth - self.lw
+ marginWithout = self.lw - (currentLineWidth - len(word))
+ if marginWith < marginWithout and marginWith < self.margin:
+ # add all buffered words
+ self._flush()
+ else:
+ # add all buffered words (except last)
+ self._wordBuffer.pop(-1)
+ self._flush()
+ self._addWordToBuffer(word)
+ else:
+ # This single word covers more than one line
+ self._flush()
+
+
+
+testText = """
+
+# This is a piece
+# of comment
+Lorem ipsum dolor sit amet, consectetur
+adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi
+ut aliquip ex ea
+commodo consequat. Duis aute irure dolor
+in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat
+non proident, sunt in culpa qui officia deserunt mollit anim
+id est laborum.
+
+ # Indented comments
+ # should work
+ # as well
+
+skdb-a-very-long-word-ksdbfksasdvbassdfhjsdfbjdfbvhjdbvhjbdfhjvbdfjbvjdfbvjdfbvjdbfvj
+
+ A change in indentation makes it a separate line
+sdckj bsdkjcb sdc
+sdckj foo bar
+aap noot mies
+
+ * Bullet points are preserved
+ * Even if they are very long the should be preserved. I know that brevity is a great virtue but you know,
+ sometimes you just need those
+ extra words to make a point.
+
+"""
+
+if __name__ == '__main__':
+ print(TextReshaper.reshapeText(testText, 70))
+
+
\ No newline at end of file
diff --git a/iep/contributors.txt b/iep/contributors.txt
new file mode 100644
index 0000000..84d97fd
--- /dev/null
+++ b/iep/contributors.txt
@@ -0,0 +1,27 @@
+### Project coordination
+
+Almar Klein
+
+
+### Development
+
+Rob Reilink
+Ludo Visser
+Gijs van Oort
+David Salter
+
+
+### Translators
+
+Hector Mtz-Seara Monné - Spanish and Catalan
+Laurent Signac - French
+Diogo Costa - Portuguese
+Gerd Schmitt - German
+George Volkov - Russian
+
+
+### Financial support
+
+Diogo Costa
+Marek Petrik
+Ken Crossen
diff --git a/iep/iepcore/__init__.py b/iep/iepcore/__init__.py
new file mode 100644
index 0000000..e40e082
--- /dev/null
+++ b/iep/iepcore/__init__.py
@@ -0,0 +1,8 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Package iepcore - the core of IEP.
+"""
diff --git a/iep/iepcore/about.py b/iep/iepcore/about.py
new file mode 100644
index 0000000..8949873
--- /dev/null
+++ b/iep/iepcore/about.py
@@ -0,0 +1,166 @@
+
+import os
+import sys
+
+import pyzolib
+from pyzolib import paths
+from pyzolib.qt import QtCore, QtGui
+
+import iep
+
+
+
+class AboutDialog(QtGui.QDialog):
+ def __init__(self, parent):
+ QtGui.QDialog.__init__(self, parent)
+ self.setWindowTitle(iep.translate("menu dialog", "About IEP"))
+ self.resize(600,500)
+
+ # Layout
+ layout = QtGui.QVBoxLayout(self)
+ self.setLayout(layout)
+
+ # Create image and title
+ im = QtGui.QPixmap( os.path.join(iep.iepDir,
+ 'resources', 'appicons', 'ieplogo64.png') )
+ imlabel = QtGui.QLabel(self)
+ imlabel.setPixmap(im)
+ textlabel = QtGui.QLabel(self)
+ textlabel.setText('<h3>IEP: the Interactive Editor for Python</h3>')
+ #
+ titleLayout = QtGui.QHBoxLayout()
+ titleLayout.addWidget(imlabel, 0)
+ titleLayout.addWidget(textlabel, 1)
+ #
+ layout.addLayout(titleLayout, 0)
+
+ # Create tab bar
+ self._tabs = QtGui.QTabWidget(self)
+ self._tabs.setDocumentMode(True)
+ layout.addWidget(self._tabs, 1)
+
+ # Create button box
+ self._butBox = QtGui.QDialogButtonBox(self)
+ self._butBox.setOrientation(QtCore.Qt.Horizontal)
+ self._butBox.setStandardButtons(self._butBox.Close)
+ layout.addWidget(self._butBox, 0)
+
+ # Signals
+ self._butBox.rejected.connect(self.close)
+
+ # Create tabs
+ self.createGeneralTab()
+ self.createContributorsTab()
+ self.createLicenseTab()
+ #
+ #from iep.iepcore.license import LicenseManager
+ #self._tabs.addTab(LicenseManager(self._tabs), 'Your licenses')
+
+
+ def addTab(self, title, text, rich=True):
+ # Create label to show info
+ label = QtGui.QTextEdit(self)
+ label.setLineWrapMode(label.WidgetWidth)
+ label.setReadOnly(True)
+ # Set text
+ if rich:
+ label.setHtml(text)
+ else:
+ label.setText(text)
+ # Add to tab bar
+ self._tabs.addTab(label, title)
+ # Done
+ return label
+
+
+ def createGeneralTab(self):
+ aboutText = """
+ {}<br><br>
+
+ <b>Version info</b><br>
+ IEP version: <u>{}</u><br>
+ Platform: {}<br>
+ Python version: {}<br>
+ pyzolib version: {}<br>
+ Qt version: {}<br>
+ {} version: {}<br>
+ <br>
+
+ <b>IEP directories</b><br>
+ IEP source directory: {}<br>
+ IEP userdata directory: {}<br>
+ <br>
+
+ <b>Acknowledgements</b><br>
+ IEP is written in Python 3 and uses the Qt widget
+ toolkit. IEP uses code and concepts that are inspired by
+ IPython, Pype, and Spyder.
+ IEP uses a (modified) subset of the silk icon set,
+ by Mark James (http://www.famfamfam.com/lab/icons/silk/).
+ """
+ # Determine license text
+ licenseText = '' # 'This copy of IEP is not registered (using the free license).'
+ if iep.license:
+ if iep.license['company']:
+ licenseText = 'This copy of IEP is registered to {name} of {company}.'
+ else:
+ licenseText = 'This copy of IEP is registered to {name}.'
+ licenseText = licenseText.format(**iep.license)
+ # Determine if this is PyQt4 or Pyside
+ if hasattr(QtCore, 'PYQT_VERSION_STR'):
+ qtWrapper = 'PyQt4'
+ qtVersion = QtCore.QT_VERSION_STR
+ qtWrapperVersion = QtCore.PYQT_VERSION_STR
+ else:
+ import PySide
+ qtWrapper = 'PySide'
+ qtVersion = QtCore.__version__
+ qtWrapperVersion = PySide.__version__
+ # Insert information texts
+ if paths.is_frozen():
+ versionText = iep.__version__ + ' (binary)'
+ else:
+ versionText = iep.__version__ + ' (source)'
+ aboutText = aboutText.format(licenseText, versionText,
+ sys.platform,
+ sys.version.split(' ')[0],
+ pyzolib.__version__,
+ qtVersion, qtWrapper, qtWrapperVersion,
+ iep.iepDir, iep.appDataDir)
+
+ self.addTab("General", aboutText)
+
+
+ def createContributorsTab(self):
+ fname = os.path.join(iep.iepDir, 'contributors.txt')
+ try:
+ with open(fname, 'rb') as f:
+ text = f.read().decode('utf-8', 'ignore').strip()
+ except Exception as err:
+ text = str(err)
+ label = self.addTab('Contributors', text, False)
+ # Decrease font
+ font = label.font()
+ font.setPointSize(int(font.pointSize()*0.9))
+ label.setFont(font)
+
+
+ def createLicenseTab(self):
+ fname = os.path.join(iep.iepDir, 'license.txt')
+ try:
+ with open(fname, 'rb') as f:
+ text = f.read().decode('utf-8', 'ignore').strip()
+ except Exception as err:
+ text = str(err)
+ label = self.addTab('BSD license', text, False)
+ # Decrease font
+ font = label.font()
+ font.setPointSize(int(font.pointSize()*0.9))
+ label.setFont(font)
+
+
+if __name__ == '__main__':
+ #iep.license = {'name': 'AK', 'company': ''}
+ m = AboutDialog(None)
+ m.show()
+
\ No newline at end of file
diff --git a/iep/iepcore/baseTextCtrl.py b/iep/iepcore/baseTextCtrl.py
new file mode 100644
index 0000000..0cdc52c
--- /dev/null
+++ b/iep/iepcore/baseTextCtrl.py
@@ -0,0 +1,619 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module baseTextCtrl
+
+Defines the base text control to be inherited by the shell and editor
+classes. Implements styling, introspection and a bit of other stuff that
+is common for both shells and editors.
+
+"""
+
+import iep
+import os, sys, time
+import weakref
+from pyzolib import ssdf
+from iep.iepcore.iepLogging import print
+import iep.codeeditor.parsers.tokens as Tokens
+
+from pyzolib.qt import QtCore, QtGui
+qt = QtGui
+
+
+# Define style stuff
+subStyleStuff = {}
+
+#subStyleStuff = { 'face': Qsci.QsciScintillaBase.SCI_STYLESETFONT ,
+# 'fore': Qsci.QsciScintillaBase.SCI_STYLESETFORE,
+# 'back': Qsci.QsciScintillaBase.SCI_STYLESETBACK,
+# 'size': Qsci.QsciScintillaBase.SCI_STYLESETSIZE,
+# 'bold': Qsci.QsciScintillaBase.SCI_STYLESETBOLD,
+# 'italic': Qsci.QsciScintillaBase.SCI_STYLESETITALIC,
+# 'underline': Qsci.QsciScintillaBase.SCI_STYLESETUNDERLINE}
+
+
+def normalizePath(path):
+ """ Normalize the path given.
+ All slashes will be made the same (and doubles removed)
+ The real case as stored on the file system is recovered.
+ Returns None on error.
+ """
+
+ # normalize
+ path = os.path.abspath(path) # make sure it is defined from the drive up
+ path = os.path.normpath(path)
+
+ # If does not exist, return as is.
+ # This also happens if the path's case is incorrect and the
+ # file system is case sensitive. That's ok, because the stuff we
+ # do below is intended to get the path right on case insensitive
+ # file systems.
+ if not os.path.isfile(path):
+ return path
+
+ # split drive name from the rest
+ drive, rest = os.path.splitdrive(path)
+ fullpath = drive.upper() + os.sep
+
+ # make lowercase and split in parts
+ parts = rest.lower().split(os.sep)
+ parts = [part for part in parts if part]
+
+ for part in parts:
+ options = [x for x in os.listdir(fullpath) if x.lower()==part]
+ if len(options) > 1:
+ print("Error normalizing path: Ambiguous path names!")
+ return path
+ elif not options:
+ print("Invalid path (part %s) in %s" % (part, fullpath))
+ return path
+ fullpath = os.path.join(fullpath, options[0])
+
+ # remove last sep
+ return fullpath
+
+
+def parseLine_autocomplete(tokens):
+ """ Given a list of tokens (from start to cursor position)
+ returns a tuple (base, name).
+ autocomp_parse("eat = banan") -> "", "banan"
+ ...("eat = food.fruit.ban") -> "food.fruit", "ban"
+ When no match found, both elements are an empty string.
+ """
+ if not len(tokens):
+ return "",""
+
+ if isinstance(tokens[-1],Tokens.NonIdentifierToken) and str(tokens[-1])=='.':
+ name = ''
+ elif isinstance(tokens[-1],(Tokens.IdentifierToken,Tokens.KeywordToken)):
+ name = str(tokens[-1])
+ else:
+ return '',''
+
+ needle = ''
+ #Now go through the remaining tokens in reverse order
+ for token in tokens[-2::-1]:
+ if isinstance(token,Tokens.NonIdentifierToken) and str(token)=='.':
+ needle = str(token) + needle
+ elif isinstance(token,(Tokens.IdentifierToken,Tokens.KeywordToken)):
+ needle = str(token) + needle
+ else:
+ break
+
+ if needle.endswith('.'):
+ needle = needle[:-1]
+
+ return needle, name
+
+
+def parseLine_signature(tokens):
+ """ Given a list of tokens (from start to cursor position)
+ returns a tuple (name, needle, stats).
+ stats is another tuple:
+ - location of end bracket
+ - amount of kommas till cursor (taking nested brackets into account)
+ """
+ openBraces = [] #Positions at which braces are opened
+ for token in tokens:
+ if not isinstance(token,Tokens.NonIdentifierToken):
+ continue
+ for i,c in enumerate(str(token)):
+ if c=='(':
+ openBraces.append(token.start + i)
+ elif c==')':
+ if len(openBraces): openBraces.pop()
+
+ if len(openBraces):
+ i = openBraces[-1]
+ # Now trim the token list up to (but not inculding) position of openBraces
+ tokens = list(filter(lambda token: token.start < i, tokens))
+
+ # Trim the last token
+ if len(tokens):
+ tokens[-1].end = i
+
+ name, needle = parseLine_autocomplete(tokens)
+
+ return name, needle, (i,0) #TODO: implement stats
+
+
+ return "","",(0,0)
+
+
+
+class KeyEvent:
+ """ A simple class for easier key events. """
+ def __init__(self, key):
+ self.key = key
+ try:
+ self.char = chr(key)
+ except ValueError:
+ self.char = ""
+
+
+
+def makeBytes(text):
+ """ Make sure the argument is bytes, converting with UTF-8 encoding
+ if it is a string. """
+ if isinstance(text, bytes):
+ return text
+ elif isinstance(text, str):
+ return text.encode('utf-8')
+ else:
+ raise ValueError("Expected str or bytes!")
+
+
+_allScintillas = []
+def getAllScintillas():
+ """ Get a list of all the scintialla editing components that
+ derive from BaseTextCtrl. Used mainly by the menu.
+ """
+ for i in reversed(range(len(_allScintillas))):
+ e = _allScintillas[i]()
+ if e is None:
+ _allScintillas.pop(i)
+ else:
+ yield e
+iep.getAllScintillas = getAllScintillas
+
+from iep import codeeditor
+
+
+class BaseTextCtrl(codeeditor.CodeEditor):
+ """ The base text control class.
+ Inherited by the shell class and the IEP editor.
+ The class implements autocompletion, calltips, and auto-help
+
+ Inherits from QsciScintilla. I tried to clean up the rather dirty api
+ by using more sensible names. Hereby I apply the following rules:
+ - if you set something, the method starts with "set"
+ - if you get something, the method starts with "get"
+ - a position is the integer position fron the start of the document
+ - a linenr is the number of a line, an index the position on that line
+ - all the above indices apply to the bytes (encoded utf-8) in which the
+ text is stored. If you have unicode text, they do not apply!
+ - the method name mentions explicityly what you get. getBytes() returns the
+ bytes of the document, getString() gets the unicode string that it
+ represents. This applies to the get-methods. the set-methods use the
+ term text, and automatically convert to bytes using UTF-8 encoding
+ when a string is given.
+ """
+
+ def __init__(self, *args, **kwds):
+ super().__init__(*args, **kwds)
+
+ # Set font and zooming
+ self.setFont(iep.config.view.fontname)
+ self.setZoom(iep.config.view.zoom)
+
+ # Create timer for autocompletion delay
+ self._delayTimer = QtCore.QTimer(self)
+ self._delayTimer.setSingleShot(True)
+ self._delayTimer.timeout.connect(self._introspectNow)
+
+ # For buffering autocompletion and calltip info
+ self._callTipBuffer_name = ''
+ self._callTipBuffer_time = 0
+ self._callTipBuffer_result = ''
+ self._autoCompBuffer_name = ''
+ self._autoCompBuffer_time = 0
+ self._autoCompBuffer_result = []
+
+ # The string with names given to SCI_AUTOCSHOW
+ self._autoCompNameString = ''
+
+ # Set autocomp accept key to default if necessary.
+ # We force it to be string (see issue 134)
+ if not isinstance(iep.config.settings.autoComplete_acceptKeys, str):
+ iep.config.settings.autoComplete_acceptKeys = 'Tab'
+
+ # Set autocomp accept keys
+ qtKeys = []
+ for key in iep.config.settings.autoComplete_acceptKeys.split(' '):
+ if len(key) > 1:
+ key = 'Key_' + key[0].upper() + key[1:].lower()
+ qtkey = getattr(QtCore.Qt, key, None)
+ else:
+ qtkey = ord(key)
+ if qtkey:
+ qtKeys.append(qtkey)
+ self.setAutoCompletionAcceptKeys(*qtKeys)
+
+ self.completer().highlighted.connect(self.updateHelp)
+ self.setIndentUsingSpaces(iep.config.settings.defaultIndentUsingSpaces)
+ self.setIndentWidth(iep.config.settings.defaultIndentWidth)
+ self.setAutocompletPopupSize(*iep.config.view.autoComplete_popupSize)
+
+
+ def _isValidPython(self):
+ """ _isValidPython()
+ Check if the code at the cursor is valid python:
+ - the active lexer is the python lexer
+ - the style at the cursor is "default"
+ """
+ #TODO:
+ return True
+
+
+
+ def introspect(self, tryAutoComp=False):
+ """ introspect(tryAutoComp=False)
+
+ The starting point for introspection (autocompletion and calltip).
+ It will always try to produce a calltip. If tryAutoComp is True,
+ will also try to produce an autocompletion list (which, on success,
+ will hide the calltip).
+
+ This method will obtain the line and (re)start a timer that will
+ call _introspectNow() after a short while. This way, if the
+ user types a lot of characters, there is not a stream of useless
+ introspection attempts; the introspection is only really started
+ after he stops typing for, say 0.1 or 0.5 seconds (depending on
+ iep.config.autoCompDelay).
+
+ The method _introspectNow() will parse the line to obtain
+ information required to obtain the autocompletion and signature
+ information. Then it calls processCallTip and processAutoComp
+ which are implemented in the editor and shell classes.
+ """
+
+ # Find the tokens up to the cursor
+ cursor = self.textCursor()
+
+ # In order to find the tokens, we need the userState from the highlighter
+ if cursor.block().previous().isValid():
+ previousState = cursor.block().previous().userState()
+ else:
+ previousState = 0
+
+ text = cursor.block().text()[:cursor.positionInBlock()]
+
+ tokensUptoCursor = list(
+ filter(lambda token:token.isToken, #filter to remove BlockStates
+ self.parser().parseLine(text, previousState)))
+
+ # TODO: Only proceed if valid python (no need to check for comments/
+ # strings, this is done by the processing of the tokens). Check for python style
+
+ # Is the char valid for auto completion?
+ if tryAutoComp:
+ if not text or not ( text[-1] in (Tokens.ALPHANUM + "._") ):
+ self.autocompleteCancel()
+ tryAutoComp = False
+
+ # Store line and (re)start timer
+ cursor.setKeepPositionOnInsert(True)
+ self._delayTimer._tokensUptoCursor = tokensUptoCursor
+ self._delayTimer._cursor = cursor
+ self._delayTimer._tryAutoComp = tryAutoComp
+ self._delayTimer.start(iep.config.advanced.autoCompDelay)
+
+
+ def _introspectNow(self):
+ """ This methos is called a short while after introspect()
+ by the timer. It parses the line and calls the specific methods
+ to process the callTip and autoComp.
+ """
+
+ tokens = self._delayTimer._tokensUptoCursor
+
+ if iep.config.settings.autoCallTip:
+ # Parse the line, to get the name of the function we should calltip
+ # if the name is empty/None, we should not show a signature
+ name, needle, stats = parseLine_signature(tokens)
+
+ if needle:
+ # Compose actual name
+ fullName = needle
+ if name:
+ fullName = name + '.' + needle
+ # Process
+ offset = self._delayTimer._cursor.positionInBlock() - stats[0] + len(needle)
+ cto = CallTipObject(self, fullName, offset)
+ self.processCallTip(cto)
+ else:
+ self.calltipCancel()
+
+ if self._delayTimer._tryAutoComp and iep.config.settings.autoComplete:
+ # Parse the line, to see what (partial) name we need to complete
+ name, needle = parseLine_autocomplete(tokens)
+
+ if name or needle:
+ # Try to do auto completion
+ aco = AutoCompObject(self, name, needle)
+ self.processAutoComp(aco)
+
+
+ def processCallTip(self, cto):
+ """ Overridden in derive class """
+ pass
+
+
+ def processAutoComp(self, aco):
+ """ Overridden in derive class """
+ pass
+
+
+ def _onDoubleClick(self):
+ """ When double clicking on a name, autocomplete it. """
+ self.processHelp()
+
+
+ def processHelp(self, name=None, showError=False):
+ """ Show help on the given full object name.
+ - called when going up/down in the autocompletion list.
+ - called when double clicking a name
+ """
+ # uses parse_autocomplete() to find baseName and objectName
+
+ # Get help tool
+ hw = iep.toolManager.getTool('iepinteractivehelp')
+ # Get the shell
+ shell = iep.shells.getCurrentShell()
+ # Both should exist
+ if not hw or not shell:
+ return
+
+ if not name:
+ # Obtain name from current cursor position
+
+ # Is this valid python?
+ if self._isValidPython():
+ # Obtain line from text
+ cursor = self.textCursor()
+ line = cursor.block().text()
+ text = line[:cursor.positionInBlock()]
+ # Obtain
+ nameBefore, name = parseLine_autocomplete(text)
+ if nameBefore:
+ name = "%s.%s" % (nameBefore, name)
+
+ if name:
+ hw.setObjectName(name)
+
+
+ ## Callbacks
+ def updateHelp(self,name):
+ """A name has been highlighted, show help on that name"""
+
+ if self._autoCompBuffer_name:
+ name = self._autoCompBuffer_name + '.' + name
+ elif not self.completer().completionPrefix():
+ # Dont update help if there is no dot or prefix;
+ # the choice would be arbitrary
+ return
+
+ # Apply
+ self.processHelp(name,True)
+
+
+ def event(self,event):
+ """ event(event)
+
+ Overload main event handler so we can pass Ctrl-C Ctr-v etc, to the main
+ window.
+
+ """
+ if isinstance(event, QtGui.QKeyEvent):
+ # Ignore CTRL+{A-Z} since those keys are handled through the menu
+ if (event.modifiers() & QtCore.Qt.ControlModifier) and \
+ (event.key()>=QtCore.Qt.Key_A) and (event.key()<=QtCore.Qt.Key_Z):
+ event.ignore()
+ return False
+
+ # Default behavior
+ codeeditor.CodeEditor.event(self, event)
+ return True
+
+
+ def keyPressEvent(self, event):
+ """ Receive qt key event.
+ From here we'l dispatch the event to perform autocompletion
+ or other stuff...
+ """
+
+ # Get ordinal key
+ ordKey = -1
+ if event.text():
+ ordKey = ord(event.text()[0])
+
+ # Cancel any introspection in progress
+ self._delayTimer._line = ''
+
+ # Also invalidate introspection for when a response gets back
+ # These are set again when the timer runs out. If the response
+ # is received before the timer runs out, the results are buffered
+ # but not shown. When the timer runs out shortly after, the buffered
+ # results are shown. If the timer runs out before the response is
+ # received, a new request is done, although the response of the old
+ # request will show the info if it's still up to date.
+ self._autoComp_bufBase = None
+ self._callTip_bufName = None
+
+
+ codeeditor.CodeEditor.keyPressEvent(self, event)
+ # Analyse character/key to determine what introspection to fire
+ if ordKey:
+ if ordKey >= 48 or ordKey in [8, 46]:
+ # If a char that allows completion or backspace or dot was pressed
+ self.introspect(True)
+ elif ordKey >= 32:
+ # Printable chars, only calltip
+ self.introspect()
+ elif event.key() in [QtCore.Qt.Key_Left, QtCore.Qt.Key_Right]:
+ self.introspect()
+
+
+
+
+
+
+
+
+class CallTipObject:
+ """ Object to help the process of call tips.
+ An instance of this class is created for each call tip action.
+ """
+ def __init__(self, textCtrl, name, offset):
+ self.textCtrl = textCtrl
+ self.name = name
+ self.bufferName = name
+ self.offset = offset
+
+ def tryUsingBuffer(self):
+ """ tryUsingBuffer()
+ Try performing this callTip using the buffer.
+ Returns True on success.
+ """
+ bufferName = self.textCtrl._callTipBuffer_name
+ t = time.time() - self.textCtrl._callTipBuffer_time
+ if ( self.bufferName == bufferName and t < 0 ):
+ self._finish(self.textCtrl._callTipBuffer_result)
+ return True
+ else:
+ return False
+
+ def finish(self, callTipText):
+ """ finish(callTipText)
+ Finish the introspection using the given calltipText.
+ Will also automatically call setBuffer.
+ """
+ self.setBuffer(callTipText)
+ self._finish(callTipText)
+
+ def setBuffer(self, callTipText, timeout=4):
+ """ setBuffer(callTipText)
+ Sets the buffer with the provided text. """
+ self.textCtrl._callTipBuffer_name = self.bufferName
+ self.textCtrl._callTipBuffer_time = time.time() + timeout
+ self.textCtrl._callTipBuffer_result = callTipText
+
+ def _finish(self, callTipText):
+ self.textCtrl.calltipShow(self.offset, callTipText, True)
+
+
+class AutoCompObject:
+ """ Object to help the process of auto completion.
+ An instance of this class is created for each auto completion action.
+ """
+ def __init__(self, textCtrl, name, needle):
+ self.textCtrl = textCtrl
+ self.bufferName = name # name to identify with
+ self.name = name # object to find attributes of
+ self.needle = needle # partial name to look for
+ self.names = set() # the names (use a set to prevent duplicates)
+ self.importNames = []
+ self.importLines = {}
+
+ def addNames(self, names):
+ """ addNames(names)
+ Add a list of names to the collection.
+ Duplicates are removed."""
+ self.names.update(names)
+
+ def tryUsingBuffer(self):
+ """ tryUsingBuffer()
+ Try performing this auto-completion using the buffer.
+ Returns True on success.
+ """
+ bufferName = self.textCtrl._autoCompBuffer_name
+ t = time.time() - self.textCtrl._autoCompBuffer_time
+ if ( self.bufferName == bufferName and t < 0 ):
+ self._finish(self.textCtrl._autoCompBuffer_result)
+ return True
+ else:
+ return False
+
+ def finish(self):
+ """ finish()
+ Finish the introspection using the collected names.
+ Will automatically call setBuffer.
+ """
+ # Remember at the object that started this introspection
+ # and get sorted names
+ names = self.setBuffer(self.names)
+ # really finish
+ self._finish(names)
+
+ def setBuffer(self, names=None, timeout=None):
+ """ setBuffer(names=None)
+ Sets the buffer with the provided names (or the collected names).
+ Also returns a list with the sorted names. """
+ # Determine timeout
+ # Global namespaces change more often than local one, plus when
+ # typing a xxx.yyy, the autocompletion buffer changes and is thus
+ # automatically refreshed.
+ # I've once encountered a wrong autocomp list on an object, but
+ # haven' been able to reproduce it. It was probably some odity.
+ if timeout is None:
+ if self.bufferName:
+ timeout = 5
+ else:
+ timeout = 1
+ # Get names
+ if names is None:
+ names = self.names
+ # Make list and sort
+ names = list(names)
+ names.sort(key=str.upper)
+ # Store
+ self.textCtrl._autoCompBuffer_name = self.bufferName
+ self.textCtrl._autoCompBuffer_time = time.time() + timeout
+ self.textCtrl._autoCompBuffer_result = names
+ # Return sorted list
+ return names
+
+ def _finish(self, names):
+ # Show completion list if required.
+ self.textCtrl.autocompleteShow(len(self.needle), names)
+
+ def nameInImportNames(self, importNames):
+ """ nameInImportNames(importNames)
+ Test whether the name, or a base part of it is present in the
+ given list of names. Returns the (part of) the name that's in
+ the list, or None otherwise.
+ """
+ baseName = self.name
+ while baseName not in importNames:
+ if '.' in baseName:
+ baseName = baseName.rsplit('.',1)[0]
+ else:
+ baseName = None
+ break
+ return baseName
+
+
+if __name__=="__main__":
+ app = QtGui.QApplication([])
+ win = BaseTextCtrl(None)
+# win.setStyle('.py')
+ tmp = "foo(bar)\nfor bar in range(5):\n print bar\n"
+ tmp += "\nclass aap:\n def monkey(self):\n pass\n\n"
+ tmp += "a\u20acb\n"
+ win.setPlainText(tmp)
+ win.show()
+ app.exec_()
+
diff --git a/iep/iepcore/codeparser.py b/iep/iepcore/codeparser.py
new file mode 100644
index 0000000..7edfab1
--- /dev/null
+++ b/iep/iepcore/codeparser.py
@@ -0,0 +1,767 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module codeparser
+
+Analyses the source code to get the structure of a module/script.
+This can be used for fictive introspection, and to display the
+structure of a source file in for example a tree widget.
+
+"""
+
+#TODO: replace this module, get data from the syntax highlighter in the code editor
+
+import time, threading, re
+from pyzolib.qt import QtCore, QtGui
+import iep
+
+
+# Define regular expression patterns
+classPattern = r'^\s*' # Optional whitespace
+classPattern += r'(cp?def\s+)?' # Cython preamble + whitespace
+classPattern += r'class\s+' # The class keyword + whitespace
+classPattern += r'([a-zA-Z_][a-zA-Z_0-9]*)\s*' # The NAME + optional whitespace
+classPattern += r'(\(.*?\))?' # The superclass(es)
+classPattern += r'\s*:' # Optional whitespace and the colon
+#
+defPattern = r'^\s*' # Optional whitespace
+defPattern += r'(cp?)?def\s+' # The Cython preamble, def keyword and whitespace
+defPattern += r'([a-zA-Z_][\*a-zA-Z_0-9]*\s+)?' # Optional Cython return type
+defPattern += r'([a-zA-Z_][a-zA-Z_0-9]*)\s*' # The NAME + optional whitespace
+defPattern += r'\((.*?)\)' # The SIGNATURE
+#defPattern += r'\s*:' # Optional whitespace and the colon
+# Leave the colon, easier for cython
+
+class Job:
+ """ Simple class to represent a job. """
+ def __init__(self, text, editorId):
+ self.text = text
+ self.editorId = editorId
+
+
+class Result:
+ """ Simple class to represent a parser result. """
+ def __init__(self, rootItem, importList, editorId):
+ self.rootItem = rootItem
+ self.importList = importList
+ self.editorId = editorId
+
+ def isMatch(self, editorId):
+ """ isMatch(editorId):
+ Returns whether the result matches with the given editorId.
+ The editorId can also be an editor instance. """
+ if isinstance(editorId, int):
+ return self.editorId == editorId
+ else:
+ return self.editorId == id(editorId)
+
+
+class Parser(threading.Thread):
+ """ Parser
+ Parsing sourcecode in a separate thread, this class obtains
+ introspection informarion. This class is also the interface
+ to the parsed information; it has methods that can be used
+ to extract information from the result.
+ """
+
+ def __init__(self):
+ threading.Thread.__init__(self)
+
+ # Reference current job
+ self._job = None
+
+ # Reference to last result
+ self._result = None
+
+ # Lock to enable save threading
+ self._lock = threading.RLock()
+
+ # Set deamon
+ self.daemon = True
+ self._exit = False
+
+
+ def stop(self, timeout=1.0):
+ self._exit = True
+ self.join(timeout)
+
+
+ def parseThis(self, editor):
+ """ parseThis(editor)
+ Give the parser new text to parse.
+ If the parser is busy parsing text, it will stop doing that
+ and start anew with the most recent version of the text.
+ """
+
+ # Get text
+ text = editor.toPlainText()
+
+ # Make job
+ self._lock.acquire()
+ self._job = Job(text, id(editor))
+ self._lock.release()
+
+
+ def getFictiveNameSpace(self, editor):
+ """ getFictiveNameSpace(editor)
+ Produce the fictive namespace, based on the current position.
+ A list of names is returned.
+ """
+
+ # Obtain result
+ result = self._getResult()
+ if result is None or not result.isMatch(editor):
+ return []
+
+ # Get linenr and indent. These are used to establish the namespace
+ # based on indentation.
+ cursor = editor.textCursor()
+ linenr = cursor.blockNumber()
+ index = cursor.positionInBlock()
+
+ # init empty namespace and item list
+ namespace = [];
+ items = result.rootItem.children
+ curIsClass = False # to not add methods (of classes)
+
+ while items:
+ curitem = None
+ for item in items:
+ # append name
+ if not curIsClass and item.type in ['class', 'def']:
+ namespace.append( item.name )
+ # check if this is the one only last one remains
+ if (item.type in ['class', 'def'] and
+ item.linenr <= linenr and item.linenr2 > linenr):
+ curitem = item
+ # prepare for next round
+ if curitem and curitem.indent < index:
+ items = curitem.children
+ if curitem.type=='class':
+ curIsClass = True
+ else:
+ curIsClass = False
+ else:
+ items = []
+
+ return namespace
+
+
+ def getFictiveClass(self, name, editor, handleSelf=False):
+ """ getFictiveClass(name, editor, handleSelf=False)
+ Return the fictive class object of the given name, or None
+ if it does not exist. If handleSelf is True, automatically
+ handles "self." names.
+ """
+ return self._getFictiveItem(name, 'class', editor, handleSelf)
+
+
+ def getFictiveSignature(self, name, editor, handleSelf=False):
+ """ getFictiveSignature(name, editor, handleSelf=False)
+ Get the signature of the fictive function or method of the
+ given name. Returns None if the given name is not a known
+ function or method. If handleSelf is True, automatically
+ handles "self." names.
+ """
+ # Get item being a function
+ item = self._getFictiveItem(name, 'def', editor, handleSelf)
+
+ # Get item being a class
+ if not item:
+ item = self._getFictiveItem(name, 'class', editor, handleSelf)
+ if item:
+ for subItem in item.children:
+ if subItem.name == '__init__' and subItem.type == 'def':
+ item = subItem
+ break
+ else:
+ item = None
+
+ # Process or return None if there was no item
+ if item:
+ nameParts = name.split('.')
+ return '{}({})'.format(nameParts[-1], item.sig)
+ else:
+ return None
+
+
+ def getFictiveImports(self, editor):
+ """ getFictiveImports(editor)
+ Get the fictive imports of this source file.
+ tuple:
+ - list of names that are imported,
+ - a dict with the line to import each name
+ """
+
+ # Obtain result
+ result = self._getResult()
+ if result is None or not result.isMatch(editor):
+ return [], []
+
+ # Extract list of names and dict of lines
+ imports = []
+ importlines = {}
+ for item in result.importList:
+ imports.append(item.name)
+ importlines[item.name] = item.text
+ return imports, importlines
+
+
+ def _getResult(self):
+ """ getResult()
+ Savely Obtain result.
+ """
+ self._lock.acquire()
+ result = self._result
+ self._lock.release()
+ return result
+
+
+ def _getFictiveItem(self, name, type, editor, handleSelf=False):
+ """ _getFictiveItem(name, type, editor, handleSelf=False)
+ Obtain the fictive item of the given name and type.
+ If handleSelf is True, will handle "self." correctly.
+ Intended for internal use.
+ """
+
+ # Obtain result
+ result = self._getResult()
+ if result is None or not result.isMatch(editor):
+ return None
+
+ # Split name in parts
+ nameParts = name.split('.')
+
+ # Try if the first part represents a class instance
+ if handleSelf:
+ item = self._getFictiveCurrentClass(editor, nameParts[0])
+ if item:
+ nameParts[0] = item.name
+
+ # Init
+ name = nameParts.pop(0)
+ items = result.rootItem.children
+ theItem = None
+
+ # Search for name
+ while items:
+ for item in items:
+ if item.name == name:
+ # Found it
+ if nameParts:
+ # Go down one level
+ name = nameParts.pop(0)
+ items = item.children
+ break
+ else:
+ # This is it, is it what we wanted?
+ if item.type == type:
+ theItem = item
+ items = []
+ break
+ else:
+ # Did not find it
+ items = []
+
+ return theItem
+
+
+ def _getFictiveCurrentClass(self, editor, selfname):
+ """ _getFictiveCurrentClass(editor, selfname)
+ Get the fictive object for the class referenced
+ using selfname (usually 'self').
+ Intendef for internal use.
+ """
+
+ # Obtain result
+ result = self._getResult()
+ if result is None:
+ return None
+
+ # Get linenr and indent
+ cursor = editor.textCursor()
+ linenr = cursor.blockNumber()
+ index = cursor.positionInBlock()
+
+
+ # Init
+ items = result.rootItem.children
+ theclass = None
+
+ while items:
+ curitem = None
+ for item in items:
+ # check if this is the one only last one remains
+ if item.linenr <= linenr:
+ if not item.linenr2 > linenr:
+ continue
+ curitem = item
+ if item.type == 'def' and item.selfname==selfname:
+ theclass = item.parent
+ else:
+ break
+
+ # prepare for next round
+ if curitem and curitem.indent < index:
+ items = curitem.children
+ else:
+ items = []
+
+ # return
+ return theclass
+
+
+ def run(self):
+ """ run()
+ This is the main loop.
+ """
+
+ time.sleep(0.5)
+ try:
+ while True:
+ time.sleep(0.1)
+
+ if self._exit:
+ return
+
+ if self._job:
+
+ # Savely obtain job
+ self._lock.acquire()
+ job = self._job
+ self._job = None
+ self._lock.release()
+
+ # Analyse job
+ result = self._analyze(job)
+
+ # Savely store result
+ self._lock.acquire()
+ self._result = result
+ self._lock.release()
+
+ # Notify
+ if iep.editors is not None:
+ iep.editors.parserDone.emit()
+
+ except AttributeError:
+ pass # when python exits, time can be None...
+
+
+ def _analyze(self, job):
+ """ The core function.
+ Analyses the source code.
+ Produces:
+ - a tree of FictiveObject objects.
+ - a (flat) list of the same object
+ - a list of imports
+ """
+
+ # Remove multiline strings
+ text = washMultilineStrings(job.text)
+
+ # Split text in lines
+ lines = text.splitlines()
+ lines.insert(0,"") # so the lines start at 1
+
+ # The structure object. It will first only consist of class and defs
+ # the rest will be inserted afterwards.
+ root = FictiveObject("root", 0, -1, 'root')
+
+ # Also keep a flat list (while running this function)
+ flatList = []
+
+ # Cells and imports are inserted in the structure afterwards
+ leafs = []
+
+ # Keep a list of imports
+ importList = []
+
+ # To know when to make something new when for instance a class is defined
+ # in an if statement, we keep track of the last valid node/object:
+ # Put inside a list, so we can set it from inside a subfuncion
+ lastObject = [root]
+
+ # Define funcion to put an item in the structure in the right parent
+ def appendToStructure(object):
+ # find position in structure to insert
+ node = lastObject[0]
+ while ( (object.indent <= node.indent) and (node is not root) ):
+ node = node.parent
+ # insert object
+ flatList.append(object)
+ node.children.append(object)
+ object.parent = node
+ lastObject[0] = object
+
+ # Find objects!
+ # type can be: cell, class, def, import, var
+ for i in range( len(lines) ):
+
+ # Obtain line
+ line = lines[i]
+ linelen = len(line)
+
+ # Should we stop?
+ if self._job or self._exit:
+ break
+
+ # Remove indentation
+ tmp = line.lstrip()
+ indent = len(line) - len(tmp)
+ line = tmp.rstrip()
+
+ # Detect cells
+ if line.startswith('##'):
+ name = line[2:].lstrip()
+ item = FictiveObject('cell', i, indent, name)
+ leafs.append(item)
+ # Next! (we have to put this before the elif stuff below
+ # because it looks like a comment!)
+ continue
+
+ # Split in line and comment
+ line, tmp, cmnt = line.partition('#')
+ line, cmnt = line.rstrip(), cmnt.lower().strip()
+
+ # Detect todos
+ if cmnt and (cmnt.startswith('todo:') or cmnt.startswith('2do:') ):
+ item = FictiveObject('todo', i, indent, cmnt)
+ item.linenr2 = i+1 # a todo is active at one line only
+ leafs.append(item)
+
+ # Continue of no line left
+ if not line:
+ continue
+
+ # Find last valid node. As the indent of the root is set to -1,
+ # this will always stop at the root
+ while indent <= lastObject[0].indent:
+ lastObject[0].linenr2 = i # close object
+ lastObject[0] = lastObject[0].parent
+
+ # Make a lowercase version of the line
+ foundSomething = False
+ linel = line.lower()
+
+ # Detect classes
+ if not foundSomething:
+ classResult = re.search(classPattern, line)
+
+ if classResult:
+ foundSomething = True
+ # Get name
+ name = classResult.group(2)
+ item = FictiveObject('class', i, indent, name)
+ appendToStructure(item)
+ item.supers = []
+ item.members = []
+ # Get inheritance
+ supers = classResult.group(3)
+ if supers:
+ supers = supers[1:-1].split(',')
+ supers = [tmp.strip() for tmp in supers]
+ item.supers = [tmp for tmp in supers if tmp]
+
+ # Detect functions and methods (also multiline)
+ if (not foundSomething) and line.count('def '):
+ # Get a multiline version (for long defs)
+ multiLine = line
+ for ii in range(1,5):
+ if i+ii<len(lines): multiLine += ' '+lines[i+ii].strip()
+ # Get result
+ defResult = re.search(defPattern, multiLine)
+ if defResult:
+ # Get name
+ name = defResult.group(3)
+ item = FictiveObject('def', i, indent, name)
+ appendToStructure(item)
+ item.selfname = None # will be filled in if a valid method
+ item.sig = defResult.group(4)
+ # is it a method? -> add method to attr and find selfname
+ if item.parent.type == 'class':
+ item.parent.members.append(name)
+
+ # Find what is used as "self"
+ i2 = line.find('(')
+ i4 = line.find(",",i2)
+ if i4 < 0:
+ i4 = line.find(")",i2)
+ if i4 < 0:
+ i4 = i2
+ selfname = line[i2+1:i4].strip()
+ if selfname:
+ item.selfname = selfname
+
+ elif line.count('import '):
+ if line.startswith("import "):
+ for name in ParseImport(line[7:]):
+ item = FictiveObject('import', i, indent, name)
+ item.text = line
+ item.linenr2 = i+1 # an import is active at one line only
+ leafs.append(item)
+ importList.append(item)
+
+ elif line.startswith("from "):
+ i1 = line.find(" import ")
+ for name in ParseImport(line[i1+8:]):
+ if not IsValidName(name):
+ continue # we cannot do that!
+ item = FictiveObject('import', i, indent, name)
+ item.text = line
+ item.linenr2 = i+1 # an import is active at one line only
+ leafs.append(item)
+ importList.append(item)
+
+ elif line.count('='):
+ if lastObject[0].type=='def' and lastObject[0].selfname:
+ selfname = lastObject[0].selfname + "."
+ line = line.partition("=")[0]
+ if line.count(selfname):
+ # A lot of ifs here. If we got here, the line is part of
+ # a valid method and contains the selfname before the =.
+ # Now we need to establish whether there is a valid
+ # assignment done here...
+ parts = line.split(",") # handle tuples
+ for part in parts:
+ part = part.strip()
+ part2 = part[len(selfname):]
+ if part.startswith(selfname) and IsValidName(part2):
+ # add to the list if not already present
+ defItem = lastObject[0]
+ classItem = lastObject[0].parent
+ #
+ item = FictiveObject('attribute', i, indent, part2)
+ item.parent = defItem
+ defItem.children.append(item)
+ if part2 not in classItem.members:
+ classItem.members.append(part2)
+
+
+ ## Post processing
+
+ def getTwoItems(series, linenr):
+ """ Return the two items just above and below the
+ given linenr. The object always is a class or def.
+ """
+ # find object after linenr
+ object1, object2 = None, None # if no items at all
+ i = -1
+ for i in range(len(series)):
+ object = series[i]
+ if object.type not in ['class','def']:
+ continue
+ if object.linenr > linenr:
+ object2 = object
+ break
+ # find object just before linenr
+ for ii in range(i,-1,-1):
+ object = series[ii]
+ if object.type not in ['class','def']:
+ continue
+ if object.linenr < linenr:
+ object1 = object
+ break
+ # return result
+ return object1, object2
+
+ # insert the leafs (backwards as the last inserted is at the top)
+ for leaf in reversed(leafs):
+ ob1, ob2 = getTwoItems(flatList, leaf.linenr)
+ if ob1 is None: # also if ob2 is None
+ # insert in root
+ root.children.insert(0,leaf)
+ leaf.parent = root
+ continue
+ if ob2 is None:
+ ob2parent = root
+ else:
+ ob2parent = ob2.parent
+
+
+ # get the object IN which to insert it: ob1
+ sibling = None
+ while 1:
+ canGoDeeper = ob1 is not ob2parent
+ canGoDeeper = canGoDeeper and ob1 is not root
+ shouldGoDeeper = ob1.indent >= leaf.indent
+ shouldGoDeeper = shouldGoDeeper or ob1.linenr2 < leaf.linenr
+ if canGoDeeper and shouldGoDeeper:
+ sibling = ob1
+ ob1 = ob1.parent
+ else:
+ break
+
+ # insert into ob1, after sibling (if available)
+ L = ob1.children
+ if sibling:
+ i = L.index(sibling)
+ L.insert(i+1,leaf)
+ else:
+ L.insert(0,leaf)
+
+ # Return result
+ return Result(root, importList, job.editorId)
+
+
+
+## Helper classes and functions
+
+
+class FictiveObject:
+ """ An un-instantiated object.
+ type can be class, def, import, cell, todo
+ extra stuff:
+ class - supers, members
+ def - selfname
+ imports - text
+ cell -
+ todo -
+ attribute -
+ """
+ def __init__(self, type, linenr, indent, name):
+ self.children = []
+ self.type = type
+ self.linenr = linenr # at which line this object starts
+ self.linenr2 = 9999999 # at which line it ends
+ self.indent = indent
+ self.name = name
+ self.sig = '' # for functions and methods
+
+
+namechars = 'abcdefghijklmnopqrstuvwxyz_0123456789'
+def IsValidName(name):
+ """ Given a string, checks whether it is a
+ valid name (dots are not valid!)
+ """
+ if not name:
+ return False
+ name = name.lower()
+ if name[0] not in namechars[0:-10]:
+ return False
+ tmp = map(lambda x: x not in namechars, name[2:])
+ return sum(tmp)==0
+
+
+def ParseImport(names):
+ for part in names.split(","):
+ i1 = part.find(' as ')
+ if i1>0:
+ name = part[i1+3:].strip()
+ else:
+ name = part.strip()
+ yield name
+
+
+def findString(text, s, i):
+ """ findString(text, s)
+ Find s in text, but only if s is not in a string or commented
+ Helper function for washMultilineStrings """
+
+ while True:
+ i = _findString(text, s, i)
+ if i<-1:
+ i = -i+1
+ else:
+ break
+ return i
+
+
+def _findString(text, s, i):
+ """ Helper function of findString, which is called recursively
+ until a match is found, or it is clear there is no match. """
+
+ # Find occurrence
+ i2 = text.find(s, i)
+ if i2<0:
+ return -1
+
+ # Find newline (if none, we're done)
+ i1 = text.rfind('\n', 0, i2)
+ if i1<0:
+ return i2
+
+ # Extract the part on the line up to the match
+ line = text[i1:i2]
+
+ # Count quotes, we're done if we found none
+ if not line.count('"') and not line.count("'") and not line.count('#'):
+ return i2
+
+ # So we found quotes, now really count them ...
+ prev = ''
+ inString = '' # this is a boolean combined with a flag which quote was used
+ isComment = False
+ for c in line:
+ if c == '#':
+ if not inString:
+ isComment = True
+ break
+ elif c in "\"\'":
+ if not inString:
+ inString = c
+ elif prev != '\\':
+ if inString == c:
+ inString = '' # exit string
+ else:
+ pass # the other quote can savely be used inside this string
+ prev = c
+
+ # If we are in a string, this match is false ...
+ if inString or isComment:
+ return -i2 # indicate failure and where to continue
+ else:
+ return i2 # all's right
+
+
+def washMultilineStrings(text):
+ """ washMultilineStrings(text)
+ Replace all text within multiline strings with dummy chars
+ so that it is not parsed.
+ """
+ i=0
+ s1 = "'''"
+ s2 = '"""'
+ while i<len(text):
+ # Detect start of a multiline comment (there are two versions)
+ i1 = findString(text, s1, i)
+ i2 = findString(text, s2, i)
+ # Stop if nothing found ...
+ if i1 == -1 and i2 == -1:
+ break
+ else:
+ # Make no result be very large
+ if i1==-1:
+ i1 = 2**60
+ if i2==-1:
+ i2 = 2**60
+ # Find end of the multiline comment
+ if i1 < i2:
+ i3 = i1+3
+ i4 = text.find(s1, i3)
+ else:
+ i3 = i2+3
+ i4 = text.find(s2, i3)
+ # No end found -> take all text, unclosed string!
+ if i4==-1:
+ i4 = 2**32
+ # Leave only the first two quotes of the start of the comment
+ i3 -= 1
+ i4 += 3
+ # Replace all non-newline chars
+ tmp = re.sub(r'\S', ' ', text[i3:i4])
+ text = text[:i3] + tmp + text[i3+len(tmp):]
+ # Prepare for next round
+ i = i4+1
+ return text
+
+"""
+## testing skipping of multiline strings
+def ThisShouldNotBeVisible():
+ pass
+class ThisShouldNotBeVisibleEither():
+ pass
+"""
diff --git a/iep/iepcore/commandline.py b/iep/iepcore/commandline.py
new file mode 100644
index 0000000..27e1dda
--- /dev/null
+++ b/iep/iepcore/commandline.py
@@ -0,0 +1,180 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2014, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module to deal with command line arguments.
+
+In specific, this allows doing "iep some_file.py" and the file will be
+opened in an existing IEP window (if available) or a new IEP process
+is started to open the file.
+
+This module is used at the very early stages of starting IEP, and also
+in main.py to apply any command line args for the current process, and
+to closse down the server when IEP is closed.
+"""
+
+import sys
+import os
+
+from yoton.clientserver import RequestServer, do_request
+import iep
+
+# Local address to host on. we use yoton's port hash to have an arbitrary port
+ADDRESS = 'localhost:iepserver'
+
+
+class Server(RequestServer):
+ """ Server that listens on a port for commands.
+ The commands can be send by executing the IEP executable with
+ command line arguments.
+ """
+
+ def handle_request(self, request):
+ """ This is where the requests enter.
+ """
+ # Get command
+ request = request.strip()
+ command, _, arg = request.partition(' ')
+
+ # Handle command
+ try:
+ reply = handle_command(command, arg)
+ except Exception as err:
+ msg = 'Error handling request %r:\n%s' % (request, str(err))
+ iep.callLater(print, msg)
+ return msg
+ else:
+ iep.callLater(print, 'Request:', request)
+ iep.callLater(print, 'Reply:', reply)
+ return reply
+
+
+def handle_command(command, arg):
+ """ Function that handles all IEP commands.
+ This gets called either from the server, or from the code that
+ processed command line args.
+ """
+ if not command:
+ return 'empty command?'
+
+ elif command == 'testerr':
+ return 1/0
+
+ elif command == 'stopserver':
+ # For efficiently stopping the server
+ if server:
+ server.stop()
+ return 'Stopped the server'
+
+ elif command == 'echo':
+ # For testing
+ return 'echo %r' % arg
+
+ elif command == 'open':
+ # Open a file in the editor
+ if not arg:
+ return 'The open command requires a filename.'
+ iep.callLater(iep.editors.loadFile, arg)
+ return 'Opened file %r' % arg
+
+ elif command == 'new':
+ # Open a new (temp) file in the editor
+ iep.callLater(iep.editors.newFile)
+ return 'Created new file'
+
+ elif command == 'close':
+ # Close IEP
+ iep.callLater(iep.main.close)
+ return 'Closing IEP'
+
+ else:
+ # Assume the user wanted to open a file
+ fname = (command + ' ' + arg).rstrip()
+ if not iep.editors:
+ return 'Still warming up ...'
+ else:
+ iep.callLater(iep.editors.loadFile, fname)
+ return 'Try opening file %r' % fname
+
+ # We should always return. So if we get here, it is a bug.
+ # Return something so that we can be aware.
+ return 'error ' + command
+
+
+def handle_cmd_args():
+ """ Handle command line arguments by sending them to the server.
+ Returns a result string if any commands were processed, and None
+ otherwise.
+ """
+ args = sys.argv[1:]
+ request = ' '.join(args)
+ if 'psn_' in request and not os.path.isfile(request):
+ request = ' '.join(args[1:]) # An OSX thing when clicking app icon
+ request = request.strip()
+ #
+ if not request:
+ return None
+ else:
+ # Always send to server, even if we are the ones that run the server
+ try:
+ return do_request(ADDRESS, request, 0.4).rstrip()
+ except Exception as err:
+ print('Could not process command line args:\n%s' % str(err))
+ return None
+
+
+def stop_our_server():
+ """ Stop our server, for shutting down nicely.
+ This is faster than calling server.stop(), because in the latter
+ case the server will need to timeout (0.25 s) before it sees that
+ it needs to stop.
+ """
+ if is_our_server_running():
+ try:
+ server.stop() # Post a stop message
+ do_request(ADDRESS, 'stopserver', 0.1) # trigger
+ print('Stopped our command server.')
+ except Exception as err:
+ print('Failed to stop command server:')
+ print(err)
+
+
+def is_our_server_running():
+ """ Return True if our server is running. If it is, this process
+ is the main IEP; the first IEP that was started. If the server is
+ not running, this is probably not the first IEP, but there might
+ also be problem with starting the server.
+ """
+ return server and server.isAlive()
+
+
+def is_iep_server_running():
+ """ Test whether the IEP server is running *somewhere* (not
+ necesarily in this process).
+ """
+ try:
+ res = do_request(ADDRESS, 'echo', 0.2)
+ return res.startswith('echo')
+ except Exception:
+ return False
+
+
+# Shold we start the server?
+_try_start_server = True
+if sys.platform.startswith('win'):
+ _try_start_server = not is_iep_server_running()
+
+
+# Create server
+server_err = None
+server = None
+try:
+ if _try_start_server:
+ server = Server(ADDRESS)
+ server.start()
+except OSError as err:
+ server_err = err
+ server = None
+
diff --git a/iep/iepcore/compactTabWidget.py b/iep/iepcore/compactTabWidget.py
new file mode 100644
index 0000000..b09dab5
--- /dev/null
+++ b/iep/iepcore/compactTabWidget.py
@@ -0,0 +1,513 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" compact tab widget class
+
+See docs of the tab widget.
+
+"""
+
+from pyzolib.qt import QtCore, QtGui
+import sys
+
+if sys.version_info[0] < 3:
+ str = unicode
+ ELLIPSIS = unichr(8230)
+else:
+ ELLIPSIS = chr(8230)
+
+# Constants for the alignments of tabs
+MIN_NAME_WIDTH = 4
+MAX_NAME_WIDTH = 64
+
+
+## Define style sheet for the tabs
+
+STYLESHEET = """
+QTabWidget::pane { /* The tab widget frame */
+ border-top: 0px solid #A09B90;
+}
+
+QTabWidget::tab-bar {
+ left: 0px; /* move to the right by x px */
+}
+
+
+/* Style the tab using the tab sub-control. Note that
+ it reads QTabBar _not_ QTabWidget */
+QTabBar::tab {
+ background: qlineargradient(x1: 0, y1: 0, x2: 0, y2: 1,
+ stop: 0.0 rgba(220,220,220,128),
+ stop: 0.4 rgba(200,200,200,128),
+ stop: 1.0 rgba(100,100,100,128) );
+ border: 1px solid #A09B90;
+ border-bottom-color: #DAD5CC; /* same as the pane color */
+ border-top-left-radius: 4px;
+ border-top-right-radius: 4px;
+ min-width: 5ex;
+ padding-bottom: PADDING_BOTTOMpx;
+ padding-top: PADDING_TOPpx;
+ padding-left: PADDING_LEFTpx;
+ padding-right: PADDING_RIGHTpx;
+ margin-right: -1px; /* "combine" borders */
+}
+QTabBar::tab:last {
+ margin-right: 0px;
+}
+
+/* Style the selected tab, hoovered tab, and other tabs. */
+QTabBar::tab:hover {
+ background: qlineargradient(x1: 0, y1: 0, x2: 0, y2: 1,
+ stop: 0.0 rgba(245,250,255,128),
+ stop: 0.4 rgba(210,210,210,128),
+ stop: 1.0 rgba(200,200,200,128) );
+}
+QTabBar::tab:selected {
+ background: qlineargradient(x1: 0, y1: 0, x2: 0, y2: 1,
+ stop: 0.0 rgba(0,0,128,128),
+ stop: 0.12 rgba(0,0,128,128),
+ stop: 0.120001 rgba(245,250,255,128),
+ stop: 0.4 rgba(210,210,210,128),
+ stop: 1.0 rgba(200,200,200,128) );
+}
+
+QTabBar::tab:selected {
+ border-width: 1px;
+ border-bottom-width: 0px;
+ border-top-left-radius: 5px;
+ border-top-right-radius: 5px;
+ border-color: #333;
+}
+
+QTabBar::tab:!selected {
+ margin-top: 3px; /* make non-selected tabs look smaller */
+}
+
+"""
+
+## Define tab widget class
+
+class TabData:
+ """ To keep track of real names of the tabs, but also keep supporting
+ tabData.
+ """
+ def __init__(self, name):
+ self.name = name
+ self.data = None
+
+
+class CompactTabBar(QtGui.QTabBar):
+ """ CompactTabBar(parent, *args, padding=(4,4,6,6), preventEqualTexts=True)
+
+ Tab bar corresponcing to the CompactTabWidget.
+
+ With the "padding" argument the padding of the tabs can be chosen.
+ It should be an integer, or a 4 element tuple specifying the padding
+ for top, bottom, left, right. When a tab has a button,
+ the padding is the space between button and text.
+
+ With preventEqualTexts to True, will reduce the amount of eliding if
+ two tabs have (partly) the same name, so that they can always be
+ distinguished.
+
+ """
+
+ # Add signal to be notified of double clicks on tabs
+ tabDoubleClicked = QtCore.Signal(int)
+ barDoubleClicked = QtCore.Signal()
+
+ def __init__(self, *args, padding=(4,4,6,6), preventEqualTexts=True):
+ QtGui.QTabBar.__init__(self, *args)
+
+ # Put tab widget in document mode
+ self.setDocumentMode(True)
+
+ # Widget needs to draw its background (otherwise Mac has a dark bg)
+ self.setDrawBase(False)
+ if sys.platform == 'darwin':
+ self.setAutoFillBackground(True)
+
+ # Set whether we want to prevent eliding for names that start the same.
+ self._preventEqualTexts = preventEqualTexts
+
+ # Allow moving tabs around
+ self.setMovable(True)
+
+ # Get padding
+ if isinstance(padding, (int, float)):
+ padding = padding, padding, padding, padding
+ elif isinstance(padding, (tuple, list)):
+ pass
+ else:
+ raise ValueError('Invalid value for padding.')
+
+ # Set style sheet
+ stylesheet = STYLESHEET
+ stylesheet = stylesheet.replace('PADDING_TOP', str(padding[0]))
+ stylesheet = stylesheet.replace('PADDING_BOTTOM', str(padding[1]))
+ stylesheet = stylesheet.replace('PADDING_LEFT', str(padding[2]))
+ stylesheet = stylesheet.replace('PADDING_RIGHT', str(padding[3]))
+ self.setStyleSheet(stylesheet)
+
+ # We do our own eliding
+ self.setElideMode(QtCore.Qt.ElideNone)
+
+ # Make tabs wider if there's plenty space?
+ self.setExpanding(False)
+
+ # If there's not enough space, use scroll buttons
+ self.setUsesScrollButtons(True)
+
+ # When a tab is removed, select previous
+ self.setSelectionBehaviorOnRemove(self.SelectPreviousTab)
+
+ # Init alignment parameters
+ self._alignWidth = MIN_NAME_WIDTH # Width in characters
+ self._alignWidthIsReducing = False # Whether in process of reducing
+
+ # Create timer for aligning
+ self._alignTimer = QtCore.QTimer(self)
+ self._alignTimer.setInterval(10)
+ self._alignTimer.setSingleShot(True)
+ self._alignTimer.timeout.connect(self._alignRecursive)
+
+
+ def _compactTabBarData(self, i):
+ """ _compactTabBarData(i)
+
+ Get the underlying tab data for tab i. Only for internal use.
+
+ """
+
+ # Get current TabData instance
+ tabData = QtGui.QTabBar.tabData(self, i)
+ if (tabData is not None) and hasattr(tabData, 'toPyObject'):
+ tabData = tabData.toPyObject() # Older version of Qt
+
+ # If none, make it as good as we can
+ if not tabData:
+ name = str(QtGui.QTabBar.tabText(self, i))
+ tabData = TabData( name )
+ QtGui.QTabBar.setTabData(self, i, tabData)
+
+ # Done
+ return tabData
+
+
+ ## Overload a few methods
+
+ def mouseDoubleClickEvent(self, event):
+ i = self.tabAt(event.pos())
+ if i == -1:
+ # There was no tab under the cursor
+ self.barDoubleClicked.emit()
+ else:
+ # Tab was double clicked
+ self.tabDoubleClicked.emit(i)
+
+
+ def setTabData(self, i, data):
+ """ setTabData(i, data)
+
+ Set the given object at the tab with index 1.
+
+ """
+ # Get underlying python instance
+ tabData = self._compactTabBarData(i)
+
+ # Attach given data
+ tabData.data = data
+
+
+ def tabData(self, i):
+ """ tabData(i)
+
+ Get the tab data at item i. Always returns a Python object.
+
+ """
+
+ # Get underlying python instance
+ tabData = self._compactTabBarData(i)
+
+ # Return stored data
+ return tabData.data
+
+
+ def setTabText(self, i, text):
+ """ setTabText(i, text)
+
+ Set the text for tab i.
+
+ """
+ tabData = self._compactTabBarData(i)
+ if text != tabData.name:
+ tabData.name = text
+ self.alignTabs()
+
+
+ def tabText(self, i):
+ """ tabText(i)
+
+ Get the title of the tab at index i.
+
+ """
+ tabData = self._compactTabBarData(i)
+ return tabData.name
+
+
+ ## Overload events and protected functions
+
+ def tabInserted(self, i):
+ QtGui.QTabBar.tabInserted(self, i)
+
+ # Is called when a tab is inserted
+
+ # Get given name and store
+ name = str(QtGui.QTabBar.tabText(self, i))
+ tabData = TabData(name)
+ QtGui.QTabBar.setTabData(self, i, tabData)
+
+ # Update
+ self.alignTabs()
+
+
+ def tabRemoved(self, i):
+ QtGui.QTabBar.tabRemoved(self, i)
+
+ # Update
+ self.alignTabs()
+
+
+ def resizeEvent(self, event):
+ QtGui.QTabBar.resizeEvent(self, event)
+ self.alignTabs()
+
+
+ def showEvent(self, event):
+ QtGui.QTabBar.showEvent(self, event)
+ self.alignTabs()
+
+
+ ## For aligning
+
+ def alignTabs(self):
+ """ alignTabs()
+
+ Align the tab items. Their names are ellided if required so that
+ all tabs fit on the tab bar if possible. When there is too little
+ space, the QTabBar will kick in and draw scroll arrows.
+
+ """
+
+ # Set name widths correct (in case new names were added)
+ self._setMaxWidthOfAllItems()
+
+ # Start alignment process
+ self._alignWidthIsReducing = False
+ self._alignTimer.start()
+
+
+ def _alignRecursive(self):
+ """ _alignRecursive()
+
+ Recursive alignment of the items. The alignment process
+ should be initiated from alignTabs().
+
+ """
+
+ # Only if visible
+ if not self.isVisible():
+ return
+
+ # Get tab bar and number of items
+ N = self.count()
+
+ # Get right edge of last tab and left edge of corner widget
+ pos1 = self.tabRect(0).topLeft()
+ pos2 = self.tabRect(N-1).topRight()
+ cornerWidget = self.parent().cornerWidget()
+ if cornerWidget:
+ pos3 = cornerWidget.pos()
+ else:
+ pos3 = QtCore.QPoint(self.width(), 0)
+ x1 = pos1.x()
+ x2 = pos2.x()
+ x3 = pos3.x()
+ alignMargin = x3 - (x2-x1) -3 # Must be positive (has margin)
+
+ # Are the tabs too wide?
+ if alignMargin < 0:
+ # Tabs extend beyond corner widget
+
+ # Reduce width then
+ self._alignWidth -= 1
+ self._alignWidth = max(self._alignWidth, MIN_NAME_WIDTH)
+
+ # Apply
+ self._setMaxWidthOfAllItems()
+ self._alignWidthIsReducing = True
+
+ # Try again if there's still room for reduction
+ if self._alignWidth > MIN_NAME_WIDTH:
+ self._alignTimer.start()
+
+ elif alignMargin > 10 and not self._alignWidthIsReducing:
+ # Gap between tabs and corner widget is a bit large
+
+ # Increase width then
+ self._alignWidth += 1
+ self._alignWidth = min(self._alignWidth, MAX_NAME_WIDTH)
+
+ # Apply
+ itemsElided = self._setMaxWidthOfAllItems()
+
+ # Try again if there's still room for increment
+ if itemsElided and self._alignWidth < MAX_NAME_WIDTH:
+ self._alignTimer.start()
+ #self._alignTimer.timeout.emit()
+
+ else:
+ pass # margin is good
+
+
+ def _getAllNames(self):
+ """ _getAllNames()
+
+ Get a list of all (full) tab names.
+
+ """
+ return [self._compactTabBarData(i).name for i in range(self.count())]
+
+
+ def _setMaxWidthOfAllItems(self):
+ """ _setMaxWidthOfAllItems()
+
+ Sets the maximum width of all items now, by eliding the names.
+ Returns whether any items were elided.
+
+ """
+
+ # Prepare for measuring font sizes
+ font = self.font()
+ metrics = QtGui.QFontMetrics(font)
+
+ # Get whether an item was reduced in size
+ itemReduced = False
+
+ for i in range(self.count()):
+
+ # Get width
+ w = self._alignWidth
+
+ # Get name
+ name = name0 = self._compactTabBarData(i).name
+
+ # Check if we can reduce the name size, correct w if necessary
+ if ( (w+1) < len(name0) ) and self._preventEqualTexts:
+
+ # Increase w untill there are no names that start the same
+ allNames = self._getAllNames()
+ hasSimilarNames = True
+ diff = 2
+ w -= 1
+ while hasSimilarNames and w < len(name0):
+ w += 1
+ w2 = w - (diff-1)
+ shortName = name[:w2]
+ similarnames = [n for n in allNames if n[:w2]==shortName]
+ hasSimilarNames = len(similarnames)>1
+
+ # Check again, with corrected w
+ if (w+1) < len(name0):
+ name = name[:w] + ELLIPSIS
+ itemReduced = True
+
+ # Set text now
+ QtGui.QTabBar.setTabText(self, i, name)
+
+ # Done
+ return itemReduced
+
+
+
+class CompactTabWidget(QtGui.QTabWidget):
+ """ CompactTabWidget(parent, *args, **kwargs)
+
+ Implements a tab widget with a tabbar that is in document mode
+ and has more compact tabs that conventional tab widgets, so more
+ items fit on the same space.
+
+ Further much care is taken to ellide the names in a smart way:
+ * All items are allowed the same amount of characters instead of
+ that the same amount of characters is removed from all names.
+ * If there are two item with the same beginning, it is made
+ sure that enough characters are shown such that the names
+ can be distinguished.
+
+ The kwargs are passed to the tab bar constructor. There are a few
+ keywords arguments to influence the appearance of the tabs. See the
+ CompactTabBar class.
+
+ """
+
+ def __init__(self, *args, **kwargs):
+ QtGui.QTabWidget.__init__(self, *args)
+
+ # Set tab bar
+ self.setTabBar(CompactTabBar(self, **kwargs))
+
+ # Draw tabs at the top by default
+ self.setTabPosition(QtGui.QTabWidget.North)
+
+
+ def setTabData(self, i, data):
+ """ setTabData(i, data)
+
+ Set the given object at the tab with index 1.
+
+ """
+ self.tabBar().setTabData(i, data)
+
+
+ def tabData(self, i):
+ """ tabData(i)
+
+ Get the tab data at item i. Always returns a Python object.
+
+ """
+ return self.tabBar().tabData(i)
+
+
+ def setTabText(self, i, text):
+ """ setTabText(i, text)
+
+ Set the text for tab i.
+
+ """
+ self.tabBar().setTabText(i, text)
+
+
+ def tabText(self, i):
+ """ tabText(i)
+
+ Get the title of the tab at index i.
+
+ """
+ return self.tabBar().tabText(i)
+
+
+if __name__ == '__main__':
+
+ w = CompactTabWidget()
+ w.show()
+
+ w.addTab(QtGui.QWidget(w), 'aapenootjedopje')
+ w.addTab(QtGui.QWidget(w), 'aapenootjedropje')
+ w.addTab( QtGui.QWidget(w), 'noot en mies')
+ w.addTab( QtGui.QWidget(w), 'boom bijv een iep')
+ w.addTab( QtGui.QWidget(w), 'roosemarijnus')
+ w.addTab( QtGui.QWidget(w), 'vis')
+ w.addTab( QtGui.QWidget(w), 'vuurvuurvuur')
diff --git a/iep/iepcore/editor.py b/iep/iepcore/editor.py
new file mode 100644
index 0000000..9b5dec3
--- /dev/null
+++ b/iep/iepcore/editor.py
@@ -0,0 +1,711 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module editor
+
+Defines the IepEditor class which is used to edit documents.
+This module/class also implements all the relatively low level
+file loading/saving /reloading stuff.
+
+"""
+
+import os, sys
+import re, codecs
+
+from pyzolib.qt import QtCore, QtGui
+qt = QtGui
+
+from iep.codeeditor import Manager
+from iep.iepcore.menu import EditorContextMenu
+from iep.iepcore.baseTextCtrl import BaseTextCtrl, normalizePath
+from iep.iepcore.iepLogging import print
+import iep
+
+
+
+# Set default line ending (if not set)
+if not iep.config.settings.defaultLineEndings:
+ if sys.platform.startswith('win'):
+ iep.config.settings.defaultLineEndings = 'CRLF'
+ else:
+ iep.config.settings.defaultLineEndings = 'LF'
+
+
+def determineEncoding(bb):
+ """ Get the encoding used to encode a file.
+ Accepts the bytes of the file. Returns the codec name. If the
+ codec could not be determined, uses UTF-8.
+ """
+
+ # Init
+ firstTwoLines = bb.split(b'\n', 2)[:2]
+ encoding = 'UTF-8'
+
+ for line in firstTwoLines:
+
+ # Try to make line a string
+ try:
+ line = line.decode('ASCII').strip()
+ except Exception:
+ continue
+
+ # Has comment?
+ if line and line[0] == '#':
+
+ # Matches regular expression given in PEP 0263?
+ expression = "coding[:=]\s*([-\w.]+)"
+ result = re.search(expression, line)
+ if result:
+
+ # Is it a known encoding? Correct name if it is
+ candidate_encoding = result.group(1)
+ try:
+ c = codecs.lookup(candidate_encoding)
+ candidate_encoding = c.name
+ except Exception:
+ pass
+ else:
+ encoding = candidate_encoding
+
+ # Done
+ return encoding
+
+
+def determineLineEnding(text):
+ """ Get the line ending style used in the text.
+ \n, \r, \r\n,
+ The EOLmode is determined by counting the occurrences of each
+ line ending...
+ """
+ # test line ending by counting the occurrence of each
+ c_win = text.count("\r\n")
+ c_mac = text.count("\r") - c_win
+ c_lin = text.count("\n") - c_win
+ # set the appropriate style
+ if c_win > c_mac and c_win > c_lin:
+ mode = '\r\n'
+ elif c_mac > c_win and c_mac > c_lin:
+ mode = '\r'
+ else:
+ mode = '\n'
+
+ # return
+ return mode
+
+
+def determineIndentation(text):
+ """ Get the indentation used in this document.
+ The text is analyzed to find the most used
+ indentations.
+ The result is -1 if tab indents are most common.
+ A positive result means spaces are used; the amount
+ signifies the amount of spaces per indentation.
+ 0 is returned if the indentation could not be determined.
+ """
+
+ # create dictionary of indents, -1 means a tab
+ indents = {}
+ indents[-1] = 0
+
+ lines = text.splitlines()
+ lines.insert(0,"") # so the lines start at 1
+ for i in range( len(lines) ):
+ line = lines[i]
+ linelen = len(line)
+
+ # remove indentation
+ tmp = line.lstrip()
+ indent = len(line) - len(tmp)
+ line = tmp.rstrip()
+
+ if line.startswith('#'):
+ continue
+ else:
+ # remove everything after the #
+ line = line.split("#",1)[0].rstrip()
+ if not line:
+ # continue of no line left
+ continue
+
+ # a colon means there will be an indent
+ # check the next line (or the one thereafter)
+ # and calculate the indentation difference with THIS line.
+ if line.endswith(":"):
+ if len(lines) > i+2:
+ line2 = lines[i+1]
+ tmp = line2.lstrip()
+ if not tmp:
+ line2 = lines[i+2]
+ tmp = line2.lstrip()
+ if tmp:
+ ind2 = len(line2)-len(tmp)
+ ind3 = ind2 - indent
+ if line2.startswith("\t"):
+ indents[-1] += 1
+ elif ind3>0:
+ if not ind3 in indents:
+ indents[ind3] = 1
+ indents[ind3] += 1
+
+ # find which was the most common tab width.
+ indent, maxvotes = 0,0
+ for nspaces in indents:
+ if indents[nspaces] > maxvotes:
+ indent, maxvotes = nspaces, indents[nspaces]
+ #print "found tabwidth %i" % indent
+ return indent
+
+
+# To give each new file a unique name
+newFileCounter = 0
+
+def createEditor(parent, filename=None):
+ """ Tries to load the file given by the filename and
+ if succesful, creates an editor instance to put it in,
+ which is returned.
+ If filename is None, an new/unsaved/temp file is created.
+ """
+
+ if filename is None:
+
+ # Increase counter
+ global newFileCounter
+ newFileCounter += 1
+
+ # Create editor
+ editor = IepEditor(parent)
+ editor.document().setModified(True)
+
+ # Set name
+ editor._name = "<tmp {}>".format(newFileCounter)
+
+ else:
+
+ # check and normalize
+ if not os.path.isfile(filename):
+ raise IOError("File does not exist '%s'." % filename)
+
+ # load file (as bytes)
+ with open(filename, 'rb') as f:
+ bb = f.read()
+ f.close()
+
+ # convert to text, be gentle with files not encoded with utf-8
+ encoding = determineEncoding(bb)
+ text = bb.decode(encoding,'replace')
+
+ # process line endings
+ lineEndings = determineLineEnding(text)
+
+ # if we got here safely ...
+
+ # create editor and set text
+ editor = IepEditor(parent)
+ editor.setPlainText(text)
+ editor.lineEndings = lineEndings
+ editor.encoding = encoding
+ editor.document().setModified(False)
+
+ # store name and filename
+ editor._filename = filename
+ editor._name = os.path.split(filename)[1]
+
+ # process indentation
+ indentWidth = determineIndentation(text)
+ if indentWidth == -1: #Tabs
+ editor.setIndentWidth(iep.config.settings.defaultIndentWidth)
+ editor.setIndentUsingSpaces(False)
+ elif indentWidth:
+ editor.setIndentWidth(indentWidth)
+ editor.setIndentUsingSpaces(True)
+
+ if editor._filename:
+ editor._modifyTime = os.path.getmtime(editor._filename)
+
+ # Set parser
+ if editor._filename:
+ ext = os.path.splitext(editor._filename)[1]
+ parser = Manager.suggestParserfromFilenameExtension(ext)
+ editor.setParser(parser)
+ else:
+ # todo: rename style -> parser
+ editor.setParser(iep.config.settings.defaultStyle)
+
+
+ # return
+ return editor
+
+class IepEditor(BaseTextCtrl):
+
+ # called when dirty changed or filename changed, etc
+ somethingChanged = QtCore.Signal()
+
+ def __init__(self, parent, **kwds):
+ super().__init__(parent, showLineNumbers = True, **kwds)
+
+ # Init filename and name
+ self._filename = ''
+ self._name = '<TMP>'
+
+ # View settings
+ self.setShowWhitespace(iep.config.view.showWhitespace)
+ #TODO: self.setViewWrapSymbols(view.showWrapSymbols)
+ self.setShowLineEndings(iep.config.view.showLineEndings)
+ self.setShowIndentationGuides(iep.config.view.showIndentationGuides)
+ #
+ self.setWrap(bool(iep.config.view.wrap))
+ self.setHighlightCurrentLine(iep.config.view.highlightCurrentLine)
+ self.setLongLineIndicatorPosition(iep.config.view.edgeColumn)
+ #TODO: self.setFolding( int(view.codeFolding)*5 )
+ # bracematch is set in baseTextCtrl, since it also applies to shells
+ # dito for zoom and tabWidth
+
+
+ # Set line endings to default
+ self.lineEndings = iep.config.settings.defaultLineEndings
+
+ # Set encoding to default
+ self.encoding = 'UTF-8'
+
+ # Modification time to test file change
+ self._modifyTime = 0
+
+ self.modificationChanged.connect(self._onModificationChanged)
+
+ # To see whether the doc has changed to update the parser.
+ self.textChanged.connect(self._onModified)
+
+ # This timer is used to hide the marker that shows which code is executed
+ self._showRunCursorTimer = QtCore.QTimer()
+
+ # Add context menu (the offset is to prevent accidental auto-clicking)
+ self._menu = EditorContextMenu(self)
+ self.setContextMenuPolicy(QtCore.Qt.CustomContextMenu)
+ self.customContextMenuRequested.connect(lambda p: self._menu.popup(self.mapToGlobal(p)+QtCore.QPoint(0,3)))
+
+
+ ## Properties
+
+ @property
+ def name(self):
+ return self._name
+
+ @property
+ def filename(self):
+ return self._filename
+
+ @property
+ def lineEndings(self):
+ """
+ Line-endings style of this file. Setter accepts machine-readable (e.g. '\r') and human-readable (e.g. 'CR') input
+ """
+ return self._lineEndings
+
+ @lineEndings.setter
+ def lineEndings(self,value):
+ if value in ('\r','\n','\r\n'):
+ self._lineEndings = value
+ return
+ try:
+ self._lineEndings = {'CR': '\r', 'LF': '\n', 'CRLF': '\r\n'}[value]
+ except KeyError:
+ raise ValueError('Invalid line endings style %r' % value)
+
+ @property
+ def lineEndingsHumanReadable(self):
+ """
+ Current line-endings style, human readable (e.g. 'CR')
+ """
+ return {'\r': 'CR', '\n': 'LF', '\r\n': 'CRLF'}[self.lineEndings]
+
+
+ @property
+ def encoding(self):
+ """ Encoding used to convert the text of this file to bytes.
+ """
+ return self._encoding
+
+
+ @encoding.setter
+ def encoding(self, value):
+ # Test given value, correct name if it exists
+ try:
+ c = codecs.lookup(value)
+ value = c.name
+ except Exception:
+ value = codecs.lookup('UTF-8').name
+ # Store
+ self._encoding = value
+
+
+ ##
+
+
+ def justifyText(self):
+ """ Overloaded version of justifyText to make it use our
+ configurable justificationwidth.
+ """
+ super().justifyText(iep.config.settings.justificationWidth)
+
+
+ def showRunCursor(self, cursor):
+ """
+ Momentarily highlight a piece of code to show that this is being executed
+ """
+
+ extraSelection = QtGui.QTextEdit.ExtraSelection()
+ extraSelection.cursor = cursor
+ extraSelection.format.setBackground(QtCore.Qt.gray)
+ self.setExtraSelections([extraSelection])
+
+ self._showRunCursorTimer.singleShot(200, lambda: self.setExtraSelections([]))
+
+
+ def id(self):
+ """ Get an id of this editor. This is the filename,
+ or for tmp files, the name. """
+ if self._filename:
+ return self._filename
+ else:
+ return self._name
+
+
+ def focusInEvent(self, event):
+ """ Test whether the file has been changed 'behind our back'
+ """
+ # Act normally to the focus event
+ BaseTextCtrl.focusInEvent(self, event)
+ # Test file change
+ self.testWhetherFileWasChanged()
+
+
+ def testWhetherFileWasChanged(self):
+ """ testWhetherFileWasChanged()
+ Test to see whether the file was changed outside our backs,
+ and let the user decide what to do.
+ Returns True if it was changed.
+ """
+
+ # get the path
+ path = self._filename
+ if not os.path.isfile(path):
+ # file is deleted from the outside
+ return
+
+ # test the modification time...
+ mtime = os.path.getmtime(path)
+ if mtime != self._modifyTime:
+
+ # ask user
+ dlg = QtGui.QMessageBox(self)
+ dlg.setWindowTitle('File was changed')
+ dlg.setText("File has been modified outside of the editor:\n"+
+ self._filename)
+ dlg.setInformativeText("Do you want to reload?")
+ t=dlg.addButton("Reload", QtGui.QMessageBox.AcceptRole) #0
+ dlg.addButton("Keep this version", QtGui.QMessageBox.RejectRole) #1
+ dlg.setDefaultButton(t)
+
+ # whatever the result, we will reset the modified time
+ self._modifyTime = os.path.getmtime(path)
+
+ # get result and act
+ result = dlg.exec_()
+ if result == QtGui.QMessageBox.AcceptRole:
+ self.reload()
+ else:
+ pass # when cancelled or explicitly said, do nothing
+
+ # Return that indeed the file was changes
+ return True
+
+ def _onModificationChanged(self,changed):
+ """Handler for the modificationChanged signal. Emit somethingChanged
+ for the editorStack to update the modification notice."""
+ self.somethingChanged.emit()
+
+ def _onModified(self):
+ iep.parser.parseThis(self)
+
+
+ def dragMoveEvent(self, event):
+ """ Otherwise cursor can get stuck.
+ https://bitbucket.org/iep-project/iep/issue/252
+ https://qt-project.org/forums/viewthread/3180
+ """
+ if event.mimeData().hasUrls():
+ event.acceptProposedAction()
+ else:
+ BaseTextCtrl.dropEvent(self, event)
+
+
+ def dropEvent(self, event):
+ """ Drop files in the list. """
+ if event.mimeData().hasUrls():
+ # file: let the editorstack do the work.
+ iep.editors.dropEvent(event)
+ else:
+ # text: act normal
+ BaseTextCtrl.dropEvent(self, event)
+
+
+ def showEvent(self, event=None):
+ """ Capture show event to change title. """
+ # Act normally
+ if event:
+ BaseTextCtrl.showEvent(self, event)
+
+ # Make parser update
+ iep.parser.parseThis(self)
+
+
+ def setTitleInMainWindow(self):
+ """ set the title text in the main window to show filename. """
+
+ # compose title
+ name, path = self._name, self._filename
+ if path:
+ iep.main.setMainTitle(path)
+ else:
+ iep.main.setMainTitle(name)
+
+
+ def save(self, filename=None):
+ """ Save the file. No checking is done. """
+
+ # get filename
+ if filename is None:
+ filename = self._filename
+ if not filename:
+ raise ValueError("No filename specified, and no filename known.")
+
+ # Test whether it was changed without us knowing. If so, dont save now.
+ if self.testWhetherFileWasChanged():
+ return
+
+ # Get text
+ text = self.toPlainText()
+
+ # Convert line endings (optionally remove trailing whitespace
+ if iep.config.settings.removeTrailingWhitespaceWhenSaving:
+ lines = []
+ for line in text.splitlines():
+ lines.append(line.rstrip())
+ text = self.lineEndings.join(lines)
+ self.setPlainText(text)
+ else:
+ text.replace('\n', self.lineEndings)
+
+ # Make bytes
+ bb = text.encode(self.encoding)
+
+ # Store
+ f = open(filename, 'wb')
+ try:
+ f.write(bb)
+ finally:
+ f.close()
+
+ # Update stats
+ self._filename = normalizePath( filename )
+ self._name = os.path.split(self._filename)[1]
+ self.document().setModified(False)
+ self._modifyTime = os.path.getmtime(self._filename)
+
+ # update title (in case of a rename)
+ self.setTitleInMainWindow()
+
+ # allow item to update its texts (no need: onModifiedChanged does this)
+ #self.somethingChanged.emit()
+
+
+ def reload(self):
+ """ Reload text using the self._filename.
+ We do not have a load method; we first try to load the file
+ and only when we succeed create an editor to show it in...
+ This method is only for reloading in case the file was changed
+ outside of the editor. """
+
+ # We can only load if the filename is known
+ if not self._filename:
+ return
+ filename = self._filename
+
+ # Remember where we are
+ cursor = self.textCursor()
+ linenr = cursor.blockNumber() + 1
+ index = cursor.positionInBlock()
+
+ # Load file (as bytes)
+ with open(filename, 'rb') as f:
+ bb = f.read()
+
+ # Convert to text
+ text = bb.decode('UTF-8')
+
+ # Process line endings (before setting the text)
+ self.lineEndings= determineLineEnding(text)
+
+ # Set text
+ self.setPlainText(text)
+ self.document().setModified(False)
+
+ # Go where we were (approximately)
+ self.gotoLine(linenr)
+
+ def deleteLines(self):
+ cursor = self.textCursor()
+ # Find start and end of selection
+ start = cursor.selectionStart()
+ end = cursor.selectionEnd()
+ # Expand selection: from start of first block to start of next block
+ cursor.setPosition(start)
+ cursor.movePosition(cursor.StartOfBlock)
+ cursor.setPosition(end, cursor.KeepAnchor)
+ cursor.movePosition(cursor.NextBlock, cursor.KeepAnchor)
+
+ cursor.removeSelectedText()
+
+
+ def commentCode(self):
+ """
+ Comment the lines that are currently selected
+ """
+ self.doForSelectedBlocks(
+ lambda cursor: cursor.insertText('# ') )
+
+
+ def uncommentCode(self):
+ """
+ Uncomment the lines that are currently selected
+ """
+ #TODO: this should not be applied to lines that are part of a multi-line string
+
+ #Define the uncomment function to be applied to all blocks
+ def uncommentBlock(cursor):
+ """
+ Find the first # on the line; if there is just whitespace before it,
+ remove the # and if it is followed by a space remove the space, too
+ """
+ text = cursor.block().text()
+ commentStart = text.find('#')
+ if commentStart == -1:
+ return #No comment on this line
+ if text[:commentStart].strip() != '':
+ return #Text before the #
+ #Move the cursor to the beginning of the comment
+ cursor.setPosition(cursor.block().position() + commentStart)
+ cursor.deleteChar()
+ if text[commentStart:].startswith('# '):
+ cursor.deleteChar()
+
+ #Apply this function to all blocks
+ self.doForSelectedBlocks(uncommentBlock)
+
+ def gotoDef(self):
+ """
+ Goto the definition for the word under the cursor
+ """
+
+ # Get name of object to go to
+ cursor = self.textCursor()
+ if not cursor.hasSelection():
+ cursor.select(cursor.WordUnderCursor)
+ word = cursor.selection().toPlainText()
+
+ # Send the open command to the shell
+ s = iep.shells.getCurrentShell()
+ if s is not None:
+ if word and word.isidentifier():
+ s.executeCommand('open %s\n'%word)
+ else:
+ s.write('Invalid identifier %r\n' % word)
+
+
+ ## Introspection processing methods
+
+ def processCallTip(self, cto):
+ """ Processes a calltip request using a CallTipObject instance.
+ """
+ # Try using buffer first
+ if cto.tryUsingBuffer():
+ return
+
+ # Try obtaining calltip from the source
+ sig = iep.parser.getFictiveSignature(cto.name, self, True)
+ if sig:
+ # Done
+ cto.finish(sig)
+ else:
+ # Try the shell
+ shell = iep.shells.getCurrentShell()
+ if shell:
+ shell.processCallTip(cto)
+
+
+ def processAutoComp(self, aco):
+ """ Processes an autocomp request using an AutoCompObject instance.
+ """
+
+ # Try using buffer first
+ if aco.tryUsingBuffer():
+ return
+
+ # Init name to poll by remote process (can be changed!)
+ nameForShell = aco.name
+
+ # Get normal fictive namespace
+ fictiveNS = iep.parser.getFictiveNameSpace(self)
+ fictiveNS = set(fictiveNS)
+
+ # Add names
+ if not aco.name:
+ # "root" names
+ aco.addNames(fictiveNS)
+ # imports
+ importNames, importLines = iep.parser.getFictiveImports(self)
+ aco.addNames(importNames)
+ else:
+ # Prepare list of class names to check out
+ classNames = [aco.name]
+ handleSelf = True
+ # Unroll supers
+ while classNames:
+ className = classNames.pop(0)
+ if not className:
+ continue
+ if handleSelf or (className in fictiveNS):
+ # Only the self list (only first iter)
+ fictiveClass = iep.parser.getFictiveClass(
+ className, self, handleSelf)
+ handleSelf = False
+ if fictiveClass:
+ aco.addNames( fictiveClass.members )
+ classNames.extend(fictiveClass.supers)
+ else:
+ nameForShell = className
+ break
+
+ # If there's a shell, let it finish the autocompletion
+ shell = iep.shells.getCurrentShell()
+ if shell:
+ aco.name = nameForShell # might be the same or a base class
+ shell.processAutoComp(aco)
+ else:
+ # Otherwise we finish it ourselves
+ aco.finish()
+
+
+if __name__=="__main__":
+ app = QtGui.QApplication([])
+ win = IepEditor(None)
+ win.setStyle('.py')
+ tmp = "foo(bar)\nfor bar in range(5):\n print bar\n"
+ tmp += "\nclass aap:\n def monkey(self):\n pass\n\n"
+ win.setPlainText(tmp)
+ win.show()
+ app.exec_()
+
diff --git a/iep/iepcore/editorTabs.py b/iep/iepcore/editorTabs.py
new file mode 100644
index 0000000..d02fdeb
--- /dev/null
+++ b/iep/iepcore/editorTabs.py
@@ -0,0 +1,1543 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" EditorTabs class
+
+Replaces the earlier EditorStack class.
+
+The editor tabs class represents the different open files. They can
+be selected using a tab widget (with tabs placed north of the editor).
+It also has a find/replace widget that is at the bottom of the editor.
+
+"""
+
+import os, sys, time, gc
+from pyzolib.qt import QtCore, QtGui
+
+import iep
+from iep.iepcore.compactTabWidget import CompactTabWidget
+from iep.iepcore.editor import createEditor
+from iep.iepcore.baseTextCtrl import normalizePath
+from iep.iepcore.iepLogging import print
+from iep.iepcore.icons import EditorTabToolButton
+from iep import translate
+
+# Constants for the alignments of tabs
+MIN_NAME_WIDTH = 50
+MAX_NAME_WIDTH = 200
+
+
+def simpleDialog(item, action, question, options, defaultOption):
+ """ simpleDialog(editor, action, question, options, defaultOption)
+
+ Options with special buttons
+ ----------------------------
+ ok, open, save, cancel, close, discard, apply, reset, restoredefaults,
+ help, saveall, yes, yestoall, no, notoall, abort, retry, ignore.
+
+ Returns the selected option as a string, or None if canceled.
+
+ """
+
+ # Get filename
+ if isinstance(item, FileItem):
+ filename = item.id
+ else:
+ filename = item.id()
+
+ # create button map
+ mb = QtGui.QMessageBox
+ M = { 'ok':mb.Ok, 'open':mb.Open, 'save':mb.Save, 'cancel':mb.Cancel,
+ 'close':mb.Close, 'discard':mb.Discard, 'apply':mb.Apply,
+ 'reset':mb.Reset, 'restoredefaults':mb.RestoreDefaults,
+ 'help':mb.Help, 'saveall':mb.SaveAll, 'yes':mb.Yes,
+ 'yestoall':mb.YesToAll, 'no':mb.No, 'notoall':mb.NoToAll,
+ 'abort':mb.Abort, 'retry':mb.Retry, 'ignore':mb.Ignore}
+
+ # setup dialog
+ dlg = QtGui.QMessageBox(iep.main)
+ dlg.setWindowTitle('IEP')
+ dlg.setText(action + " file:\n{}".format(filename))
+ dlg.setInformativeText(question)
+
+ # process options
+ buttons = {}
+ for option in options:
+ option_lower = option.lower()
+ # Use standard button?
+ if option_lower in M:
+ button = dlg.addButton(M[option_lower])
+ else:
+ button = dlg.addButton(option, dlg.AcceptRole)
+ buttons[button] = option
+ # Set as default?
+ if option_lower == defaultOption.lower():
+ dlg.setDefaultButton(button)
+
+ # get result
+ result = dlg.exec_()
+ button = dlg.clickedButton()
+ if button in buttons:
+ return buttons[button]
+ else:
+ return None
+
+
+
+# todo: some management stuff could (should?) go here
+class FileItem:
+ """ FileItem(editor)
+
+ A file item represents an open file. It is associated with an editing
+ component and has a filename.
+
+ """
+
+ def __init__(self, editor):
+
+ # Store editor
+ self._editor = editor
+
+ # Init pinned state
+ self._pinned = False
+
+ @property
+ def editor(self):
+ """ Get the editor component corresponding to this item.
+ """
+ return self._editor
+
+ @property
+ def id(self):
+ """ Get an id of this editor. This is the filename,
+ or for tmp files, the name. """
+ if self.filename:
+ return self.filename
+ else:
+ return self.name
+
+ @property
+ def filename(self):
+ """ Get the full filename corresponding to this item.
+ """
+ return self._editor.filename
+
+ @property
+ def name(self):
+ """ Get the name corresponding to this item.
+ """
+ return self._editor.name
+
+ @property
+ def dirty(self):
+ """ Get whether the file has been changed since it is changed.
+ """
+ return self._editor.document().isModified()
+
+ @property
+ def pinned(self):
+ """ Get whether this item is pinned (i.e. will not be closed
+ when closing all files.
+ """
+ return self._pinned
+
+
+# todo: when this works with the new editor, put in own module.
+class FindReplaceWidget(QtGui.QFrame):
+ """ A widget to find and replace text. """
+
+ def __init__(self, *args):
+ QtGui.QFrame.__init__(self, *args)
+
+ self.setFocusPolicy(QtCore.Qt.ClickFocus)
+
+ # init layout
+ layout = QtGui.QHBoxLayout(self)
+ layout.setSpacing(0)
+ self.setLayout(layout)
+
+ # Create some widgets first to realize a correct tab order
+ self._hidebut = QtGui.QToolButton(self)
+ self._findText = QtGui.QLineEdit(self)
+ self._replaceText = QtGui.QLineEdit(self)
+
+ if True:
+ # Create sub layouts
+ vsubLayout = QtGui.QVBoxLayout()
+ vsubLayout.setSpacing(0)
+ layout.addLayout(vsubLayout, 0)
+
+ # Add button
+ self._hidebut.setFont( QtGui.QFont('helvetica',7) )
+ self._hidebut.setToolTip(translate('search', 'Hide search widget (Escape)'))
+ self._hidebut.setIcon( iep.icons.cancel )
+ self._hidebut.setIconSize(QtCore.QSize(16,16))
+ vsubLayout.addWidget(self._hidebut, 0)
+
+ vsubLayout.addStretch(1)
+
+ layout.addSpacing(10)
+
+ if True:
+
+ # Create sub layouts
+ vsubLayout = QtGui.QVBoxLayout()
+ hsubLayout = QtGui.QHBoxLayout()
+ vsubLayout.setSpacing(0)
+ hsubLayout.setSpacing(0)
+ layout.addLayout(vsubLayout, 0)
+
+ # Add find text
+ self._findText.setToolTip(translate('search', 'Find pattern'))
+ vsubLayout.addWidget(self._findText, 0)
+
+ vsubLayout.addLayout(hsubLayout)
+
+ # Add previous button
+ self._findPrev = QtGui.QToolButton(self)
+ t = translate('search', 'Previous ::: Find previous occurrence of the pattern.')
+ self._findPrev.setText(t); self._findPrev.setToolTip(t.tt)
+
+ hsubLayout.addWidget(self._findPrev, 0)
+
+ hsubLayout.addStretch(1)
+
+ # Add next button
+ self._findNext = QtGui.QToolButton(self)
+ t = translate('search', 'Next ::: Find next occurrence of the pattern.')
+ self._findNext.setText(t); self._findNext.setToolTip(t.tt)
+ #self._findNext.setDefault(True) # Not possible with tool buttons
+ hsubLayout.addWidget(self._findNext, 0)
+
+ layout.addSpacing(10)
+
+ if True:
+
+ # Create sub layouts
+ vsubLayout = QtGui.QVBoxLayout()
+ hsubLayout = QtGui.QHBoxLayout()
+ vsubLayout.setSpacing(0)
+ hsubLayout.setSpacing(0)
+ layout.addLayout(vsubLayout, 0)
+
+ # Add replace text
+ self._replaceText.setToolTip(translate('search', 'Replace pattern'))
+ vsubLayout.addWidget(self._replaceText, 0)
+
+ vsubLayout.addLayout(hsubLayout)
+
+ # Add replace-all button
+ self._replaceAll = QtGui.QToolButton(self)
+ t = translate('search', 'Repl. all ::: Replace all matches in current document.')
+ self._replaceAll.setText(t); self._replaceAll.setToolTip(t.tt)
+ hsubLayout.addWidget(self._replaceAll, 0)
+
+ hsubLayout.addStretch(1)
+
+ # Add replace button
+ self._replace = QtGui.QToolButton(self)
+ t = translate('search', 'Replace ::: Replace this match.')
+ self._replace.setText(t); self._replace.setToolTip(t.tt)
+ hsubLayout.addWidget(self._replace, 0)
+
+
+ layout.addSpacing(10)
+
+ if True:
+
+ # Create sub layouts
+ vsubLayout = QtGui.QVBoxLayout()
+ vsubLayout.setSpacing(0)
+ layout.addLayout(vsubLayout, 0)
+
+ # Add match-case checkbox
+ t = translate('search', 'Match case ::: Find words that match case.')
+ self._caseCheck = QtGui.QCheckBox(t, self)
+ self._caseCheck.setToolTip(t.tt)
+ vsubLayout.addWidget(self._caseCheck, 0)
+
+ # Add regexp checkbox
+ t = translate('search', 'RegExp ::: Find using regular expressions.')
+ self._regExp = QtGui.QCheckBox(t, self)
+ self._regExp.setToolTip(t.tt)
+ vsubLayout.addWidget(self._regExp, 0)
+
+ if True:
+
+ # Create sub layouts
+ vsubLayout = QtGui.QVBoxLayout()
+ vsubLayout.setSpacing(0)
+ layout.addLayout(vsubLayout, 0)
+
+ # Add whole-word checkbox
+ t = translate('search', 'Whole words ::: Find only whole words.')
+ self._wholeWord = QtGui.QCheckBox(t, self)
+ self._wholeWord.setToolTip(t.tt)
+ self._wholeWord.resize(60, 16)
+ vsubLayout.addWidget(self._wholeWord, 0)
+
+ # Add autohide dropbox
+ t = translate('search', 'Auto hide ::: Hide search/replace when unused for 10 s.')
+ self._autoHide = QtGui.QCheckBox(t, self)
+ self._autoHide.setToolTip(t.tt)
+ self._autoHide.resize(60, 16)
+ vsubLayout.addWidget(self._autoHide, 0)
+
+ layout.addStretch(1)
+
+
+ # Set placeholder texts
+ for lineEdit in [self._findText, self._replaceText]:
+ if hasattr(lineEdit, 'setPlaceholderText'):
+ lineEdit.setPlaceholderText(lineEdit.toolTip())
+ lineEdit.textChanged.connect(self.autoHideTimerReset)
+
+ # Set focus policy
+ for but in [self._findPrev, self._findNext,
+ self._replaceAll, self._replace,
+ self._caseCheck, self._wholeWord, self._regExp]:
+ #but.setFocusPolicy(QtCore.Qt.ClickFocus)
+ but.clicked.connect(self.autoHideTimerReset)
+
+ # create timer objects
+ self._timerBeginEnd = QtCore.QTimer(self)
+ self._timerBeginEnd.setSingleShot(True)
+ self._timerBeginEnd.timeout.connect( self.resetAppearance )
+ #
+ self._timerAutoHide = QtCore.QTimer(self)
+ self._timerAutoHide.setSingleShot(False)
+ self._timerAutoHide.setInterval(500) # ms
+ self._timerAutoHide.timeout.connect( self.autoHideTimerCallback )
+ self._timerAutoHide_t0 = time.time()
+ self._timerAutoHide.start()
+
+ # create callbacks
+ self._findText.returnPressed.connect(self.findNext)
+ self._hidebut.clicked.connect(self.hideMe)
+ self._findNext.clicked.connect(self.findNext)
+ self._findPrev.clicked.connect(self.findPrevious)
+ self._replace.clicked.connect(self.replaceOne)
+ self._replaceAll.clicked.connect(self.replaceAll)
+ #
+ self._regExp.stateChanged.connect(self.handleReplacePossible)
+
+ # init case and regexp
+ self._caseCheck.setChecked( bool(iep.config.state.find_matchCase) )
+ self._regExp.setChecked( bool(iep.config.state.find_regExp) )
+ self._wholeWord.setChecked( bool(iep.config.state.find_wholeWord) )
+ self._autoHide.setChecked( bool(iep.config.state.find_autoHide) )
+
+ # show or hide?
+ if bool(iep.config.state.find_show):
+ self.show()
+ else:
+ self.hide()
+
+
+ def autoHideTimerReset(self):
+ self._timerAutoHide_t0 = time.time()
+
+
+ def autoHideTimerCallback(self):
+ """ Check whether we should hide the tool.
+ """
+ timeout = iep.config.advanced.find_autoHide_timeout
+ if self._autoHide.isChecked():
+ if (time.time() - self._timerAutoHide_t0) > timeout: # seconds
+ # Hide if editor has focus
+ es = self.parent() # editor stack
+ editor = es.getCurrentEditor()
+ if editor and editor.hasFocus():
+ self.hide()
+
+
+ def hideMe(self):
+ """ Hide the find/replace widget. """
+ self.hide()
+ es = self.parent() # editor stack
+ #es._boxLayout.activate()
+ editor = es.getCurrentEditor()
+ if editor:
+ editor.setFocus()
+
+
+ def event(self, event):
+ """ Handle tab key and escape key. For the tab key we need to
+ overload event instead of KeyPressEvent.
+ """
+ if isinstance(event, QtGui.QKeyEvent):
+ if event.key() in (QtCore.Qt.Key_Tab, QtCore.Qt.Key_Backtab):
+ event.accept() # focusNextPrevChild is called by Qt
+ return True
+ elif event.key() == QtCore.Qt.Key_Escape:
+ self.hideMe()
+ event.accept()
+ return True
+ # Otherwise ... handle in default manner
+ return QtGui.QFrame.event(self, event)
+
+
+ def handleReplacePossible(self, state):
+ """ Disable replacing when using regular expressions.
+ """
+ for w in [self._replaceText, self._replaceAll, self._replace]:
+ w.setEnabled(not state)
+
+
+ def startFind(self,event=None):
+ """ Use this rather than show(). It will check if anything is
+ selected in the current editor, and if so, will set that as the
+ initial search string
+ """
+ # show
+ self.show()
+ self.autoHideTimerReset()
+ es = self.parent()
+
+ # get needle
+ editor = self.parent().getCurrentEditor()
+ if editor:
+ needle = editor.textCursor().selectedText().replace('\u2029', '\n')
+ if needle:
+ self._findText.setText( needle )
+ # select the find-text
+ self.selectFindText()
+
+
+ def notifyPassBeginEnd(self):
+ self.setStyleSheet("QFrame { background:#f00; }")
+ self._timerBeginEnd.start(300)
+
+ def resetAppearance(self):
+ self.setStyleSheet("QFrame {}")
+
+ def selectFindText(self):
+ """ Select the textcontrol for the find needle,
+ and the text in it """
+ # select text
+ self._findText.selectAll()
+ # focus
+ self._findText.setFocus()
+
+ def findNext(self, event=None):
+ self.find()
+ #self._findText.setFocus()
+
+ def findPrevious(self, event=None):
+ self.find(False)
+ # self._findText.setFocus()
+
+ def findSelection(self, event=None):
+ self.startFind()
+ self.findNext()
+
+ def findSelectionBw(self, event=None):
+ self.startFind()
+ self.findPrevious()
+
+ def find(self, forward=True, wrapAround=True):
+ """ The main find method.
+ Returns True if a match was found. """
+
+ # Reset timer
+ self.autoHideTimerReset()
+
+ # get editor
+ editor = self.parent().getCurrentEditor()
+ if not editor:
+ return
+
+ # find flags
+ flags = QtGui.QTextDocument.FindFlags()
+ if self._caseCheck.isChecked():
+ flags |= QtGui.QTextDocument.FindCaseSensitively
+ if not forward:
+ flags |= QtGui.QTextDocument.FindBackward
+ #if self._wholeWord.isChecked():
+ # flags |= QtGui.QTextDocument.FindWholeWords
+
+ # focus
+ self.selectFindText()
+
+ # get text to find
+ needle = self._findText.text()
+ if self._regExp.isChecked():
+ #Make needle a QRegExp; speciffy case-sensitivity here since the
+ #FindCaseSensitively flag is ignored when finding using a QRegExp
+ needle = QtCore.QRegExp(needle,
+ QtCore.Qt.CaseSensitive if self._caseCheck.isChecked() else
+ QtCore.Qt.CaseInsensitive)
+ elif self._wholeWord.isChecked():
+ # Use regexp, because the default begaviour does not find
+ # whole words correctly, see issue #276
+ # it should *not* find this in this_word
+ needle = QtCore.QRegExp(r'\b' + needle + r'\b',
+ QtCore.Qt.CaseSensitive if self._caseCheck.isChecked() else
+ QtCore.Qt.CaseInsensitive)
+
+ # estblish start position
+ cursor = editor.textCursor()
+ result = editor.document().find(needle, cursor, flags)
+
+ if not result.isNull():
+ editor.setTextCursor(result)
+ elif wrapAround:
+ self.notifyPassBeginEnd()
+ #Move cursor to start or end of document
+ if forward:
+ cursor.movePosition(cursor.Start)
+ else:
+ cursor.movePosition(cursor.End)
+ #Try again
+ result = editor.document().find(needle, cursor, flags)
+ if not result.isNull():
+ editor.setTextCursor(result)
+
+ # done
+ editor.setFocus()
+ return not result.isNull()
+
+
+ def replaceOne(self,event=None, wrapAround=True):
+ """ If the currently selected text matches the find string,
+ replaces that text. Then it finds and selects the next match.
+ Returns True if a next match was found.
+ """
+
+ # get editor
+ editor = self.parent().getCurrentEditor()
+ if not editor:
+ return
+
+ #Create a cursor to do the editing
+ cursor = editor.textCursor()
+
+ # matchCase
+ matchCase = self._caseCheck.isChecked()
+
+ # get text to find
+ needle = self._findText.text()
+ if not matchCase:
+ needle = needle.lower()
+
+ # get replacement
+ replacement = self._replaceText.text()
+
+ # get original text
+ original = cursor.selectedText().replace('\u2029', '\n')
+ if not original:
+ original = ''
+ if not matchCase:
+ original = original.lower()
+
+ # replace
+ #TODO: < line does not work for regexp-search!
+ if original and original == needle:
+ cursor.insertText( replacement )
+
+ # next!
+ return self.find(wrapAround=wrapAround)
+
+
+ def replaceAll(self,event=None):
+ #TODO: share a cursor between all replaces, in order to
+ #make this one undo/redo-step
+
+ # get editor
+ editor = self.parent().getCurrentEditor()
+ if not editor:
+ return
+
+ # get current position
+ originalPosition = editor.textCursor()
+
+ # Move to beginning of text and replace all
+ # Make this a single undo operation
+ cursor = editor.textCursor()
+ cursor.beginEditBlock()
+ try:
+ cursor.movePosition(cursor.Start)
+ editor.setTextCursor(cursor)
+ while self.replaceOne(wrapAround=False):
+ pass
+ finally:
+ cursor.endEditBlock()
+
+ # reset position
+ editor.setTextCursor(originalPosition)
+
+
+
+class FileTabWidget(CompactTabWidget):
+ """ FileTabWidget(parent)
+
+ The tab widget that contains the editors and lists all open files.
+
+ """
+
+ def __init__(self, parent):
+ CompactTabWidget.__init__(self, parent, padding=(2,1,0,4))
+
+ # Init main file
+ self._mainFile = ''
+
+ # Init item history
+ self._itemHistory = []
+
+# # Create a corner widget
+# but = QtGui.QToolButton()
+# but.setIcon( iep.icons.cross )
+# but.setIconSize(QtCore.QSize(16,16))
+# but.clicked.connect(self.onClose)
+# self.setCornerWidget(but)
+
+ # Bind signal to update items and keep track of history
+ self.currentChanged.connect(self.updateItems)
+ self.currentChanged.connect(self.trackHistory)
+ self.currentChanged.connect(self.setTitleInMainWindowWhenTabChanged)
+ self.setTitleInMainWindowWhenTabChanged(-1)
+
+
+ def setTitleInMainWindowWhenTabChanged(self, index):
+
+ # Valid index?
+ if index<0 or index>=self.count():
+ iep.main.setMainTitle() # No open file
+
+ # Remove current item from history
+ currentItem = self.currentItem()
+ if currentItem:
+ currentItem.editor.setTitleInMainWindow()
+
+
+ ## Item management
+
+
+ def items(self):
+ """ Get the items in the tab widget. These are Item instances, and
+ are in the order in which they are at the tab bar.
+ """
+ tabBar = self.tabBar()
+ items = []
+ for i in range(tabBar.count()):
+ item = tabBar.tabData(i)
+ if item is None:
+ continue
+ items.append(item)
+ return items
+
+
+ def currentItem(self):
+ """ Get the item corresponding to the currently active tab.
+ """
+ i = self.currentIndex()
+ if i>=0:
+ return self.tabBar().tabData(i)
+
+ def getItemAt(self, i):
+ return self.tabBar().tabData(i)
+
+ def mainItem(self):
+ """ Get the item corresponding to the "main" file. Returns None
+ if there is no main file.
+ """
+ for item in self.items():
+ if item.id == self._mainFile:
+ return item
+ else:
+ return None
+
+
+ def trackHistory(self, index):
+ """ trackHistory(index)
+
+ Called when a tab is changed. Puts the current item on top of
+ the history.
+
+ """
+
+ # Valid index?
+ if index<0 or index>=self.count():
+ return
+
+ # Remove current item from history
+ currentItem = self.currentItem()
+ while currentItem in self._itemHistory:
+ self._itemHistory.remove(currentItem)
+
+ # Add current item to history
+ self._itemHistory.insert(0, currentItem)
+
+ # Limit history size
+ self._itemHistory[10:] = []
+
+
+ def setCurrentItem(self, item):
+ """ _setCurrentItem(self, item)
+
+ Set a FileItem instance to be the current. If the given item
+ is not in the list, no action is taken.
+
+ item can be an int, FileItem, or file name.
+ """
+
+ if isinstance(item, int):
+ self.setCurrentIndex(i)
+
+ elif isinstance(item, FileItem):
+
+ items = self.items()
+ for i in range(self.count()):
+ if item is items[i]:
+ self.setCurrentIndex(i)
+ break
+
+ elif isinstance(item, str):
+
+ items = self.items()
+ for i in range(self.count()):
+ if item == items[i].filename:
+ self.setCurrentIndex(i)
+ break
+
+ else:
+ raise ValueError('item should be int, FileItem or file name.')
+
+
+ def selectPreviousItem(self):
+ """ Select the previously selected item. """
+
+ # make an old item history
+ if len(self._itemHistory)>1:
+ item = self._itemHistory[1]
+ self.setCurrentItem(item)
+
+ # just select first one then ...
+ elif item is None and self.count():
+ item = 0
+ self.setCurrentItem(item)
+
+
+ ## Closing, adding and updating
+
+ def onClose(self):
+ """ onClose()
+
+ Request to close the current tab.
+
+ """
+
+ self.tabCloseRequested.emit(self.currentIndex())
+
+
+ def removeTab(self, which):
+ """ removeTab(which)
+
+ Removes the specified tab. which can be an integer, an item,
+ or an editor.
+
+ """
+
+ # Init
+ items = self.items()
+ theIndex = -1
+
+ # Find index
+ if isinstance(which, int) and which>=0 and which<len(items):
+ theIndex = which
+
+ elif isinstance(which, FileItem):
+ for i in range(self.count()):
+ if items[i] is which:
+ theIndex = i
+ break
+
+ elif isinstance(which, str):
+ for i in range(self.count()):
+ if items[i].filename == which:
+ theIndex = i
+ break
+
+ elif hasattr(which, '_filename'):
+ for i in range(self.count()):
+ if items[i].filename == which._filename:
+ theIndex = i
+ break
+
+ else:
+ raise ValueError('removeTab accepts a FileItem, integer, file name, or editor.')
+
+
+ if theIndex >= 0:
+
+ # Close tab
+ CompactTabWidget.removeTab(self, theIndex)
+
+ # Delete editor
+ items[theIndex].editor.destroy()
+ gc.collect()
+
+
+ def addItem(self, item, update=True):
+ """ addItem(item, update=True)
+
+ Add item to the tab widget. Set update to false if you are
+ calling this method many times in a row. Then use updateItemsFull()
+ to update the tab widget.
+
+ """
+
+ # Add tab and widget
+ i = self.addTab(item.editor, item.name)
+ tabBut = EditorTabToolButton(self.tabBar())
+ self.tabBar().setTabButton(i, QtGui.QTabBar.LeftSide, tabBut)
+
+ # Keep informed about changes
+ item.editor.somethingChanged.connect(self.updateItems)
+ item.editor.blockCountChanged.connect(self.updateItems)
+ item.editor.breakPointsChanged.connect(self.parent().updateBreakPoints)
+
+ # Store the item at the tab
+ self.tabBar().setTabData(i, item)
+
+ # Emit the currentChanged again (already emitted on addTab), because
+ # now the itemdata is actually set
+ self.currentChanged.emit(self.currentIndex())
+
+ # Update
+ if update:
+ self.updateItems()
+
+
+ def updateItemsFull(self):
+ """ updateItemsFull()
+
+ Update the appearance of the items and also updates names and
+ re-aligns the items.
+
+ """
+ self.updateItems()
+ self.tabBar().alignTabs()
+
+
+ def updateItems(self):
+ """ updateItems()
+
+ Update the appearance of the items.
+
+ """
+
+ # Get items and tab bar
+ items = self.items()
+ tabBar = self.tabBar()
+
+ for i in range(len(items)):
+
+ # Get item
+ item = items[i]
+ if item is None:
+ continue
+
+ # Update name and tooltip
+ if item.dirty:
+ #tabBar.setTabText(i, '*'+item.name)
+ tabBar.setTabToolTip(i, item.filename + ' [modified]')
+ else:
+ tabBar.setTabText(i, item.name)
+ tabBar.setTabToolTip(i, item.filename)
+
+ # Determine text color. Is main file? Is current?
+ if self._mainFile == item.id:
+ tabBar.setTabTextColor(i, QtGui.QColor('#008'))
+ elif i == self.currentIndex():
+ tabBar.setTabTextColor(i, QtGui.QColor('#000'))
+ else:
+ tabBar.setTabTextColor(i, QtGui.QColor('#444'))
+
+ # Get number of blocks
+ nBlocks = item.editor.blockCount()
+ if nBlocks == 1 and not item.editor.toPlainText():
+ nBlocks = 0
+
+ # Update appearance of icon
+ but = tabBar.tabButton(i, QtGui.QTabBar.LeftSide)
+ but.updateIcon(item.dirty, self._mainFile==item.id,
+ item.pinned, nBlocks)
+
+
+class EditorTabs(QtGui.QWidget):
+ """ The EditorTabs instance manages the open files and corresponding
+ editors. It does the saving loading etc.
+ """
+
+ # Signal to indicate that a breakpoint has changed, emits dict
+ breakPointsChanged = QtCore.Signal(object)
+
+ # Signal to notify that a different file was selected
+ currentChanged = QtCore.Signal()
+
+ # Signal to notify that the parser has parsed the text (emit by parser)
+ parserDone = QtCore.Signal()
+
+
+ def __init__(self, parent):
+ QtGui.QWidget.__init__(self,parent)
+
+ # keep a booking of opened directories
+ self._lastpath = ''
+
+ # keep track of all breakpoints
+ self._breakPoints = {}
+
+ # create tab widget
+ self._tabs = FileTabWidget(self)
+ self._tabs.tabCloseRequested.connect(self.closeFile)
+ self._tabs.currentChanged.connect(self.onCurrentChanged)
+
+ # Double clicking a tab saves the file, clicking on the bar opens a new file
+ self._tabs.tabBar().tabDoubleClicked.connect(self.saveFile)
+ self._tabs.tabBar().barDoubleClicked.connect(self.newFile)
+
+ # Create find/replace widget
+ self._findReplace = FindReplaceWidget(self)
+
+ # create box layout control and add widgets
+ self._boxLayout = QtGui.QVBoxLayout(self)
+ self._boxLayout.addWidget(self._tabs, 1)
+ self._boxLayout.addWidget(self._findReplace, 0)
+ # spacing of widgets
+ self._boxLayout.setSpacing(0)
+ # apply
+ self.setLayout(self._boxLayout)
+
+ #self.setAttribute(QtCore.Qt.WA_AlwaysShowToolTips,True)
+
+ # accept drops
+ self.setAcceptDrops(True)
+
+ # restore state (call later so that the menu module can bind to the
+ # currentChanged signal first, in order to set tab/indentation
+ # checkmarks appropriately)
+ # todo: Resetting the scrolling would work better if set after
+ # the widgets are properly sized.
+ iep.callLater(self.restoreEditorState)
+
+
+ def addContextMenu(self):
+ """ Adds a context menu to the tab bar """
+
+ from iep.iepcore.menu import EditorTabContextMenu
+ self._menu = EditorTabContextMenu(self, "EditorTabMenu")
+ self._tabs.setContextMenuPolicy(QtCore.Qt.CustomContextMenu)
+ self._tabs.customContextMenuRequested.connect(self.contextMenuTriggered)
+
+
+ def contextMenuTriggered(self, p):
+ """ Called when context menu is clicked """
+
+ # Get index of current tab
+ index = self._tabs.tabBar().tabAt(p)
+ self._menu.setIndex(index)
+
+ # Show menu if item is available
+ if index >= 0:
+ p = self._tabs.tabBar().tabRect(index).bottomLeft()
+ self._menu.popup(self._tabs.tabBar().mapToGlobal(p))
+
+
+ def onCurrentChanged(self):
+ self.currentChanged.emit()
+
+
+ def getCurrentEditor(self):
+ """ Get the currently active editor. """
+ item = self._tabs.currentItem()
+ if item:
+ return item.editor
+ else:
+ return None
+
+
+ def getMainEditor(self):
+ """ Get the editor that represents the main file, or None if
+ there is no main file. """
+ item = self._tabs.mainItem()
+ if item:
+ return item.editor
+ else:
+ return None
+
+
+ def __iter__(self):
+ tmp = [item.editor for item in self._tabs.items()]
+ return tmp.__iter__()
+
+
+ def updateBreakPoints(self, editor=None):
+ # Get list of editors to update keypoints for
+ if editor is None:
+ editors = self
+ self._breakPoints = {} # Full reset
+ else:
+ editors = [editor]
+
+ # Update our keypoints dict
+ for editor in editors:
+ fname = editor._filename or editor._name
+ if not fname:
+ continue
+ linenumbers = editor.breakPoints()
+ if linenumbers:
+ self._breakPoints[fname] = linenumbers
+ else:
+ self._breakPoints.pop(fname, None)
+
+ # Emit signal so shells can update the kernel
+ self.breakPointsChanged.emit(self._breakPoints)
+
+
+ def setDebugLineIndicators(self, *filename_linenr):
+ """ Set the debug line indicator. There is one indicator
+ global to IEP, corresponding to the last shell for which we
+ received the indicator.
+ """
+ if len(filename_linenr) and filename_linenr[0] is None:
+ filename_linenr = []
+
+ # Normalize case
+ filename_linenr = [(os.path.normcase(i[0]), int(i[1])) for i in filename_linenr]
+
+ for item in self._tabs.items():
+ # Prepare
+ editor = item._editor
+ fname = editor._filename or editor._name
+ fname = os.path.normcase(fname)
+ # Reset
+ editor.setDebugLineIndicator(None)
+ # Set
+ for filename, linenr in filename_linenr:
+ if fname == filename:
+ active = (filename, linenr) == filename_linenr[-1]
+ editor.setDebugLineIndicator(linenr, active)
+
+
+ ## Loading ad saving files
+
+ def dragEnterEvent(self, event):
+ if event.mimeData().hasUrls():
+ event.acceptProposedAction()
+
+ def dropEvent(self, event):
+ """ Drop files in the list. """
+ for qurl in event.mimeData().urls():
+ path = str( qurl.toLocalFile() )
+ if os.path.isfile(path):
+ self.loadFile(path)
+ elif os.path.isdir(path):
+ self.loadDir(path)
+ else:
+ pass
+
+
+ def newFile(self):
+ """ Create a new (unsaved) file. """
+
+ # create editor
+ editor = createEditor(self, None)
+ # add to list
+ item = FileItem(editor)
+ self._tabs.addItem(item)
+ self._tabs.setCurrentItem(item)
+ # set focus to new file
+ editor.setFocus()
+
+ return item
+
+
+ def openFile(self):
+ """ Create a dialog for the user to select a file. """
+
+ # determine start dir
+ # todo: better selection of dir, using project manager
+ editor = self.getCurrentEditor()
+ if editor and editor._filename:
+ startdir = os.path.split(editor._filename)[0]
+ else:
+ startdir = self._lastpath
+ if not os.path.isdir(startdir):
+ startdir = ''
+
+ # show dialog
+ msg = "Select one or more files to open"
+ filter = "Python (*.py *.pyw);;"
+ filter += "Pyrex (*.pyi *.pyx *.pxd);;"
+ filter += "C (*.c *.h *.cpp *.c++);;"
+ #filter += "Py+Cy+C (*.py *.pyw *.pyi *.pyx *.pxd *.c *.h *.cpp);;"
+ filter += "All (*)"
+ if True:
+ filenames = QtGui.QFileDialog.getOpenFileNames(self,
+ msg, startdir, filter)
+ if isinstance(filenames, tuple): # PySide
+ filenames = filenames[0]
+ else:
+ # Example how to preselect files, can be used when the users
+ # opens a file in a project to select all files currently not
+ # loaded.
+ d = QtGui.QFileDialog(self, msg, startdir, filter)
+ d.setFileMode(d.ExistingFiles)
+ d.selectFile('"codeparser.py" "editorStack.py"')
+ d.exec_()
+ if d.result():
+ filenames = d.selectedFiles()
+ else:
+ filenames = []
+
+ # were some selected?
+ if not filenames:
+ return
+
+ # load
+ for filename in filenames:
+ self.loadFile(filename)
+
+
+ def openDir(self):
+ """ Create a dialog for the user to select a directory. """
+
+ # determine start dir
+ editor = self.getCurrentEditor()
+ if editor and editor._filename:
+ startdir = os.path.split(editor._filename)[0]
+ else:
+ startdir = self._lastpath
+ if not os.path.isdir(startdir):
+ startdir = ''
+
+ # show dialog
+ msg = "Select a directory to open"
+ dirname = QtGui.QFileDialog.getExistingDirectory(self, msg, startdir)
+
+ # was a dir selected?
+ if not dirname:
+ return
+
+ # load
+ self.loadDir(dirname)
+
+
+ def loadFile(self, filename, updateTabs=True):
+ """ Load the specified file.
+ On success returns the item of the file, also if it was
+ already open."""
+
+ # Note that by giving the name of a tempfile, we can select that
+ # temp file.
+
+ # normalize path
+ if filename[0] != '<':
+ filename = normalizePath(filename)
+ if not filename:
+ return None
+
+ # if the file is already open...
+ for item in self._tabs.items():
+ if item.id == filename:
+ # id gets _filename or _name for temp files
+ break
+ else:
+ item = None
+ if item:
+ self._tabs.setCurrentItem(item)
+ print("File already open: '{}'".format(filename))
+ return item
+
+ # create editor
+ try:
+ editor = createEditor(self, filename)
+ except Exception as err:
+ # Notify in logger
+ print("Error loading file: ", err)
+ # Make sure the user knows
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle("Error loading file")
+ m.setText(str(err))
+ m.setIcon(m.Warning)
+ m.exec_()
+ return None
+
+ # create list item
+ item = FileItem(editor)
+ self._tabs.addItem(item, updateTabs)
+ if updateTabs:
+ self._tabs.setCurrentItem(item)
+
+ # store the path
+ self._lastpath = os.path.dirname(item.filename)
+
+ return item
+
+
+ def loadDir(self, path):
+ """ Create a project with the dir's name and add all files
+ contained in the directory to it.
+ extensions is a komma separated list of extenstions of files
+ to accept...
+ """
+
+ # if the path does not exist, stop
+ path = os.path.abspath(path)
+ if not os.path.isdir(path):
+ print("ERROR loading dir: the specified directory does not exist!")
+ return
+
+ # get extensions
+ extensions = iep.config.advanced.fileExtensionsToLoadFromDir
+ extensions = extensions.replace(',',' ').replace(';',' ')
+ extensions = ["."+a.lstrip(".").strip() for a in extensions.split(" ")]
+
+ # init item
+ item = None
+
+ # open all qualified files...
+ self._tabs.setUpdatesEnabled(False)
+ try:
+ filelist = os.listdir(path)
+ for filename in filelist:
+ filename = os.path.join(path, filename)
+ ext = os.path.splitext(filename)[1]
+ if str(ext) in extensions:
+ item = self.loadFile(filename, False)
+ finally:
+ self._tabs.setUpdatesEnabled(True)
+ self._tabs.updateItems()
+
+ # return lastopened item
+ return item
+
+
+ def saveFileAs(self, editor=None):
+ """ Create a dialog for the user to select a file.
+ returns: True if succesfull, False if fails
+ """
+
+ # get editor
+ if editor is None:
+ editor = self.getCurrentEditor()
+ if editor is None:
+ return False
+
+ # get startdir
+ if editor._filename:
+ startdir = os.path.dirname(editor._filename)
+ else:
+ startdir = self._lastpath
+ # Try the file browser or project manager to suggest a path
+ fileBrowser = iep.toolManager.getTool('iepfilebrowser')
+ projectManager = iep.toolManager.getTool('iepprojectmanager')
+ if fileBrowser:
+ startdir = fileBrowser.getDefaultSavePath()
+ if projectManager and not startdir:
+ startdir = projectManager.getDefaultSavePath()
+
+ if not os.path.isdir(startdir):
+ startdir = ''
+
+ # show dialog
+ msg = "Select the file to save to"
+ filter = "Python (*.py *.pyw);;"
+ filter += "Pyrex (*.pyi *.pyx *.pxd);;"
+ filter += "C (*.c *.h *.cpp);;"
+ #filter += "Py+Cy+C (*.py *.pyw *.pyi *.pyx *.pxd *.c *.h *.cpp);;"
+ filter += "All (*.*)"
+ filename = QtGui.QFileDialog.getSaveFileName(self,
+ msg, startdir, filter)
+ if isinstance(filename, tuple): # PySide
+ filename = filename[0]
+
+ # give python extension if it has no extension
+ head, tail = os.path.split(filename)
+ if tail and '.' not in tail:
+ filename += '.py'
+
+ # proceed or cancel
+ if filename:
+ return self.saveFile(editor, filename)
+ else:
+ return False # Cancel was pressed
+
+
+ def saveFile(self, editor=None, filename=None):
+ """ Save the file.
+ returns: True if succesfull, False if fails
+ """
+
+ # get editor
+ if editor is None:
+ editor = self.getCurrentEditor()
+ elif isinstance(editor, int):
+ index = editor
+ editor = None
+ if index>=0:
+ item = self._tabs.items()[index]
+ editor = item.editor
+ if editor is None:
+ return False
+
+ # get filename
+ if filename is None:
+ filename = editor._filename
+ if not filename:
+ return self.saveFileAs(editor)
+
+
+ # let the editor do the low level stuff...
+ try:
+ editor.save(filename)
+ except Exception as err:
+ # Notify in logger
+ print("Error saving file:",err)
+ # Make sure the user knows
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle("Error saving file")
+ m.setText(str(err))
+ m.setIcon(m.Warning)
+ m.exec_()
+ # Return now
+ return False
+
+ # get actual normalized filename
+ filename = editor._filename
+
+ # notify
+ # TODO: message concerining line endings
+ print("saved file: {} ({})".format(filename, editor.lineEndingsHumanReadable))
+ self._tabs.updateItems()
+
+ # todo: this is where we once detected whether the file being saved was a style file.
+
+ # Notify done
+ return True
+
+ def saveAllFiles(self):
+ """ Save all files"""
+ for editor in self:
+ self.saveFile(editor)
+
+
+ ## Closing files / closing down
+
+ def askToSaveFileIfDirty(self, editor):
+ """ askToSaveFileIfDirty(editor)
+
+ If the given file is not saved, pop up a dialog
+ where the user can save the file
+ .
+ Returns 1 if file need not be saved.
+ Returns 2 if file was saved.
+ Returns 3 if user discarded changes.
+ Returns 0 if cancelled.
+
+ """
+
+ # should we ask to save the file?
+ if editor.document().isModified():
+
+ # Ask user what to do
+ result = simpleDialog(editor, "Closing", "Save modified file?",
+ ['Discard', 'Cancel', 'Save'], 'Save')
+ result = result.lower()
+
+ # Get result and act
+ if result == 'save':
+ return 2 if self.saveFile(editor) else 0
+ elif result == 'discard':
+ return 3
+ else: # cancel
+ return 0
+
+ return 1
+
+
+ def closeFile(self, editor=None):
+ """ Close the selected (or current) editor.
+ Returns same result as askToSaveFileIfDirty() """
+
+ # get editor
+ if editor is None:
+ editor = self.getCurrentEditor()
+ item = self._tabs.currentItem()
+ elif isinstance(editor, int):
+ index = editor
+ editor, item = None, None
+ if index>=0:
+ item = self._tabs.items()[index]
+ editor = item.editor
+ else:
+ item = None
+ for i in self._tabs.items():
+ if i.editor is editor:
+ item = i
+ if editor is None or item is None:
+ return
+
+ # Ask if dirty
+ result = self.askToSaveFileIfDirty(editor)
+
+ # Ask if closing pinned file
+ if result and item.pinned:
+ result = simpleDialog(editor, "Closing pinned",
+ "Are you sure you want to close this pinned file?",
+ ['Close', 'Cancel'], 'Cancel')
+ result = result == 'Close'
+
+ # ok, close...
+ if result:
+ if editor._name.startswith("<tmp"):
+ # Temp file, try to find its index
+ for i in range(len(self._tabs.items())):
+ if self._tabs.getItemAt(i).editor is editor:
+ self._tabs.removeTab(i)
+ break
+ else:
+ self._tabs.removeTab(editor)
+
+ # Clear any breakpoints that it may have had
+ self.updateBreakPoints()
+
+ return result
+
+ def closeAllFiles(self):
+ """Close all files"""
+ for editor in self:
+ self.closeFile(editor)
+
+
+ def saveEditorState(self):
+ """ Save the editor's state configuration.
+ """
+ fr = self._findReplace
+ iep.config.state.find_matchCase = fr._caseCheck.isChecked()
+ iep.config.state.find_regExp = fr._regExp.isChecked()
+ iep.config.state.find_wholeWord = fr._wholeWord.isChecked()
+ iep.config.state.find_show = fr.isVisible()
+ #
+ iep.config.state.editorState2 = self._getCurrentOpenFilesAsSsdfList()
+
+
+ def restoreEditorState(self):
+ """ Restore the editor's state configuration.
+ """
+
+ # Restore opened editors
+ if iep.config.state.editorState2:
+ self._setCurrentOpenFilesAsSsdfList(iep.config.state.editorState2)
+ else:
+ self.newFile()
+
+ # The find/replace state is set in the corresponding class during init
+
+
+ def _getCurrentOpenFilesAsSsdfList(self):
+ """ Get the state as it currently is as an ssdf list.
+ The state entails all open files and their structure in the
+ projects. The being collapsed of projects and their main files.
+ The position of the cursor in the editors.
+ """
+
+ # Init
+ state = []
+
+ # Get items
+ for item in self._tabs.items():
+
+ # Get editor
+ ed = item.editor
+ if not ed._filename:
+ continue
+
+ # Init info
+ info = []
+ # Add filename, line number, and scroll distance
+ info.append(ed._filename)
+ info.append(int(ed.textCursor().position()))
+ info.append(int(ed.verticalScrollBar().value()))
+ # Add whether pinned or main file
+ if item.pinned:
+ info.append('pinned')
+ if item.id == self._tabs._mainFile:
+ info.append('main')
+
+ # Add to state
+ state.append( tuple(info) )
+
+ # Get history
+ history = [item for item in self._tabs._itemHistory]
+ history.reverse() # Last one is current
+ for item in history:
+ if isinstance(item, FileItem):
+ ed = item._editor
+ if ed._filename:
+ state.append( (ed._filename, 'hist') )
+
+ # Done
+ return state
+
+
+ def _setCurrentOpenFilesAsSsdfList(self, state):
+ """ Set the state of the editor in terms of opened files.
+ The input should be a list object as returned by
+ ._getCurrentOpenFilesAsSsdfList().
+ """
+
+ # Init dict
+ fileItems = {}
+
+ # Process items
+ for item in state:
+ fname = item[0]
+ if item[1] == 'hist':
+ # select item (to make the history right)
+ if fname in fileItems:
+ self._tabs.setCurrentItem( fileItems[fname] )
+ elif fname:
+ # a file item, create editor-item and store
+ itm = self.loadFile(fname)
+ fileItems[fname] = itm
+ # set position
+ if itm:
+ try:
+ ed = itm.editor
+ cursor = ed.textCursor()
+ cursor.setPosition(int(item[1]))
+ ed.setTextCursor(cursor)
+ # set scrolling
+ ed.verticalScrollBar().setValue(int(item[2]))
+ #ed.centerCursor() #TODO: this does not work properly yet
+ # set main and/or pinned?
+ if 'main' in item:
+ self._tabs._mainFile = itm.id
+ if 'pinned' in item:
+ itm._pinned = True
+ except Exception as err:
+ print('Could not set position for %s' % fname, err)
+
+
+ def closeAll(self):
+ """ Close all files (well technically, we don't really close them,
+ so that they are all stil there when the user presses cancel).
+ Returns False if the user pressed cancel when asked for
+ saving an unsaved file.
+ """
+
+ # try closing all editors.
+ for editor in self:
+ result = self.askToSaveFileIfDirty(editor)
+ if not result:
+ return False
+
+ # we're good to go closing
+ return True
+
diff --git a/iep/iepcore/icons.py b/iep/iepcore/icons.py
new file mode 100644
index 0000000..2ba8a5a
--- /dev/null
+++ b/iep/iepcore/icons.py
@@ -0,0 +1,713 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Icons module
+
+Defines functionality for creating icons by composing different overlays
+and also by directly drawing into the pixmap. This allows making icons
+that show information to the user in a very effective, yet subtle manner.
+
+"""
+
+from pyzolib.qt import QtCore, QtGui
+import iep
+
+
+class IconArtist:
+ """ IconArtist(icon=None)
+
+ Object to draw icons with. Can be instantiated with an existing icon
+ or as a blank icon. Perform operations and then use finish() to
+ obtain the result.
+
+ """
+
+ def __init__(self, icon=None):
+
+ # Get pixmap from given icon (None creates empty pixmap)
+ self._pm = self._getPixmap(icon)
+
+ # Instantiate painter for the pixmap
+ self._painter = QtGui.QPainter()
+ self._painter.begin(self._pm)
+
+
+ def finish(self, icon=None):
+ """ finish()
+ Finish the drawing and return the resulting icon.
+ """
+ self._painter.end()
+ return QtGui.QIcon(self._pm)
+
+
+ def _getPixmap(self, icon):
+
+ # Get icon if given by name
+ if isinstance(icon, str):
+ icon = iep.icons[icon]
+
+ # Create pixmap
+ if icon is None:
+ pm = QtGui.QPixmap(16, 16)
+ pm.fill(QtGui.QColor(0,0,0,0))
+ return pm
+ elif isinstance(icon, tuple):
+ pm = QtGui.QPixmap(icon[0], icon[1])
+ pm.fill(QtGui.QColor(0,0,0,0))
+ return pm
+ elif isinstance(icon, QtGui.QPixmap):
+ return icon
+ elif isinstance(icon, QtGui.QIcon):
+ return icon.pixmap(16, 16)
+ else:
+ raise ValueError('Icon for IconArtis should be icon, pixmap or name.')
+
+
+ def setPenColor(self, color):
+ """ setPenColor(color)
+ Set the color of the pen. Color can be anything that can be passed to
+ Qcolor().
+ """
+ pen = QtGui.QPen()
+ if isinstance(color, tuple):
+ pen.setColor(QtGui.QColor(*color))
+ else:
+ pen.setColor(QtGui.QColor(color))
+ self._painter.setPen(pen)
+
+
+ def addLayer(self, overlay, x=0, y=0):
+ """ addOverlay(overlay, x=0, y=0)
+ Add an overlay icon to the icon (add the specified position).
+ """
+ pm = self._getPixmap(overlay)
+ self._painter.drawPixmap(x, y, pm)
+
+
+ def addLine(self, x1, y1, x2, y2):
+ """ addLine( x1, y1, x2, y2)
+ Add a line to the icon.
+ """
+ self._painter.drawLine(x1, y1, x2, y2)
+
+ def addPoint(self, x, y):
+ """ addPoint( x, y)
+ Add a point to the icon.
+ """
+ self._painter.drawPoint(x, y)
+
+ def addMenuArrow(self, strength=100):
+ """ addMenuArrow()
+ Adds a menu arrow to the icon to let the user know the icon
+ is clickable.
+ """
+ x, y = 0, 12
+ a1, a2 = int(strength/2), strength
+ # Zeroth line of 3+2
+ self.setPenColor((0,0,0,a1))
+ self.addPoint(x+0,y-1); self.addPoint(x+4,y-1);
+ self.setPenColor((0,0,0,a2))
+ self.addPoint(x+1,y-1); self.addPoint(x+2,y-1); self.addPoint(x+3,y-1);
+ # First line of 3+2
+ self.setPenColor((0,0,0,a1))
+ self.addPoint(x+0,y+0); self.addPoint(x+4,y+0);
+ self.setPenColor((0,0,0,a2))
+ self.addPoint(x+1,y+0); self.addPoint(x+2,y+0); self.addPoint(x+3,y+0);
+ # Second line of 3
+ self.addPoint(x+1,y+1); self.addPoint(x+2,y+1); self.addPoint(x+3,y+1)
+ # Third line of 1+2
+ self.addPoint(x+2,y+2)
+ self.setPenColor((0,0,0,a1))
+ self.addPoint(x+1,y+2); self.addPoint(x+3,y+2)
+ # Fourth line of 1
+ self.setPenColor((0,0,0,a2))
+ self.addPoint(x+2,y+3);
+
+
+# todo: not used; remove me?
+class TabCloseButton(QtGui.QToolButton):
+ """ TabCloseButton
+
+ This class implements a very compact close button to be used in tabs.
+ It allows managing tab (the closing part of it) in a fast and intuitive
+ fashion.
+
+ """
+
+ SIZE = 5,8
+
+ def __init__(self):
+ QtGui.QToolButton.__init__(self)
+
+ # Init
+ self.setIconSize(QtCore.QSize(*self.SIZE))
+ self.setStyleSheet("QToolButton{ border:none; padding:0px; margin:0px; }")
+ self.setIcon(self.getCrossIcon1())
+
+ def mousePressEvent(self, event):
+ # Get tabs
+ tabs = self.parent().parent()
+ # Get index from position
+ pos = self.mapTo(tabs, event.pos())
+ index = tabs.tabBar().tabAt(pos)
+ # Close it
+ tabs.tabCloseRequested.emit(index)
+
+ def enterEvent(self, event):
+ QtGui.QToolButton.enterEvent(self, event)
+ self.setIcon(self.getCrossIcon2())
+
+ def leaveEvent(self, event):
+ QtGui.QToolButton.leaveEvent(self, event)
+ self.setIcon(self.getCrossIcon1())
+
+ def _createCrossPixmap(self, alpha):
+ artist = IconArtist(self.SIZE)
+ #
+ artist.setPenColor((0,0,0,alpha))
+ #
+ artist.addPoint(0,0); artist.addPoint(1,1)
+ artist.addPoint(2,2); artist.addPoint(3,3)
+ artist.addPoint(4,4);
+ artist.addPoint(0,4); artist.addPoint(1,3)
+ artist.addPoint(3,1); artist.addPoint(4,0)
+ #
+ artist.setPenColor((0,0,0,int(0.5*alpha)))
+ #
+ artist.addPoint(1,0); artist.addPoint(0,1)
+ artist.addPoint(2,1); artist.addPoint(1,2)
+ artist.addPoint(3,2); artist.addPoint(2,3)
+ artist.addPoint(4,3); artist.addPoint(3,4)
+ #
+ artist.addPoint(0,3); artist.addPoint(1,4)
+ artist.addPoint(3,0); artist.addPoint(4,1)
+ #
+ return artist.finish().pixmap(*self.SIZE)
+
+ def getCrossIcon1(self):
+ if hasattr(self, '_cross1'):
+ pm = self._cross1
+ else:
+ pm = self._createCrossPixmap(80)
+ return QtGui.QIcon(pm)
+
+ def getCrossIcon2(self):
+ if hasattr(self, '_cross2'):
+ pm = self._cross2
+ else:
+ pm = self._createCrossPixmap(240)
+ # Set
+ return QtGui.QIcon(pm)
+
+
+# todo: not used; remove me?
+class ToolButtonWithMenuIndication(QtGui.QToolButton):
+ """ ToolButtonWithMenuIndication
+
+ Tool button that wraps the icon in a slightly larger icon that
+ contains a small arrow that lights up when hovering over the icon.
+
+ The button itself is not drawn. If the icon is clicked, the
+ customContextMenuRequested signal of the "grandparent" is emitted. In
+ this way we realize a suble icon that can be clicked on to show a menu.
+
+ """
+
+ SIZE = 21, 16
+
+ def __init__(self):
+ QtGui.QToolButton.__init__(self)
+
+ # Init
+ self.setIconSize(QtCore.QSize(*self.SIZE))
+ self.setStyleSheet("QToolButton{ border: none; }")
+
+ # Create arrow pixmaps
+ self._menuarrow1 = self._createMenuArrowPixmap(0)
+ self._menuarrow2 = self._createMenuArrowPixmap(70)
+ self._menuarrow = self._menuarrow1
+
+ # Variable to keep icon
+ self._icon = None
+
+ # Variable to keep track of when the mouse was pressed, so that
+ # we can allow dragging as well as clicking the menu.
+ self._menuPressed = False
+
+ def mousePressEvent(self, event):
+ # Ignore event so that the tabbar will change to that tab
+ event.ignore()
+ self._menuPressed = event.pos()
+
+ def mouseMoveEvent(self, event):
+ QtGui.QToolButton.mouseMoveEvent(self, event)
+ if self._menuPressed:
+ dragDist = QtGui.QApplication.startDragDistance()
+ if (event.pos()-self._menuPressed).manhattanLength() >= dragDist:
+ self._menuPressed = False
+
+ def mouseReleaseEvent(self, event):
+ event.ignore()
+ if self._menuPressed:
+ tabs = self.parent().parent()
+ pos = self.mapTo(tabs, event.pos())
+ tabs.customContextMenuRequested.emit(pos)
+
+ def enterEvent(self, event):
+ QtGui.QToolButton.enterEvent(self, event)
+ self._menuarrow = self._menuarrow2
+ self.setIcon()
+ self._menuPressed = False
+
+ def leaveEvent(self, event):
+ QtGui.QToolButton.leaveEvent(self, event)
+ self._menuarrow = self._menuarrow1
+ self.setIcon()
+ self._menuPressed = False
+
+
+ def setIcon(self, icon=None):
+
+ # Store icon if given, otherwise use buffered version
+ if icon is not None:
+ self._icon = icon
+
+ # Compose icon by superimposing the menuarrow pixmap
+ artist = IconArtist(self.SIZE)
+ if self._icon:
+ artist.addLayer(self._icon, 5, 0)
+ artist.addLayer(self._menuarrow, 0,0)
+ icon = artist.finish()
+
+ # Set icon
+ QtGui.QToolButton.setIcon(self, icon)
+
+
+ def _createMenuArrowPixmap(self, strength):
+ artist = IconArtist()
+ artist.addMenuArrow(strength)
+ return artist.finish().pixmap(16,16)
+
+
+
+class TabToolButton(QtGui.QToolButton):
+ """ TabToolButton
+
+ Base menu for editor and shell tabs.
+
+ """
+
+ SIZE = 16, 16
+
+ def __init__(self, *args):
+ QtGui.QToolButton.__init__(self, *args)
+
+ # Init
+ self.setIconSize(QtCore.QSize(*self.SIZE))
+ self.setStyleSheet("QToolButton{ border: none; }")
+
+ def mousePressEvent(self, event):
+ # Ignore event so that the tabbar will change to that tab
+ event.ignore()
+
+
+
+class TabToolButtonWithCloseButton(TabToolButton):
+ """ TabToolButtonWithCloseButton
+
+ Tool button that wraps the icon in a slightly larger icon that
+ contains a small cross that can be used to invoke a close request.
+
+ """
+
+ SIZE = 22, 16
+ CROSS_OFFSET = 0, 2
+
+ def __init__(self, *args):
+ TabToolButton.__init__(self, *args)
+
+ # Variable to keep icon
+ self._icon = None
+ self._cross = self.getCrossPixmap1()
+
+ # For mouse tracking inside icon
+ self.setMouseTracking(True)
+ self._overCross = False
+
+
+ def _isOverCross(self, pos):
+ x1, x2 = self.CROSS_OFFSET[0], self.CROSS_OFFSET[0]+5+1
+ y1, y2 = self.CROSS_OFFSET[1], self.CROSS_OFFSET[1]+5+1
+ if pos.x()>=x1 and pos.x()<=x2 and pos.y()>=y1 and pos.y()<=y2:
+ return True
+ else:
+ return False
+
+
+ def mousePressEvent(self, event):
+ if self._isOverCross(event.pos()):
+ # Accept event so that the tabbar will NOT change to that tab
+ event.accept()
+ else:
+ event.ignore()
+
+
+ def mouseReleaseEvent(self, event):
+ if self._isOverCross(event.pos()):
+ event.accept()
+ # Get tabs
+ tabs = self.parent().parent()
+ # Get index from position
+ pos = self.mapTo(tabs, event.pos())
+ index = tabs.tabBar().tabAt(pos)
+ # Close it
+ tabs.tabCloseRequested.emit(index)
+ else:
+ event.ignore()
+
+
+ def mouseMoveEvent(self, event):
+ QtGui.QToolButton.mouseMoveEvent(self, event)
+ new_overCross = self._isOverCross(event.pos())
+ if new_overCross != self._overCross:
+ self._overCross = new_overCross
+ if new_overCross:
+ self._cross = self.getCrossPixmap2()
+ else:
+ self._cross = self.getCrossPixmap1()
+ self.setIcon()
+
+ def leaveEvent(self, event):
+ if self._overCross:
+ self._overCross = False
+ self._cross = self.getCrossPixmap1()
+ self.setIcon()
+
+
+ def setIcon(self, icon=None):
+
+ # Store icon if given, otherwise use buffered version
+ if icon is not None:
+ self._icon = icon
+
+ # Compose icon by superimposing the menuarrow pixmap
+ artist = IconArtist(self.SIZE)
+ if self._icon:
+ if self.CROSS_OFFSET[0] > 8:
+ artist.addLayer(self._icon, 0,0)
+ else:
+ artist.addLayer(self._icon, 6,0)
+ artist.addLayer(self._cross, *self.CROSS_OFFSET)
+ icon = artist.finish()
+
+ # Set icon
+ QtGui.QToolButton.setIcon(self, icon)
+
+
+ def _createMenuArrowPixmap(self, strength):
+ artist = IconArtist()
+ artist.addMenuArrow(strength)
+ return artist.finish().pixmap(16,16)
+
+
+ def _createCrossPixmap(self, alpha):
+ artist = IconArtist((5,5))
+ #
+ artist.setPenColor((0,0,0,alpha))
+ #
+ artist.addPoint(0,0); artist.addPoint(1,1)
+ artist.addPoint(2,2); artist.addPoint(3,3)
+ artist.addPoint(4,4);
+ artist.addPoint(0,4); artist.addPoint(1,3)
+ artist.addPoint(3,1); artist.addPoint(4,0)
+ #
+ artist.setPenColor((0,0,0,int(0.5*alpha)))
+ #
+ artist.addPoint(1,0); artist.addPoint(0,1)
+ artist.addPoint(2,1); artist.addPoint(1,2)
+ artist.addPoint(3,2); artist.addPoint(2,3)
+ artist.addPoint(4,3); artist.addPoint(3,4)
+ #
+ artist.addPoint(0,3); artist.addPoint(1,4)
+ artist.addPoint(3,0); artist.addPoint(4,1)
+ #
+ return artist.finish().pixmap(5,5)
+
+
+ def getCrossPixmap1(self):
+ if hasattr(self, '_cross1'):
+ pm = self._cross1
+ else:
+ pm = self._createCrossPixmap(50)
+ return pm
+
+ def getCrossPixmap2(self):
+ if hasattr(self, '_cross2'):
+ pm = self._cross2
+ else:
+ pm = self._createCrossPixmap(240)
+ # Set
+ return pm
+
+
+
+class EditorTabToolButton(TabToolButtonWithCloseButton):
+ """ Button for the tabs of the editors. This is just a
+ tight wrapper for the icon.
+ """
+
+ def updateIcon(self, isDirty, isMain, isPinned, nBlocks=10001):
+
+ # Init drawing
+ artist = IconArtist()
+
+ # Create base
+ if isDirty:
+ artist.addLayer('page_white_dirty')
+ artist.setPenColor('#f00')
+ else:
+ artist.addLayer('page_white')
+ artist.setPenColor('#444')
+
+ # Paint lines
+ if not nBlocks:
+ nLines = 0
+ elif nBlocks <= 10: nLines = 1
+ elif nBlocks <= 100: nLines = 2
+ elif nBlocks <= 1000: nLines = 3
+ elif nBlocks <= 10000: nLines = 4
+ else: nLines = 5
+ #
+ fraction = float(nBlocks) / 10**nLines
+ fraction = min(fraction, 1.0)
+ #
+ for i in range(nLines):
+ y = 4 + 2 * i
+ n = 5
+ if y>6: n = 8
+ #if i == nLines-1:
+ # n = int(fraction * n)
+ artist.addLine(4,y,4+n,y)
+
+ # Overlays
+ if isMain:
+ artist.addLayer('overlay_star')
+ if isPinned:
+ artist.addLayer('overlay_thumbnail')
+ if isDirty:
+ artist.addLayer('overlay_disk')
+
+ # Apply
+ self.setIcon(artist.finish())
+
+
+
+class ShellIconMaker:
+ """ Object that can make an icon for the shells
+ """
+
+ POSITION = (6,7) # absolute position of center of wheel.
+
+ # Relative position for the wheel at two levels. Center is at (3,,3)
+ POSITIONS1 = [(2,2), (3,2), (4,2), (4,3), (4,4), (3,4), (2,4), (2,3)]
+ POSITIONS2 = [ (2,1), (3,1), (4,1), (5,2), (5,3), (5,4),
+ (4,5), (3,5), (2,5), (1,4), (1,3), (1,2) ]
+
+ # Maps to make transitions between levels more natural
+ MAP1to2 = [1,2, 4,5, 7,8, 10,11]
+ MAP2to1 = [1,2,3, 3,4,5, 5,6,7, 7,0,1]
+
+ MAX_ITERS_IN_LEVEL_1 = 2
+
+
+ def __init__(self, objectWithIcon):
+
+ self._objectWithIcon = objectWithIcon
+
+ # Motion properties
+ self._index = 0
+ self._level = 0
+ self._count = 0 # to count number of iters in level 1
+
+ # Prepare blob pixmap
+ self._blob = self._createBlobPixmap()
+ self._legs = self._createLegsPixmap()
+
+ # Create timer
+ self._timer = QtCore.QTimer(None)
+ self._timer.setInterval(150)
+ self._timer.setSingleShot(False)
+ self._timer.timeout.connect(self.onTimer)
+
+
+ def setIcon(self, icon):
+ self._objectWithIcon.setIcon(icon)
+
+
+ def _createBlobPixmap(self):
+
+ artist = IconArtist()
+ artist.setPenColor((0,150,0,255))
+ artist.addPoint(1,1)
+ artist.setPenColor((0,150,0, 200))
+ artist.addPoint(1,0); artist.addPoint(1,2)
+ artist.addPoint(0,1); artist.addPoint(2,1)
+ artist.setPenColor((0,150,0, 100))
+ artist.addPoint(0,0); artist.addPoint(2,0)
+ artist.addPoint(0,2); artist.addPoint(2,2)
+ return artist.finish().pixmap(16,16)
+
+
+ def _createLegsPixmap(self):
+ artist = IconArtist()
+ x,y = self.POSITION
+ artist.setPenColor((0,50,0,150))
+ artist.addPoint(x+1,y-1); artist.addPoint(x+1,y-2); artist.addPoint(x+0,y-2)
+ artist.addPoint(x+3,y+1); artist.addPoint(x+4,y+1); artist.addPoint(x+4,y+2)
+ artist.addPoint(x+2,y+3); artist.addPoint(x+2,y+4)
+ artist.addPoint(x+0,y+3); artist.addPoint(x+0,y+4)
+ artist.addPoint(x-1,y+2); artist.addPoint(x-2,y+2)
+ artist.addPoint(x-1,y+0); artist.addPoint(x-2,y+0)
+ return artist.finish().pixmap(16,16)
+
+
+ def updateIcon(self, status='Ready'):
+ """ updateIcon(status)
+ Public method to set what state the icon must show.
+ """
+
+ # Normalize and store
+ if isinstance(status, str):
+ status = status.lower()
+ self._status = status
+
+ # Handle
+ if status == 'busy':
+ self._index = 0
+ if self._level == 2:
+ self._index = self.MAP2to1[self._index]
+ self._level = 1
+
+ elif status == 'very busy':
+ self._index = 0
+ if self._level == 1:
+ self._index = self.MAP1to2[self._index]
+ self._level = 2
+
+ else:
+ self._level = 0
+
+ # At least one timer iteration
+ self._timer.start()
+
+
+ def _nextIndex(self):
+ self._index += 1
+ if self._level == 1 and self._index >= 8:
+ self._index = 0
+ elif self._level == 2 and self._index >= 12:
+ self._index = 0
+
+ def _index1(self):
+ return self._index
+
+
+ def _index2(self):
+ n = [0, 8, 12][self._level]
+ index = self._index + n/2
+ if index >= n:
+ index -= n
+ return int(index)
+
+
+ def onTimer(self):
+ """ onTimer()
+ Invoked on each timer iteration. Will call the static drawing
+ methods if in level 0. Otherwise will invoke drawInMotion().
+ This method also checks if we should change levels and calculates
+ how this is best achieved.
+ """
+ if self._level == 0:
+ # Turn of timer
+ self._timer.stop()
+ # Draw
+ if self._status in ['ready', 'more']:
+ self.drawReady()
+ elif self._status == 'debug':
+ self.drawDebug()
+ elif self._status == 'dead':
+ self.drawDead()
+ else:
+ self.drawDead()
+
+ elif self._level == 1:
+ # Draw
+ self.drawInMotion()
+ # Next, this is always intermediate
+ self._nextIndex()
+ self._count += 1
+
+ elif self._level == 2:
+ # Draw
+ self.drawInMotion()
+ # Next
+ self._nextIndex()
+
+
+ def drawReady(self):
+ """ drawReady()
+ Draw static icon for when in ready mode.
+ """
+ artist = IconArtist("application")
+ artist.addLayer(self._blob, *self.POSITION)
+ self.setIcon(artist.finish())
+
+
+ def drawDebug(self):
+ """ drawDebug()
+ Draw static icon for when in debug mode.
+ """
+ artist = IconArtist("application")
+ artist.addLayer(self._blob, *self.POSITION)
+ artist.addLayer(self._legs)
+ self.setIcon(artist.finish())
+
+
+ def drawDead(self):
+ """ drawDead()
+ Draw static empty icon for when the kernel is dead.
+ """
+ artist = IconArtist("application")
+ self.setIcon(artist.finish())
+
+
+ def drawInMotion(self):
+ """ drawInMotion()
+ Draw one frame of the icon in motion. Position of the blobs
+ is determined from the index and the list of locations.
+ """
+
+ # Init drawing
+ artist = IconArtist("application")
+
+ # Define params
+ dx, dy = self.POSITION[0]-3, self.POSITION[1]-3
+ blob = self._blob
+ #
+ if self._level == 1:
+ positions = self.POSITIONS1
+ elif self._level == 2:
+ positions = self.POSITIONS2
+
+ # Draw
+ pos1 = positions[self._index1()]
+ pos2 = positions[self._index2()]
+ artist.addLayer(blob, pos1[0]+dx, pos1[1]+dy)
+ artist.addLayer(blob, pos2[0]+dx, pos2[1]+dy)
+
+ # Done
+ self.setIcon(artist.finish())
+
diff --git a/iep/iepcore/iepLogging.py b/iep/iepcore/iepLogging.py
new file mode 100644
index 0000000..00fdb3e
--- /dev/null
+++ b/iep/iepcore/iepLogging.py
@@ -0,0 +1,142 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+""" Module logging
+
+Functionality for logging in IEP.
+
+"""
+
+import sys, os, time
+import code
+import iep
+iep.status = None
+
+# todo: enable logging to a file?
+
+# Define prompts
+try:
+ sys.ps1
+except AttributeError:
+ sys.ps1 = ">>> "
+try:
+ sys.ps2
+except AttributeError:
+ sys.ps2 = "... "
+
+
+class DummyStd:
+ """ For when std is not available. """
+ def __init__(self):
+ self._closed = False
+ def write(self, text):
+ pass
+ def encoding(self):
+ return 'utf-8'
+ @property
+ def closed(self):
+ return self._closed
+ def close(self):
+ self._closed = False
+ def flush(self):
+ pass
+
+
+original_print = print
+def print(*args, **kwargs):
+ # Obtain time string
+ t = time.localtime()
+ preamble = "{:02g}-{:02g}-{:04g} {:02g}:{:02g}:{:02g}: "
+ preamble = preamble.format( t.tm_mday, t.tm_mon, t.tm_year,
+ t.tm_hour, t.tm_min, t.tm_sec)
+ # Prepend to args and print
+ args = [preamble] + list(args)
+ original_print(*tuple(args),**kwargs)
+
+
+
+def splitConsole(stdoutFun=None, stderrFun=None):
+ """ splitConsole(stdoutFun=None, stderrFun=None)
+ Splits the stdout and stderr streams. On each call
+ to their write methods, in addition to the original
+ write method being called, will call the given
+ functions.
+ Returns the history of the console (combined stdout
+ and stderr).
+ Used by the logger shell.
+ """
+
+ # Split stdout and stderr
+ sys.stdout = OutputStreamSplitter(sys.stdout)
+ sys.stderr = OutputStreamSplitter(sys.stderr)
+
+ # Make them share their history
+ sys.stderr._history = sys.stdout._history
+
+ # Set defer functions
+ if stdoutFun:
+ sys.stdout._deferFunction = stdoutFun
+ if stderrFun:
+ sys.stderr._deferFunction = stderrFun
+
+ # Return history
+ return ''.join(sys.stdout._history)
+
+
+class OutputStreamSplitter:
+ """ This class is used to replace stdout and stderr output
+ streams. It defers the stream to the original and to
+ a function that can be registered.
+ Used by the logger shell.
+ """
+
+ def __init__(self, fileObject):
+
+ # Init, copy properties if it was already a splitter
+ if isinstance(fileObject, OutputStreamSplitter):
+ self._original = fileObject._original
+ self._history = fileObject._history
+ self._deferFunction = fileObject._deferFunction
+ else:
+ self._original = fileObject
+ self._history = []
+ self._deferFunction = self.dummyDeferFunction
+
+ # Replace original with a dummy if None
+ if self._original is None:
+ self._original = DummyStd()
+
+
+ def dummyDeferFunction(self, text):
+ pass
+
+ def write(self, text):
+ """ Write method. """
+ self._original.write(text)
+ self._history.append(text)
+ self._deferFunction(text)
+ # Show in statusbar
+ if iep.status and len(text)>1:
+ iep.status.showMessage(text, 5000)
+
+
+ def flush(self):
+ return self._original.flush()
+
+ @property
+ def closed(self):
+ return self._original.closed
+
+ def close(self):
+ return self._original.close()
+
+ def encoding(self):
+ return self._original.encoding()
+
+# Split now, with no defering
+splitConsole()
+
diff --git a/iep/iepcore/kernelbroker.py b/iep/iepcore/kernelbroker.py
new file mode 100644
index 0000000..460d9bd
--- /dev/null
+++ b/iep/iepcore/kernelbroker.py
@@ -0,0 +1,823 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module kernelBroker
+
+This module implements the interface between IEP and the kernel.
+
+"""
+
+import os, sys, time
+import subprocess
+import signal
+import threading
+import ctypes
+
+from pyzolib import ssdf
+import yoton
+import iep # local IEP (can be on a different box than where the user is)
+
+
+# Important: the yoton event loop should run somehow!
+
+class KernelInfo(ssdf.Struct):
+ """ KernelInfo
+
+ Describes all information for a kernel. This class can be used at
+ the IDE as well as the kernelbroker.
+
+ This information goes a long way from the iep config file to the
+ kernel. The list iep.config.shellConfigs2 contains the configs
+ for all kernels. These objects are edited in-place by the
+ shell config.
+
+ The shell keeps a reference of the shell config used to start the
+ kernel. On each restart all information is resend. In this way,
+ if a user changes a setting in the shell config, it is updated
+ when the shell restarts.
+
+ The broker also keeps a copy of the shell config. In this way,
+ the shell might send no config information (or only partially
+ update the config information) on a restart. This is not so
+ relevant now, but it can be when we are running multiple people
+ on a single kernel, and there is only one user who has the
+ original config.
+
+ """
+ def __init__(self, info=None):
+
+ # ----- Fixed parameters that define a shell -----
+
+ # scriptFile is used to define the mode. If given, we run in
+ # script-mode. Otherwise we run in interactive mode.
+
+ # The name of this shell config. Can be used to name the kernel
+ self.name = 'Python'
+
+ # The executable. This can be '/usr/bin/python3.1' or
+ # 'c:/program files/python2.6/python.exe', etc.
+ # The "[default]" is a placeholder text that is replaced at the last
+ # moment with iep.defaultInterpreterExe()
+ self.exe = '[default]'
+
+ # The GUI toolkit to embed the event loop of.
+ # Instantiate with a value that is settable
+ self.gui = iep.defaultInterpreterGui() or 'none'
+
+ # The Python path. Paths should be separated by newlines.
+ # '$PYTHONPATH' is replaced by environment variable by broker
+ self.pythonPath = ''
+
+ # The path of the current project, the kernel will prepend this
+ # to the sys.path. The broker could prepend to PYTHONPATH, but
+ # in this way it is more explicit (kernel can tell the user that
+ # the project path was prepended).
+ self.projectPath = ''
+
+ # The full filename of the script to run.
+ # If given, the kernel should run in script-mode.
+ # The kernel will check whether this file exists, and will
+ # revert to interactive mode if it doesn't.
+ self.scriptFile = ''
+
+ # Interactive-mode only:
+
+ # The initial directory. Only used for interactive-mode; in
+ # script-mode the initial directory is the dir of the script.
+ self.startDir = ''
+
+ # The Startup script (only used for interactive-mode).
+ # - Empty string means run nothing,
+ # - Single line means file name
+ # - multiple lines means source code.
+ # - '$PYTHONSTARTUP' uses the code in that file. Broker replaces this.
+ self.startupScript = ''
+
+ # Additional command line arguments, set by the kernel
+ self.argv = ''
+
+ # Additional environment variables
+ self.environ = ''
+
+ # Load info from ssdf struct. Make sure they are all strings
+ if info:
+ # Get struct
+ if isinstance(info, dict):
+ s = info
+ elif ssdf.isstruct(info):
+ s = info
+ elif isinstance(info, str):
+ s = ssdf.loads(info)
+ else:
+ raise ValueError('Kernel info should be a string or ssdf struct, not %s' % str(type(info)))
+ # Inject values
+ for key in s:
+ val = s[key]
+ if not val:
+ val = ''
+ self[key] = val
+
+
+ def tostring(self):
+ return ssdf.saves(self)
+
+
+def getCommandFromKernelInfo(info, port):
+ info = KernelInfo(info)
+
+ # Apply default exe
+ exe = info.exe
+ if exe in ('[default]', '<default>'):
+ exe = iep.defaultInterpreterExe()
+
+ # Correct path when it contains spaces
+ if exe.count(' ') and exe[0] != '"':
+ exe = '"{}"'.format(exe)
+
+ # Get start script
+ startScript = os.path.join( iep.iepDir, 'iepkernel', 'start.py')
+ startScript = '"{}"'.format(startScript)
+
+ # Build command
+ command = exe + ' ' + startScript + ' ' + str(port)
+
+ # Done
+ return command
+
+
+def getEnvFromKernelInfo(info):
+ info = KernelInfo(info)
+
+ pythonPath = info.pythonPath
+
+ # Set default pythonPath (replace only first occurrence of $PYTHONPATH
+ ENV_PP = os.environ.get('PYTHONPATH','')
+ pythonPath = pythonPath.replace('$PYTHONPATH', '\n'+ENV_PP+'\n', 1)
+ pythonPath = pythonPath.replace('$PYTHONPATH', '')
+ # Split paths, allow newlines and os.pathsep
+ for splitChar in '\n\r' + os.pathsep:
+ pythonPath = pythonPath.replace(splitChar, '\n')
+ pythonPaths = [p.strip() for p in pythonPath.split('\n') if p]
+ # Recombine using the OS's path separator
+ pythonPath = os.pathsep.join(pythonPaths)
+ # Add entry to Pythopath, so that we can import yoton
+ # Note: an empty entry might cause trouble if the start-directory is
+ # somehow overriden (see issue 128).
+ pythonPath = iep.iepDir + os.pathsep + pythonPath
+
+ # Prepare environment, remove references to tk libraries,
+ # since they're wrong when frozen. Python will insert the
+ # correct ones if required.
+ env = os.environ.copy()
+ #
+ env.pop('TK_LIBRARY','')
+ env.pop('TCL_LIBRARY','')
+ env['PYTHONPATH'] = pythonPath
+
+ # Add environment variables specified in shell config
+ for line in info.environ.splitlines():
+ line = line.strip()
+ if '=' in line:
+ key, val = line.split('=', 1)
+ if key:
+ env[key] = val
+
+ # Done
+ return env
+
+
+
+class KernelBroker:
+ """ KernelBroker(info)
+
+ This class functions as a broker between a kernel process and zero or
+ more IDE's (clients).
+
+ This class has a single context assosiated with it, that lives as long
+ as this object. It is used to connect to a kernel process and to
+ 0 or more IDE's (clients). The kernel process can be "restarted", meaning
+ that it is terminated and a new process started.
+
+ The broker is cleaned up if there is no kernel process AND no connections.
+
+ """
+
+ def __init__(self, manager, info, name=''):
+ self._manager = manager
+
+ # Store info that defines the kernel
+ self._originalInfo = KernelInfo(info)
+
+ # Make a copy for the current version. This copy is re-created on
+ # each restart
+ self._info = ssdf.copy(self._originalInfo)
+
+ # Store name (or should the name be defined in the info struct)
+ self._name = name
+
+ # Create context for the connection to the kernel and IDE's
+ # This context is persistent (it stays as long as this KernelBroker
+ # instance is alive).
+ self._context = yoton.Context()
+ self._kernelCon = None
+ self._ctrl_broker = None
+
+ # Create yoton-based timer
+ self._timer = yoton.Timer(0.2, oneshot=False)
+ self._timer.bind(self.mainLoopIter)
+
+ # Kernel process and connection (these are replaced on restarting)
+ self._reset()
+
+ # For restarting after terminating
+ self._pending_restart = None
+
+
+ ## Startup and teardown
+
+
+ def _create_channels(self):
+ ct = self._context
+
+ # Close any existing channels first
+ self._context.close_channels()
+
+ # Create stream channels.
+ # Stdout is for the C-level stdout/stderr streams.
+ self._strm_broker = yoton.PubChannel(ct, 'strm-broker')
+ self._strm_raw = yoton.PubChannel(ct, 'strm-raw')
+ self._strm_prompt = yoton.PubChannel(ct, 'strm-prompt')
+
+ # Create control channel so that the IDE can control restarting etc.
+ self._ctrl_broker = yoton.SubChannel(ct, 'ctrl-broker')
+
+ # Status channel to pass startup parameters to the kernel
+ self._stat_startup = yoton.StateChannel(ct, 'stat-startup', yoton.OBJECT)
+
+ # We use the stat-interpreter to set the status to dead when kernel dies
+ self._stat_interpreter = yoton.StateChannel(ct, 'stat-interpreter')
+
+ # Create introspect channel so we can interrupt and terminate
+ self._reqp_introspect = yoton.ReqChannel(ct, 'reqp-introspect')
+
+
+ def _reset(self, destroy=False):
+ """ _reset(destroy=False)
+
+ Reset state. if destroy, does a full clean up, closing the context
+ and removing itself from the KernelManager's list.
+
+ """
+
+ # Close connection (it might be in a wait state if the process
+ # failed to start)
+ if self._kernelCon is not None:
+ self._kernelCon.close()
+
+ # Set process and kernel connection to None
+ self._process = None
+ self._kernelCon = None
+ self._terminator = None
+ self._streamReader = None
+
+ if destroy==True:
+
+ # Stop timer
+ self._timer.unbind(self.mainLoopIter)
+ self._timer.stop()
+ self._timer = None
+
+ # Clean up this kernelbroker instance
+ L = self._manager._kernels
+ while self in L:
+ L.remove(self)
+
+ # Remove references
+ #
+ if self._context is not None:
+ self._context.close()
+ self._context = None
+ #
+ self._strm_broker = None
+ self._strm_raw = None
+ self._stat_startup = None
+ self._stat_interpreter = None
+ self._strm_prompt = None
+ #
+ self._ctrl_broker = None
+ self._reqp_introspect = None
+
+
+ def startKernelIfConnected(self, timeout=10.0):
+ """ startKernelIfConnected(timout=10.0)
+
+ Start the kernel as soon as there is a connection.
+
+ """
+ self._process = time.time() + timeout
+ self._timer.start()
+
+
+ def startKernel(self):
+ """ startKernel()
+
+ Launch the kernel in a subprocess, and connect to it via the
+ context and two Pypes.
+
+ """
+
+ # Create channels
+ self._create_channels()
+
+ # Create info dict
+ info = {}
+ for key in self._info:
+ info[key] = self._info[key]
+
+ # Send info stuff so that the kernel has access to the information
+ self._stat_startup.send(info)
+
+ # Get directory to start process in
+ cwd = iep.iepDir
+
+ # Host connection for the kernel to connect
+ # (tries several port numbers, staring from 'IEP')
+ self._kernelCon = self._context.bind('localhost:IEP2',
+ max_tries=256, name='kernel')
+
+ # Get command to execute, and environment to use
+ command = getCommandFromKernelInfo(self._info, self._kernelCon.port1)
+ env = getEnvFromKernelInfo(self._info)
+
+ # Wrap command in call to 'cmd'?
+ if sys.platform.startswith('win'):
+ # as the author from Pype writes:
+ #if we don't run via a command shell, then either sometimes we
+ #don't get wx GUIs, or sometimes we can't kill the subprocesses.
+ # And I also see problems with Tk.
+ # But we only use it if we are sure that cmd is available.
+ # See IEP issue #240
+ try:
+ subprocess.check_output('cmd /c "cd"', shell=True)
+ except IOError:
+ pass # Do not use cmd
+ else:
+ command = 'cmd /c "{}"'.format(command)
+
+ # Start process
+ self._process = subprocess.Popen( command, shell=True,
+ env=env, cwd=cwd,
+ stdin=subprocess.PIPE, # Fixes issue 165
+ stdout=subprocess.PIPE,
+ stderr=subprocess.STDOUT
+ )
+
+ # Set timeout for connection, i.e. after how much time of
+ # unresponsive ness is the kernel found to be running extension code
+ # Better set this before connecting
+ self._kernelCon.timeout = 0.5
+
+ # Bind to events
+ self._kernelCon.closed.bind(self._onKernelConnectionClose)
+ self._kernelCon.timedout.bind(self._onKernelTimedOut)
+
+ # Create reader for stream
+ self._streamReader = StreamReader(self._process,
+ self._strm_raw, self._strm_broker)
+
+ # Start streamreader and timer
+ self._streamReader.start()
+ self._timer.start()
+
+ # Reset some variables
+ self._pending_restart = None
+
+
+ def hostConnectionForIDE(self, address='localhost'):
+ """ hostConnectionForIDE()
+
+ Host a connection for an IDE to connect to. Returns the port to which
+ the ide can connect.
+
+ """
+ c = self._context.bind(address+':IEP+256', max_tries=32)
+ return c.port1
+
+
+ ## Callbacks
+
+
+ def _onKernelTimedOut(self, c, timedout):
+ """ _onKernelTimedOut(c, timeout)
+
+ The kernel timed out (i.e. did not send heartbeat messages for
+ a while. It is probably running extension code.
+
+ """
+ if timedout:
+ self._stat_interpreter.send('Very busy')
+ else:
+ self._stat_interpreter.send('Busy')
+
+
+ def _onKernelConnectionClose(self, c, why):
+ """ _onKernelConnectionClose(c, why)
+
+ Connection with kernel lost. Tell clients why.
+
+ """
+
+ # If we receive this event while the current kernel connection
+ # is not the one that generated the event, ignore it.
+ if self._kernelCon is not c:
+ return
+
+ # The only reasonable way that the connection
+ # can be lost without the kernel closing, is if the yoton context
+ # crashed or was stopped somehow. In both cases, we lost control,
+ # and should put it down!
+ if not self._terminator:
+ self.terminate('because connecton was lost', 'KILL', 0.5)
+
+
+ def _onKernelDied(self, returncode=0):
+ """ _onKernelDied()
+
+ Kernel process died. Clean up!
+
+ """
+
+ # If the kernel did not start yet, probably the command is invalid
+ if self._kernelCon and self._kernelCon.is_waiting:
+ msg = 'The process failed to start (invalid command?).'
+ elif not self.isTerminating():
+ msg = 'Kernel process exited.'
+ elif not self._terminator._prev_action:
+ # We did not actually take any terminating action
+ # This happens, because if the kernel is killed from outside,
+ # _onKernelConnectionClose() triggers a terminate sequence
+ # (but with a delay).
+ # Note the "The" to be able to distinguish this case
+ msg = 'The kernel process exited.'
+ else:
+ msg = self._terminator.getMessage('Kernel process')
+
+ if self._context.connection_count:
+ # Notify
+ returncodeMsg = '\n%s (%s)\n\n' % (msg, str(returncode))
+ self._strm_broker.send(returncodeMsg)
+ # Empty prompt and signal dead
+ self._strm_prompt.send('\b')
+ self._stat_interpreter.send('Dead')
+ self._context.flush()
+
+ # Cleanup (get rid of kernel process references)
+ self._reset()
+
+ # Handle any pending action
+ if self._pending_restart:
+ self.startKernel()
+
+
+ ## Main loop and termination
+
+
+ def terminate(self, reason='by user', action='TERM', timeout=0.0):
+ """ terminate(reason='by user', action='TERM', timeout=0.0)
+
+ Initiate termination procedure for the current kernel.
+
+ """
+
+ # The terminatation procedure is started by creating
+ # a KernelTerminator instance. This instance's iteration method
+ # iscalled from _mailLoopIter().
+ self._terminator = KernelTerminator(self, reason, action, timeout)
+
+
+ def isTerminating(self):
+ """ isTerminating()
+
+ Get whether the termination procedure has been initiated. This
+ simply checks whether there is a self._terminator instance.
+
+ """
+ return bool(self._terminator)
+
+
+ def mainLoopIter(self):
+ """ mainLoopIter()
+
+ Periodically called. Kind of the main loop iteration for this kernel.
+
+ """
+
+ # Get some important status info
+ hasProcess = self._process is not None
+ hasKernelConnection = bool(self._kernelCon and self._kernelCon.is_connected)
+ hasClients = False
+ if self._context:
+ hasClients = self._context.connection_count > int(hasKernelConnection)
+
+
+ # Should we clean the whole thing up?
+ if not (hasProcess or hasClients):
+ self._reset(True) # Also unregisters this timer callback
+ return
+
+ # Waiting to get started; waiting for client to connect
+ if isinstance(self._process, float):
+ if self._context.connection_count:
+ self.startKernel()
+ elif self._process > time.time():
+ self._process = None
+ return
+
+ # If we have a process ...
+ if self._process:
+ # Test if process is dead
+ process_returncode = self._process.poll()
+ if process_returncode is not None:
+ self._onKernelDied(process_returncode)
+ return
+ # Are we in the process of terminating?
+ elif self.isTerminating():
+ self._terminator.next()
+ elif self.isTerminating():
+ # We cannot have a terminator if we have no process
+ self._terminator = None
+
+ # handle control messages
+ if self._ctrl_broker:
+ for msg in self._ctrl_broker.recv_all():
+ if msg == 'INT':
+ self._commandInterrupt()
+ elif msg == 'TERM':
+ self._commandTerminate()
+ elif msg.startswith('RESTART'):
+ self._commandRestart(msg)
+ else:
+ pass # Message is not for us
+
+
+ def _commandInterrupt(self):
+ if self._process is None:
+ self._strm_broker.send('Cannot interrupt: process is dead.\n')
+ # Kernel receives and acts
+ elif sys.platform.startswith('win'):
+ self._reqp_introspect.interrupt()
+ else:
+ # Use POSIX to interrupt, which is more reliable
+ # (the introspect thread might not get a chance)
+ # but also does not work if running extension code
+ pid = self._kernelCon.pid2
+ os.kill(pid, signal.SIGINT)
+
+
+ def _commandTerminate(self):
+ # Start termination procedure
+ # Kernel will receive term and act (if it can).
+ # If it wont, we will act in a second or so.
+ if self._process is None:
+ self._strm_broker.send('Cannot terminate: process is dead.\n')
+ elif self.isTerminating():
+ # The user gave kill command while the kill process
+ # is running. We could do an immediate kill now,
+ # or we let the terminate process run its course.
+ pass
+ else:
+ self.terminate('by user')
+
+
+ def _commandRestart(self, msg):
+ # Almost the same as terminate, but now we have a pending action
+ self._pending_restart = True
+
+ # Recreate the info struct
+ self._info = ssdf.copy(self._originalInfo)
+ # Update the info struct
+ new_info = ssdf.loads(msg.split('RESTART',1)[1])
+ for key in new_info:
+ self._info[key] = new_info[key]
+
+ # Restart now, wait, or initiate termination procedure?
+ if self._process is None:
+ self.startKernel()
+ elif self.isTerminating():
+ pass # Already terminating
+ else:
+ self.terminate('for restart')
+
+
+
+class KernelTerminator:
+ """ KernelTerminator(broker, reason='user terminated', action='TERM', timeout=0.0)
+
+ Simple class to help terminating the kernel. It has a next() method
+ that should be periodically called. It keeps track whether the timeout
+ has passed and will undertake increaslingly ruder actions to terminate
+ the kernel.
+
+ """
+ def __init__(self, broker, reason='by user', action='TERM', timeout=0.0):
+
+ # Init/store
+ self._broker = broker
+ self._reason = reason
+ self._next_action = ''
+
+ # Go
+ self._do(action, timeout)
+
+
+ def _do(self, action, timeout):
+ self._prev_action = self._next_action
+ self._next_action = action
+ self._timeout = time.time() + timeout
+ if not timeout:
+ self.next()
+
+
+ def next(self):
+
+ # Get action
+ action = self._next_action
+
+ if time.time() < self._timeout:
+ # Time did not pass yet
+ pass
+
+ elif action == 'TERM':
+ self._broker._reqp_introspect.terminate()
+ self._do('INT', 0.5)
+
+ elif action == 'INT':
+ # Count
+ if not hasattr(self, '_count'):
+ self._count = 0
+ self._count +=1
+ # Handle
+ if self._count < 5:
+ self._broker._reqp_introspect.interrupt()
+ self._do('INT', 0.1)
+ else:
+ self._do('KILL', 0)
+
+ elif action == 'KILL':
+ # Get pid and signal
+ pid = self._broker._kernelCon.pid2
+ sigkill = signal.SIGTERM
+ if hasattr(signal,'SIGKILL'):
+ sigkill = signal.SIGKILL
+ # Kill
+ if hasattr(os,'kill'):
+ os.kill(pid, sigkill)
+ elif sys.platform.startswith('win'):
+ kernel32 = ctypes.windll.kernel32
+ handle = kernel32.OpenProcess(1, 0, pid)
+ kernel32.TerminateProcess(handle, 0)
+ #os.system("TASKKILL /PID " + str(pid) + " /F")
+ # Set what we did
+ self._do('NOTHING', 9999999999999999)
+
+
+ def getMessage(self, what):
+ # Get last performed action
+ action = self._prev_action
+
+ # Get nice string of that
+ D = { '': 'exited',
+ 'TERM': 'terminated',
+ 'INT': 'terminated (after interrupting)',
+ 'KILL': 'killed'}
+ actionMsg = D.get(self._prev_action, 'stopped for unknown reason')
+
+ # Compile stop-string
+ return '{} {} {}.'.format( what, actionMsg, self._reason)
+
+
+
+class StreamReader(threading.Thread):
+ """ StreamReader(process, channel)
+
+ Reads stdout of process and send to a yoton channel.
+ This needs to be done in a separate thread because reading from
+ a PYPE blocks.
+
+ """
+ def __init__(self, process, strm_raw, strm_broker):
+ threading.Thread.__init__(self)
+
+ self._process = process
+ self._strm_raw = strm_raw
+ self._strm_broker = strm_broker
+ self.deamon = True
+ self._exit = False
+
+ def stop(self, timeout=1.0):
+ self._exit = True
+ self.join(timeout)
+
+ def run(self):
+ while not self._exit:
+ time.sleep(0.001)
+ # Read any stdout/stderr messages and route them via yoton.
+ msg = self._process.stdout.readline() # <-- Blocks here
+ if not isinstance(msg, str):
+ msg = msg.decode('utf-8', 'ignore')
+ try:
+ self._strm_raw.send(msg)
+ except IOError:
+ pass # Channel is closed
+ # Process dead?
+ if not msg:# or self._process.poll() is not None:
+ break
+ #self._strm_broker.send('streamreader exit\n')
+
+
+class Kernelmanager:
+ """ Kernelmanager
+
+ This class manages a set of kernels. These kernels run on the
+ same machine as this broker. IDE's can ask which kernels are available
+ and can connect to them via this broker.
+
+ The IEP process runs an instance of this class that connects at
+ localhost. At a later stage, we may make it possible to create
+ a kernel-server at a remote machine.
+
+ """
+
+ def __init__(self, public=False):
+
+ # Set whether other machines in this network may connect to our kernels
+ self._public = public
+
+ # Init list of kernels
+ self._kernels = []
+
+
+ def createKernel(self, info, name=None):
+ """ create_kernel(info, name=None)
+
+ Create a new kernel. Returns the port number to connect to the
+ broker's context.
+
+ """
+
+ # Set name if not given
+ if not name:
+ i = len(self._kernels) + 1
+ name = 'kernel %i' % i
+
+ # Create kernel
+ kernel = KernelBroker(self, info, name)
+ self._kernels.append(kernel)
+
+ # Host a connection for the ide
+ port = kernel.hostConnectionForIDE()
+
+ # Tell broker to start as soon as the IDE connects with the broker
+ kernel.startKernelIfConnected()
+
+ # Done
+ return port
+
+
+ def getKernelList(self):
+
+ # Get info of each kernel as an ssdf struct
+ infos = []
+ for kernel in self._kernels:
+ info = kernel._info
+ info = ssdf.loads(info.tostring())
+ info.name = kernel._name
+ infos.append(info)
+
+ # Done
+ return infos
+
+
+ def terminateAll(self):
+ """ terminateAll()
+
+ Terminates all kernels. Required when shutting down IEP.
+ When this function returns, all kernels will be terminated.
+
+ """
+ for kernel in [kernel for kernel in self._kernels]:
+
+ # Try closing the process gently: by closing stdin
+ terminator = KernelTerminator(kernel, 'for closing down')
+
+ # Terminate
+ while (kernel._kernelCon and kernel._kernelCon.is_connected and
+ kernel._process and (kernel._process.poll() is None) ):
+ time.sleep(0.02)
+ terminator.next()
+
+ # Clean up
+ kernel._reset(True)
diff --git a/iep/iepcore/license.py b/iep/iepcore/license.py
new file mode 100644
index 0000000..9bfe425
--- /dev/null
+++ b/iep/iepcore/license.py
@@ -0,0 +1,317 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Code related to the license.
+"""
+
+import os
+import sys
+import datetime
+
+import iep
+from pyzolib.qt import QtCore, QtGui
+
+
+LICENSEKEY_FILE = os.path.join(iep.appDataDir, "licensekey.txt")
+
+UNMANGLE_CODE ="""
+eJytU8Fu2zAMvecr2OQgGXOMJU23wVgOOfQwdLcAK4piGFSJToS5UiDJ6Yph/z5KVpxm7YYe5ost
+8r1HPoqewDW2LShr8AxubAf3wogNKggWFEqrEMIWodUSjUfoDOU3LULTGRm0NWejCUzB4UY45UtY
+S41GIqx2u1ajGilsBg73RT0CesbjMXzuBaff8TGW8sFps0lFtQzVAZbeO4eN/lHCtxL8Apbgq4je
+8aLaCRd07IKzKSuegAl1Jzy+W1S9h7vHgJ73uYoapBBnwkutWVFkDGddaKYfso5uwNgAmQPCKCqe
++4+PE5rG8UW0HV46Zx1nV+QkUrSB9Qoa6+5FqE7VcgM+UN/+QYctZ+vV1eUN+z/CsFxCL7ifsX8p
+fjJ70WoFe3Sepge2ea7sz18eol+8boB+TnzG0re0nQl0fJ9OVAdkdOPPj032kDcHTPJGDOsUlwVt
+WMoPqYetph3UH98eBXoGCcwvLoYgNUERuXVc565mf3E1f50rRfSfvwYbcQGTk1nlaeEDZ3VdP73N
+BFimV95aVmepfH10jgoRcWKGfowS6JoGdtZn5ezIx9bj6Qj+oJWHK8jVKH2KV7cU+kpo4vQObxlF
+WAx5gAkIpSIr5RyGzhlQvwFvTS4N
+"""
+
+
+import types, base64, zlib
+def parse_license(key):
+ """ Unmangle the license key and return a dict with license info.
+ The dict at least has these fields:
+ name, company, email, expires, product, reference.
+
+ The actual code of this function is obfuscated. We realize that
+ anyone with a bit of free time can find out the license parsing.
+ The obfuscating is to make this a bit harder and to avoid having
+ the code verbatim in the repository.
+
+ You are free to reverse-engineer our license key format and then
+ produce your own license. However, who would you be fooling?
+ """
+ # Define function
+ codeb = zlib.decompress(base64.decodebytes(UNMANGLE_CODE.encode('ascii')))
+ exec(codeb.decode('utf-8'), globals())
+ # Call it
+ return unmangle(key)
+
+
+
+
+def get_keys():
+ """ Get a list of all license keys, in the order that thet were added.
+ """
+
+ # Get text of license file
+ if os.path.isfile(LICENSEKEY_FILE):
+ text = open(LICENSEKEY_FILE, 'rt').read()
+ else:
+ text = ''
+
+ # Remove comments
+ lines = []
+ for line in text.splitlines():
+ if line.startswith('#'):
+ line = ''
+ lines.append(line.rstrip())
+
+ # Split in licenses
+ licenses = ('\n'.join(lines)).split('\n\n')
+ licenses = [key.strip() for key in licenses]
+ licenses = [key for key in licenses if key]
+
+ # Remove duplicates (avoid set() to maintain order)
+ licenses, licenses2 = [], licenses
+ for key in licenses2:
+ if key not in licenses:
+ licenses.append(key)
+
+ # Sort and return
+ return licenses
+
+
+def is_invalid(info):
+ """ Get whether a license is invalid. Returns a string with the reason.
+ """
+ # IEP license?
+ if not ('IEP' in info['product'].upper() or
+ 'PYZO' in info['product'].upper() ):
+ return 'This is not an IEP license.'
+ # Expired
+ today = datetime.datetime.now().strftime('%Y%m%d')
+ if today > info['expires']:
+ return 'The license has expired'
+
+
+def get_license_info():
+ """ Get the license info of the most recently added valid license.
+ Returns a dict which at least has these fields:
+ name, company, email, expires, product, reference.
+ Returns None if there is no valid license.
+ """
+
+ # Get all keys
+ keys = get_keys()
+
+ # Get valid licenses
+ valid_licenses = []
+ for key in keys:
+ info = parse_license(key)
+ if not is_invalid(info):
+ valid_licenses.append(info)
+
+ # Done
+ if valid_licenses:
+ return valid_licenses[-1]
+ else:
+ return None
+
+
+
+def add_license(key):
+ """ Add a license key to IEP.
+ """
+
+ # Normalize and check license
+ key = key.strip().replace('\n', '').replace('\r', '')
+ info = parse_license(key)
+ invalid = is_invalid(info)
+ if invalid:
+ raise ValueError('Given license is not valid: %s' % invalid)
+
+ # Get licenses and add our key
+ licenses = get_keys()
+ licenses.append(key)
+
+ # Remove duplicates (avoid set() to maintain order)
+ licenses, licenses2 = [], licenses
+ for key in licenses2:
+ if key not in licenses:
+ licenses.append(key)
+
+ # Write back
+ lines = ['# List of license keys for IEP', '']
+ for key in licenses:
+ info = parse_license(key)
+ comment = '# Licensed to {name} expires {expires}'.format(**info)
+ lines.append(comment)
+ lines.append(key)
+ lines.append('')
+ with open(LICENSEKEY_FILE, 'wt') as f:
+ f.write('\n'.join(lines))
+
+
+
+class LicenseManager(QtGui.QDialog):
+ """ Dialog to view current licenses and to add license keys.
+ """
+
+ def __init__(self, parent):
+ QtGui.QDialog.__init__(self, parent)
+ self.setWindowTitle(iep.translate("menu dialog", "Manage IEP license keys"))
+ self.resize(500,500)
+
+ # Create button to add license key
+ self._addbut = QtGui.QPushButton(
+ iep.translate("menu dialog", "Add license key") )
+ self._addbut.clicked.connect(self.addLicenseKey)
+
+ # Create label with link to website
+ self._linkLabel = QtGui.QLabel(self)
+ self._linkLabel.setTextFormat(QtCore.Qt.RichText)
+ self._linkLabel.setOpenExternalLinks(True)
+ self._linkLabel.setText("You can purchase a license at " +
+ "<a href='http://iep-project.org/contributing.html'>http://iep-project.org</a>")
+ self._linkLabel.setVisible(False)
+
+ # Create label to show license info
+ self._label = QtGui.QTextEdit(self)
+ self._label.setLineWrapMode(self._label.WidgetWidth)
+ self._label.setReadOnly(True)
+
+ # Layout
+ layout = QtGui.QVBoxLayout(self)
+ self.setLayout(layout)
+ layout.addWidget(self._addbut)
+ layout.addWidget(self._linkLabel)
+ layout.addWidget(self._label)
+
+ # Init
+ self.showLicenses()
+
+
+ def addLicenseKey(self):
+ """ Show dialog to insert new key.
+ """
+ # Ask for key
+ title = iep.translate("menu dialog", "Add license key")
+ label = ''
+ s = PlainTextInputDialog.getText(self, title, label)
+ if isinstance(s, tuple):
+ s = s[0] if s[1] else ''
+
+ # Add it
+ if s:
+ try:
+ add_license(s)
+ except Exception as err:
+ label = 'Could not add label:\n%s' % str(err)
+ QtGui.QMessageBox.warning(self, title, label)
+
+ # Update
+ self.showLicenses()
+ iep.license = get_license_info()
+
+
+ def showLicenses(self):
+ """ Show all licenses.
+ """
+ # Get active license
+ activeLicense = get_license_info()
+
+ # Get all keys, transform to license dicts
+ license_keys = get_keys()
+ license_dicts = [parse_license(key) for key in license_keys]
+ license_dicts.sort(key=lambda x:x['expires'])
+
+ lines = ['<p>Listing licenses from <i>%s</i></p>' % LICENSEKEY_FILE]
+ for info in reversed(license_dicts):
+ # Get info
+ activeText = ''
+ key = info['key']
+ if activeLicense and activeLicense['key'] == key:
+ activeText = ' (active)'
+ e = datetime.datetime.strptime(info['expires'], '%Y%m%d')
+ expires = e.strftime('%d-%m-%Y')
+ # Create summary
+ lines.append('<p>')
+ lines.append('<b>%s</b>%s<br />' % (info['product'], activeText))
+ lines.append('Name: %s<br />' % info['name'])
+ lines.append('Email: %s<br />' % info['email'])
+ lines.append('Company: %s<br />' % info['company'])
+ lines.append('Expires: %s<br />' % expires)
+ lines.append('key: <tiny><sub>%s</sub></tiny><br />' % key)
+ lines.append('</p>')
+
+ # No licenses?
+ if not license_dicts:
+ lines.insert(1, '<p>No license keys found.</p>')
+ self._linkLabel.setVisible(True)
+ elif not activeLicense:
+ lines.insert(1, '<p>All your keys seem to have expired.</p>')
+ self._linkLabel.setVisible(True)
+ else:
+ self._linkLabel.setVisible(False)
+
+ # Set label text
+ self._label.setHtml('\n'.join(lines))
+
+
+class PlainTextInputDialog(QtGui.QDialog):
+ def __init__(self, parent, title='', label=''):
+ QtGui.QDialog.__init__(self, parent)
+ self.setWindowTitle(title)
+
+ self._result = None # Default (when closed with cross)
+
+ # Layout
+ gridLayout = QtGui.QGridLayout(self)
+ self.setLayout(gridLayout)
+
+ # Create label
+ self._label = QtGui.QLabel(label, self)
+ gridLayout.addWidget(self._label, 0,0,1,1)
+
+ # Create text edit
+ self._txtEdit = QtGui.QPlainTextEdit(self)
+ gridLayout.addWidget(self._txtEdit, 1,0,1,1)
+
+ # Create button box
+ self._butBox = QtGui.QDialogButtonBox(self)
+ self._butBox.setOrientation(QtCore.Qt.Horizontal)
+ self._butBox.setStandardButtons(self._butBox.Cancel | self._butBox.Ok)
+ gridLayout.addWidget(self._butBox, 2,0,1,1)
+
+ # Signals
+ self._butBox.accepted.connect(self.on_accept)
+ self._butBox.rejected.connect(self.on_reject)
+
+ def on_accept(self):
+ self.setResult(1)
+ self._result = self._txtEdit.toPlainText()
+ self.close()
+
+ def on_reject(self):
+ self.setResult(0)
+ self._result = None
+ self.close()
+
+ @classmethod
+ def getText(cls, parent, title='', label=''):
+ d = PlainTextInputDialog(parent, title, label)
+ d.exec_()
+ return d._result
+
+
+if __name__ == '__main__':
+ w = LicenseManager(None)
+ w.show()
+ #print(PlainTextInputDialog.getText(None, 'foo', 'bar'))
+
+
+
diff --git a/iep/iepcore/main.py b/iep/iepcore/main.py
new file mode 100644
index 0000000..7608a8f
--- /dev/null
+++ b/iep/iepcore/main.py
@@ -0,0 +1,644 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module main
+
+This module contains the main frame. Implements the main window.
+Also adds some variables to the iep namespace, such as the callLater
+function which is also defined here.
+
+"""
+
+import os, sys, time
+import base64
+from queue import Queue, Empty
+from pyzolib import ssdf, paths
+
+import iep
+from iep.iepcore.icons import IconArtist
+from iep.iepcore import commandline
+from pyzolib.qt import QtCore, QtGui
+from iep.iepcore.splash import SplashWidget
+
+
+class MainWindow(QtGui.QMainWindow):
+
+ def __init__(self, parent=None, locale=None):
+ QtGui.QMainWindow.__init__(self, parent)
+
+ self._closeflag = 0 # Used during closing/restarting
+
+ # Init window title and application icon
+ # Set title to something nice. On Ubuntu 12.10 this text is what
+ # is being shown at the fancy title bar (since it's not properly
+ # updated)
+ self.setMainTitle()
+ loadAppIcons()
+ self.setWindowIcon(iep.icon)
+
+ # Restore window geometry before drawing for the first time,
+ # such that the window is in the right place
+ self.resize(800, 600) # default size
+ self.restoreGeometry()
+
+ # Show splash screen (we need to set our color too)
+ w = SplashWidget(self, distro=iep.distro_name)
+ self.setCentralWidget(w)
+ self.setStyleSheet("QMainWindow { background-color: #268bd2;}")
+
+ # Show empty window and disable updates for a while
+ self.show()
+ self.paintNow()
+ self.setUpdatesEnabled(False)
+
+ # Determine timeout for showing splash screen
+ splash_timeout = time.time() + 1.0
+
+ # Set locale of main widget, so that qt strings are translated
+ # in the right way
+ if locale:
+ self.setLocale(locale)
+
+ # Store myself
+ iep.main = self
+
+ # Init dockwidget settings
+ self.setTabPosition(QtCore.Qt.AllDockWidgetAreas,QtGui.QTabWidget.South)
+ self.setDockOptions(
+ QtGui.QMainWindow.AllowNestedDocks
+ | QtGui.QMainWindow.AllowTabbedDocks
+ #| QtGui.QMainWindow.AnimatedDocks
+ )
+
+ # Set window atrributes
+ self.setAttribute(QtCore.Qt.WA_AlwaysShowToolTips, True)
+
+ # Load icons and fonts
+ loadIcons()
+ loadFonts()
+
+ # Set qt style and test success
+ self.setQtStyle(None) # None means init!
+
+ # Hold the splash screen if needed
+ while time.time() < splash_timeout:
+ QtGui.qApp.flush()
+ QtGui.qApp.processEvents()
+ time.sleep(0.05)
+
+ # Populate the window (imports more code)
+ self._populate()
+
+ # Revert to normal background, and enable updates
+ self.setStyleSheet('')
+ self.setUpdatesEnabled(True)
+
+ # Restore window state, force updating, and restore again
+ self.restoreState()
+ self.paintNow()
+ self.restoreState()
+
+ # Load basic tools if new user
+ if iep.config.state.newUser and not iep.config.state.loadedTools:
+ iep.toolManager.loadTool('iepsourcestructure')
+ iep.toolManager.loadTool('iepfilebrowser')
+
+ # Present user with wizard if he/she is new.
+ if iep.config.state.newUser:
+ from iep.util.iepwizard import IEPWizard
+ w = IEPWizard(self)
+ w.show() # Use show() instead of exec_() so the user can interact with IEP
+
+ # Create new shell config if there is None
+ if not iep.config.shellConfigs2:
+ from iep.iepcore.kernelbroker import KernelInfo
+ iep.config.shellConfigs2.append( KernelInfo() )
+
+ # Focus on editor
+ e = iep.editors.getCurrentEditor()
+ if e is not None:
+ e.setFocus()
+
+ # Handle any actions
+ commandline.handle_cmd_args()
+
+
+ # To force drawing ourselves
+ def paintEvent(self, event):
+ QtGui.QMainWindow.paintEvent(self, event)
+ self._ispainted = True
+
+ def paintNow(self):
+ """ Enforce a repaint and keep calling processEvents until
+ we are repainted.
+ """
+ self._ispainted = False
+ self.update()
+ while not self._ispainted:
+ QtGui.qApp.flush()
+ QtGui.qApp.processEvents()
+ time.sleep(0.01)
+
+ def _populate(self):
+
+ # Delayed imports
+ from iep.iepcore.editorTabs import EditorTabs
+ from iep.iepcore.shellStack import ShellStackWidget
+ from iep.iepcore import codeparser
+ from iep.tools import ToolManager
+
+ # Instantiate tool manager
+ iep.toolManager = ToolManager()
+
+ # Instantiate and start source-code parser
+ if iep.parser is None:
+ iep.parser = codeparser.Parser()
+ iep.parser.start()
+
+ # Create editor stack and make the central widget
+ iep.editors = EditorTabs(self)
+ self.setCentralWidget(iep.editors)
+
+
+ # Create floater for shell
+ self._shellDock = dock = QtGui.QDockWidget(self)
+ dock.setFeatures(dock.DockWidgetMovable)
+ dock.setObjectName('shells')
+ dock.setWindowTitle('Shells')
+ self.addDockWidget(QtCore.Qt.TopDockWidgetArea, dock)
+
+ # Create shell stack
+ iep.shells = ShellStackWidget(self)
+ dock.setWidget(iep.shells)
+
+ # Create the default shell when returning to the event queue
+ callLater(iep.shells.addShell)
+
+
+ # Create statusbar
+ if iep.config.view.showStatusbar:
+ iep.status = self.statusBar()
+ else:
+ iep.status = None
+ self.setStatusBar(None)
+
+ # Create menu
+ from iep.iepcore import menu
+ iep.keyMapper = menu.KeyMapper()
+ menu.buildMenus(self.menuBar())
+
+ # Add the context menu to the editor
+ iep.editors.addContextMenu()
+ iep.shells.addContextMenu()
+
+ # Load tools
+ if iep.config.state.loadedTools:
+ for toolId in iep.config.state.loadedTools:
+ iep.toolManager.loadTool(toolId)
+
+
+ def setMainTitle(self, path=None):
+ """ Set the title of the main window, by giving a file path.
+ """
+ if not path:
+ # Plain title
+ title = "Interactive Editor for Python"
+ else:
+ # Title with a filename
+ name = os.path.basename(path)
+ if os.path.isfile(path):
+ pass
+ elif name == path:
+ path = 'no location on disk'
+ else:
+ pass # We hope the given path is informative
+ # Set title
+ tmp = { 'fileName':name, 'filename':name, 'name':name,
+ 'fullPath':path, 'fullpath':path, 'path':path }
+ title = iep.config.advanced.titleText.format(**tmp)
+
+ # Add license info
+ if iep.license:
+ title += ' - licensed to {name}'.format(**iep.license)
+
+ # Set
+ self.setWindowTitle(title)
+
+
+ def saveWindowState(self):
+ """ Save:
+ * which tools are loaded
+ * geometry of the top level windows
+ * layout of dockwidgets and toolbars
+ """
+
+ # Save tool list
+ tools = iep.toolManager.getLoadedTools()
+ iep.config.state.loadedTools = tools
+
+ # Store window geometry
+ geometry = self.saveGeometry()
+ try:
+ geometry = bytes(geometry) # PyQt4
+ except:
+ geometry = bytes().join(geometry) # PySide
+ geometry = base64.encodebytes(geometry).decode('ascii')
+ iep.config.state.windowGeometry = geometry
+
+ # Store window state
+ state = self.saveState()
+ try:
+ state = bytes(state) # PyQt4
+ except:
+ state = bytes().join(state) # PySide
+ state = base64.encodebytes(state).decode('ascii')
+ iep.config.state.windowState = state
+
+
+ def restoreGeometry(self, value=None):
+ # Restore window position and whether it is maximized
+
+ if value is not None:
+ return super().restoreGeometry(value)
+
+ # No value give, try to get it from the config
+ if iep.config.state.windowGeometry:
+ try:
+ geometry = iep.config.state.windowGeometry
+ geometry = base64.decodebytes(geometry.encode('ascii'))
+ self.restoreGeometry(geometry)
+ except Exception as err:
+ print('Could not restore window geomerty: ' + str(err))
+
+
+ def restoreState(self, value=None):
+ # Restore layout of dock widgets and toolbars
+
+ if value is not None:
+ return super().restoreState(value)
+
+ # No value give, try to get it from the config
+ if iep.config.state.windowState:
+ try:
+ state = iep.config.state.windowState
+ state = base64.decodebytes(state.encode('ascii'))
+ self.restoreState(state)
+ except Exception as err:
+ print('Could not restore window state: ' + str(err))
+
+
+ def setQtStyle(self, stylename=None):
+ """ Set the style and the palette, based on the given style name.
+ If stylename is None or not given will do some initialization.
+ If bool(stylename) evaluates to False will use the default style
+ for this system. Returns the QStyle instance.
+ """
+
+ if stylename is None:
+ # Initialize
+
+ # Get native pallette (used below)
+ QtGui.qApp.nativePalette = QtGui.qApp.palette()
+
+ # Obtain default style name
+ iep.defaultQtStyleName = str(QtGui.qApp.style().objectName())
+
+ # Other than gtk+ and mac, cleanlooks looks best (in my opinion)
+ if 'gtk' in iep.defaultQtStyleName.lower():
+ pass # Use default style
+ elif 'macintosh' in iep.defaultQtStyleName.lower():
+ pass # Use default style
+ else:
+ iep.defaultQtStyleName = 'Cleanlooks'
+
+ # Set style if there is no style yet
+ if not iep.config.view.qtstyle:
+ iep.config.view.qtstyle = iep.defaultQtStyleName
+
+ # Init
+ if not stylename:
+ stylename = iep.config.view.qtstyle
+ useStandardStyle = False
+ stylename2 = stylename
+
+ # Handle special cleanlooks style
+ if stylename.lower().startswith('cleanlooks'):
+ stylename2 = stylename.rstrip('+')
+ if stylename2 != stylename:
+ useStandardStyle = True
+
+ # Check if this style exist, set to default otherwise
+ styleNames = [name.lower() for name in QtGui.QStyleFactory.keys()]
+ if stylename2.lower() not in styleNames:
+ stylename2 = iep.defaultQtStyleName
+
+ # Try changing the style
+ qstyle = QtGui.qApp.setStyle(stylename2)
+
+ # Set palette
+ if qstyle:
+ if useStandardStyle:
+ QtGui.qApp.setPalette(QtGui.QStyle.standardPalette(qstyle))
+ else:
+ QtGui.qApp.setPalette(QtGui.qApp.nativePalette)
+
+ # Done
+ return qstyle
+
+
+ def closeEvent(self, event):
+ """ Override close event handler. """
+
+ # Are we restaring?
+ restarting = time.time() - self._closeflag < 1.0
+
+ # Save settings
+ iep.saveConfig()
+
+ # Stop command server
+ commandline.stop_our_server()
+
+ # Proceed with closing...
+ result = iep.editors.closeAll()
+ if not result:
+ self._closeflag = False
+ event.ignore()
+ return
+ else:
+ self._closeflag = True
+ #event.accept() # Had to comment on Windows+py3.3 to prevent error
+
+ # Proceed with closing shells
+ iep.localKernelManager.terminateAll()
+ for shell in iep.shells:
+ shell._context.close()
+
+ # Close tools
+ for toolname in iep.toolManager.getLoadedTools():
+ tool = iep.toolManager.getTool(toolname)
+ tool.close()
+
+ # Stop all threads (this should really only be daemon threads)
+ import threading
+ for thread in threading.enumerate():
+ if hasattr(thread, 'stop'):
+ try:
+ thread.stop(0.1)
+ except Exception:
+ pass
+
+# # Wait for threads to die ...
+# # This should not be necessary, but I used it in the hope that it
+# # would prevent the segfault on Python3.3. It didn't.
+# timeout = time.time() + 0.5
+# while threading.activeCount() > 1 and time.time() < timeout:
+# time.sleep(0.1)
+# print('Number of threads alive:', threading.activeCount())
+
+ # Proceed as normal
+ QtGui.QMainWindow.closeEvent(self, event)
+
+ # Harder exit to prevent segfault. Not really a solution,
+ # but it does the job until Pyside gets fixed.
+ if sys.version_info >= (3,3,0) and not restarting:
+ if hasattr(os, '_exit'):
+ os._exit(0)
+
+
+ def restart(self):
+ """ Restart IEP. """
+
+ self._closeflag = time.time()
+
+ # Close
+ self.close()
+
+ if self._closeflag:
+ # Get args
+ args = [arg for arg in sys.argv]
+
+ if not paths.is_frozen():
+ # Prepend the executable name (required on Linux)
+ lastBit = os.path.basename(sys.executable)
+ args.insert(0, lastBit)
+
+ # Replace the process!
+ os.execv(sys.executable, args)
+
+
+ def createPopupMenu(self):
+
+ # Init menu
+ menu = QtGui.QMenu()
+
+ # Insert two items
+ for item in ['Editors', 'Shells']:
+ action = menu.addAction(item)
+ action.setCheckable(True)
+ action.setChecked(True)
+ action.setEnabled(False)
+
+ # Insert tools
+ for tool in iep.toolManager.loadToolInfo():
+ action = menu.addAction(tool.name)
+ action.setCheckable(True)
+ action.setChecked(bool(tool.instance))
+ action.menuLauncher = tool.menuLauncher
+
+ # Show menu and process result
+ a = menu.popup(QtGui.QCursor.pos())
+ if a:
+ a.menuLauncher(not a.menuLauncher(None))
+
+
+def loadAppIcons():
+ """ loadAppIcons()
+ Load the application iconsr.
+ """
+ # Get directory containing the icons
+ appiconDir = os.path.join(iep.iepDir, 'resources', 'appicons')
+
+ # Determine template for filename of the application icon-files.
+ # Use the Pyzo logo if in pyzo_mode.
+ if False: #iep.pyzo_mode:
+ fnameT = 'pyzologo{}.png'
+ else:
+ fnameT = 'ieplogo{}.png'
+
+ # Construct application icon. Include a range of resolutions. Note that
+ # Qt somehow does not use the highest possible res on Linux/Gnome(?), even
+ # the logo of qt-designer when alt-tabbing looks a bit ugly.
+ iep.icon = QtGui.QIcon()
+ for sze in [16, 32, 48, 64, 128, 256]:
+ fname = os.path.join(appiconDir, fnameT.format(sze))
+ if os.path.isfile(fname):
+ iep.icon.addFile(fname, QtCore.QSize(sze, sze))
+
+ # Set as application icon. This one is used as the default for all
+ # windows of the application.
+ QtGui.qApp.setWindowIcon(iep.icon)
+
+ # Construct another icon to show when the current shell is busy
+ artist = IconArtist(iep.icon) # extracts the 16x16 version
+ artist.setPenColor('#0B0')
+ for x in range(11, 16):
+ d = x-11 # runs from 0 to 4
+ artist.addLine(x,6+d,x,15-d)
+ pm = artist.finish().pixmap(16,16)
+ #
+ iep.iconRunning = QtGui.QIcon(iep.icon)
+ iep.iconRunning.addPixmap(pm) # Change only 16x16 icon
+
+
+def loadIcons():
+ """ loadIcons()
+ Load all icons in the icon dir.
+ """
+ # Get directory containing the icons
+ iconDir = os.path.join(iep.iepDir, 'resources', 'icons')
+
+ # Construct other icons
+ dummyIcon = IconArtist().finish()
+ iep.icons = ssdf.new()
+ for fname in os.listdir(iconDir):
+ if fname.startswith('iep'):
+ continue
+ if fname.endswith('.png'):
+ try:
+ # Short and full name
+ name = fname.split('.')[0]
+ ffname = os.path.join(iconDir,fname)
+ # Create icon
+ icon = QtGui.QIcon()
+ icon.addFile(ffname, QtCore.QSize(16,16))
+ # Store
+ iep.icons[name] = icon
+ except Exception as err:
+ iep.icons[name] = dummyIcon
+ print('Could not load icon %s: %s' % (fname, str(err)))
+
+
+def loadFonts():
+ """ loadFonts()
+ Load all fonts that come with IEP.
+ """
+ import iep.codeeditor # we need iep and codeeditor namespace here
+
+ # Get directory containing the icons
+ fontDir = os.path.join(iep.iepDir, 'resources', 'fonts')
+
+ # Get database object
+ db = QtGui.QFontDatabase()
+
+ # Set default font
+ iep.codeeditor.Manager.setDefaultFontFamily('DejaVu Sans Mono')
+
+ # Load fonts that are in the fonts directory
+ if os.path.isdir(fontDir):
+ for fname in os.listdir(fontDir):
+ if os.path.splitext(fname)[1].lower() in ['.otf', '.ttf']:
+ try:
+ db.addApplicationFont( os.path.join(fontDir, fname) )
+ except Exception as err:
+ print('Could not load font %s: %s' % (fname, str(err)))
+
+
+class _CallbackEventHandler(QtCore.QObject):
+ """ Helper class to provide the callLater function.
+ """
+
+ def __init__(self):
+ QtCore.QObject.__init__(self)
+ self.queue = Queue()
+
+ def customEvent(self, event):
+ while True:
+ try:
+ callback, args = self.queue.get_nowait()
+ except Empty:
+ break
+ try:
+ callback(*args)
+ except Exception as why:
+ print('callback failed: {}:\n{}'.format(callback, why))
+
+ def postEventWithCallback(self, callback, *args):
+ self.queue.put((callback, args))
+ QtGui.qApp.postEvent(self, QtCore.QEvent(QtCore.QEvent.User))
+
+def callLater(callback, *args):
+ """ callLater(callback, *args)
+ Post a callback to be called in the main thread.
+ """
+ _callbackEventHandler.postEventWithCallback(callback, *args)
+
+# Create callback event handler instance and insert function in IEP namespace
+_callbackEventHandler = _CallbackEventHandler()
+iep.callLater = callLater
+
+
+_SCREENSHOT_CODE = """
+import random
+
+numerator = 4
+
+def get_number():
+ # todo: something appears to be broken here
+ val = random.choice(range(10))
+ return numerator / val
+
+class Groceries(list):
+ \"\"\" Overloaded list class.
+ \"\"\"
+ def append_defaults(self):
+ spam = 'yum'
+ pie = 3.14159
+ self.extend([spam, pie])
+
+class GroceriesPlus(Groceries):
+ \"\"\" Groceries with surprises!
+ \"\"\"
+ def append_random(self):
+ value = get_number()
+ self.append(value)
+
+# Create some groceries
+g = GroceriesPlus()
+g.append_defaults()
+g.append_random()
+
+"""
+
+def screenshotExample(width=1244, height=700):
+ e = iep.editors.newFile()
+ e.editor.setPlainText(_SCREENSHOT_CODE)
+ iep.main.resize(width, height)
+
+def screenshot(countdown=5):
+ QtCore.QTimer.singleShot(countdown*1000, _screenshot)
+
+def _screenshot():
+ # Grab
+ print('SNAP!')
+ pix = QtGui.QPixmap.grabWindow(iep.main.winId())
+ #pix = QtGui.QPixmap.grabWidget(iep.main)
+ # Get name
+ i = 1
+ while i > 0:
+ name = 'iep_screen_%s_%02i.png' % (sys.platform, i)
+ fname = os.path.join(os.path.expanduser('~'), name)
+ if os.path.isfile(fname):
+ i += 1
+ else:
+ i = -1
+ # Save screenshot and a thumb
+ pix.save(fname)
+ thumb = pix.scaledToWidth(500, QtCore.Qt.SmoothTransformation)
+ thumb.save(fname.replace('screen', 'thumb'))
+ print('Screenshot and thumb saved in', os.path.expanduser('~'))
+
+iep.screenshot = screenshot
+iep.screenshotExample = screenshotExample
diff --git a/iep/iepcore/menu.py b/iep/iepcore/menu.py
new file mode 100644
index 0000000..f3d5124
--- /dev/null
+++ b/iep/iepcore/menu.py
@@ -0,0 +1,2171 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module menu
+
+Implements a menu that can be edited very easily. Every menu item is
+represented by a class. Also implements a dialog to change keyboard
+shortcuts.
+
+"""
+
+import os, sys, re, time
+import unicodedata
+import datetime
+
+from pyzolib import paths
+
+from pyzolib.qt import QtCore, QtGui
+
+import iep
+from iep.iepcore.compactTabWidget import CompactTabWidget
+from iep.iepcore.iepLogging import print
+import webbrowser
+from iep import translate
+
+
+
+def buildMenus(menuBar):
+ """
+ Build all the menus
+ """
+ menus = [ FileMenu(menuBar, translate("menu", "File")),
+ EditMenu(menuBar, translate("menu", "Edit")),
+ ViewMenu(menuBar, translate("menu", "View")),
+ SettingsMenu(menuBar, translate("menu", "Settings")),
+ ShellMenu(menuBar, translate("menu", "Shell")),
+ RunMenu(menuBar, translate("menu", "Run")),
+ ToolsMenu(menuBar, translate("menu", "Tools")),
+ HelpMenu(menuBar, translate("menu", "Help")),
+ ]
+ menuBar._menumap = {}
+ menuBar._menus = menus
+ for menu in menuBar._menus:
+ menuBar.addMenu(menu)
+ menuName = menu.__class__.__name__.lower().split('menu')[0]
+ menuBar._menumap[menuName] = menu
+
+ # Enable tooltips
+ def onHover(action):
+ # This ugly bit of code makes sure that the tooltip is refreshed
+ # (thus raised above the submenu). This happens only once and after
+ # ths submenu has become visible.
+ if action.menu():
+ if not hasattr(menuBar, '_lastAction'):
+ menuBar._lastAction = None
+ menuBar._haveRaisedTooltip = False
+ if action is menuBar._lastAction:
+ if ((not menuBar._haveRaisedTooltip) and
+ action.menu().isVisible()):
+ QtGui.QToolTip.hideText()
+ menuBar._haveRaisedTooltip = True
+ else:
+ menuBar._lastAction = action
+ menuBar._haveRaisedTooltip = False
+ # Set tooltip
+ tt = action.statusTip()
+ if hasattr(action, '_shortcutsText'):
+ tt = tt + ' ({})'.format(action._shortcutsText) # Add shortcuts text in it
+ QtGui.QToolTip.showText(QtGui.QCursor.pos(), tt)
+ menuBar.hovered.connect(onHover)
+
+
+# todo: syntax styles now uses a new system. Make dialog for it!
+# todo: put many settings in an advanced settings dialog:
+# - autocomp use keywords
+# - autocomp case sensitive
+# - autocomp select chars
+# - Default parser / indentation (width and tabsOrSpaces) / line endings
+# - Shell wrapping to 80 columns?
+# - number of lines in shell
+# - more stuff from iep.config.advanced?
+
+
+def getShortcut(fullName):
+ """ Given the full name or an action, get the shortcut
+ from the iep.config.shortcuts2 dict. A tuple is returned
+ representing the two shortcuts. """
+ if isinstance(fullName, QtGui.QAction):
+ fullName = fullName.menuPath # the menuPath property is set in Menu._addAction
+ shortcut = '', ''
+ if fullName in iep.config.shortcuts2:
+ shortcut = iep.config.shortcuts2[fullName]
+ if shortcut.count(','):
+ shortcut = tuple(shortcut.split(','))
+ else:
+ shortcut = shortcut, ''
+ return shortcut
+
+
+def translateShortcutToOSNames(shortcut):
+ """
+ Translate Qt names to OS names (e.g. Ctrl -> cmd symbol for Mac,
+ Meta -> Windows for windows
+ """
+
+ if sys.platform == 'darwin':
+ replace = (('Ctrl+','\u2318'),('Shift+','\u21E7'),
+ ('Alt+','\u2325'),('Meta+','^'))
+ else:
+ replace = ()
+
+ for old, new in replace:
+ shortcut = shortcut.replace(old, new)
+
+ return shortcut
+
+
+
+class KeyMapper(QtCore.QObject):
+ """
+ This class is accessable via iep.keyMapper
+ iep.keyMapper.keyMappingChanged is emitted when keybindings are changed
+ """
+
+ keyMappingChanged = QtCore.Signal()
+
+ def setShortcut(self, action):
+ """
+ When an action is created or when keymappings are changed, this method
+ is called to set the shortcut of an action based on its menuPath
+ (which is the key in iep.config.shortcuts2, e.g. shell__clear_screen)
+ """
+ if action.menuPath in iep.config.shortcuts2:
+ # Set shortcut so Qt can do its magic
+ shortcuts = iep.config.shortcuts2[action.menuPath]
+ action.setShortcuts(shortcuts.split(','))
+ # Also store shortcut text (used in display of tooltip
+ shortcuts = shortcuts.replace(',',', ').replace(' ', ' ')
+ action._shortcutsText = shortcuts.rstrip(', ')
+
+
+def unwrapText(text):
+ """ Unwrap text to display in message boxes. This just removes all
+ newlines. If you want to insert newlines, use \\r."""
+
+ # Removes newlines
+ text = text.replace('\n', '')
+
+ # Remove double/triple/etc spaces
+ text = text.lstrip()
+ for i in range(10):
+ text = text.replace(' ', ' ')
+
+ # Convert \\r newlines
+ text = text.replace('\r', '\n')
+
+ # Remove spaces after newlines
+ text = text.replace('\n ', '\n')
+
+ return text
+
+
+
+class Menu(QtGui.QMenu):
+ """ Menu(parent=None, name=None)
+
+ Base class for all menus. Has methods to add actions of all sorts.
+
+ The add* methods all have the name and icon as first two arguments.
+ This is not so consistent with the Qt API for addAction, but it allows
+ for cleaner code to add items; the first item can be quite long because
+ it is a translation. In the current API, the second and subsequent
+ arguments usually fit nicely on the second line.
+
+ """
+ def __init__(self, parent=None, name=None):
+ QtGui.QMenu.__init__(self, parent)
+
+ # Make sure that the menu has a title
+ if name:
+ self.setTitle(name)
+ else:
+ raise ValueError
+
+ # Set tooltip too?
+ if hasattr(name, 'tt'):
+ self.setStatusTip(name.tt)
+
+ # Action groups within the menu keep track of the selected value
+ self._groups = {}
+
+ # menuPath is used to bind shortcuts, it is ,e.g. shell__clear_screen
+ if hasattr(parent,'menuPath'):
+ self.menuPath = parent.menuPath + '__'
+ else:
+ self.menuPath = '' #This is a top-level menu
+
+ # Get key for this menu
+ key = name
+ if hasattr(name, 'key'):
+ key = name.key
+ self.menuPath += self._createMenuPathName(key)
+
+ # Build the menu. Happens only once
+ self.build()
+
+
+ def _createMenuPathName(self, name):
+ """
+ Convert a menu title into a menuPath component name
+ e.g. Interrupt current shell -> interrupt_current_shell
+ """
+ # hide anything between brackets
+ name = re.sub('\(.*\)', '', name)
+ # replace invalid chars
+ name = name.replace(' ', '_')
+ if name and name[0] in '0123456789_':
+ name = "_" + name
+ name = re.sub('[^a-zA-z_0-9]','',name)
+ return name.lower()
+
+
+ def _addAction(self, text, icon, selected=None):
+ """ Convenience function that makes the right call to addAction().
+ """
+
+ # Add the action
+ if icon is None:
+ a = self.addAction(text)
+ else:
+ a = self.addAction(icon, text)
+
+ # Checkable?
+ if selected is not None:
+ a.setCheckable(True)
+ a.setChecked(selected)
+
+ # Set tooltip if we can find it
+ if hasattr(text, 'tt'):
+ a.setStatusTip(text.tt)
+
+ # Find the key (untranslated name) for this menu item
+ key = a.text()
+ if hasattr(text, 'key'):
+ key = text.key
+ a.menuPath = self.menuPath + '__' + self._createMenuPathName(key)
+
+ # Register the action so its keymap is kept up to date
+ iep.keyMapper.keyMappingChanged.connect(lambda: iep.keyMapper.setShortcut(a))
+ iep.keyMapper.setShortcut(a)
+
+ return a
+
+
+ def build(self):
+ """
+ Add all actions to the menu. To be overridden.
+ """
+ pass
+
+
+ def addMenu(self, menu, icon=None):
+ """
+ Add a (sub)menu to this menu.
+ """
+
+ # Add menu in the conventional way
+ a = QtGui.QMenu.addMenu(self, menu)
+ a.menuPath = menu.menuPath
+
+ # Set icon
+ if icon is not None:
+ a.setIcon(icon)
+
+ return menu
+
+ def addItem(self, text, icon=None, callback=None, value=None):
+ """
+ Add an item to the menu. If callback is given and not None,
+ connect triggered signal to the callback. If value is None or not
+ given, callback is called without parameteres, otherwise it is called
+ with value as parameter
+ """
+
+ # Add action
+ a = self._addAction(text, icon)
+
+ # Connect the menu item to its callback
+ if callback:
+ if value is not None:
+ a.triggered.connect(lambda b=None, v=value: callback(v))
+ else:
+ a.triggered.connect(lambda b=None: callback())
+
+ return a
+
+
+ def addGroupItem(self, text, icon=None, callback=None, value=None, group=None):
+ """
+ Add a 'select-one' option to the menu. Items with equal group value form
+ a group. If callback is specified and not None, the callback is called
+ for the new active item, with the value for that item as parameter
+ whenever the selection is changed
+ """
+
+ # Init action
+ a = self._addAction(text, icon)
+ a.setCheckable(True)
+
+ # Connect the menu item to its callback (toggled is a signal only
+ # emitted by checkable actions, and can also be called programmatically,
+ # e.g. in QActionGroup)
+ if callback:
+ def doCallback(b, v):
+ if b:
+ callback(v)
+ a.toggled.connect(lambda b=None, v=value: doCallback(a.isChecked(), v))
+
+ # Add the menu item to a action group
+ if group is None:
+ group = 'default'
+ if group not in self._groups:
+ #self._groups contains tuples (actiongroup, dict-of-actions)
+ self._groups[group] = (QtGui.QActionGroup(self), {})
+
+ actionGroup,actions = self._groups[group]
+ actionGroup.addAction(a)
+ actions[value]=a
+
+ return a
+
+
+ def addCheckItem(self, text, icon=None, callback=None, value=None, selected=False):
+ """
+ Add a true/false item to the menu. If callback is specified and not
+ None, the callback is called when the item is changed. If value is not
+ specified or None, callback is called with the new state as parameter.
+ Otherwise, it is called with the new state and value as parameters
+ """
+
+ # Add action
+ a = self._addAction(text, icon, selected)
+
+ # Connect the menu item to its callback
+ if callback:
+ if value is not None:
+ a.triggered.connect(lambda b=None, v=value: callback(a.isChecked(),v))
+ else:
+ a.triggered.connect(lambda b=None: callback(a.isChecked()))
+
+ return a
+
+
+ def setCheckedOption(self, group, value):
+ """
+ Set the selected value of a group. This will also activate the
+ callback function of the item that gets selected.
+ if group is None the default group is used.
+ """
+ if group is None:
+ group = 'default'
+ actionGroup, actions = self._groups[group]
+ if value in actions:
+ actions[value].setChecked(True)
+
+
+class GeneralOptionsMenu(Menu):
+ """ GeneralOptionsMenu(parent, name, callback, options=None)
+
+ Menu to present the user with a list from which to select one item.
+ We need this a lot.
+
+ """
+
+ def __init__(self, parent=None, name=None, callback=None, options=None):
+ Menu.__init__(self, parent, name)
+ self._options_callback = callback
+ if options:
+ self.setOptions(options)
+
+ def build(self):
+ pass # We build when the options are given
+
+ def setOptions(self, options, values=None):
+ """
+ Set the list of options, clearing any existing options. The options
+ are added ad group items and registered to the callback given
+ at initialization.
+ """
+ # Init
+ self.clear()
+ cb = self._options_callback
+ # Get values
+ if values is None:
+ values = options
+ for option, value in zip(options, values):
+ self.addGroupItem(option, None, cb, value)
+
+
+class IndentationMenu(Menu):
+ """
+ Menu for the user to control the type of indentation for a document:
+ tabs vs spaces and the amount of spaces.
+ Part of the File menu.
+ """
+
+ def build(self):
+ self._items = [
+ self.addGroupItem(translate("menu", "Use tabs"),
+ None, self._setStyle, False, group="style"),
+ self.addGroupItem(translate("menu", "Use spaces"),
+ None, self._setStyle, True, group="style")
+ ]
+ self.addSeparator()
+ spaces = translate("menu", "spaces", "plural of spacebar character")
+ self._items += [
+ self.addGroupItem("%d %s" % (i, spaces), None, self._setWidth, i, group="width")
+ for i in range(2,9)
+ ]
+
+ def _setWidth(self, width):
+ editor = iep.editors.getCurrentEditor()
+ if editor is not None:
+ editor.setIndentWidth(width)
+
+ def _setStyle(self, style):
+ editor = iep.editors.getCurrentEditor()
+ if editor is not None:
+ editor.setIndentUsingSpaces(style)
+
+
+class FileMenu(Menu):
+ def build(self):
+ icons = iep.icons
+
+ self._items = []
+
+ # Create indent menu
+ t = translate("menu", "Indentation ::: The indentation used of the current file.")
+ self._indentMenu = IndentationMenu(self, t)
+
+ # Create parser menu
+ from iep import codeeditor
+ t = translate("menu", "Syntax parser ::: The syntax parser of the current file.")
+ self._parserMenu = GeneralOptionsMenu(self, t, self._setParser)
+ self._parserMenu.setOptions(['None'] + codeeditor.Manager.getParserNames())
+
+ # Create line ending menu
+ t = translate("menu", "Line endings ::: The line ending character of the current file.")
+ self._lineEndingMenu = GeneralOptionsMenu(self, t, self._setLineEndings)
+ self._lineEndingMenu.setOptions(['LF', 'CR', 'CRLF'])
+
+ # Create encoding menu
+ t = translate("menu", "Encoding ::: The character encoding of the current file.")
+ self._encodingMenu = GeneralOptionsMenu(self, t, self._setEncoding)
+
+ # Bind to signal
+ iep.editors.currentChanged.connect(self.onEditorsCurrentChanged)
+
+
+ # Build menu file management stuff
+ self.addItem(translate('menu', 'New ::: Create a new (or temporary) file.'),
+ icons.page_add, iep.editors.newFile)
+ self.addItem(translate("menu", "Open... ::: Open an existing file from disk."),
+ icons.folder_page, iep.editors.openFile)
+ #
+ self._items += [
+ self.addItem(translate("menu", "Save ::: Save the current file to disk."),
+ icons.disk, iep.editors.saveFile),
+ self.addItem(translate("menu", "Save as... ::: Save the current file under another name."),
+ icons.disk_as, iep.editors.saveFileAs),
+ self.addItem(translate("menu", "Save all ::: Save all open files."),
+ icons.disk_multiple, iep.editors.saveAllFiles),
+ self.addItem(translate("menu", "Close ::: Close the current file."),
+ icons.page_delete, iep.editors.closeFile),
+ self.addItem(translate("menu", "Close all ::: Close all files."),
+ icons.page_delete_all, iep.editors.closeAllFiles),
+ self.addItem(translate("menu", "Export to PDF ::: Export current file to PDF (e.g. for printing)."),
+ None, self._print),
+ ]
+
+ # Build file properties stuff
+ self.addSeparator()
+ self._items += [
+ self.addMenu(self._indentMenu, icons.page_white_gear),
+ self.addMenu(self._parserMenu, icons.page_white_gear),
+ self.addMenu(self._lineEndingMenu, icons.page_white_gear),
+ self.addMenu(self._encodingMenu, icons.page_white_gear),
+ ]
+
+ # Closing of app
+ self.addSeparator()
+ self.addItem(translate("menu", "Restart IEP ::: Restart the application."),
+ icons.arrow_rotate_clockwise, iep.main.restart)
+ self.addItem(translate("menu","Quit IEP ::: Close the application."),
+ icons.cancel, iep.main.close)
+
+ # Start disabled
+ self.setEnabled(False)
+
+
+ def setEnabled(self, enabled):
+ """ Enable or disable all items. If disabling, also uncheck all items """
+ for child in self._items:
+ child.setEnabled(enabled)
+
+ def onEditorsCurrentChanged(self):
+ editor = iep.editors.getCurrentEditor()
+ if editor is None:
+ self.setEnabled(False) #Disable / uncheck all editor-related options
+ else:
+ self.setEnabled(True)
+ # Update indentation
+ self._indentMenu.setCheckedOption("style", editor.indentUsingSpaces())
+ self._indentMenu.setCheckedOption("width", editor.indentWidth())
+ # Update parser
+ parserName = 'None'
+ if editor.parser():
+ parserName = editor.parser().name() or 'None'
+ self._parserMenu.setCheckedOption(None, parserName )
+ # Update line ending
+ self._lineEndingMenu.setCheckedOption(None, editor.lineEndingsHumanReadable)
+ # Update encoding
+ self._updateEncoding(editor)
+
+ def _setParser(self, value):
+ editor = iep.editors.getCurrentEditor()
+ if value.lower() == 'none':
+ value = None
+ if editor is not None:
+ editor.setParser(value)
+
+ def _setLineEndings(self, value):
+ editor = iep.editors.getCurrentEditor()
+ editor.lineEndings = value
+
+ def _updateEncoding(self, editor):
+ # Dict with encoding aliases (official to aliases)
+ D = { 'cp1250': ('windows-1252', ),
+ 'cp1251': ('windows-1251', ),
+ 'latin_1': ('iso-8859-1', 'iso8859-1', 'cp819', 'latin', 'latin1', 'L1')}
+ # Dict with aliases mapping to "official value"
+ Da = {}
+ for key in D:
+ for key2 in D[key]:
+ Da[key2] = key
+
+ # Encodings to list
+ encodings = [ 'utf-8','ascii', 'latin_1',
+ 'cp1250', 'cp1251']
+
+ # Get current encoding (add if not present)
+ editorEncoding = editor.encoding
+ if editorEncoding in Da:
+ editorEncoding = Da[editorEncoding]
+ if editorEncoding not in encodings:
+ encodings.append(editorEncoding)
+
+ # Handle aliases
+ encodingNames, encodingValues = [], []
+ for encoding in encodings:
+ encodingValues.append(encoding)
+ if encoding in D:
+ name = '%s (%s)' % (encoding, ', '.join(D[encoding]))
+ encodingNames.append(name)
+ else:
+ encodingNames.append(encoding)
+
+ # Update
+ self._encodingMenu.setOptions(encodingNames, encodingValues)
+ self._encodingMenu.setCheckedOption(None, editorEncoding)
+
+ def _setEncoding(self, value):
+ editor = iep.editors.getCurrentEditor()
+ if editor is not None:
+ editor.encoding = value
+
+ def _print(self):
+ editor = iep.editors.getCurrentEditor()
+ if editor is not None:
+ printer = QtGui.QPrinter(QtGui.QPrinter.HighResolution)
+ if True:
+ filename = QtGui.QFileDialog.getSaveFileName(None,
+ 'Export PDF', os.path.expanduser("~"), "*.pdf *.ps")
+ if isinstance(filename, tuple): # PySide
+ filename = filename[0]
+ if not filename:
+ return
+ printer.setOutputFileName(filename)
+ else:
+ d = QtGui.QPrintDialog(printer)
+ d.setWindowTitle('Print code')
+ d.setOption(d.PrintSelection, editor.textCursor().hasSelection())
+ d.setOption(d.PrintToFile, True)
+ ok = d.exec_()
+ if ok != d.Accepted:
+ return
+ # Print
+ editor.print_(printer)
+
+
+# todo: move to matching brace
+class EditMenu(Menu):
+ def build(self):
+ icons = iep.icons
+
+ self.addItem(translate("menu", "Undo ::: Undo the latest editing action."),
+ icons.arrow_undo, self._editItemCallback, "undo")
+ self.addItem(translate("menu", "Redo ::: Redo the last undone editong action."),
+ icons.arrow_redo, self._editItemCallback, "redo")
+ self.addSeparator()
+ self.addItem(translate("menu", "Cut ::: Cut the selected text."),
+ icons.cut, self._editItemCallback, "cut")
+ self.addItem(translate("menu", "Copy ::: Copy the selected text to the clipboard."),
+ icons.page_white_copy, self._editItemCallback, "copy")
+ self.addItem(translate("menu", "Paste ::: Paste the text that is now on the clipboard."),
+ icons.paste_plain, self._editItemCallback, "paste")
+ self.addItem(translate("menu", "Select all ::: Select all text."),
+ icons.sum, self._editItemCallback, "selectAll")
+ self.addSeparator()
+ self.addItem(translate("menu", "Indent ::: Indent the selected line."),
+ icons.text_indent, self._editItemCallback, "indentSelection")
+ self.addItem(translate("menu", "Dedent ::: Unindent the selected line."),
+ icons.text_indent_remove, self._editItemCallback, "dedentSelection")
+ self.addItem(translate("menu", "Comment ::: Comment the selected line."),
+ icons.comment_add, self._editItemCallback, "commentCode")
+ self.addItem(translate("menu", "Uncomment ::: Uncomment the selected line."),
+ icons.comment_delete, self._editItemCallback, "uncommentCode")
+ self.addItem(translate("menu", "Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters."),
+ icons.text_align_justify, self._editItemCallback, "justifyText")
+ self.addItem(translate("menu", "Go to line ::: Go to a specific line number."),
+ None, self._editItemCallback, "gotoLinePopup")
+ self.addItem(translate("menu", "Delete line ::: Delete the selected line."),
+ None, self._editItemCallback, "deleteLines")
+ self.addSeparator()
+ self.addItem(translate("menu", "Find or replace ::: Show find/replace widget. Initialize with selected text."),
+ icons.find, iep.editors._findReplace.startFind)
+ self.addItem(translate("menu", "Find selection ::: Find the next occurrence of the selected text."),
+ None, iep.editors._findReplace.findSelection)
+ self.addItem(translate("menu", "Find selection backward ::: Find the previous occurrence of the selected text."),
+ None, iep.editors._findReplace.findSelectionBw)
+ self.addItem(translate("menu", "Find next ::: Find the next occurrence of the search string."),
+ None, iep.editors._findReplace.findNext)
+ self.addItem(translate("menu", "Find previous ::: Find the previous occurrence of the search string."),
+ None, iep.editors._findReplace.findPrevious)
+
+
+ def _editItemCallback(self, action):
+ widget = QtGui.qApp.focusWidget()
+ #If the widget has a 'name' attribute, call it
+ if hasattr(widget, action):
+ getattr(widget, action)()
+
+
+class ZoomMenu(Menu):
+ """
+ Small menu for the zooming. Part of the view menu.
+ """
+ def build(self):
+ self.addItem(translate("menu", 'Zoom in'), None, self._setZoom, +1)
+ self.addItem(translate("menu", 'Zoom out'), None, self._setZoom, -1)
+ self.addItem(translate("menu", 'Zoom reset'), None, self._setZoom, 0)
+
+ def _setZoom(self, value):
+ if not value:
+ iep.config.view.zoom = 0
+ else:
+ iep.config.view.zoom += value
+ # Apply
+ for editor in iep.editors:
+ iep.config.view.zoom = editor.setZoom(iep.config.view.zoom)
+ for shell in iep.shells:
+ iep.config.view.zoom = shell.setZoom(iep.config.view.zoom)
+ logger = iep.toolManager.getTool('ieplogger')
+ if logger:
+ logger.setZoom(iep.config.view.zoom)
+
+
+class FontMenu(Menu):
+ def __init__(self, parent=None, name="Font", *args, **kwds):
+ Menu.__init__(self, parent, name, *args, **kwds)
+ self.aboutToShow.connect(self._updateFonts)
+
+ def _updateFonts(self):
+ self.clear()
+ # Build list with known available monospace fonts
+ names = iep.codeeditor.Manager.fontNames()
+ defaultName = 'DejaVu Sans Mono'
+ for name in sorted(names):
+ txt = name+' (default)' if name == defaultName else name
+ self.addGroupItem(txt, None, self._selectFont, value=name)
+ # Select the current one
+ self.setCheckedOption(None, iep.config.view.fontname)
+
+ def _selectFont(self, name):
+ iep.config.view.fontname = name
+ # Apply
+ for editor in iep.editors:
+ editor.setFont(iep.config.view.fontname)
+ for shell in iep.shells:
+ shell.setFont(iep.config.view.fontname)
+ logger = iep.toolManager.getTool('ieplogger')
+ if logger:
+ logger.setFont(iep.config.view.fontname)
+
+
+# todo: brace matching
+# todo: code folding?
+# todo: maybe move qt theme to settings
+class ViewMenu(Menu):
+ def build(self):
+ icons = iep.icons
+
+ # Create edge column menu
+ t = translate("menu", "Location of long line indicator ::: The location of the long-line-indicator.")
+ self._edgeColumMenu = GeneralOptionsMenu(self, t, self._setEdgeColumn)
+ values = [0] + [i for i in range(60,130,10)]
+ names = ["None"] + [str(i) for i in values[1:]]
+ self._edgeColumMenu.setOptions(names, values)
+ self._edgeColumMenu.setCheckedOption(None, iep.config.view.edgeColumn)
+
+ # Create qt theme menu
+ t = translate("menu", "Qt theme ::: The styling of the user interface widgets.")
+ self._qtThemeMenu = GeneralOptionsMenu(self, t, self._setQtTheme)
+ styleNames = list(QtGui.QStyleFactory.keys()) + ['Cleanlooks+']
+ styleNames.sort()
+ titles = [name for name in styleNames]
+ styleNames = [name.lower() for name in styleNames]
+ for i in range(len(titles)):
+ if titles[i].lower() == iep.defaultQtStyleName.lower():
+ titles[i] += " (default)"
+ self._qtThemeMenu.setOptions(titles, styleNames)
+ self._qtThemeMenu.setCheckedOption(None, iep.config.view.qtstyle.lower())
+
+ # Build menu
+ self.addItem(translate("menu", "Select shell ::: Focus the cursor on the current shell."),
+ icons.application_shell, self._selectShell)
+ self.addItem(translate("menu", "Select editor ::: Focus the cursor on the current editor."),
+ icons.application_edit, self._selectEditor)
+ self.addItem(translate("menu", "Select previous file ::: Select the previously selected file."),
+ icons.application_double, iep.editors._tabs.selectPreviousItem)
+ self.addSeparator()
+ self.addEditorItem(translate("menu", "Show whitespace ::: Show spaces and tabs."),
+ None, "showWhitespace")
+ self.addEditorItem(translate("menu", "Show line endings ::: Show the end of each line."),
+ None, "showLineEndings")
+ self.addEditorItem(translate("menu", "Show indentation guides ::: Show vertical lines to indicate indentation."),
+ None, "showIndentationGuides")
+ self.addSeparator()
+ self.addEditorItem(translate("menu", "Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling)."),
+ None, "wrap")
+ self.addEditorItem(translate("menu", "Highlight current line ::: Highlight the line where the cursor is."),
+ None, "highlightCurrentLine")
+ self.addSeparator()
+ self.addMenu(self._edgeColumMenu, icons.text_padding_right)
+ self.addMenu(FontMenu(self, translate("menu", "Font")), icons.style)
+ self.addMenu(ZoomMenu(self, translate("menu", "Zooming")), icons.magnifier)
+ self.addMenu(self._qtThemeMenu, icons.application_view_tile)
+
+ def addEditorItem(self, name, icon, param):
+ """
+ Create a boolean item that reperesents a property of the editors,
+ whose value is stored in iep.config.view.param
+ """
+ if hasattr(iep.config.view, param):
+ default = getattr(iep.config.view, param)
+ else:
+ default = True
+
+ self.addCheckItem(name, icon, self._configEditor, param, default)
+
+ def _configEditor(self, state, param):
+ """
+ Callback for addEditorItem items
+ """
+ # Store this parameter in the config
+ setattr(iep.config.view, param, state)
+ # Apply to all editors, translate e.g. showWhitespace to setShowWhitespace
+ setter = 'set' + param[0].upper() + param[1:]
+ for editor in iep.editors:
+ getattr(editor,setter)(state)
+
+ def _selectShell(self):
+ shell = iep.shells.getCurrentShell()
+ if shell:
+ shell.setFocus()
+
+ def _selectEditor(self):
+ editor = iep.editors.getCurrentEditor()
+ if editor:
+ editor.setFocus()
+
+ def _setEdgeColumn(self, value):
+ iep.config.view.edgeColumn = value
+ for editor in iep.editors:
+ editor.setLongLineIndicatorPosition(value)
+
+ def _setQtTheme(self, value):
+ iep.config.view.qtstyle = value
+ iep.main.setQtStyle(value)
+
+
+class ShellMenu(Menu):
+
+ def __init__(self, parent=None, name="Shell", *args, **kwds):
+ self._shellCreateActions = []
+ self._shellActions = []
+ Menu.__init__(self, parent, name, *args, **kwds)
+ iep.shells.currentShellChanged.connect(self.onCurrentShellChanged)
+ self.aboutToShow.connect(self._updateShells)
+
+ def onCurrentShellChanged(self):
+ """ Enable/disable shell actions based on wether a shell is available """
+ for shellAction in self._shellActions:
+ shellAction.setEnabled(bool(iep.shells.getCurrentShell()))
+
+ def buildShellActions(self):
+ """ Create the menu items which are also avaliable in the
+ ShellTabContextMenu
+
+ Returns a list of all items added"""
+ icons = iep.icons
+ return [
+ self.addItem(translate("menu", 'Clear screen ::: Clear the screen.'),
+ icons.application_eraser, self._shellAction, "clearScreen"),
+ self.addItem(translate("menu", 'Interrupt ::: Interrupt the current running code (does not work for extension code).'),
+ icons.application_lightning, self._shellAction, "interrupt"),
+ self.addItem(translate("menu", 'Restart ::: Terminate and restart the interpreter.'),
+ icons.application_refresh, self._shellAction, "restart"),
+ self.addItem(translate("menu", 'Terminate ::: Terminate the interpreter, leaving the shell open.'),
+ icons.application_delete, self._shellAction, "terminate"),
+ self.addItem(translate("menu", 'Close ::: Terminate the interpreter and close the shell.'),
+ icons.cancel, self._shellAction, "closeShell"),
+ ]
+
+ def buildShellDebugActions(self):
+ """ Create the menu items for debug shell actions.
+ Returns a list of all items added"""
+ icons = iep.icons
+
+ return [
+ self.addItem(translate("menu", 'Debug next: proceed until next line'),
+ icons.debug_next, self._debugAction, "NEXT"),
+ self.addItem(translate("menu", 'Debug step into: proceed one step'),
+ icons.debug_step, self._debugAction, "STEP"),
+ self.addItem(translate("menu", 'Debug return: proceed until returns'),
+ icons.debug_return, self._debugAction, "RETURN"),
+ self.addItem(translate("menu", 'Debug continue: proceed to next breakpoint'),
+ icons.debug_continue, self._debugAction, "CONTINUE"),
+ self.addItem(translate("menu", 'Stop debugging'),
+ icons.debug_quit, self._debugAction, "STOP"),
+ ]
+
+
+ def getShell(self):
+ """ Returns the shell on which to apply the menu actions. Default is
+ the current shell, this is overridden in the shell/shell tab context
+ menus"""
+ return iep.shells.getCurrentShell()
+
+ def build(self):
+ """ Create the items for the shells menu """
+
+ # Normal shell actions
+ self._shellActions = self.buildShellActions()
+
+ self.addSeparator()
+
+ # Debug stuff
+ self._debug_clear_text = translate('menu', 'Clear all {} breakpoints')
+ self._debug_clear = self.addItem('', iep.icons.bug_delete, self._clearBreakPoints)
+ self._debug_pm = self.addItem(
+ translate('menu', 'Postmortem: debug from last traceback'),
+ iep.icons.bug_delete, self._debugAction, "START")
+ self._shellDebugActions = self.buildShellDebugActions()
+ #
+ self.aboutToShow.connect(self._updateDebugButtons)
+
+ self.addSeparator()
+
+ # Shell config
+ self.addItem(translate("menu", 'Edit shell configurations... ::: Add new shell configs and edit interpreter properties.'),
+ iep.icons.application_wrench, self._editConfig2)
+
+ self.addSeparator()
+
+ # Add shell configs
+ self._updateShells()
+
+ def _updateShells(self):
+ """ Remove, then add the items for the creation of each shell """
+ for action in self._shellCreateActions:
+ self.removeAction(action)
+
+ self._shellCreateActions = []
+ for i, config in enumerate(iep.config.shellConfigs2):
+ name = 'Create shell %s: (%s)' % (i+1, config.name)
+ action = self.addItem(name,
+ iep.icons.application_add, iep.shells.addShell, config)
+ self._shellCreateActions.append(action)
+
+ def _updateDebugButtons(self):
+ # Count breakpoints
+ bpcount = 0
+ for e in iep.editors:
+ bpcount += len(e.breakPoints())
+ self._debug_clear.setText(self._debug_clear_text.format(bpcount))
+ # Determine state of PM and clear button
+ debugmode = iep.shells._debugmode
+ self._debug_pm.setEnabled(debugmode==0)
+ self._debug_clear.setEnabled(debugmode==0)
+ # The _shellDebugActions are enabled/disabled by the shellStack
+
+ def _shellAction(self, action):
+ """ Call the method specified by 'action' on the current shell.
+ """
+ shell = self.getShell()
+ if shell:
+ # Call the specified action
+ getattr(shell,action)()
+
+ def _debugAction(self, action):
+ shell = self.getShell()
+ if shell:
+ # Call the specified action
+ command = action.upper()
+ shell.executeCommand('DB %s\n' % command)
+
+ def _clearBreakPoints(self, action=None):
+ for e in iep.editors:
+ e.clearBreakPoints()
+
+ def _editConfig2(self):
+ """ Edit, add and remove configurations for the shells. """
+ from iep.iepcore.shellInfoDialog import ShellInfoDialog
+ d = ShellInfoDialog()
+ d.exec_()
+
+
+class ShellButtonMenu(ShellMenu):
+
+ def build(self):
+ self._shellActions = []
+
+ self.addItem(translate("menu", 'Edit shell configurations... ::: Add new shell configs and edit interpreter properties.'),
+ iep.icons.application_wrench, self._editConfig2)
+
+ submenu = Menu(self, translate("menu", 'New shell ... ::: Create new shell to run code in.'))
+ self._newShellMenu = self.addMenu(submenu, iep.icons.application_add)
+
+ self.addSeparator()
+
+ def _updateShells(self):
+ """ Remove, then add the items for the creation of each shell """
+ for action in self._shellCreateActions:
+ self._newShellMenu.removeAction(action)
+
+ self._shellCreateActions = []
+ for i, config in enumerate(iep.config.shellConfigs2):
+ name = 'Create shell %s: (%s)' % (i+1, config.name)
+ action = self._newShellMenu.addItem(name,
+ iep.icons.application_add, iep.shells.addShell, config)
+ self._shellCreateActions.append(action)
+
+
+
+class ShellContextMenu(ShellMenu):
+ """ This is the context menu for the shell """
+ def __init__(self, shell, *args, **kwds):
+ ShellMenu.__init__(self, *args, **kwds)
+ self._shell = shell
+
+ def build(self):
+ """ Build menu """
+ self.buildShellActions()
+ icons = iep.icons
+
+ # This is a subset of the edit menu. Copied manually.
+ self.addSeparator()
+ self.addItem(translate("menu", "Cut ::: Cut the selected text."),
+ icons.cut, self._editItemCallback, "cut")
+ self.addItem(translate("menu", "Copy ::: Copy the selected text to the clipboard."),
+ icons.page_white_copy, self._editItemCallback, "copy")
+ self.addItem(translate("menu", "Paste ::: Paste the text that is now on the clipboard."),
+ icons.paste_plain, self._editItemCallback, "paste")
+ self.addItem(translate("menu", "Select all ::: Select all text."),
+ icons.sum, self._editItemCallback, "selectAll")
+
+ def getShell(self):
+ """ Shell actions of this menu operate on the shell specified in the constructor """
+ return self._shell
+
+ def _editItemCallback(self, action):
+ #If the widget has a 'name' attribute, call it
+ getattr(self._shell, action)()
+
+ def _updateShells(self):
+ pass
+
+
+class ShellTabContextMenu(ShellContextMenu):
+ """ The context menu for the shell tab is similar to the shell context menu,
+ but only has the shell actions defined in ShellMenu.buildShellActions()"""
+ def build(self):
+ """ Build menu """
+ self.buildShellActions()
+
+ def _updateShells(self):
+ pass
+
+
+
+class EditorContextMenu(Menu):
+ """ This is the context menu for the editor """
+ def __init__(self, editor, name='EditorContextMenu' ):
+ self._editor = editor
+ Menu.__init__(self, editor, name)
+
+
+ def build(self):
+ """ Build menu """
+ icons = iep.icons
+
+ # This is a subset of the edit menu. Copied manually.
+ self.addItem(translate("menu", "Cut ::: Cut the selected text."),
+ icons.cut, self._editItemCallback, "cut")
+ self.addItem(translate("menu", "Copy ::: Copy the selected text to the clipboard."),
+ icons.page_white_copy, self._editItemCallback, "copy")
+ self.addItem(translate("menu", "Paste ::: Paste the text that is now on the clipboard."),
+ icons.paste_plain, self._editItemCallback, "paste")
+ self.addItem(translate("menu", "Select all ::: Select all text."),
+ icons.sum, self._editItemCallback, "selectAll")
+ self.addSeparator()
+ self.addItem(translate("menu", "Indent ::: Indent the selected line."),
+ icons.text_indent, self._editItemCallback, "indentSelection")
+ self.addItem(translate("menu", "Dedent ::: Unindent the selected line."),
+ icons.text_indent_remove, self._editItemCallback, "dedentSelection")
+ self.addItem(translate("menu", "Comment ::: Comment the selected line."),
+ icons.comment_add, self._editItemCallback, "commentCode")
+ self.addItem(translate("menu", "Uncomment ::: Uncomment the selected line."),
+ icons.comment_delete, self._editItemCallback, "uncommentCode")
+ self.addItem(translate("menu", "Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters."),
+ icons.text_align_justify, self._editItemCallback, "justifyText")
+ self.addSeparator()
+ self.addItem(translate("menu", "Goto Definition ::: Go to definition of word under cursor."),
+ icons.debug_return, self._editItemCallback, "gotoDef")
+
+ # This is a subset of the run menu. Copied manually.
+ self.addSeparator()
+ self.addItem(translate("menu", 'Run selection ::: Run the current editor\'s selected lines, selected words on the current line, or current line if there is no selection.'),
+ icons.run_lines, self._runSelected)
+
+
+ def _editItemCallback(self, action):
+ #If the widget has a 'name' attribute, call it
+ getattr(self._editor, action)()
+
+ def _runSelected(self):
+ runMenu = iep.main.menuBar()._menumap['run']
+ runMenu._runSelected()
+
+
+class EditorTabContextMenu(Menu):
+ def __init__(self, *args, **kwds):
+ Menu.__init__(self, *args, **kwds)
+ self._index = -1
+
+ def setIndex(self, index):
+ self._index = index
+
+ def build(self):
+ """ Build menu """
+ icons = iep.icons
+
+ # Copied (and edited) manually from the File memu
+ self.addItem(translate("menu", "Save ::: Save the current file to disk."),
+ icons.disk, self._fileAction, "saveFile")
+ self.addItem(translate("menu", "Save as... ::: Save the current file under another name."),
+ icons.disk_as, self._fileAction, "saveFileAs")
+ self.addItem(translate("menu", "Close ::: Close the current file."),
+ icons.page_delete, self._fileAction, "closeFile")
+ self.addItem(translate("menu", "Close others::: Close all files but this one."),
+ None, self._fileAction, "close_others")
+ self.addItem(translate("menu", "Close all ::: Close all files."),
+ icons.page_delete_all, self._fileAction, "close_all")
+ self.addItem(translate("menu", "Rename ::: Rename this file."),
+ None, self._fileAction, "rename")
+
+ self.addSeparator()
+ # todo: remove feature to pin files?
+ self.addItem(translate("menu", "Pin/Unpin ::: Pinned files get closed less easily."),
+ None, self._fileAction, "pin")
+ self.addItem(translate("menu", "Set/Unset as MAIN file ::: The main file can be run while another file is selected."),
+ icons.star, self._fileAction, "main")
+
+ self.addSeparator()
+ self.addItem(translate("menu", "Run file ::: Run the code in this file."),
+ icons.run_file, self._fileAction, "run")
+ self.addItem(translate("menu", "Run file as script ::: Run this file as a script (restarts the interpreter)."),
+ icons.run_file_script, self._fileAction, "run_script")
+
+
+ def _fileAction(self, action):
+ """ Call the method specified by 'action' on the selected shell """
+
+ item = iep.editors._tabs.getItemAt(self._index)
+
+ if action in ["saveFile", "saveFileAs", "closeFile"]:
+ getattr(iep.editors, action)(item.editor)
+ elif action == "close_others" or action == "close_all":
+ if action == "close_all":
+ item = None #The item not to be closed is not there
+ items = iep.editors._tabs.items()
+ for i in reversed(range(iep.editors._tabs.count())):
+ if items[i] is item or items[i].pinned:
+ continue
+ iep.editors._tabs.tabCloseRequested.emit(i)
+
+ elif action == "rename":
+ filename = item.filename
+ iep.editors.saveFileAs(item.editor)
+ if item.filename != filename:
+ try:
+ os.remove(filename)
+ except Exception:
+ pass
+ elif action == "pin":
+ item._pinned = not item._pinned
+ elif action == "main":
+ if iep.editors._tabs._mainFile == item.id:
+ iep.editors._tabs._mainFile = None
+ else:
+ iep.editors._tabs._mainFile = item.id
+ elif action == "run":
+ menu = iep.main.menuBar().findChild(RunMenu)
+ if menu:
+ menu._runFile((False, False), item.editor)
+ elif action == "run_script":
+ menu = iep.main.menuBar().findChild(RunMenu)
+ if menu:
+ menu._runFile((True, False), item.editor)
+
+ iep.editors._tabs.updateItems()
+
+
+class RunMenu(Menu):
+ def build(self):
+ icons = iep.icons
+
+ self.addItem(translate("menu", 'Run file as script ::: Restart and run the current file as a script.'),
+ icons.run_file_script, self._runFile, (True, False))
+ self.addItem(translate("menu", 'Run main file as script ::: Restart and run the main file as a script.'),
+ icons.run_mainfile_script, self._runFile, (True, True))
+
+ self.addSeparator()
+
+ self.addItem(translate("menu", 'Execute selection ::: Execute the current editor\'s selected lines, selected words on the current line, or current line if there is no selection.'),
+ icons.run_lines, self._runSelected)
+ self.addItem(translate("menu", 'Execute cell ::: Execute the current editors\'s cell in the current shell.'),
+ icons.run_cell, self._runCell)
+ self.addItem(translate("menu", 'Execute cell and advance ::: Execute the current editors\'s cell and advance to the next cell.'),
+ icons.run_cell, self._runCellAdvance)
+ #In the _runFile calls, the parameter specifies (asScript, mainFile)
+ self.addItem(translate("menu", 'Execute file ::: Execute the current file in the current shell.'),
+ icons.run_file, self._runFile,(False, False))
+ self.addItem(translate("menu", 'Execute main file ::: Execute the main file in the current shell.'),
+ icons.run_mainfile, self._runFile,(False, True))
+
+ self.addSeparator()
+
+ self.addItem(translate("menu", 'Help on running code ::: Open the IEP wizard at the page about running code.'),
+ icons.information, self._showHelp)
+
+
+ def _showHelp(self):
+ """ Show more information about ways to run code. """
+ from iep.util.iepwizard import IEPWizard
+ w = IEPWizard(self)
+ w.show('RuncodeWizardPage1') # Start wizard at page about running code
+
+ def _getShellAndEditor(self, what, mainEditor=False):
+ """ Get the shell and editor. Shows a warning dialog when one of
+ these is not available.
+ """
+ # Init empty error message
+ msg = ''
+ # Get shell
+ shell = iep.shells.getCurrentShell()
+ if shell is None:
+ msg += "No shell to run code in. "
+ # Get editor
+ if mainEditor:
+ editor = iep.editors.getMainEditor()
+ if editor is None:
+ msg += "The is no main file selected."
+ else:
+ editor = iep.editors.getCurrentEditor()
+ if editor is None:
+ msg += "No editor selected."
+ # Show error dialog
+ if msg:
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle(translate("menu dialog", "Could not run"))
+ m.setText("Could not run " + what + ":\n\n" + msg)
+ m.setIcon(m.Warning)
+ m.exec_()
+ # Return
+ return shell, editor
+
+
+ def _runSelected(self):
+ """ Run the selected whole lines in the current shell.
+ """
+ # Get editor and shell
+ shell, editor = self._getShellAndEditor('selection')
+ if not shell or not editor:
+ return
+
+ # Get position to sample between (only sample whole lines)
+ screenCursor = editor.textCursor() #Current selection in the editor
+ runCursor = editor.textCursor() #The part that should be run
+
+ runCursor.setPosition(screenCursor.selectionStart())
+ runCursor.movePosition(runCursor.StartOfBlock) #This also moves the anchor
+ lineNumber1 = runCursor.blockNumber()
+
+ runCursor.setPosition(screenCursor.selectionEnd(),runCursor.KeepAnchor)
+ if not (screenCursor.hasSelection() and runCursor.atBlockStart()):
+ #If the end of the selection is at the beginning of a block, don't extend it
+ runCursor.movePosition(runCursor.EndOfBlock,runCursor.KeepAnchor)
+ lineNumber2 = runCursor.blockNumber()
+
+ # Does this look like a statement?
+ isStatement = lineNumber1 == lineNumber2 and screenCursor.hasSelection()
+
+ if isStatement:
+ # Get source code of statement
+ code = screenCursor.selectedText().replace('\u2029', '\n').strip()
+ # Execute statement
+ shell.executeCommand(code+'\n')
+ else:
+ # Get source code
+ code = runCursor.selectedText().replace('\u2029', '\n')
+ # Notify user of what we execute
+ self._showWhatToExecute(editor, runCursor)
+ # Get filename and run code
+ fname = editor.id() # editor._name or editor._filename
+ shell.executeCode(code, fname, lineNumber1)
+
+ def _runCellAdvance(self):
+ self._runCell(True)
+
+ def _runCell(self, advance=False):
+ """ Run the code between two cell separaters ('##').
+ """
+ #TODO: ignore ## in multi-line strings
+ # Maybe using source-structure information?
+
+ # Get editor and shell
+ shell, editor = self._getShellAndEditor('cell')
+ if not shell or not editor:
+ return
+
+ cellName = ''
+
+ # Get current cell
+ # Move up until the start of document
+ # or right after a line starting with '##'
+ runCursor = editor.textCursor() #The part that should be run
+ runCursor.movePosition(runCursor.StartOfBlock)
+ while True:
+ line = runCursor.block().text().lstrip()
+ if line.startswith('##'):
+ # ## line, move to the line following this one
+ if not runCursor.block().next().isValid():
+ #The user tried to execute the last line of a file which
+ #started with ##. Do nothing
+ return
+ runCursor.movePosition(runCursor.NextBlock)
+ cellName = line.lstrip('#').strip()
+ break
+ if not runCursor.block().previous().isValid():
+ break #Start of document
+ runCursor.movePosition(runCursor.PreviousBlock)
+
+ # This is the line number of the start
+ lineNumber = runCursor.blockNumber()
+ if len(cellName) > 20:
+ cellName = cellName[:17]+'...'
+
+ # Move down until a line before one starting with'##'
+ # or to end of document
+ while True:
+ if runCursor.block().text().lstrip().startswith('##'):
+ #This line starts with ##, move to the end of the previous one
+ runCursor.movePosition(runCursor.Left,runCursor.KeepAnchor)
+ break
+ if not runCursor.block().next().isValid():
+ #Last block of the document, move to the end of the line
+ runCursor.movePosition(runCursor.EndOfBlock,runCursor.KeepAnchor)
+ break
+ runCursor.movePosition(runCursor.NextBlock,runCursor.KeepAnchor)
+
+ # Get source code
+ code = runCursor.selectedText().replace('\u2029', '\n')
+ # Notify user of what we execute
+ self._showWhatToExecute(editor, runCursor)
+ # Get filename and run code
+ fname = editor.id() # editor._name or editor._filename
+ shell.executeCode(code, fname, lineNumber, cellName)
+
+ # Advance
+ if advance:
+ cursor = editor.textCursor()
+ cursor.setPosition(runCursor.position())
+ cursor.movePosition(cursor.NextBlock)
+ editor.setTextCursor(cursor)
+
+
+ def _showWhatToExecute(self, editor, runCursor=None):
+ # Get runCursor for whole document if not given
+ if runCursor is None:
+ runCursor = editor.textCursor()
+ runCursor.movePosition(runCursor.Start)
+ runCursor.movePosition(runCursor.End, runCursor.KeepAnchor)
+
+ editor.showRunCursor(runCursor)
+
+
+ def _getCodeOfFile(self, editor):
+ # Obtain source code
+ text = editor.toPlainText()
+ # Show what we execute
+ self._showWhatToExecute(editor)
+ # Get filename and return
+ fname = editor.id() # editor._name or editor._filename
+ return fname, text
+
+ def _runFile(self, runMode, givenEditor=None):
+ """ Run a file
+ runMode is a tuple (asScript, mainFile)
+ """
+ asScript, mainFile = runMode
+
+ # Get editor and shell
+ description = 'main file' if mainFile else 'file'
+ if asScript:
+ description += ' (as script)'
+
+ shell, editor = self._getShellAndEditor(description, mainFile)
+ if givenEditor:
+ editor = givenEditor
+ if not shell or not editor:
+ return
+
+ if asScript:
+ # Go
+ self._runScript(editor, shell)
+ else:
+ # Obtain source code and fname
+ fname, text = self._getCodeOfFile(editor)
+ shell.executeCode(text, fname)
+
+ def _runScript(self, editor, shell):
+ # Obtain fname and try running
+ err = ""
+ if editor._filename:
+ saveOk = iep.editors.saveFile(editor) # Always try to save
+ if saveOk or not editor.document().isModified():
+ self._showWhatToExecute(editor)
+ shell.restart(editor._filename)
+ else:
+ err = "Could not save the file."
+ else:
+ err = "Can only run scripts that are in the file system."
+ # If not success, notify
+ if err:
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle(translate("menu dialog", "Could not run script."))
+ m.setText(err)
+ m.setIcon(m.Warning)
+ m.exec_()
+
+
+class ToolsMenu(Menu):
+
+ def __init__(self, *args, **kwds):
+ self._toolActions = []
+ Menu.__init__(self, *args, **kwds)
+
+ def build(self):
+ self.addItem(translate("menu", 'Reload tools ::: For people who develop tools.'),
+ iep.icons.plugin_refresh, iep.toolManager.reloadTools)
+ self.addSeparator()
+
+ self.onToolInstanceChange() # Build initial menu
+ iep.toolManager.toolInstanceChange.connect(self.onToolInstanceChange)
+
+
+ def onToolInstanceChange(self):
+ # Remove all exisiting tools from the menu
+ for toolAction in self._toolActions:
+ self.removeAction(toolAction)
+
+ # Add all tools, with checkmarks for those that are active
+ self._toolActions = []
+ for tool in iep.toolManager.getToolInfo():
+ action = self.addCheckItem(tool.name, iep.icons.plugin,
+ tool.menuLauncher, selected=bool(tool.instance))
+ self._toolActions.append(action)
+
+
+class HelpMenu(Menu):
+
+ def build(self):
+ icons = iep.icons
+ issues_url = "https://bitbucket.org/iep-project/iep/issues/"
+ if iep.pyzo_mode:
+ issues_url = "http://pyzo.org/issues.html"
+
+
+ if False: # pyzo mode!
+ # Work in progress
+ self.addItem(translate("menu", "Pyzo docs ::: Documentation on Python and the Scipy Stack."),
+ icons.help, self._showPyzoDocs)
+
+ if iep.pyzo_mode:
+ self.addUrlItem(translate("menu", "Pyzo Website ::: Open the Pyzo website in your browser."),
+ icons.help, "http://www.pyzo.org")
+ self.addUrlItem(translate("menu", "IEP Website ::: Open the IEP website in your browser."),
+ icons.help, "http://iep.pyzo.org")
+ self.addUrlItem(translate("menu", "Ask a question ::: Need help?"),
+ icons.comments, "http://pyzo.org/community.html#discussion-fora-and-email-lists")
+ self.addUrlItem(translate("menu", "Report an issue ::: Did you found a bug in IEP, or do you have a feature request?"),
+ icons.error_add, issues_url)
+ self.addSeparator()
+ self.addItem(translate("menu", "IEP wizard ::: Get started quickly."),
+ icons.wand, self._showIepWizard)
+ #self.addItem(translate("menu", "View code license ::: Legal stuff."),
+ # icons.script, lambda: iep.editors.loadFile(os.path.join(iep.iepDir,"license.txt")))
+
+ self.addItem(translate("menu", "Check for updates ::: Are you using the latest version?"),
+ icons.application_go, self._checkUpdates)
+
+ #self.addItem(translate("menu", "Manage your IEP license ::: View/add licenses."),
+ # icons.script, self._manageLicenses)
+ self.addItem(translate("menu", "About IEP ::: More information about IEP."),
+ icons.information, self._aboutIep)
+
+ def addUrlItem(self, name, icon, url):
+ self.addItem(name, icon, lambda: webbrowser.open(url))
+
+ def _showIepWizard(self):
+ from iep.util.iepwizard import IEPWizard
+ w = IEPWizard(self)
+ w.show() # Use show() instead of exec_() so the user can interact with IEP
+
+ def _checkUpdates(self):
+ """ Check whether a newer version of IEP is available. """
+ # Get versions available
+ import urllib.request, re
+ url = "http://www.iep-project.org/downloads.html"
+ text = str( urllib.request.urlopen(url).read() )
+ results = []
+ for pattern in ['iep-(.{1,9}?)\.source\.zip' ]:
+ results.extend( re.findall(pattern, text) )
+ # Produce single string with all versions ...
+ def sorter(x):
+ # Tilde is high ASCII, make 3.2.1 > 3.2 and 3.2 > 3.2beta
+ return x.replace('.','~')+'~'
+ versions = list(sorted(set(results), key=sorter, reverse=True))
+ if not versions:
+ versions = '?'
+ # Define message
+ text = "Your version of IEP is: {}\n"
+ text += "Latest available version is: {}\n\n"
+ text = text.format(iep.__version__, versions[0])
+ # Show message box
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle(translate("menu dialog", "Check for the latest version."))
+ if versions == '?':
+ text += "Oops, could not determine available versions.\n\n"
+ if True:
+ text += "Do you want to open the download page?\n"
+ m.setStandardButtons(m.Yes | m.Cancel)
+ m.setDefaultButton(m.Cancel)
+ m.setText(text)
+ m.setIcon(m.Information)
+ result = m.exec_()
+ # Goto webpage if user chose to
+ if result == m.Yes:
+ import webbrowser
+ webbrowser.open("http://www.iep-project.org/downloads.html")
+
+ def _manageLicenses(self):
+ from iep.iepcore.license import LicenseManager
+ w = LicenseManager(None)
+ w.exec_()
+
+
+ def _aboutIep(self):
+ from iep.iepcore.about import AboutDialog
+ m = AboutDialog(self)
+ m.exec_()
+
+
+ def _showPyzoDocs(self):
+ # Get filename of doc collection
+ dirname = os.path.join(sys.prefix, 'share', 'pyzodocs')
+ #dirname = os.path.join('/home/almar/projects/pyzo_latest', 'share', 'pyzodocs')
+ fname = os.path.join(dirname, 'py.qhc')
+
+ # Get exename of assistant
+ dirname = os.path.join(sys.prefix, 'bin', )
+ #dirname = os.path.join('/home/almar/projects/pyzo_latest', 'bin')
+ exename = os.path.join(dirname, 'assistant')
+
+ import subprocess
+ iep._assistant = subprocess.Popen([exename , '-collectionFile', fname])
+
+
+class SettingsMenu(Menu):
+ def build(self):
+ icons = iep.icons
+
+ # Create language menu
+ from iep.util.locale import LANGUAGES, LANGUAGE_SYNONYMS
+ # Update language setting if necessary
+ cur = iep.config.settings.language
+ iep.config.settings.language = LANGUAGE_SYNONYMS.get(cur, cur)
+ # Create menu
+ t = translate("menu", "Select language ::: The language used by IEP.")
+ self._languageMenu = GeneralOptionsMenu(self, t, self._selectLanguage)
+ values = [key for key in sorted(LANGUAGES)]
+ self._languageMenu.setOptions(values, values)
+ self._languageMenu.setCheckedOption(None, iep.config.settings.language)
+
+ self.addBoolSetting(translate("menu", 'Automatically indent ::: Indent when pressing enter after a colon.'),
+ 'autoIndent', lambda state, key: [e.setAutoIndent(state) for e in iep.editors])
+ self.addBoolSetting(translate("menu", 'Enable calltips ::: Show calltips with function signatures.'),
+ 'autoCallTip')
+ self.addBoolSetting(translate("menu", 'Enable autocompletion ::: Show autocompletion with known names.'),
+ 'autoComplete')
+ self.addBoolSetting(translate("menu", 'Autocomplete keywords ::: The autocompletion list includes keywords.'),
+ 'autoComplete_keywords')
+
+ self.addSeparator()
+ self.addItem(translate("menu", 'Edit key mappings... ::: Edit the shortcuts for menu items.'),
+ icons.keyboard, lambda: KeymappingDialog().exec_())
+ self.addItem(translate("menu", 'Edit syntax styles... ::: Change the coloring of your code.'),
+ icons.style, self._editStyles)
+ self.addMenu(self._languageMenu, icons.flag_green)
+ self.addItem(translate("menu", 'Advanced settings... ::: Configure IEP even further.'),
+ icons.cog, self._advancedSettings)
+
+ def _editStyles(self):
+ """ Edit the style file. """
+ text = """
+ In this 3.0 release, chosing or editing the syntax style is not yet
+ available. We selected a style which we like a lot. It's based on the
+ solarized theme (http://ethanschoonover.com/solarized) isn't it pretty?
+ \r\r
+ In case you really want to change the style, you can change the
+ source code at:\r
+ {}
+ """.format(os.path.join(iep.iepDir, 'codeeditor', 'base.py'))
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle(translate("menu dialog", "Edit syntax styling"))
+ m.setText(unwrapText(text))
+ m.setIcon(m.Information)
+ m.setStandardButtons(m.Ok | m.Cancel)
+ m.setDefaultButton(m.Ok)
+ result = m.exec_()
+
+ def _advancedSettings(self):
+ """ How to edit the advanced settings. """
+ text = """
+ More settings are available via the logger-tool:
+ \r\r
+ - Advanced settings are stored in the struct "iep.config.advanced".
+ Type "print(iep.config.advanced)" to view all advanced settings.\r
+ - Call "iep.resetConfig()" to reset all settings.\r
+ - Call "iep.resetConfig(True)" to reset all settings and state.\r
+ \r\r
+ Note that most settings require a restart for the change to
+ take effect.
+ """
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle(translate("menu dialog", "Advanced settings"))
+ m.setText(unwrapText(text))
+ m.setIcon(m.Information)
+ m.exec_()
+
+ def addBoolSetting(self, name, key, callback = None):
+ def _callback(state, key):
+ setattr(iep.config.settings, key, state)
+ if callback is not None:
+ callback(state, key)
+
+ self.addCheckItem(name, None, _callback, key,
+ getattr(iep.config.settings,key)) #Default value
+
+ def _selectLanguage(self, languageName):
+ # Skip if the same
+ if iep.config.settings.language == languageName:
+ return
+ # Save new language
+ iep.config.settings.language = languageName
+ # Notify user
+ text = translate('menu dialog', """
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ """)
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle(translate("menu dialog", "Language changed"))
+ m.setText(unwrapText(text))
+ m.setIcon(m.Information)
+ m.exec_()
+
+
+# Remains of old settings menu. Leave here because some settings should some day be
+# accessible via a dialog (advanced settings).
+BaseMenu=object
+class xSettingsMenu(BaseMenu):
+ def fill(self):
+ BaseMenu.fill(self)
+ addItem = self.addItem
+
+ addItem( MI('Autocomplete case sensitive', self.fun_autoComplete_case, []) )
+ addItem( MI('Autocomplete select chars', self.fun_autoComplete_fillups, []) )
+ addItem( None )
+ addItem( MI('Default style', self.fun_defaultStyle, []) )
+ addItem( MI('Default indentation width', self.fun_defaultIndentWidth, []) )
+ addItem( MI('Default indentation style', self.fun_defaultIndentStyle, []) )
+ addItem( MI('Default line endings', self.fun_defaultLineEndings, []) )
+
+ def fun_defaultStyle(self, value):
+ """ The style used for new files. """
+ if value is None:
+ current = iep.config.settings.defaultStyle
+ options = iep.styleManager.getStyleNames()
+ options.append(current)
+ return options
+ else:
+ # store
+ iep.config.settings.defaultStyle = value
+
+ def fun_defaultIndentWidth(self, value):
+ """ The indentation used for new files and in the shells. """
+
+ if value is None:
+ current = iep.config.settings.defaultIndentWidth
+ options = [2,3,4,5,6,7,8, current]
+ return ['%d' % i for i in options]
+
+ # parse value
+ try:
+ val = int(value[:2])
+ except ValueError:
+ val = 4
+ # store
+ iep.config.settings.defaultIndentWidth = val
+ # Apply to shells
+ for shell in iep.shells:
+ shell.setIndentWidth(val)
+
+ def fun_defaultIndentStyle(self,value):
+ """Whether to use tabs or spaces for indentation in the shells and in new files"""
+ # get editor
+
+ if value is None:
+ options = ['Spaces', 'Tabs']
+ return options + [options[0 if iep.config.settings.defaultIndentUsingSpaces else 1]]
+ else:
+ # parse value
+ val = None
+
+ try:
+ val = {'Spaces': True, 'Tabs': False}[value]
+ except KeyError:
+ val = True
+ # apply
+ iep.config.settings.defaultIndentUsingSpaces = val
+
+ def fun_defaultLineEndings(self, value):
+ """ The line endings used for new files. """
+ if value is None:
+ current = iep.config.settings.defaultLineEndings
+ return ['LF', 'CR', 'CRLF', current]
+ else:
+ # store
+ iep.config.settings.defaultLineEndings = value
+
+
+ def fun_autoComplete_case(self, value):
+ """ Whether the autocompletion is case sensitive or not. """
+ if value is None:
+ return bool(iep.config.settings.autoComplete_caseSensitive)
+ else:
+ value = not bool(iep.config.settings.autoComplete_caseSensitive)
+ iep.config.settings.autoComplete_caseSensitive = value
+ # Apply
+ for e in iep.getAllScintillas():
+ e.SendScintilla(e.SCI_AUTOCSETIGNORECASE, not value)
+
+ def fun_autoComplete_fillups(self, value):
+ """ Selected autocomp item is inserted when typing these chars. """
+ if value is None:
+ # Show options
+ options = ['Tab', 'Tab and Enter', 'Tab, Enter and " .(["']
+ if '.' in iep.config.settings.autoComplete_fillups:
+ options.append( options[2] )
+ elif '\n' in iep.config.settings.autoComplete_fillups:
+ options.append( options[1] )
+ else:
+ options.append( options[0] )
+ return options
+ else:
+ # Process selection
+ if '.' in value:
+ iep.config.settings.autoComplete_fillups = '\n .(['
+ elif 'enter' in value.lower():
+ iep.config.settings.autoComplete_fillups = '\n'
+ else:
+ iep.config.settings.autoComplete_fillups = ''
+ # Apply
+ tmp = iep.config.settings.autoComplete_fillups
+ for e in iep.getAllScintillas():
+ e.SendScintilla(e.SCI_AUTOCSETFILLUPS, tmp)
+
+
+## Classes to enable editing the key mappings
+
+
+class KeyMapModel(QtCore.QAbstractItemModel):
+ """ The model to view the structure of the menu and the shortcuts
+ currently mapped. """
+
+ def __init__(self, *args):
+ QtCore.QAbstractItemModel.__init__(self, *args)
+ self._root = None
+
+ def setRootMenu(self, menu):
+ """ Call this after starting. """
+ self._root = menu
+
+ def data(self, index, role):
+ if not index.isValid() or role not in [0, 8]:
+ return None
+
+ # get menu or action item
+ item = index.internalPointer()
+
+ # get text and shortcuts
+ key1, key2 = '', ''
+ if isinstance(item, QtGui.QMenu):
+ value = item.title()
+ else:
+ value = item.text()
+ if not value:
+ value = '-'*10
+ elif index.column()>0:
+ key1, key2 = ' ', ' '
+ shortcuts = getShortcut(item)
+ if shortcuts[0]:
+ key1 = shortcuts[0]
+ if shortcuts[1]:
+ key2 = shortcuts[1]
+ # translate to text for the user
+ key1 = translateShortcutToOSNames(key1)
+ key2 = translateShortcutToOSNames(key2)
+
+ # obtain value
+ value = [value,key1,key2, ''][index.column()]
+
+ # return
+ if role == 0:
+ # display role
+ return value
+ elif role == 8:
+ # 8: BackgroundRole
+ if not value:
+ return None
+ elif index.column() == 1:
+ return QtGui.QBrush(QtGui.QColor(200,220,240))
+ elif index.column() == 2:
+ return QtGui.QBrush(QtGui.QColor(210,230,250))
+ else:
+ return None
+ else:
+ return None
+
+
+ def rowCount(self, parent):
+ if parent.isValid():
+ menu = parent.internalPointer()
+ return len(menu.actions())
+ else:
+ return len(self._root.actions())
+
+ def columnCount(self, parent):
+ return 4
+
+ def headerData(self, section, orientation, role):
+ if role == 0:# and orientation==1:
+ tmp = ['Menu action','Shortcut 1','Shortcut 2', '']
+ return tmp[section]
+
+ def parent(self, index):
+ if not index.isValid():
+ return QtCore.QModelIndex()
+ item = index.internalPointer()
+ pitem = item.parent()
+ if pitem is self._root:
+ return QtCore.QModelIndex()
+ else:
+ L = pitem.parent().actions()
+ row = 0
+ if pitem in L:
+ row = L.index(pitem)
+ return self.createIndex(row, 0, pitem)
+
+ def hasChildren(self, index):
+ # no items have parents (except the root item)
+
+ if index.row()<0:
+ return True
+ else:
+ return isinstance(index.internalPointer(), QtGui.QMenu)
+
+ def index(self, row, column, parent):
+# if not self.hasIndex(row, column, parent):
+# return QtCore.QModelIndex()
+ # establish parent
+ if not parent.isValid():
+ parentMenu = self._root
+ else:
+ parentMenu = parent.internalPointer()
+ # produce index and make menu if the action represents a menu
+ childAction = parentMenu.actions()[row]
+ if childAction.menu():
+ childAction = childAction.menu()
+ return self.createIndex(row, column, childAction)
+ # This is the trick. The internal pointer is the way to establish
+ # correspondence between ModelIndex and underlying data.
+
+
+# Key to string mappings
+k = QtCore.Qt
+keymap = {k.Key_Enter:'Enter', k.Key_Return:'Return', k.Key_Escape:'Escape',
+ k.Key_Tab:'Tab', k.Key_Backspace:'Backspace', k.Key_Pause:'Pause',
+ k.Key_Backtab: 'Tab', #Backtab is actually shift+tab
+ k.Key_F1:'F1', k.Key_F2:'F2', k.Key_F3:'F3', k.Key_F4:'F4', k.Key_F5:'F5',
+ k.Key_F6:'F6', k.Key_F7:'F7', k.Key_F8:'F8', k.Key_F9:'F9',
+ k.Key_F10:'F10', k.Key_F11:'F11', k.Key_F12:'F12', k.Key_Space:'Space',
+ k.Key_Delete:'Delete', k.Key_Insert:'Insert', k.Key_Home:'Home',
+ k.Key_End:'End', k.Key_PageUp:'PageUp', k.Key_PageDown:'PageDown',
+ k.Key_Left:'Left', k.Key_Up:'Up', k.Key_Right:'Right', k.Key_Down:'Down' }
+
+
+class KeyMapLineEdit(QtGui.QLineEdit):
+ """ A modified version of a lineEdit object that catches the key event
+ and displays "Ctrl" when control was pressed, and similarly for alt and
+ shift, function keys and other keys.
+ """
+
+ textUpdate = QtCore.Signal()
+
+ def __init__(self, *args, **kwargs):
+ QtGui.QLineEdit.__init__(self, *args, **kwargs)
+ self.clear()
+
+
+ # keep a list of native keys, so that we can capture for example
+ # "shift+]". If we would use text(), we can only capture "shift+}"
+ # which is not a valid shortcut.
+ self._nativeKeys = {}
+
+ # Override setText, text and clear, so as to be able to set shortcuts like
+ # Ctrl+A, while the actually displayed value is an OS shortcut (e.g. on Mac
+ # Cmd-symbol + A)
+ def setText(self, text):
+ QtGui.QLineEdit.setText(self, translateShortcutToOSNames(text))
+ self._shortcut = text
+ def text(self):
+ return self._shortcut
+ def clear(self):
+ QtGui.QLineEdit.setText(self, '<enter key combination here>')
+ self._shortcut = ''
+
+ def focusInEvent(self, event):
+ #self.clear()
+ QtGui.QLineEdit.focusInEvent(self, event)
+
+ def event(self,event):
+ # Override event handler to enable catching the Tab key
+ # If the event is a KeyPress or KeyRelease, handle it with
+ # self.keyPressEvent or keyReleaseEvent
+ if event.type()==event.KeyPress:
+ self.keyPressEvent(event)
+ return True #Mark as handled
+ if event.type()==event.KeyRelease:
+ self.keyReleaseEvent(event)
+ return True #Mark as handled
+ #Default: handle events as usual
+ return QtGui.QLineEdit.event(self,event)
+
+ def keyPressEvent(self, event):
+ # get key codes
+ key = event.key()
+ nativekey = event.nativeVirtualKey()
+
+ # try to get text
+ if nativekey < 128 and sys.platform != 'darwin':
+ text = chr(nativekey).upper()
+ elif key<128:
+ text = chr(key).upper()
+ else:
+ text = ''
+
+ # do we know this specic key or this native key?
+ if key in keymap:
+ text = keymap[key]
+ elif nativekey in self._nativeKeys:
+ text = self._nativeKeys[nativekey]
+
+ # apply!
+ if text:
+ storeNativeKey, text0 = True, text
+ if QtGui.qApp.keyboardModifiers() & k.AltModifier:
+ text = 'Alt+' + text
+ if QtGui.qApp.keyboardModifiers() & k.ShiftModifier:
+ text = 'Shift+' + text
+ storeNativeKey = False
+ if QtGui.qApp.keyboardModifiers() & k.ControlModifier:
+ text = 'Ctrl+' + text
+ if QtGui.qApp.keyboardModifiers() & k.MetaModifier:
+ text = 'Meta+' + text
+ self.setText(text)
+ if storeNativeKey and nativekey:
+ # store native key if shift was not pressed.
+ self._nativeKeys[nativekey] = text0
+
+ # notify listeners
+ self.textUpdate.emit()
+
+
+class KeyMapEditDialog(QtGui.QDialog):
+ """ The prompt that is shown when double clicking
+ a keymap in the tree.
+ It notifies the user when the entered shortcut is already used
+ elsewhere and applies the shortcut (removing it elsewhere if
+ required) when the apply button is pressed.
+ """
+
+ def __init__(self, *args):
+ QtGui.QDialog.__init__(self, *args)
+
+ # set title
+ self.setWindowTitle(translate("menu dialog", 'Edit shortcut mapping'))
+
+ # set size
+ size = 400,140
+ offset = 5
+ size2 = size[0], size[1]+offset
+ self.resize(*size2)
+ self.setMaximumSize(*size2)
+ self.setMinimumSize(*size2)
+
+ self._label = QtGui.QLabel("", self)
+ self._label.setAlignment(QtCore.Qt.AlignTop | QtCore.Qt.AlignLeft)
+ self._label.resize(size[0]-20, 100)
+ self._label.move(10,2)
+
+ self._line = KeyMapLineEdit('', self)
+ self._line.resize(size[0]-80, 20)
+ self._line.move(10,90)
+
+ self._clear = QtGui.QPushButton("Clear", self)
+ self._clear.resize(50, 20)
+ self._clear.move(size[0]-60,90)
+
+ self._apply = QtGui.QPushButton("Apply", self)
+ self._apply.resize(50, 20)
+ self._apply.move(size[0]-120,120)
+
+ self._cancel = QtGui.QPushButton("Cancel", self)
+ self._cancel.resize(50, 20)
+ self._cancel.move(size[0]-60,120)
+
+ # callbacks
+ self._line.textUpdate.connect(self.onEdit)
+ self._clear.clicked.connect(self.onClear)
+ self._apply.clicked.connect(self.onAccept)
+ self._cancel.clicked.connect(self.close)
+
+ # stuff to fill in later
+ self._fullname = ''
+ self._intro = ''
+ self._isprimary = True
+
+ def setFullName(self, fullname, isprimary):
+ """ To be called right after initialization to let the user
+ know what he's updating, and show the current shortcut for that
+ in the line edit. """
+
+ # store
+ self._isprimary = isprimary
+ self._fullname = fullname
+ # create intro to show, and store + show it
+ tmp = fullname.replace('__',' -> ').replace('_', ' ')
+ primSec = ['secondary', 'primary'][int(isprimary)]
+ self._intro = "Set the {} shortcut for:\n{}".format(primSec,tmp)
+ self._label.setText(self._intro)
+ # set initial value
+ if fullname in iep.config.shortcuts2:
+ current = iep.config.shortcuts2[fullname]
+ if ',' not in current:
+ current += ','
+ current = current.split(',')
+ self._line.setText( current[0] if isprimary else current[1] )
+
+
+ def onClear(self):
+ self._line.clear()
+ self._line.setFocus()
+
+ def onEdit(self):
+ """ Test if already in use. """
+
+ # init
+ shortcut = self._line.text()
+ if not shortcut:
+ self._label.setText(self._intro)
+ return
+
+ for key in iep.config.shortcuts2:
+ # get shortcut and test whether it corresponds with what's pressed
+ shortcuts = getShortcut(key)
+ primSec = ''
+ if shortcuts[0].lower() == shortcut.lower():
+ primSec = 'primary'
+ elif shortcuts[1].lower() == shortcut.lower():
+ primSec = 'secondary'
+ # if a correspondence, let the user know
+ if primSec and key != self._fullname:
+ tmp = "Warning: shortcut already in use for:\n"
+ tmp += key.replace('__',' -> ').replace('_', ' ')
+ self._label.setText(self._intro + '\n\n' + tmp + '\n')
+ break
+ else:
+ self._label.setText(self._intro)
+
+
+ def onAccept(self):
+ shortcut = self._line.text()
+
+ # remove shortcut if present elsewhere
+ keys = [key for key in iep.config.shortcuts2] # copy
+ for key in keys:
+ # get shortcut, test whether it corresponds with what's pressed
+ shortcuts = getShortcut(key)
+ tmp = list(shortcuts)
+ needUpdate = False
+ if shortcuts[0].lower() == shortcut.lower():
+ tmp[0] = ''
+ needUpdate = True
+ if shortcuts[1].lower() == shortcut.lower():
+ tmp[1] = ''
+ needUpdate = True
+ if needUpdate:
+ tmp = ','.join(tmp)
+ tmp = tmp.replace(' ','')
+ if len(tmp)==1:
+ del iep.config.shortcuts2[key]
+ else:
+ iep.config.shortcuts2[key] = tmp
+
+ # insert shortcut
+ if self._fullname:
+ # get current and make list of size two
+ if self._fullname in iep.config.shortcuts2:
+ current = list(getShortcut(self._fullname))
+ else:
+ current = ['', '']
+ # update the list
+ current[int(not self._isprimary)] = shortcut
+ iep.config.shortcuts2[self._fullname] = ','.join(current)
+
+ # close
+ self.close()
+
+
+class KeymappingDialog(QtGui.QDialog):
+ """ The main keymap dialog, it has tabs corresponding with the
+ different menus and each tab has a tree representing the structure
+ of these menus. The current shortcuts are displayed.
+ On double clicking on an item, the shortcut can be edited. """
+
+ def __init__(self, *args):
+ QtGui.QDialog.__init__(self, *args)
+
+ # set title
+ self.setWindowTitle(translate("menu dialog", 'Shortcut mappings'))
+
+ # set size
+ size = 600,400
+ offset = 0
+ size2 = size[0], size[1]+offset
+ self.resize(*size2)
+ self.setMaximumSize(*size2)
+ self.setMinimumSize(* size2)
+
+ self.tab = CompactTabWidget(self, padding=(4,4,6,6))
+ self.tab.resize(*size)
+ self.tab.move(0,offset)
+ self.tab.setMovable(False)
+
+ # fill tab
+ self._models = []
+ self._trees = []
+ for menu in iep.main.menuBar()._menus:
+ # create treeview and model
+ model = KeyMapModel()
+ model.setRootMenu(menu)
+ tree = QtGui.QTreeView(self.tab)
+ tree.setModel(model)
+ # configure treeview
+ tree.clicked.connect(self.onClickSelect)
+ tree.doubleClicked.connect(self.onDoubleClick)
+ tree.setColumnWidth(0,150)
+ # append to lists
+ self._models.append(model)
+ self._trees.append(tree)
+ self.tab.addTab(tree, menu.title())
+
+ self.tab.currentChanged.connect(self.onTabSelect)
+
+
+ def closeEvent(self, event):
+ # update key setting
+ iep.keyMapper.keyMappingChanged.emit()
+
+ event.accept()
+
+ def onTabSelect(self):
+ pass
+
+
+ def onClickSelect(self, index):
+ # should we show a prompt?
+ if index.column():
+ self.popupItem(index.internalPointer(), index.column())
+
+
+ def onDoubleClick(self, index):
+ if not index.column():
+ self.popupItem(index.internalPointer())
+
+
+ def popupItem(self, item, shortCutId=1):
+ """ Popup the dialog to change the shortcut. """
+ if isinstance(item, QtGui.QAction) and item.text():
+ # create prompt dialog
+ dlg = KeyMapEditDialog(self)
+ dlg.setFullName( item.menuPath, shortCutId==1 )
+ # show it
+ dlg.exec_()
diff --git a/iep/iepcore/shell.py b/iep/iepcore/shell.py
new file mode 100644
index 0000000..9a18d9a
--- /dev/null
+++ b/iep/iepcore/shell.py
@@ -0,0 +1,1507 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+""" Module shell
+
+Defines the shell to be used in IEP.
+This is done in a few inheritance steps:
+ - BaseShell inherits BaseTextCtrl and adds the typical shell behaviour.
+ - PythonShell makes it specific to Python.
+This module also implements ways to communicate with the shell and to run
+code in it.
+
+"""
+
+from pyzolib.qt import QtCore, QtGui
+Qt = QtCore.Qt
+
+import os, sys, time, subprocess
+import re
+import yoton
+import iep
+from pyzolib import ssdf
+
+from iep.codeeditor.highlighter import Highlighter
+from iep.codeeditor import parsers
+
+from iep.iepcore.baseTextCtrl import BaseTextCtrl
+from iep.iepcore.iepLogging import print
+from iep.iepcore.kernelbroker import KernelInfo, Kernelmanager
+from iep.iepcore.menu import ShellContextMenu
+
+
+
+# Interval for polling messages. Timer for each kernel. I found
+# that this one does not affect performance much
+POLL_TIMER_INTERVAL = 30 # 30 ms 33Hz
+
+# Maximum number of lines in the shell
+MAXBLOCKCOUNT = iep.config.advanced.shellMaxLines
+
+
+# todo: we could make command shells to, with autocompletion and coloring...
+
+class YotonEmbedder(QtCore.QObject):
+ """ Embed the Yoton event loop.
+ """
+
+ def __init__(self):
+ QtCore.QObject.__init__(self)
+ yoton.app.embed_event_loop(self.postYotonEvent)
+
+ def postYotonEvent(self):
+ try:
+ QtGui.qApp.postEvent(self, QtCore.QEvent(QtCore.QEvent.User))
+ except Exception:
+ pass # If IEP is shutting down, the app may be None
+
+ def customEvent(self, event):
+ """ This is what gets called by Qt.
+ """
+ yoton.process_events(False)
+
+yotonEmbedder = YotonEmbedder()
+
+
+# Short constants for cursor movement
+A_KEEP = QtGui.QTextCursor.KeepAnchor
+A_MOVE = QtGui.QTextCursor.MoveAnchor
+
+# Instantiate a local kernel broker upon loading this module
+iep.localKernelManager = Kernelmanager(public=False)
+
+
+def finishKernelInfo(info, scriptFile=None):
+ """ finishKernelInfo(info, scriptFile=None)
+
+ Get a copy of the kernel info struct, with the scriptFile
+ and the projectPath set.
+
+ """
+
+ # Set executable to default if it is empty
+ # Note that we do this on the original struct object.
+ if not info.exe:
+ info.exe = '[default]'
+
+ # Make a copy, we do not want to change the original
+ info = ssdf.copy(info)
+
+ # Set scriptFile (if '', the kernel will run in interactive mode)
+ if scriptFile:
+ info.scriptFile = scriptFile
+ else:
+ info.scriptFile = ''
+
+ #If the file browser is active, and has the check box
+ #'add path to Python path' set, set the PROJECTPATH variable
+ fileBrowser = iep.toolManager.getTool('iepfilebrowser')
+ projectManager = iep.toolManager.getTool('iepprojectmanager')
+ info.projectPath = ''
+ if fileBrowser:
+ info.projectPath = fileBrowser.getAddToPythonPath()
+ if projectManager and not info.projectPath:
+ # Only process project manager tool if file browser did not set a path.
+ info.projectPath = projectManager.getAddToPythonPath()
+
+ return info
+
+
+
+class ShellHighlighter(Highlighter):
+ """ This highlighter implements highlighting for a shell;
+ only the input lines are highlighted with this highlighter.
+ """
+
+ def highlightBlock(self, line):
+
+ t0 = time.time()
+
+ # Make sure this is a Unicode Python string
+ line = str(line)
+
+ # Get previous state
+ previousState = self.previousBlockState()
+
+ # Get parser
+ parser = None
+ if hasattr(self._codeEditor, 'parser'):
+ parser = self._codeEditor.parser()
+
+ # Get function to get format
+ nameToFormat = self._codeEditor.getStyleElementFormat
+
+ # Last line?
+ cursor1 = self._codeEditor._cursor1
+ cursor2 = self._codeEditor._cursor2
+ commandCursor = self._codeEditor._lastCommandCursor
+ curBlock = self.currentBlock()
+ #
+ atLastPrompt, atCurrentPrompt = False, False
+ if curBlock.position() == 0:
+ pass
+ elif curBlock.position() == commandCursor.block().position():
+ atLastPrompt = True
+ elif curBlock.position() >= cursor1.block().position():
+ atCurrentPrompt = True
+
+ if not atLastPrompt and not atCurrentPrompt:
+ # Do not highlight anything but current and last prompts
+ return
+
+
+ if parser:
+ if atCurrentPrompt:
+ pos1, pos2 = cursor1.positionInBlock(), cursor2.positionInBlock()
+ else:
+ pos1, pos2 = 0, commandCursor.positionInBlock()
+
+ # Check if we should *not* format this line.
+ # This is the case for special "executing" text
+ # A bit of a hack though ... is there a better way to signal this?
+ specialinput = (not atCurrentPrompt) and line[pos2:].startswith('(executing ')
+
+ self.setCurrentBlockState(0)
+ if specialinput:
+ pass # Let the kernel decide formatting
+ else:
+ for token in parser.parseLine(line, previousState):
+ # Handle block state
+ if isinstance(token, parsers.BlockState):
+ self.setCurrentBlockState(token.state)
+ else:
+ # Get format
+ try:
+ format = nameToFormat(token.name).textCharFormat
+ except KeyError:
+ #print(repr(nameToFormat(token.name)))
+ continue
+ # Set format
+ #format.setFontWeight(75)
+ if token.start >= pos2:
+ self.setFormat(token.start,token.end-token.start,format)
+
+ # Set prompt to bold
+ if atCurrentPrompt:
+ format = QtGui.QTextCharFormat()
+ format.setFontWeight(75)
+ self.setFormat(pos1, pos2-pos1, format)
+
+ #Get the indentation setting of the editors
+ indentUsingSpaces = self._codeEditor.indentUsingSpaces()
+
+ # Get user data
+ bd = self.getCurrentBlockUserData()
+
+ leadingWhitespace=line[:len(line)-len(line.lstrip())]
+ if '\t' in leadingWhitespace and ' ' in leadingWhitespace:
+ #Mixed whitespace
+ bd.indentation = 0
+ format=QtGui.QTextCharFormat()
+ format.setUnderlineStyle(QtGui.QTextCharFormat.SpellCheckUnderline)
+ format.setUnderlineColor(QtCore.Qt.red)
+ format.setToolTip('Mixed tabs and spaces')
+ self.setFormat(0,len(leadingWhitespace),format)
+ elif ('\t' in leadingWhitespace and indentUsingSpaces) or \
+ (' ' in leadingWhitespace and not indentUsingSpaces):
+ #Whitespace differs from document setting
+ bd.indentation = 0
+ format=QtGui.QTextCharFormat()
+ format.setUnderlineStyle(QtGui.QTextCharFormat.SpellCheckUnderline)
+ format.setUnderlineColor(QtCore.Qt.blue)
+ format.setToolTip('Whitespace differs from document setting')
+ self.setFormat(0,len(leadingWhitespace),format)
+ else:
+ # Store info for indentation guides
+ # amount of tabs or spaces
+ bd.indentation = len(leadingWhitespace)
+
+
+
+class BaseShell(BaseTextCtrl):
+ """ The BaseShell implements functionality to make a generic shell.
+ """
+
+
+ def __init__(self, parent,**kwds):
+ super().__init__(parent, wrap=True, showLineNumbers=False,
+ showBreakPoints=False, highlightCurrentLine=False, parser='python',
+ **kwds)
+
+ # Use a special highlighter that only highlights the input.
+ self._setHighlighter(ShellHighlighter)
+
+ # No undo in shells
+ self.setUndoRedoEnabled(False)
+
+ # variables we need
+ self._more = False
+
+ # We use two cursors to keep track of where the prompt is
+ # cursor1 is in front, and cursor2 is at the end of the prompt.
+ # They can be in the same position.
+ # Further, we store a cursor that selects the last given command,
+ # so it can be styled.
+ self._cursor1 = self.textCursor()
+ self._cursor2 = self.textCursor()
+ self._lastCommandCursor = self.textCursor()
+
+ # When inserting/removing text at the edit line (thus also while typing)
+ # keep cursor2 at its place. Only when text is written before
+ # the prompt (i.e. in write), this flag is temporarily set to False.
+ # Same for cursor1, because sometimes (when there is no prompt) it
+ # is at the same position.
+ self._cursor1.setKeepPositionOnInsert(True)
+ self._cursor2.setKeepPositionOnInsert(True)
+
+ # Similarly, we use the _lastCommandCursor cursor really for pointing.
+ self._lastCommandCursor.setKeepPositionOnInsert(True)
+
+ # Create the command history. Commands are added into the
+ # front of the list (ie. at index 0) as they are entered.
+ self._history = []
+ self._historyNeedle = None # None means none, "" means look in all
+ self._historyStep = 0
+
+ # Set minimum width so 80 lines do fit in smallest font size
+ self.setMinimumWidth(200)
+
+ # Hard wrapping. QTextEdit allows hard wrapping at a specific column.
+ # Unfortunately, QPlainTextEdit does not.
+ self.setWordWrapMode(QtGui.QTextOption.WrapAnywhere)
+
+ # Limit number of lines
+ self.setMaximumBlockCount(MAXBLOCKCOUNT)
+
+ # Keep track of position, so we can disable editing if the cursor
+ # is before the prompt
+ self.cursorPositionChanged.connect(self.onCursorPositionChanged)
+
+ self.setFocusPolicy(Qt.TabFocus) # See remark at mousePressEvent
+
+ ## Cursor stuff
+
+
+
+ def onCursorPositionChanged(self):
+ #If the end of the selection (or just the cursor if there is no selection)
+ #is before the beginning of the line. make the document read-only
+ cursor = self.textCursor()
+ promptpos = self._cursor2.position()
+ if cursor.position() < promptpos or cursor.anchor() < promptpos:
+ self.setReadOnly(True)
+ else:
+ self.setReadOnly(False)
+
+
+ def ensureCursorAtEditLine(self):
+ """
+ If the text cursor is before the beginning of the edit line,
+ move it to the end of the edit line
+ """
+ cursor = self.textCursor()
+ promptpos = self._cursor2.position()
+ if cursor.position() < promptpos or cursor.anchor() < promptpos:
+ cursor.movePosition(cursor.End, A_MOVE) # Move to end of document
+ self.setTextCursor(cursor)
+ self.onCursorPositionChanged()
+
+
+ def mousePressEvent(self, event):
+ """
+ - Disable right MB and middle MB (which pastes by default).
+ - Focus policy
+ If a user clicks this shell, while it has no focus, we do
+ not want the cursor position to change (since generally the
+ user clicks the shell to give it the focus). We do this by
+ setting the focus-policy to Qt::TabFocus, and we give the
+ widget its focus manually from the mousePressedEvent event
+ handler
+
+ """
+
+ if not self.hasFocus():
+ self.setFocus()
+ return
+
+ if event.button() != QtCore.Qt.MidButton:
+ super().mousePressEvent(event)
+
+
+ def contextMenuEvent(self, event):
+ """ Do not show context menu. """
+ pass
+
+
+ def mouseDoubleClickEvent(self, event):
+ BaseTextCtrl.mouseDoubleClickEvent(self, event)
+ self._handleClickOnFilename(event.pos())
+
+
+ def _handleClickOnFilename(self, mousepos):
+ """ Check whether the text that is clicked is a filename
+ and open the file in the editor. If a line number can also be
+ detected, open the file at that line number.
+ """
+
+ # Get cursor and its current pos
+ cursor = self.cursorForPosition(mousepos)
+ ocursor = QtGui.QTextCursor(cursor) # Make a copy to use below
+ pos = cursor.positionInBlock()
+
+ # Get line of text for the cursor
+ cursor.movePosition(cursor.EndOfBlock, cursor.MoveAnchor)
+ cursor.movePosition(cursor.StartOfBlock, cursor.KeepAnchor)
+ line = cursor.selectedText()
+ if len(line) > 1024:
+ return # safety
+
+ # Get the word that is clicked. Qt's cursor.StartOfWord does not
+ # work for filenames.
+ line = line.replace('"', ' ') # IEP uses " around filenames
+ before = line[:pos].split(' ')[-1]
+ after = line[pos:].split(' ')[0]
+ word = before + after
+
+ # Check if it looks like a filename, quit if it does not
+ if len(word) < 4:
+ return
+ elif not ('/' in word or '\\' in word):
+ return
+ #
+ if sys.platform.startswith('win'):
+ if word[1] != ':':
+ return
+ else:
+ if not word.startswith('/'):
+ return
+ #
+ filename = word
+
+ # Split in parts for getting line number
+ line = line[pos+len(after):]
+ line = line.replace(',', ' ')
+ parts = [p for p in line.split(' ') if p]
+ # Iterate over parts
+ linenr = None
+ for i, part in enumerate(parts):
+ if part in ('line', 'linenr', 'lineno'):
+ try:
+ linenr = int(parts[i+1])
+ except IndexError:
+ pass # no more parts
+ except ValueError:
+ pass # not an integer
+ else:
+ break
+
+ # Try again IPython style
+ # IPython shows a few lines with the active line indicated by an arrow
+ if linenr is None:
+ for i in range(4):
+ cursor.movePosition(cursor.NextBlock, cursor.MoveAnchor)
+ cursor.movePosition(cursor.EndOfBlock, cursor.KeepAnchor)
+ line = cursor.selectedText()
+ if len(line) > 1024:
+ continue # safety
+ if not line.startswith('-'):
+ continue
+ parts = line.split(' ', 2)
+ if parts[0] in ('->', '-->', '--->', '---->', '----->'):
+ try:
+ linenr = int(parts[1].strip())
+ except IndexError:
+ pass # too few parts
+ except ValueError:
+ pass # not an integer
+ else:
+ break
+
+ # Select word here (in shell)
+ cursor = ocursor
+ cursor.movePosition(cursor.Left, cursor.MoveAnchor, len(before))
+ cursor.movePosition(cursor.Right, cursor.KeepAnchor, len(word))
+ self.setTextCursor(cursor)
+
+ # Try opening the file (at the line number if we have one)
+ result = iep.editors.loadFile(filename)
+ if result and linenr is not None:
+ editor = result._editor
+ editor.gotoLine(linenr)
+ cursor = editor.textCursor()
+ cursor.movePosition(cursor.StartOfBlock)
+ cursor.movePosition(cursor.EndOfBlock, cursor.KeepAnchor)
+ editor.setTextCursor(cursor)
+
+
+ ##Indentation: override code editor behaviour
+ def indentSelection(self):
+ pass
+ def dedentSelection(self):
+ pass
+
+ ## Key handlers
+ def keyPressEvent(self,event):
+
+ if event.key() in [Qt.Key_Return, Qt.Key_Enter]:
+
+ # First check if autocompletion triggered
+ if self.potentiallyAutoComplete(event):
+ return
+ else:
+ # Enter: execute line
+ # Remove calltip and autocomp if shown
+ self.autocompleteCancel()
+ self.calltipCancel()
+
+ # reset history needle
+ self._historyNeedle = None
+
+ # process
+ self.processLine()
+ return
+
+ if event.key() == Qt.Key_Escape:
+ # Escape clears command
+ if not ( self.autocompleteActive() or self.calltipActive() ):
+ self.clearCommand()
+
+ if event.key() == Qt.Key_Home:
+ # Home goes to the prompt.
+ cursor = self.textCursor()
+ if event.modifiers() & Qt.ShiftModifier:
+ cursor.setPosition(self._cursor2.position(), A_KEEP)
+ else:
+ cursor.setPosition(self._cursor2.position(), A_MOVE)
+ #
+ self.setTextCursor(cursor)
+ self.autocompleteCancel()
+ return
+
+ if event.key() == Qt.Key_Insert:
+ # Don't toggle between insert mode and overwrite mode.
+ return True
+
+ #Ensure to not backspace / go left beyond the prompt
+ if event.key() in [Qt.Key_Backspace, Qt.Key_Left]:
+ self._historyNeedle = None
+ if self.textCursor().position() == self._cursor2.position():
+ if event.key() == Qt.Key_Backspace:
+ self.textCursor().removeSelectedText()
+ return #Ignore the key, don't go beyond the prompt
+
+
+ if event.key() in [Qt.Key_Up, Qt.Key_Down] and not \
+ self.autocompleteActive():
+
+ # needle
+ if self._historyNeedle is None:
+ # get partly-written-command
+ #
+ # Select text
+ cursor = self.textCursor()
+ cursor.setPosition(self._cursor2.position(), A_MOVE)
+ cursor.movePosition(cursor.End, A_KEEP)
+ # Update needle text
+ self._historyNeedle = cursor.selectedText()
+ self._historyStep = 0
+
+ #Browse through history
+ if event.key() == Qt.Key_Up:
+ self._historyStep +=1
+ else: # Key_Down
+ self._historyStep -=1
+ if self._historyStep < 1:
+ self._historyStep = 1
+
+ # find the command
+ count = 0
+ for c in self._history:
+ if c.startswith(self._historyNeedle):
+ count+=1
+ if count >= self._historyStep:
+ break
+ else:
+ # found nothing-> reset
+ self._historyStep = 0
+ c = self._historyNeedle
+
+ # Replace text
+ cursor = self.textCursor()
+ cursor.setPosition(self._cursor2.position(), A_MOVE)
+ cursor.movePosition(cursor.End, A_KEEP)
+ cursor.insertText(c)
+
+ self.ensureCursorAtEditLine()
+ return
+
+ else:
+ # Reset needle
+ self._historyNeedle = None
+
+ #if a 'normal' key is pressed, ensure the cursor is at the edit line
+ if event.text():
+ self.ensureCursorAtEditLine()
+
+ #Default behaviour: BaseTextCtrl
+ BaseTextCtrl.keyPressEvent(self,event)
+
+
+
+ ## Cut / Copy / Paste / Drag & Drop
+
+ def cut(self):
+ """ Reimplement cut to only copy if part of the selected text
+ is not at the prompt. """
+
+ if self.isReadOnly():
+ return self.copy()
+ else:
+ return BaseTextCtrl.cut(self)
+
+ #def copy(self): # no overload needed
+
+ def paste(self):
+ """ Reimplement paste to paste at the end of the edit line when
+ the position is at the prompt. """
+ self.ensureCursorAtEditLine()
+ # Paste normally
+ return BaseTextCtrl.paste(self)
+
+ def dragEnterEvent(self, event):
+ """No dropping allowed"""
+ pass
+
+ def dropEvent(self,event):
+ """No dropping allowed"""
+ pass
+
+
+ ## Basic commands to control the shell
+
+
+ def clearScreen(self):
+ """ Clear all the previous output from the screen. """
+ # Select from beginning of prompt to start of document
+ self._cursor1.clearSelection()
+ self._cursor1.movePosition(self._cursor1.Start, A_KEEP) # Keep anchor
+ self._cursor1.removeSelectedText()
+ # Wrap up
+ self.ensureCursorAtEditLine()
+ self.ensureCursorVisible()
+
+ def deleteLines(self):
+ """ Called from the menu option "delete lines", just execute self.clearCommand() """
+ self.clearCommand()
+
+ def clearCommand(self):
+ """ Clear the current command, move the cursor right behind
+ the prompt, and ensure it's visible.
+ """
+ # Select from prompt end to length and delete selected text.
+ cursor = self.textCursor()
+ cursor.setPosition(self._cursor2.position(), A_MOVE)
+ cursor.movePosition(cursor.End, A_KEEP)
+ cursor.removeSelectedText()
+ # Wrap up
+ self.ensureCursorAtEditLine()
+ self.ensureCursorVisible()
+
+
+ def _handleBackspaces_split(self, text):
+
+ # while NOT a backspace at first position, or none found
+ i = 9999999999999
+ while i>0:
+ i = text.rfind('\b',0,i)
+ if i>0 and text[i-1]!='\b':
+ text = text[0:i-1] + text[i+1:]
+
+ # Strip the backspaces at the start
+ text2 = text.lstrip('\b')
+ n = len(text) - len(text2)
+
+ # Done
+ return n, text2
+
+
+ def _handleBackspacesOnList(self, texts):
+ """ _handleBackspacesOnList(texts)
+
+ Handle backspaces on a list of messages. When printing
+ progress, many messages will simply replace each-other, which
+ means we can process them much more effectively than when they're
+ combined in a list.
+
+ """
+ # Init number of backspaces at the start
+ N = 0
+
+ for i in range(len(texts)):
+
+ # Remove backspaces in text and how many are left
+ n, text = self._handleBackspaces_split(texts[i])
+ texts[i] = text
+
+ # Use remaining backspaces to remove backspaces in earlier texts
+ while n and i > 0:
+ i -= 1
+ text = texts[i]
+ if len(text) > n:
+ texts[i] = text[:-n]
+ n = 0
+ else:
+ texts[i] = ''
+ n -= len(text)
+ N += n
+
+ # Insert tabs for start
+ if N:
+ texts[0] = '\b'*N + texts[0]
+
+ # Return with empy elements popped
+ return [t for t in texts if t]
+
+
+ def _handleBackspaces(self, text):
+ """ Apply backspaces in the string itself and if there are
+ backspaces left at the start of the text, remove the appropriate
+ amount of characters from the text.
+
+ Returns the new text.
+ """
+ # take care of backspaces
+ if '\b' in text:
+ # Remove backspaces and get how many were at the beginning
+ nb, text = self._handleBackspaces_split(text)
+ if nb:
+ # Select what we remove and delete that
+ self._cursor1.clearSelection()
+ self._cursor1.movePosition(self._cursor1.Left, A_KEEP, nb)
+ self._cursor1.removeSelectedText()
+
+ # Return result
+ return text
+
+
+ def _splitLinesForPrinting(self, text):
+ """ Given a text, split the text in lines. Lines that are extremely
+ long are split in pieces of 80 characters to increase performance for
+ wrapping. This is kind of a failsafe for when the user accidentally
+ prints a bitmap or huge list. See issue 98.
+ """
+ for line in text.splitlines(True):
+ if len(line) > 1024: # about 12 lines of 80 chars
+ parts = [line[i:i+80] for i in range(0, len(line), 80)]
+ yield '\n'.join(parts)
+ else:
+ yield line
+
+
+ def write(self, text, prompt=0, color=None):
+ """ write(text, prompt=0, color=None)
+
+ Write to the shell.
+
+ If prompt is 0 (default) the text is printed before the prompt. If
+ prompt is 1, the text is printed after the prompt, the new prompt
+ becomes null. If prompt is 2, the given text becomes the new prompt.
+
+ The color of the text can also be specified (as a hex-string).
+
+ """
+
+ # From The Qt docs: Note that a cursor always moves when text is
+ # inserted before the current position of the cursor, and it always
+ # keeps its position when text is inserted after the current position
+ # of the cursor.
+
+ # Make sure there's text and make sure its a string
+ if not text:
+ return
+ if isinstance(text, bytes):
+ text = text.decode('utf-8')
+
+ # Prepare format
+ format = QtGui.QTextCharFormat()
+ if color:
+ format.setForeground(QtGui.QColor(color))
+
+ #pos1, pos2 = self._cursor1.position(), self._cursor2.position()
+
+ # Just in case, clear any selection of the cursors
+ self._cursor1.clearSelection()
+ self._cursor2.clearSelection()
+
+ if prompt == 0:
+ # Insert text behind prompt (normal streams)
+ self._cursor1.setKeepPositionOnInsert(False)
+ self._cursor2.setKeepPositionOnInsert(False)
+ text = self._handleBackspaces(text)
+ self._insertText(self._cursor1, text, format)
+ elif prompt == 1:
+ # Insert command text after prompt, prompt becomes null (input)
+ self._lastCommandCursor.setPosition(self._cursor2.position())
+ self._cursor1.setKeepPositionOnInsert(False)
+ self._cursor2.setKeepPositionOnInsert(False)
+ self._insertText(self._cursor2, text, format)
+ self._cursor1.setPosition(self._cursor2.position(), A_MOVE)
+ elif prompt == 2 and text == '\b':
+ # Remove prompt (used when closing the kernel)
+ self._cursor1.setPosition(self._cursor2.position(), A_KEEP)
+ self._cursor1.removeSelectedText()
+ self._cursor2.setPosition(self._cursor1.position(), A_MOVE)
+ elif prompt == 2:
+ # Insert text after prompt, inserted text becomes new prompt
+ self._cursor1.setPosition(self._cursor2.position(), A_MOVE)
+ self._cursor1.setKeepPositionOnInsert(True)
+ self._cursor2.setKeepPositionOnInsert(False)
+ self._insertText(self._cursor1, text, format)
+
+ # Reset cursor states for the user to type his/her commands
+ self._cursor1.setKeepPositionOnInsert(True)
+ self._cursor2.setKeepPositionOnInsert(True)
+
+ # Make sure that cursor is visible (only when cursor is at edit line)
+ if not self.isReadOnly():
+ self.ensureCursorVisible()
+
+ # Scroll along with the text if lines are popped from the top
+ elif self.blockCount() == MAXBLOCKCOUNT:
+ n = text.count('\n')
+ sb = self.verticalScrollBar()
+ sb.setValue(sb.value()-n)
+
+
+ def _insertText(self, cursor, text, format):
+ """ Insert text at the given cursor, and with the given format.
+ This function processes ANSI escape code for formatting and
+ colorization: http://en.wikipedia.org/wiki/ANSI_escape_code
+ """
+
+ # If necessary, make a new cursor that moves along. We insert
+ # the text in pieces, so we need to move along with the text!
+ if cursor.keepPositionOnInsert():
+ cursor = QtGui.QTextCursor(cursor)
+ cursor.setKeepPositionOnInsert(False)
+
+ # Init. We use the solarised color theme
+ pattern = r'\x1b\[(.*?)m'
+ #CLRS = ['#000', '#F00', '#0F0', '#FF0', '#00F', '#F0F', '#0FF', '#FFF']
+ CLRS = ['#657b83', '#dc322f', '#859900', '#b58900', '#268bd2',
+ '#d33682', '#2aa198', '#eee8d5']
+ pendingtext = ''
+ i0 = 0
+
+
+ for match in re.finditer(pattern, text):
+
+ # Insert pending text with the current format
+ # Also update indices
+ i1, i2 = match.span()
+ cursor.insertText(text[i0:i1], format)
+ i0 = i2
+
+ # The formay that we are now going to parse should apply to
+ # the text that follow it ...
+
+ # Get parameters
+ try:
+ params = [int(i) for i in match.group(1).split(';')]
+ except ValueError:
+ params = []
+ if not params:
+ params = [0]
+
+ # Process
+ for param in params:
+ if param == 0:
+ format = QtGui.QTextCharFormat()
+ elif param == 1:
+ format.setFontWeight(75) # Bold
+ elif param == 2:
+ format.setFontWeight(25) # Faint
+ elif param == 3:
+ format.setFontItalic(True) # Italic
+ elif param == 4:
+ format.setFontUnderline(True) # Underline
+ #
+ elif param == 22:
+ format.setFontWeight(50) # Not bold or faint
+ elif param == 23:
+ format.setFontItalic(False) # Not italic
+ elif param == 24:
+ format.setFontUnderline(False) # Not underline
+ #
+ elif 30 <= param <= 37: # Set foreground color
+ clr = CLRS[param-30]
+ format.setForeground(QtGui.QColor(clr))
+ elif 40 <= param <= 47:
+ pass # Cannot set background text in QPlainTextEdit
+ #
+ else:
+ pass # Not supported
+
+ else:
+ # At the end, process the remaining text
+ text = text[i0:]
+
+ # Process very long text more efficiently.
+ # Insert per line (very long lines are split in smaller ones)
+ if len(text) > 1024:
+ for line in self._splitLinesForPrinting(text):
+ cursor.insertText(line, format)
+ else:
+ cursor.insertText(text, format)
+
+
+
+ ## Executing stuff
+
+ def processLine(self, line=None, execute=True):
+ """ processLine(self, line=None, execute=True)
+
+ Process the given line or the current line at the prompt if not given.
+ Called when the user presses enter.
+
+ If execute is False will not execute the command. This way
+ a message can be written while other ways are used to process
+ the command.
+ """
+
+ # Can we do this?
+ if self.isReadOnly() and not line:
+ return
+
+ if line:
+ # remove trailing newline(s)
+ command = line.rstrip('\n')
+ else:
+ # Select command
+ cursor = self.textCursor()
+ cursor.setPosition(self._cursor2.position(), A_MOVE)
+ cursor.movePosition(cursor.End, A_KEEP)
+
+ # Sample the text from the prompt and remove it
+ command = cursor.selectedText().replace('\u2029', '\n') .rstrip('\n')
+ cursor.removeSelectedText()
+
+ # Remember the command (but first remove to prevent duplicates)
+ if command:
+ if command in self._history:
+ self._history.remove(command)
+ self._history.insert(0,command)
+
+ if execute:
+ command = command.replace('\r\n', '\n')
+ self.executeCommand(command+'\n')
+
+
+ def executeCommand(self, command):
+ """ Execute the given command.
+ Should be overridden.
+ """
+ # this is a stupid simulation version
+ self.write("you executed: "+command+'\n')
+ self.write(">>> ", prompt=2)
+
+
+
+class PythonShell(BaseShell):
+ """ The PythonShell class implements the python part of the shell
+ by connecting to a remote process that runs a Python interpreter.
+ """
+
+ # Emits when the status string has changed or when receiving a new prompt
+ stateChanged = QtCore.Signal(BaseShell)
+
+ # Emits when the debug status is changed
+ debugStateChanged = QtCore.Signal(BaseShell)
+
+
+ def __init__(self, parent, info):
+ BaseShell.__init__(self, parent)
+
+ # Get standard info if not given.
+ if info is None and iep.config.shellConfigs2:
+ info = iep.config.shellConfigs2[0]
+ if not info:
+ info = KernelInfo(None)
+
+ # Store info so we can reuse it on a restart
+ self._info = info
+
+ # For the editor to keep track of attempted imports
+ self._importAttempts = []
+
+ # To keep track of the response for introspection
+ self._currentCTO = None
+ self._currentACO = None
+
+ # Write buffer to store messages in for writing
+ self._write_buffer = None
+
+ # Create timer to keep polling any results
+ # todo: Maybe use yoton events to process messages as they arrive.
+ # I tried this briefly, but it seemd to be less efficient because
+ # messages are not so much bach-processed anymore. We should decide
+ # on either method.
+ self._timer = QtCore.QTimer(self)
+ self._timer.setInterval(POLL_TIMER_INTERVAL) # ms
+ self._timer.setSingleShot(False)
+ self._timer.timeout.connect(self.poll)
+ self._timer.start()
+
+ # Add context menu
+ self._menu = ShellContextMenu(shell=self, parent=self)
+ self.setContextMenuPolicy(QtCore.Qt.CustomContextMenu)
+ self.customContextMenuRequested.connect(lambda p: self._menu.popup(self.mapToGlobal(p+QtCore.QPoint(0,3))))
+
+ # Keep track of breakpoints
+ iep.editors.breakPointsChanged.connect(self.sendBreakPoints)
+
+ # Start!
+ self.resetVariables()
+ self.connectToKernel(info)
+
+
+ def resetVariables(self):
+ """ Resets some variables. """
+
+ # Reset read state
+ self.setReadOnly(False)
+
+ # Variables to store state, python version, builtins and keywords
+ self._state = ''
+ self._debugState = {}
+ self._version = ""
+ self._builtins = []
+ self._keywords = []
+ self._startup_info = {}
+ self._start_time = 0
+
+ # (re)set import attempts
+ self._importAttempts[:] = []
+
+ # Update
+ self.stateChanged.emit(self)
+
+
+ def connectToKernel(self, info):
+ """ connectToKernel()
+
+ Create kernel and connect to it.
+
+ """
+
+ # Create yoton context
+ self._context = ct = yoton.Context()
+
+ # Create stream channels
+ self._strm_out = yoton.SubChannel(ct, 'strm-out')
+ self._strm_err = yoton.SubChannel(ct, 'strm-err')
+ self._strm_raw = yoton.SubChannel(ct, 'strm-raw')
+ self._strm_echo = yoton.SubChannel(ct, 'strm-echo')
+ self._strm_prompt = yoton.SubChannel(ct, 'strm-prompt')
+ self._strm_broker = yoton.SubChannel(ct, 'strm-broker')
+ self._strm_action = yoton.SubChannel(ct, 'strm-action', yoton.OBJECT)
+
+ # Set channels to sync mode. This means that if the IEP cannot process
+ # the messages fast enough, the sending side is blocked for a short
+ # while. We don't want our users to miss any messages.
+ for c in [self._strm_out, self._strm_err]:
+ c.set_sync_mode(True)
+
+ # Create control channels
+ self._ctrl_command = yoton.PubChannel(ct, 'ctrl-command')
+ self._ctrl_code = yoton.PubChannel(ct, 'ctrl-code', yoton.OBJECT)
+ self._ctrl_broker = yoton.PubChannel(ct, 'ctrl-broker')
+
+ # Create status channels
+ self._stat_interpreter = yoton.StateChannel(ct, 'stat-interpreter')
+ self._stat_debug = yoton.StateChannel(ct, 'stat-debug', yoton.OBJECT)
+ self._stat_startup = yoton.StateChannel(ct, 'stat-startup', yoton.OBJECT)
+ self._stat_startup.received.bind(self._onReceivedStartupInfo)
+ self._stat_breakpoints = yoton.StateChannel(ct, 'stat-breakpoints', yoton.OBJECT)
+
+ # Create introspection request channel
+ self._request = yoton.ReqChannel(ct, 'reqp-introspect')
+
+ # Connect! The broker will only start the kernel AFTER
+ # we connect, so we do not miss out on anything.
+ slot = iep.localKernelManager.createKernel(finishKernelInfo(info))
+ self._brokerConnection = ct.connect('localhost:%i'%slot)
+ self._brokerConnection.closed.bind(self._onConnectionClose)
+
+ # Force updating of breakpoints
+ iep.editors.updateBreakPoints()
+
+ # todo: see polling vs events
+# # Detect incoming messages
+# for c in [self._strm_out, self._strm_err, self._strm_raw,
+# self._strm_echo, self._strm_prompt, self._strm_broker,
+# self._strm_action,
+# self._stat_interpreter, self._stat_debug]:
+# c.received.bind(self.poll)
+
+
+ def _onReceivedStartupInfo(self, channel):
+ startup_info = channel.recv()
+
+ # Store the whole dict
+ self._startup_info = startup_info
+
+ # Store when we received this
+ self._start_time = time.time()
+
+ # Set version
+ version = startup_info.get('version', None)
+ if isinstance(version, tuple):
+ version = [str(v) for v in version]
+ self._version = '.'.join(version[:2])
+
+ # Set keywords
+ L = startup_info.get('keywords', None)
+ if isinstance(L, list):
+ self._keywords = L
+
+ # Set builtins
+ L = startup_info.get('builtins', None)
+ if isinstance(L, list):
+ self._builtins = L
+
+ # Notify
+ self.stateChanged.emit(self)
+
+
+ ## Introspection processing methods
+
+
+ def processCallTip(self, cto):
+ """ Processes a calltip request using a CallTipObject instance.
+ """
+
+ # Try using buffer first (not if we're not the requester)
+ if self is cto.textCtrl:
+ if cto.tryUsingBuffer():
+ return
+
+ # Clear buffer to prevent doing a second request
+ # and store cto to see whether the response is still wanted.
+ cto.setBuffer('')
+ self._currentCTO = cto
+
+ # Post request
+ future = self._request.signature(cto.name)
+ future.add_done_callback(self._processCallTip_response)
+ future.cto = cto
+
+
+ def _processCallTip_response(self, future):
+ """ Process response of shell to show signature.
+ """
+
+ # Process future
+ if future.cancelled():
+ #print('Introspect cancelled') # No kernel
+ return
+ elif future.exception():
+ print('Introspect-exception: ', future.exception())
+ return
+ else:
+ response = future.result()
+ cto = future.cto
+
+ # First see if this is still the right editor (can also be a shell)
+ editor1 = iep.editors.getCurrentEditor()
+ editor2 = iep.shells.getCurrentShell()
+ if cto.textCtrl not in [editor1, editor2]:
+ # The editor or shell starting the autocomp is no longer active
+ aco.textCtrl.autocompleteCancel()
+ return
+
+ # Invalid response
+ if response is None:
+ cto.textCtrl.autocompleteCancel()
+ return
+
+ # If still required, show tip, otherwise only store result
+ if cto is self._currentCTO:
+ cto.finish(response)
+ else:
+ cto.setBuffer(response)
+
+
+ def processAutoComp(self, aco):
+ """ Processes an autocomp request using an AutoCompObject instance.
+ """
+
+ # Try using buffer first (not if we're not the requester)
+ if self is aco.textCtrl:
+ if aco.tryUsingBuffer():
+ return
+
+ # Include builtins and keywords?
+ if not aco.name:
+ aco.addNames(self._builtins)
+ if iep.config.settings.autoComplete_keywords:
+ aco.addNames(self._keywords)
+
+ # Set buffer to prevent doing a second request
+ # and store aco to see whether the response is still wanted.
+ aco.setBuffer()
+ self._currentACO = aco
+
+ # Post request
+ future = self._request.dir(aco.name)
+ future.add_done_callback(self._processAutoComp_response)
+ future.aco = aco
+
+
+ def _processAutoComp_response(self, future):
+ """ Process the response of the shell for the auto completion.
+ """
+
+ # Process future
+ if future.cancelled():
+ #print('Introspect cancelled') # No living kernel
+ return
+ elif future.exception():
+ print('Introspect-exception: ', future.exception())
+ return
+ else:
+ response = future.result()
+ aco = future.aco
+
+ # First see if this is still the right editor (can also be a shell)
+ editor1 = iep.editors.getCurrentEditor()
+ editor2 = iep.shells.getCurrentShell()
+ if aco.textCtrl not in [editor1, editor2]:
+ # The editor or shell starting the autocomp is no longer active
+ aco.textCtrl.autocompleteCancel()
+ return
+
+ # Add result to the list
+ foundNames = []
+ if response is not None:
+ foundNames = response
+ aco.addNames(foundNames)
+
+ # Process list
+ if aco.name and not foundNames:
+ # No names found for the requested name. This means
+ # it does not exist, let's try to import it
+ importNames, importLines = iep.parser.getFictiveImports(editor1)
+ baseName = aco.nameInImportNames(importNames)
+ if baseName:
+ line = importLines[baseName].strip()
+ if line not in self._importAttempts:
+ # Do import
+ self.processLine(line + ' # auto-import')
+ self._importAttempts.append(line)
+ # Wait a barely noticable time to increase the chances
+ # That the import is complete when we repost the request.
+ time.sleep(0.2)
+ # To be sure, decrease the experiration date on the buffer
+ aco.setBuffer(timeout=1)
+ # Repost request
+ future = self._request.signature(aco.name)
+ future.add_done_callback(self._processAutoComp_response)
+ future.aco = aco
+ else:
+ # If still required, show list, otherwise only store result
+ if self._currentACO is aco:
+ aco.finish()
+ else:
+ aco.setBuffer()
+
+
+ ## Methods for executing code
+
+
+ def executeCommand(self, text):
+ """ executeCommand(text)
+ Execute one-line command in the remote Python session.
+ """
+
+ # Ensure edit line is selected (to reset scrolling to end)
+ self.ensureCursorAtEditLine()
+
+ self._ctrl_command.send(text)
+
+
+ def executeCode(self, text, fname, lineno=0, cellName=None):
+ """ executeCode(text, fname, lineno, cellName=None)
+ Execute (run) a large piece of code in the remote shell.
+ text: the source code to execute
+ filename: the file from which the source comes
+ lineno: the first lineno of the text in the file, where 0 would be
+ the first line of the file...
+
+ The text (source code) is first pre-processed:
+ - convert all line-endings to \n
+ - remove all empty lines at the end
+ - remove commented lines at the end
+ - convert tabs to spaces
+ - dedent so minimal indentation is zero
+ """
+
+ # Convert tabs to spaces
+ text = text.replace("\t"," "*4)
+
+ # Make sure there is always *some* text
+ if not text:
+ text = ' '
+
+ # Examine the text line by line...
+ # - check for empty/commented lined at the end
+ # - calculate minimal indentation
+ lines = text.splitlines()
+ lastLineOfCode = 0
+ minIndent = 99
+ for linenr in range(len(lines)):
+ # Get line
+ line = lines[linenr]
+ # Check if empty (can be commented, but nothing more)
+ tmp = line.split("#",1)[0] # get part before first #
+ if tmp.count(" ") == len(tmp):
+ continue # empty line, proceed
+ else:
+ lastLineOfCode = linenr
+ # Calculate indentation
+ tmp = line.lstrip(" ")
+ indent = len(line) - len(tmp)
+ if indent < minIndent:
+ minIndent = indent
+
+ # Copy all proper lines to a new list,
+ # remove minimal indentation, but only if we then would only remove
+ # spaces (in the case of commented lines)
+ lines2 = []
+ for linenr in range(lastLineOfCode+1):
+ line = lines[linenr]
+ # Remove indentation,
+ if line[:minIndent].count(" ") == minIndent:
+ line = line[minIndent:]
+ else:
+ line = line.lstrip(" ")
+ lines2.append( line )
+
+
+ # Ensure edit line is selected (to reset scrolling to end)
+ self.ensureCursorAtEditLine()
+
+
+ # Send message
+ text = "\n".join(lines2)
+ msg = {'source':text, 'fname':fname, 'lineno':lineno, 'cellName': cellName}
+ self._ctrl_code.send(msg)
+
+
+ def sendBreakPoints(self, breaks):
+ """ Send all breakpoints.
+ """
+ # breaks is a dict of filenames to integers
+ self._stat_breakpoints.send(breaks)
+
+
+ ## The polling methods and terminating methods
+
+ def poll(self, channel=None):
+ """ poll()
+ To keep the shell up-to-date.
+ Call this periodically.
+ """
+
+ if self._write_buffer:
+ # There is still data in the buffer
+ sub, M = self._write_buffer
+ else:
+ # Check what subchannel has the latest message pending
+ sub = yoton.select_sub_channel(self._strm_out, self._strm_err,
+ self._strm_echo, self._strm_raw,
+ self._strm_broker, self._strm_prompt )
+ # Read messages from it
+ if sub:
+ M = sub.recv_selected()
+ #M = [sub.recv()] # Slow version (for testing)
+ # Optimization: handle backspaces on stack of messages
+ if sub is self._strm_out:
+ M = self._handleBackspacesOnList(M)
+ # New prompt?
+ if sub is self._strm_prompt:
+ self.stateChanged.emit(self)
+
+ # Write all pending messages that are later than any other message
+ if sub:
+ # Select messages to process
+ N = 256
+ M, buffer = M[:N], M[N:]
+ # Buffer the rest
+ if buffer:
+ self._write_buffer = sub, buffer
+ else:
+ self._write_buffer = None
+ # Get how to deal with prompt
+ prompt = 0
+ if sub is self._strm_echo:
+ prompt = 1
+ elif sub is self._strm_prompt:
+ prompt = 2
+ # Get color
+ color = None
+ if sub is self._strm_broker:
+ color = '#000'
+ elif sub is self._strm_raw:
+ color = '#888888' # Halfway
+ elif sub is self._strm_err:
+ color = '#F00'
+ # Write
+ self.write(''.join(M), prompt, color)
+
+
+ # Do any actions?
+ action = self._strm_action.recv(False)
+ if action:
+ if action.startswith('open '):
+ parts = action.split(' ')
+ parts.pop(0)
+ try:
+ linenr = int(parts[0])
+ parts.pop(0)
+ except ValueError:
+ linenr = None
+ fname = ' '.join(parts)
+ editor = iep.editors.loadFile(fname)
+ if editor and linenr:
+ editor._editor.gotoLine(linenr)
+ else:
+ print('Unkown action: %s' % action)
+
+ # ----- status
+
+ # Do not update status when the kernel is not really up and running
+ # self._version is set when the startup info is received
+ if not self._version:
+ return
+
+ # Update status
+ state = self._stat_interpreter.recv()
+ if state != self._state:
+ self._state = state
+ self.stateChanged.emit(self)
+
+ # Update debug status
+ state = self._stat_debug.recv()
+ if state != self._debugState:
+ self._debugState = state
+ self.debugStateChanged.emit(self)
+
+
+ def interrupt(self):
+ """ interrupt()
+ Send a Keyboard interrupt signal to the main thread of the
+ remote process.
+ """
+ # Ensure edit line is selected (to reset scrolling to end)
+ self.ensureCursorAtEditLine()
+
+ self._ctrl_broker.send('INT')
+
+
+ def restart(self, scriptFile=None):
+ """ restart(scriptFile=None)
+ Terminate the shell, after which it is restarted.
+ Args can be a filename, to execute as a script as soon as the
+ shell is back up.
+ """
+
+ # Ensure edit line is selected (to reset scrolling to end)
+ self.ensureCursorAtEditLine()
+
+ # Get info
+ info = finishKernelInfo(self._info, scriptFile)
+
+ # Create message and send
+ msg = 'RESTART\n' + ssdf.saves(info)
+ self._ctrl_broker.send(msg)
+
+ # Reset
+ self.resetVariables()
+
+
+ def terminate(self):
+ """ terminate()
+ Terminates the python process. It will first try gently, but
+ if that does not work, the process shall be killed.
+ To be notified of the termination, connect to the "terminated"
+ signal of the shell.
+ """
+ # Ensure edit line is selected (to reset scrolling to end)
+ self.ensureCursorAtEditLine()
+
+
+ self._ctrl_broker.send('TERM')
+
+
+ def closeShell(self): # do not call it close(); that is a reserved method.
+ """ closeShell()
+
+ Very simple. This closes the shell. If possible, we will first
+ tell the broker to terminate the kernel.
+
+ The broker will be cleaned up if there are no clients connected
+ and if there is no active kernel. In a multi-user environment,
+ we should thus be able to close the shell without killing the
+ kernel. But in a closed 1-to-1 environment we really want to
+ prevent loose brokers and kernels dangling around.
+
+ In both cases however, it is the responsibility of the broker to
+ terminate the kernel, and the shell will simply assume that this
+ will work :)
+
+ """
+
+ # If we can, try to tell the broker to terminate the kernel
+ if self._context and self._context.connection_count:
+ self.terminate()
+ self._context.flush() # Important, make sure the message is send!
+ self._context.close()
+
+ # Adios
+ iep.shells.removeShell(self)
+
+
+ def _onConnectionClose(self, c, why):
+ """ To be called after disconnecting.
+ In general, the broker will not close the connection, so it can
+ be considered an error-state if this function is called.
+ """
+
+ # Stop context
+ if self._context:
+ self._context.close()
+
+ # New (empty prompt)
+ self._cursor1.movePosition(self._cursor1.End, A_MOVE)
+ self._cursor2.movePosition(self._cursor2.End, A_MOVE)
+
+ self.write('\n\n');
+ self.write('Lost connection with broker:\n')
+ self.write(why)
+ self.write('\n\n')
+
+ # Set style to indicate dead-ness
+ self.setReadOnly(True)
+
+ # Goto end such that the closing message is visible
+ cursor = self.textCursor()
+ cursor.movePosition(cursor.End, A_MOVE)
+ self.setTextCursor(cursor)
+ self.ensureCursorVisible()
+
+
diff --git a/iep/iepcore/shellInfoDialog.py b/iep/iepcore/shellInfoDialog.py
new file mode 100644
index 0000000..56d839f
--- /dev/null
+++ b/iep/iepcore/shellInfoDialog.py
@@ -0,0 +1,711 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+""" Module shellInfoDialog
+
+Implements shell configuration dialog.
+
+"""
+
+import os, sys, time, re
+from pyzolib.qt import QtCore, QtGui
+
+import iep
+from iep.iepcore.compactTabWidget import CompactTabWidget
+from iep.iepcore.iepLogging import print
+from iep.iepcore.kernelbroker import KernelInfo
+from iep import translate
+
+
+## Implement widgets that have a common interface
+
+
+class ShellInfoLineEdit(QtGui.QLineEdit):
+
+ def setTheText(self, value):
+ self.setText(value)
+
+ def getTheText(self):
+ return self.text()
+
+
+
+class ShellInfo_name(ShellInfoLineEdit):
+
+ def __init__(self, *args, **kwargs):
+ ShellInfoLineEdit.__init__(self, *args, **kwargs)
+ self.editingFinished.connect(self.onValueChanged)
+ t = translate('shell', 'name ::: The name of this configuration.')
+ self.setPlaceholderText(t.tt)
+
+
+ def setTheText(self, value):
+ ShellInfoLineEdit.setTheText(self, value)
+ self.onValueChanged()
+
+
+ def onValueChanged(self):
+ self.parent().parent().parent().setTabTitle(self.getTheText())
+
+
+
+class ShellInfo_exe(QtGui.QComboBox):
+
+ def __init__(self, *args):
+ QtGui.QComboBox.__init__(self, *args)
+ # Uncomment this to also select the matching GUI toolkit if [default]
+ # is selected. Note that adding a new config will always init with
+ # the matching GUI toolkit.
+ #self.activated.connect(self.onActivated)
+
+ def _interpreterName(self, p):
+ if p.is_pyzo:
+ return '%s [v%s at Pyzo]' % (p.path, p.version)
+ else:
+ return '%s [v%s]' % (p.path, p.version)
+
+ def setTheText(self, value):
+
+ # Init
+ self.clear()
+ self.setEditable(True)
+ self.setInsertPolicy(self.InsertAtTop)
+
+ # Get known interpreters from shellDialog (which are sorted by version)
+ shellDialog = self
+ while not isinstance(shellDialog, ShellInfoDialog):
+ shellDialog = shellDialog.parent()
+ interpreters = shellDialog.interpreters
+ exes = [p.path for p in interpreters]
+
+ # Get name for default interpreter
+ # note: the filled in name will not be correct if working remotely
+ defaultName = '%s [default]' % iep.defaultInterpreterExe()
+
+ # Hande current value
+ if value == '[default]':
+ value = defaultName
+ elif value in exes:
+ value = self._interpreterName( interpreters[exes.index(value)] )
+ else:
+ self.addItem(value)
+
+ # Add default value
+ self.addItem(defaultName)
+
+ # Add all found interpreters
+ for p in interpreters:
+ self.addItem(self._interpreterName(p))
+
+ # Set current text
+ self.setEditText(value)
+
+
+ def getTheText(self):
+ #return self.currentText().split('(')[0].rstrip()
+ value = self.currentText()
+ if value.endswith('[default]'):
+ value = '[default]'
+ elif value.endswith(']') and '[' in value:
+ value = value.rsplit('[', 1)[0]
+ return value.strip()
+
+
+ def onActivated(self, index=None):
+ # Select GUI corresponding to default interpreter if it was selected.
+ defaultGui = iep.defaultInterpreterGui()
+ if defaultGui and self.currentText().startswith('[default]'):
+ guicombobox = self.parent()._shellInfoWidgets['gui']
+ guicombobox.setTheText(defaultGui)
+
+
+class ShellInfo_ipython(QtGui.QCheckBox):
+
+ def __init__(self, parent):
+ QtGui.QCheckBox.__init__(self, parent)
+ t = translate('shell', 'ipython ::: Use IPython shell if available.')
+ self.setText(t.tt)
+ # Default is True
+ self.setChecked(True)
+
+ def setTheText(self, value):
+ if value.lower() in ['no', 'false']:
+ self.setChecked(False)
+ else:
+ self.setChecked(True) # Also for empty string; default is True
+
+ def getTheText(self):
+ if self.isChecked():
+ return 'yes'
+ else:
+ return 'no'
+
+
+class ShellInfo_gui(QtGui.QComboBox):
+
+ # For (backward) compatibility
+ COMPAT = {'QT4':'PYQT4'}
+
+ # GUI names
+ GUIS = [ ('None', 'no GUI support'),
+ ('PySide', 'LGPL licensed wrapper to Qt (recommended)'),
+ ('PyQt4', 'GPL/commercial licensed wrapper to Qt (recommended)'),
+ ('Tk', 'Tk widget toolkit'),
+ ('WX', 'wxPython'),
+ ('FLTK', 'The fast light toolkit'),
+ ('GTK', 'GIMP Toolkit'),
+ ]
+
+ # GUI descriptions
+
+ def setTheText(self, value):
+
+ # Process value
+ value = value.upper()
+ value = self.COMPAT.get(value, value)
+
+ # Set options
+ ii = 0
+ self.clear()
+ for i in range(len(self.GUIS)):
+ gui, des = self.GUIS[i]
+ if value == gui.upper():
+ ii = i
+ self.addItem('%s - %s' % (gui, des))
+
+ # Set current text
+ self.setCurrentIndex(ii)
+
+
+ def getTheText(self):
+ text = self.currentText().lower()
+ return text.partition('-')[0].strip()
+
+
+
+class ShellinfoWithSystemDefault(QtGui.QVBoxLayout):
+
+ DISABLE_SYSTEM_DEFAULT = sys.platform == 'darwin'
+ SYSTEM_VALUE = ''
+
+ def __init__(self, parent, widget):
+ # Do not pass parent, because is a sublayout
+ QtGui.QVBoxLayout.__init__(self)
+
+ # Layout
+ self.setSpacing(1)
+ self.addWidget(widget)
+
+ # Create checkbox widget
+ if not self.DISABLE_SYSTEM_DEFAULT:
+ t = translate('shell', 'Use system default')
+ self._check = QtGui.QCheckBox(t, parent)
+ self._check.stateChanged.connect(self.onCheckChanged)
+ self.addWidget(self._check)
+
+ # The actual value of this shell config attribute
+ self._value = ''
+
+ # A buffered version, so that clicking the text box does not
+ # remove the value at once
+ self._bufferedValue = ''
+
+
+ def onEditChanged(self):
+ if self.DISABLE_SYSTEM_DEFAULT or not self._check.isChecked():
+ self._value = self.getWidgetText()
+
+
+ def onCheckChanged(self, state):
+ if state:
+ self._bufferedValue = self._value
+ self.setTheText(self.SYSTEM_VALUE)
+ else:
+ self.setTheText(self._bufferedValue)
+
+
+ def setTheText(self, value):
+
+ if self.DISABLE_SYSTEM_DEFAULT:
+ # Just set the value
+ self._edit.setReadOnly(False)
+ self.setWidgetText(value)
+
+ elif value != self.SYSTEM_VALUE:
+ # Value given, enable edit
+ self._check.setChecked(False)
+ self._edit.setReadOnly(False)
+ # Set the text
+ self.setWidgetText(value)
+
+ else:
+ # Use system default, disable edit widget
+ self._check.setChecked(True)
+ self._edit.setReadOnly(True)
+ # Set text using system environment
+ self.setWidgetText(None)
+
+ # Store value
+ self._value = value
+
+
+ def getTheText(self):
+ return self._value
+
+
+
+class ShellInfo_pythonPath(ShellinfoWithSystemDefault):
+
+ SYSTEM_VALUE = '$PYTHONPATH'
+
+ def __init__(self, parent):
+
+ # Create sub-widget
+ self._edit = QtGui.QTextEdit(parent)
+ self._edit.zoomOut(1)
+ self._edit.setMaximumHeight(80)
+ self._edit.setMinimumWidth(200)
+ self._edit.textChanged.connect(self.onEditChanged)
+
+ # Instantiate
+ ShellinfoWithSystemDefault.__init__(self, parent, self._edit)
+
+
+ def getWidgetText(self):
+ return self._edit.toPlainText()
+
+
+ def setWidgetText(self, value=None):
+ if value is None:
+ pp = os.environ.get('PYTHONPATH','')
+ pp = pp.replace(os.pathsep, '\n').strip()
+ value = '$PYTHONPATH:\n%s\n' % pp
+ self._edit.setText(value)
+
+
+
+# class ShellInfo_startupScript(ShellinfoWithSystemDefault):
+#
+# SYSTEM_VALUE = '$PYTHONSTARTUP'
+#
+# def __init__(self, parent):
+#
+# # Create sub-widget
+# self._edit = QtGui.QLineEdit(parent)
+# self._edit.textEdited.connect(self.onEditChanged)
+#
+# # Instantiate
+# ShellinfoWithSystemDefault.__init__(self, parent, self._edit)
+#
+#
+# def getWidgetText(self):
+# return self._edit.text()
+#
+#
+# def setWidgetText(self, value=None):
+# if value is None:
+# pp = os.environ.get('PYTHONSTARTUP','').strip()
+# if pp:
+# value = '$PYTHONSTARTUP: "%s"' % pp
+# else:
+# value = '$PYTHONSTARTUP: None'
+#
+# self._edit.setText(value)
+
+
+
+class ShellInfo_startupScript(QtGui.QVBoxLayout):
+
+ DISABLE_SYSTEM_DEFAULT = sys.platform == 'darwin'
+ SYSTEM_VALUE = '$PYTHONSTARTUP'
+ RUN_AFTER_GUI_TEXT = '# AFTER_GUI - remove to run the code BEFORE integrating the GUI\n'
+
+ def __init__(self, parent):
+ # Do not pass parent, because is a sublayout
+ QtGui.QVBoxLayout.__init__(self)
+
+ # Create sub-widget
+ self._edit1 = QtGui.QLineEdit(parent)
+ self._edit1.textEdited.connect(self.onEditChanged)
+ if sys.platform.startswith('win'):
+ self._edit1.setPlaceholderText('C:\\path\\to\\script.py')
+ else:
+ self._edit1.setPlaceholderText('/path/to/script.py')
+ #
+ self._edit2 = QtGui.QTextEdit(parent)
+ self._edit2.zoomOut(1)
+ self._edit2.setMaximumHeight(80)
+ self._edit2.setMinimumWidth(200)
+ self._edit2.textChanged.connect(self.onEditChanged)
+
+ # Layout
+ self.setSpacing(1)
+ self.addWidget(self._edit1)
+ self.addWidget(self._edit2)
+
+ # Create radio widget for system default
+ t = translate('shell', 'Use system default')
+ self._radio_system = QtGui.QRadioButton(t, parent)
+ self._radio_system.toggled.connect(self.onCheckChanged)
+ self.addWidget(self._radio_system)
+ if self.DISABLE_SYSTEM_DEFAULT:
+ self._radio_system.hide()
+
+ # Create radio widget for file
+ t = translate('shell', 'File to run at startup')
+ self._radio_file = QtGui.QRadioButton(t, parent)
+ self._radio_file.toggled.connect(self.onCheckChanged)
+ self.addWidget(self._radio_file)
+
+ # Create radio widget for code
+ t = translate('shell', 'Code to run at startup')
+ self._radio_code = QtGui.QRadioButton(t, parent)
+ self._radio_code.toggled.connect(self.onCheckChanged)
+ self.addWidget(self._radio_code)
+
+ # The actual value of this shell config attribute
+ self._value = ''
+
+ # A buffered version, so that clicking the text box does not
+ # remove the value at once
+ self._valueFile = ''
+ self._valueCode = '\n'
+
+
+ def onEditChanged(self):
+ if self._radio_file.isChecked():
+ self._value = self._valueFile = self._edit1.text().strip()
+ elif self._radio_code.isChecked():
+ # ensure newline!
+ self._value = self._valueCode = self._edit2.toPlainText().strip() + '\n'
+
+
+ def onCheckChanged(self, state):
+ if self._radio_system.isChecked():
+ self.setWidgetText(self.SYSTEM_VALUE)
+ elif self._radio_file.isChecked():
+ self.setWidgetText(self._valueFile)
+ elif self._radio_code.isChecked():
+ self.setWidgetText(self._valueCode)
+
+
+ def setTheText(self, value):
+ self.setWidgetText(value, True)
+ self._value = value
+
+
+ def setWidgetText(self, value, init=False):
+ self._value = value
+
+ if value == self.SYSTEM_VALUE and not self.DISABLE_SYSTEM_DEFAULT:
+ # System default
+ if init:
+ self._radio_system.setChecked(True)
+ pp = os.environ.get('PYTHONSTARTUP','').strip()
+ if pp:
+ value = '$PYTHONSTARTUP: "%s"' % pp
+ else:
+ value = '$PYTHONSTARTUP: None'
+ #
+ self._edit1.setReadOnly(True)
+ self._edit1.show()
+ self._edit2.hide()
+ self._edit1.setText(value)
+
+ elif not '\n' in value:
+ # File
+ if init:
+ self._radio_file.setChecked(True)
+ self._edit1.setReadOnly(False)
+ self._edit1.show()
+ self._edit2.hide()
+ self._edit1.setText(value)
+
+
+ else:
+ # Code
+ if init:
+ self._radio_code.setChecked(True)
+ self._edit1.hide()
+ self._edit2.show()
+ if not value.strip():
+ value = self.RUN_AFTER_GUI_TEXT
+ self._edit2.setText(value)
+
+
+ def getTheText(self):
+ return self._value
+
+
+
+class ShellInfo_startDir(ShellInfoLineEdit):
+ def __init__(self, parent):
+ ShellInfoLineEdit.__init__(self, parent)
+ if sys.platform.startswith('win'):
+ self.setPlaceholderText('C:\\path\\to\\your\\python\\modules')
+ else:
+ self.setPlaceholderText('/path/to/your/python/modules')
+
+
+
+class ShellInfo_argv(ShellInfoLineEdit):
+ def __init__(self, parent):
+ ShellInfoLineEdit.__init__(self, parent)
+ self.setPlaceholderText('arg1 arg2 "arg with spaces"')
+
+
+
+class ShellInfo_environ(QtGui.QTextEdit):
+ EXAMPLE = 'EXAMPLE_VAR1=value1\nIEP_PROCESS_EVENTS_WHILE_DEBUGGING=1'
+
+ def __init__(self, parent):
+ QtGui.QTextEdit.__init__(self, parent)
+ self.zoomOut(1)
+ self.setText(self.EXAMPLE)
+
+ def _cleanText(self, txt):
+ return '\n'.join([line.strip() for line in txt.splitlines()])
+
+ def setTheText(self, value):
+ value = self._cleanText(value)
+ if value:
+ self.setText(value)
+ else:
+ self.setText(self.EXAMPLE)
+
+ def getTheText(self):
+ value = self.toPlainText()
+ value = self._cleanText(value)
+ if value == self.EXAMPLE:
+ return ''
+ else:
+ return value
+
+
+
+## The dialog class and container with tabs
+
+
+class ShellInfoTab(QtGui.QScrollArea):
+
+ INFO_KEYS = [ translate('shell', 'name ::: The name of this configuration.'),
+ translate('shell', 'exe ::: The Python executable.'),
+ translate('shell', 'ipython ::: Use IPython shell if available.'),
+ translate('shell', 'gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).'),
+ translate('shell', 'pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.'),
+ translate('shell', 'startupScript ::: The script to run at startup (not in script mode).'),
+ translate('shell', 'startDir ::: The start directory (not in script mode).'),
+ translate('shell', 'argv ::: The command line arguments (sys.argv).'),
+ translate('shell', 'environ ::: Extra environment variables (os.environ).'),
+ ]
+
+ def __init__(self, parent):
+ QtGui.QScrollArea.__init__(self, parent)
+
+ # Init the scroll area
+ self.setHorizontalScrollBarPolicy(QtCore.Qt.ScrollBarAlwaysOff)
+ self.setVerticalScrollBarPolicy(QtCore.Qt.ScrollBarAsNeeded)
+ self.setWidgetResizable(True)
+ self.setFrameShape(QtGui.QFrame.NoFrame);
+
+ # Create widget and a layout
+ self._content = QtGui.QWidget(parent)
+ self._formLayout = QtGui.QFormLayout(self._content)
+
+ # Collect classes of widgets to instantiate
+ classes = []
+ for t in self.INFO_KEYS:
+ className = 'ShellInfo_' + t.key
+ cls = globals()[className]
+ classes.append((t, cls))
+
+ # Instantiate all classes
+ self._shellInfoWidgets = {}
+ for t, cls in classes:
+ # Instantiate and store
+ instance = cls(self._content)
+ self._shellInfoWidgets[t.key] = instance
+ # Create label
+ label = QtGui.QLabel(t, self._content)
+ label.setToolTip(t.tt)
+ # Add to layout
+ self._formLayout.addRow(label, instance)
+
+ # Add delete button
+
+ t = translate('shell', 'Delete ::: Delete this shell configuration')
+ label = QtGui.QLabel('', self._content)
+ instance = QtGui.QPushButton(iep.icons.cancel, t, self._content)
+ instance.setToolTip(t.tt)
+ instance.setAutoDefault(False)
+ instance.clicked.connect(self.parent().parent().onTabClose)
+ deleteLayout = QtGui.QHBoxLayout()
+ deleteLayout.addWidget(instance, 0)
+ deleteLayout.addStretch(1)
+ # Add to layout
+ self._formLayout.addRow(label, deleteLayout)
+
+ # Apply layout
+ self._formLayout.setSpacing(15)
+ self._content.setLayout(self._formLayout)
+ self.setWidget(self._content)
+
+
+ def setTabTitle(self, name):
+ tabWidget = self.parent().parent()
+ tabWidget.setTabText(tabWidget.indexOf(self), name)
+
+
+ def setInfo(self, info=None):
+ """ Set the shell info struct, and use it to update the widgets.
+ Not via init, because this function also sets the tab name.
+ """
+
+ # If info not given, use default as specified by the KernelInfo struct
+ if info is None:
+ info = KernelInfo()
+ # Name
+ n = self.parent().parent().count()
+ if n > 1:
+ info.name = "Shell config %i" % n
+
+ # Store info
+ self._info = info
+
+ # Set widget values according to info
+ try:
+ for key in info:
+ widget = self._shellInfoWidgets.get(key, None)
+ if widget is not None:
+ widget.setTheText(info[key])
+
+ except Exception as why:
+ print("Error setting info in shell config:", why)
+ print(info)
+
+
+ def getInfo(self):
+
+ info = self._info
+
+ # Set struct values according to widgets
+ try:
+ for key, widget in self._shellInfoWidgets.items():
+ info[key] = widget.getTheText()
+
+ except Exception as why:
+ print("Error getting info in shell config:", why)
+ print(info)
+
+ # Return the original (but modified) ssdf struct object
+ return info
+
+
+
+class ShellInfoDialog(QtGui.QDialog):
+ """ Dialog to edit the shell configurations. """
+
+ def __init__(self, *args):
+ QtGui.QDialog.__init__(self, *args)
+ self.setModal(True)
+
+ # Set title
+ self.setWindowTitle(iep.translate('shell', 'Shell configurations'))
+ # Create tab widget
+ self._tabs = QtGui.QTabWidget(self)
+ #self._tabs = CompactTabWidget(self, padding=(4,4,5,5))
+ #self._tabs.setDocumentMode(False)
+ self._tabs.setMovable(True)
+
+ # Get known interpreters (sorted them by version)
+ # Do this here so we only need to do it once ...
+ from pyzolib.interpreters import get_interpreters
+ self.interpreters = list(reversed(get_interpreters('2.4')))
+
+ # Introduce an entry if there's none
+ if not iep.config.shellConfigs2:
+ w = ShellInfoTab(self._tabs)
+ self._tabs.addTab(w, '---')
+ w.setInfo()
+
+ # Fill tabs
+ for item in iep.config.shellConfigs2:
+ w = ShellInfoTab(self._tabs)
+ self._tabs.addTab(w, '---')
+ w.setInfo(item)
+
+ # Enable making new tabs and closing tabs
+ self._add = QtGui.QToolButton(self)
+ self._tabs.setCornerWidget(self._add)
+ self._add.clicked.connect(self.onAdd)
+ self._add.setToolButtonStyle(QtCore.Qt.ToolButtonTextBesideIcon)
+ self._add.setIcon(iep.icons.add)
+ self._add.setText(translate('shell', 'Add config'))
+ #
+ #self._tabs.setTabsClosable(True)
+ self._tabs.tabCloseRequested.connect(self.onTabClose)
+
+ # Create buttons
+ cancelBut = QtGui.QPushButton("Cancel", self)
+ okBut = QtGui.QPushButton("Done", self)
+ cancelBut.clicked.connect(self.close)
+ okBut.clicked.connect(self.applyAndClose)
+ # Layout for buttons
+ buttonLayout = QtGui.QHBoxLayout()
+ buttonLayout.addStretch(1)
+ buttonLayout.addWidget(cancelBut)
+ buttonLayout.addSpacing(10)
+ buttonLayout.addWidget(okBut)
+
+ # Layout the widgets
+ mainLayout = QtGui.QVBoxLayout(self)
+ mainLayout.addSpacing(8)
+ mainLayout.addWidget(self._tabs,0)
+ mainLayout.addLayout(buttonLayout,0)
+ self.setLayout(mainLayout)
+
+ # Prevent resizing
+ self.show()
+ self.setMinimumSize(500, 400)
+ self.resize(640, 500)
+ #self.setMaximumHeight(500)
+
+
+
+ def onAdd(self):
+ # Create widget and add to tabs
+ w = ShellInfoTab(self._tabs)
+ self._tabs.addTab(w, '---')
+ w.setInfo()
+ # Select
+ self._tabs.setCurrentWidget(w)
+ w.setFocus()
+
+
+ def onTabClose(self):
+ index = self._tabs.currentIndex()
+ self._tabs.removeTab( index )
+
+
+ def applyAndClose(self, event=None):
+ self.apply()
+ self.close()
+
+
+ def apply(self):
+ """ Apply changes for all tabs. """
+
+ # Clear
+ iep.config.shellConfigs2 = []
+
+ # Set new versions. Note that although we recreate the list,
+ # the list is filled with the orignal structs, so having a
+ # reference to such a struct (as the shell has) will enable
+ # you to keep track of any made changes.
+ for i in range(self._tabs.count()):
+ w = self._tabs.widget(i)
+ iep.config.shellConfigs2.append( w.getInfo() )
diff --git a/iep/iepcore/shellStack.py b/iep/iepcore/shellStack.py
new file mode 100644
index 0000000..581f6f2
--- /dev/null
+++ b/iep/iepcore/shellStack.py
@@ -0,0 +1,599 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+""" Module shellStack
+
+Implements the stack of shells. Also implements the nifty debug button
+and a dialog to edit the shell configurations.
+
+"""
+
+import os, sys, time, re
+from pyzolib.qt import QtCore, QtGui
+
+import iep
+from iep import translate
+from iep.iepcore.compactTabWidget import CompactTabWidget
+from iep.iepcore.shell import PythonShell
+from iep.iepcore.iepLogging import print
+from iep.iepcore.menu import ShellTabContextMenu, ShellButtonMenu
+from iep.iepcore.icons import ShellIconMaker
+
+
+def shellTitle(shell, moreinfo=False):
+ """ Given a shell instance, build the text title to represent it.
+ """
+
+ # Get name
+ nameText = shell._info.name
+
+ # Build version text
+ if shell._version:
+ versionText = 'v{}'.format(shell._version)
+ else:
+ versionText = 'v?'
+
+ # Build gui text
+ guiText = shell._startup_info.get('gui')
+ guiText = guiText or ''
+ if guiText.lower() in ['none', '']:
+ guiText = 'without gui'
+ else:
+ guiText = 'with ' + guiText
+
+ # Build state text
+ stateText = shell._state or ''
+
+ # Build text for elapsed time
+ elapsed = time.time() - shell._start_time
+ hh = elapsed//3600
+ mm = (elapsed - hh*3600)//60
+ ss = elapsed - hh*3600 - mm*60
+ runtimeText = 'runtime: %i:%02i:%02i' % (hh, mm, ss)
+
+ # Build text
+ if not moreinfo:
+ text = nameText
+ else:
+ text = "'%s' (%s %s) - %s, %s" % (nameText, versionText, guiText, stateText, runtimeText)
+
+ # Done
+ return text
+
+
+class ShellStackWidget(QtGui.QWidget):
+ """ The shell stack widget provides a stack of shells.
+
+ It wrapps a QStackedWidget that contains the shell objects. This
+ stack is used as a reference to synchronize the shell selection with.
+ We keep track of what is the current selected shell and apply updates
+ if necessary. Therefore, changing the current shell in the stack
+ should be enough to invoke a full update.
+
+ """
+
+ # When the current shell changes.
+ currentShellChanged = QtCore.Signal()
+
+ # When the current shells state (or debug state) changes,
+ # or when a new prompt is received.
+ # Also fired when the current shell changes.
+ currentShellStateChanged = QtCore.Signal()
+
+ def __init__(self, parent):
+ QtGui.QWidget.__init__(self, parent)
+
+ # create toolbar
+ self._toolbar = QtGui.QToolBar(self)
+ self._toolbar.setMaximumHeight(25)
+ self._toolbar.setIconSize(QtCore.QSize(16,16))
+
+ # create stack
+ self._stack = QtGui.QStackedWidget(self)
+
+ # Populate toolbar
+ self._shellButton = ShellControl(self._toolbar, self._stack)
+ self._debugmode = 0
+ self._dbs = DebugStack(self._toolbar)
+ #
+ self._toolbar.addWidget(self._shellButton)
+ self._toolbar.addSeparator()
+ # self._toolbar.addWidget(self._dbc) -> delayed, see addContextMenu()
+
+ # widget layout
+ layout = QtGui.QVBoxLayout()
+ layout.setSpacing(0)
+ layout.setContentsMargins(0, 0, 0, 0)
+ layout.addWidget(self._toolbar)
+ layout.addWidget(self._stack)
+ self.setLayout(layout)
+
+ # make callbacks
+ self._stack.currentChanged.connect(self.onCurrentChanged)
+
+
+ def __iter__(self):
+ i = 0
+ while i < self._stack.count():
+ w = self._stack.widget(i)
+ i += 1
+ yield w
+
+
+ def addShell(self, shellInfo=None):
+ """ addShell()
+ Add a shell to the widget. """
+
+ # Create shell and add to stack
+ shell = PythonShell(self, shellInfo)
+ index = self._stack.addWidget(shell)
+ # Bind to signals
+ shell.stateChanged.connect(self.onShellStateChange)
+ shell.debugStateChanged.connect(self.onShellDebugStateChange)
+ # Select it and focus on it (invokes onCurrentChanged)
+ self._stack.setCurrentWidget(shell)
+ shell.setFocus()
+
+
+ def removeShell(self, shell):
+ """ removeShell()
+ Remove an existing shell from the widget
+ """
+ self._stack.removeWidget(shell)
+
+
+ def onCurrentChanged(self, index):
+ """ When another shell is selected, update some things.
+ """
+
+ # Get current
+ shell = self.getCurrentShell()
+ # Call functions
+ self.onShellStateChange(shell)
+ self.onShellDebugStateChange(shell)
+ # Emit Signal
+ self.currentShellChanged.emit()
+
+
+ def onShellStateChange(self, shell):
+ """ Called when the shell state changes, and is called
+ by onCurrentChanged. Sets the mainwindow's icon if busy.
+ """
+
+ # Keep shell button and its menu up-to-date
+ self._shellButton.updateShellMenu(shell)
+
+ if shell is self.getCurrentShell(): # can be None
+ # Update application icon
+ if shell and shell._state in ['Busy']:
+ iep.main.setWindowIcon(iep.iconRunning)
+ else:
+ iep.main.setWindowIcon(iep.icon)
+ # Send signal
+ self.currentShellStateChanged.emit()
+
+
+ def onShellDebugStateChange(self, shell):
+ """ Called when the shell debug state changes, and is called
+ by onCurrentChanged. Sets the debug button.
+ """
+
+ if shell is self.getCurrentShell():
+
+ # Update debug info
+ if shell and shell._debugState:
+ info = shell._debugState
+ self._debugmode = info['debugmode']
+ for action in self._debugActions:
+ action.setEnabled(self._debugmode==2)
+ self._debugActions[-1].setEnabled(self._debugmode>0) # Stop
+ self._dbs.setTrace(shell._debugState)
+ else:
+ for action in self._debugActions:
+ action.setEnabled(False)
+ self._debugmode = 0
+ self._dbs.setTrace(None)
+ # Send signal
+ self.currentShellStateChanged.emit()
+
+
+ def getCurrentShell(self):
+ """ getCurrentShell()
+ Get the currently active shell.
+ """
+
+ w = None
+ if self._stack.count():
+ w = self._stack.currentWidget()
+ if not w:
+ return None
+ else:
+ return w
+
+
+ def getShells(self):
+ """ Get all shell in stack as list """
+
+ shells = []
+ for i in range(self._stack.count()):
+ shell = self.getShellAt(i)
+ if shell is not None:
+ shells.append(shell)
+
+ return shells
+
+
+ def getShellAt(self, i):
+ return
+ """ Get shell at current tab index """
+
+ return self._stack.widget(i)
+
+
+ def addContextMenu(self):
+ # A bit awkward... but the ShellMenu needs the ShellStack, so it
+ # can only be initialized *after* the shellstack is created ...
+
+ # Give shell tool button a menu
+ self._shellButton.setMenu(ShellButtonMenu(self, 'Shell button menu'))
+ self._shellButton.menu().aboutToShow.connect(self._shellButton._elapsedTimesTimer.start)
+
+ # Also give it a context menu
+ self._shellButton.setContextMenuPolicy(QtCore.Qt.CustomContextMenu)
+ self._shellButton.customContextMenuRequested.connect(self.contextMenuTriggered)
+
+ # Add actions
+ for action in iep.main.menuBar()._menumap['shell']._shellActions:
+ action = self._toolbar.addAction(action)
+
+ self._toolbar.addSeparator()
+
+ # Add debug actions
+ self._debugActions = []
+ for action in iep.main.menuBar()._menumap['shell']._shellDebugActions:
+ self._debugActions.append(action)
+ action = self._toolbar.addAction(action)
+
+ # Delayed-add debug control buttons
+ self._toolbar.addWidget(self._dbs)
+
+ def contextMenuTriggered(self, p):
+ """ Called when context menu is clicked """
+
+ # Get index of shell belonging to the tab
+ shell = self.getCurrentShell()
+
+ if shell:
+ p = self._shellButton.mapToGlobal(self._shellButton.rect().bottomLeft())
+ ShellTabContextMenu(shell=shell, parent=self).popup(p)
+
+
+ def onShellAction(self, action):
+ shell = self.getCurrentShell()
+ if shell:
+ getattr(shell, action)()
+
+
+
+class ShellControl(QtGui.QToolButton):
+ """ A button that can be used to select a shell and start a new shell.
+ """
+
+ def __init__(self, parent, shellStack):
+ QtGui.QToolButton.__init__(self, parent)
+
+ # Store reference of shell stack
+ self._shellStack = shellStack
+
+ # Keep reference of actions corresponding to shells
+ self._shellActions = []
+
+ # Set text and tooltip
+ self.setText('Warming up ...')
+ self.setToolTip("Click to select shell.")
+ self.setToolButtonStyle(QtCore.Qt.ToolButtonTextBesideIcon)
+ self.setPopupMode(self.InstantPopup)
+
+ # Set icon
+ self._iconMaker = ShellIconMaker(self)
+ self._iconMaker.updateIcon('busy') # Busy initializing
+
+ # Create timer
+ self._elapsedTimesTimer = QtCore.QTimer(self)
+ self._elapsedTimesTimer.setInterval(200)
+ self._elapsedTimesTimer.setSingleShot(False)
+ self._elapsedTimesTimer.timeout.connect(self.onElapsedTimesTimer)
+
+
+ def updateShellMenu(self, shellToUpdate=None):
+ """ Update the shell menu. Ensure that there is a menu item
+ for each shell. If shellToUpdate is given, updates the corresponding
+ menu item.
+ """
+ menu = self.menu()
+
+ # Get shells now active
+ currentShell = self._shellStack.currentWidget()
+ shells = [self._shellStack.widget(i) for i in range(self._shellStack.count())]
+
+ # Synchronize actions. Remove invalid actions
+ for action in self._shellActions:
+ # Check match with shells
+ if action._shell in shells:
+ shells.remove(action._shell)
+ else:
+ menu.removeAction(action)
+ # Update checked state
+ if action._shell is currentShell and currentShell:
+ action.setChecked(True)
+ else:
+ action.setChecked(False)
+ # Update text if necessary
+ if action._shell is shellToUpdate:
+ action.setText(shellTitle(shellToUpdate, True))
+
+ # Any items left in shells need a menu item
+ # Dont give them an icon, or the icon is used as checkbox thingy
+ for shell in shells:
+ text = shellTitle(shell)
+ action = menu.addItem(text, None, self._shellStack.setCurrentWidget, shell)
+ action._shell = shell
+ action.setCheckable(True)
+ self._shellActions.append(action)
+
+ # Is the shell being updated the current?
+ if currentShell is shellToUpdate and currentShell is not None:
+ self._iconMaker.updateIcon(currentShell._state)
+ self.setText(shellTitle(currentShell))
+ elif currentShell is None:
+ self._iconMaker.updateIcon('')
+ self.setText('No shell selected')
+
+
+ def onElapsedTimesTimer(self):
+ # Automatically turn timer off is menu is hidden
+ if not self.menu().isVisible():
+ self._elapsedTimesTimer.stop()
+ return
+
+ # Update text for each shell action
+ for action in self._shellActions:
+ action.setText(shellTitle(action._shell, True))
+
+
+
+# todo: remove this?
+# class DebugControl(QtGui.QToolButton):
+# """ A button to control debugging.
+# """
+#
+# def __init__(self, parent):
+# QtGui.QToolButton.__init__(self, parent)
+#
+# # Flag
+# self._debugmode = False
+#
+# # Set text
+# self.setText(translate('debug', 'Debug'))
+# self.setIcon(iep.icons.bug)
+# self.setToolButtonStyle(QtCore.Qt.ToolButtonTextBesideIcon)
+# #self.setPopupMode(self.InstantPopup)
+#
+# # Bind to triggers
+# self.triggered.connect(self.onTriggered)
+# self.pressed.connect(self.onPressed)
+# self.buildMenu()
+#
+#
+# def buildMenu(self):
+#
+# # Count breakpoints
+# bpcount = 0
+# for e in iep.editors:
+# bpcount += len(e.breakPoints())
+#
+# # Prepare a text
+# clearallbps = translate('debug', 'Clear all {} breakpoints')
+# clearallbps = clearallbps.format(bpcount)
+#
+# # Set menu
+# menu = QtGui.QMenu(self)
+# self.setMenu(menu)
+#
+# for cmd, enabled, icon, text in [
+# ('CLEAR', self._debugmode==0, iep.icons.bug_delete, clearallbps),
+# ('PM', self._debugmode==0, iep.icons.bug_error,
+# translate('debug', 'Postmortem: debug from last traceback')),
+# ('STOP', self._debugmode>0, iep.icons.debug_quit,
+# translate('debug', 'Stop debugging')),
+# # ('NEXT', self._debugmode==2, iep.icons.debug_next,
+# # translate('debug', 'Next: proceed until next line')),
+# # ('STEP', self._debugmode==2, iep.icons.debug_step,
+# # translate('debug', 'Step: proceed one step')),
+# # ('RETURN', self._debugmode==2, iep.icons.debug_return,
+# # translate('debug', 'Return: proceed until returns')),
+# # ('CONTINUE', self._debugmode==2, iep.icons.debug_continue,
+# # translate('debug', 'Continue: proceed to next breakpoint')),
+# ]:
+# if cmd is None:
+# menu.addSeparator()
+# else:
+# if icon is not None:
+# a = menu.addAction(icon, text)
+# else:
+# a = menu.addAction(text)
+# if hasattr(text, 'tt'):
+# a.setToolTip(text.tt)
+# a.cmd = cmd
+# a.setEnabled(enabled)
+#
+#
+# def onPressed(self, show=True):
+# self.buildMenu()
+# self.showMenu()
+#
+#
+# def onTriggered(self, action):
+# if action.cmd == 'PM':
+# # Initiate postmortem debugging
+# shell = iep.shells.getCurrentShell()
+# if shell:
+# shell.executeCommand('DB START\n')
+#
+# elif action.cmd == 'CLEAR':
+# # Clear all breakpoints
+# for e in iep.editors:
+# e.clearBreakPoints()
+#
+# else:
+# command = action.cmd.upper()
+# shell = iep.shells.getCurrentShell()
+# if shell:
+# shell.executeCommand('DB %s\n' % command)
+#
+#
+# def setTrace(self, info):
+# """ Determine whether we are in debug mode.
+# """
+# if info is None:
+# self._debugmode = 0
+# else:
+# self._debugmode = info['debugmode']
+
+
+
+class DebugStack(QtGui.QToolButton):
+ """ A button that shows the stack trace.
+ """
+
+ def __init__(self, parent):
+ QtGui.QToolButton.__init__(self, parent)
+
+ # Set text and tooltip
+ self._baseText = translate('debug', 'Stack')
+ self.setText('%s:' % self._baseText)
+ self.setIcon(iep.icons.text_align_justify)
+ self.setToolButtonStyle(QtCore.Qt.ToolButtonTextBesideIcon)
+ self.setPopupMode(self.InstantPopup)
+
+ # Bind to triggers
+ self.triggered.connect(self.onTriggered)
+
+
+ def onTriggered(self, action):
+
+ # Get shell
+ shell = iep.shells.getCurrentShell()
+ if not shell:
+ return
+
+ # Change stack index
+ if not action._isCurrent:
+ shell.executeCommand('DB FRAME {}\n'.format(action._index))
+ # Open file and select line
+ if True:
+ line = action.text().split(': ',1)[1]
+ self.debugFocus(line)
+
+
+ def setTrace(self, info):
+ """ Set the stack trace. This method is called from
+ the shell that receives the trace via its status channel
+ directly from the interpreter.
+ If trace is None, removes the trace
+ """
+
+ # Get info
+ if info:
+ index, frames, debugmode = info['index'], info['frames'], info['debugmode']
+ else:
+ index, frames = -1, []
+
+ if (not frames) or (debugmode==0):
+
+ # Remove trace
+ self.setMenu(None)
+ self.setText('') #(self._baseText)
+ self.setEnabled(False)
+ iep.editors.setDebugLineIndicators(None)
+
+ else:
+ # Get the current frame
+ theAction = None
+
+ # Create menu and add __main__
+ menu = QtGui.QMenu(self)
+ self.setMenu(menu)
+
+ # Fill trace
+ for i in range(len(frames)):
+ thisIndex = i + 1
+ # Set text for action
+ text = '{}: File "{}", line {}, in {}'
+ text = text.format(thisIndex, *frames[i])
+ action = menu.addAction(text)
+ action._index = thisIndex
+ action._isCurrent = False
+ if thisIndex == index:
+ action._isCurrent = True
+ theAction = action
+ self.debugFocus(text.split(': ',1)[1]) # Load editor
+
+ # Get debug indicators
+ debugIndicators = []
+ for i in range(len(frames)):
+ thisIndex = i + 1
+ filename, linenr, func = frames[i]
+ debugIndicators.append((filename, linenr))
+ if thisIndex == index:
+ break
+ # Set debug indicators
+ iep.editors.setDebugLineIndicators(*debugIndicators)
+
+ # Highlight current item and set the button text
+ if theAction:
+ menu.setDefaultAction(theAction)
+ #self.setText(theAction.text().ljust(20))
+ i = theAction._index
+ text = "{} ({}/{}): ".format(self._baseText, i, len(frames))
+ self.setText(text)
+
+ self.setEnabled(True)
+
+
+ def debugFocus(self, lineFromDebugState):
+ """ debugFocus(lineFromDebugState)
+ Open the file and show the linenr of the given lineFromDebugState.
+ """
+ # Get filenr and item
+ try:
+ tmp = lineFromDebugState.split(', in ')[0].split(', line ')
+ filename = tmp[0][len('File '):].strip('"')
+ linenr = int(tmp[1].strip())
+ except Exception:
+ return 'Could not focus!'
+ # Cannot open <console>
+ if filename == '<console>':
+ return 'Stack frame is <console>.'
+ elif filename.startswith('<ipython-input-'):
+ return 'Stack frame is IPython input.'
+ elif filename.startswith('<'):
+ return 'Stack frame is special name'
+ # Go there!
+ result = iep.editors.loadFile(filename)
+ if not result:
+ return 'Could not open file where the error occured.'
+ else:
+ editor = result._editor
+ # Goto line and select it
+ editor.gotoLine(linenr)
+ cursor = editor.textCursor()
+ cursor.movePosition(cursor.StartOfBlock)
+ cursor.movePosition(cursor.EndOfBlock, cursor.KeepAnchor)
+ editor.setTextCursor(cursor)
+
+
diff --git a/iep/iepcore/splash.py b/iep/iepcore/splash.py
new file mode 100644
index 0000000..9d80a49
--- /dev/null
+++ b/iep/iepcore/splash.py
@@ -0,0 +1,125 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module splash
+
+Defines splash window shown during startup.
+
+"""
+
+import os, sys, time
+
+import iep
+from pyzolib.qt import QtCore, QtGui
+
+
+STYLESHEET = """
+QWidget {
+ background-color: #268bd2;
+}
+QFrame {
+ background-image: url("%s");
+ background-repeat: no-repeat;
+ background-position: center;
+}
+QLabel {
+ color: #222;
+ background: #46abf2;
+ border-radius:20px;
+}
+"""
+
+splash_text = """
+<p>
+This is the <b>Interactive Editor for Python</b>
+{distro}
+</p>
+<p>
+Version {version}
+</p>
+<p>
+IEP is open source software and freely available for everyone.
+Read more at
+<a href='http://www.iep-project.org/'>http://iep-project.org</a>
+</p>
+"""
+
+
+class LogoWidget(QtGui.QFrame):
+ def __init__(self, parent):
+ QtGui.QFrame.__init__(self, parent)
+ self.setMinimumSize(256, 256)
+ self.setMaximumSize(256, 256)
+
+
+
+class LabelWidget(QtGui.QWidget):
+ def __init__(self, parent, distro=None):
+ QtGui.QWidget.__init__(self, parent)
+ self.setMinimumSize(360, 256) # Ensure title fits nicely
+
+ # Create label widget and costumize
+ self._label = QtGui.QLabel(self)
+ self._label.setTextFormat(QtCore.Qt.RichText)
+ self._label.setOpenExternalLinks(True)
+ self._label.setWordWrap(True)
+ self._label.setMargin(20)
+
+ # Set font size (absolute value)
+ font = self._label.font()
+ font.setPointSize(11) #(font.pointSize()+1)
+ self._label.setFont(font)
+
+ # Build
+ distrotext = ''
+ if distro:
+ distrotext = '<br />brought to you by %s.' % distro
+ text = splash_text.format(distro=distrotext, version=iep.__version__)
+
+ # Set text
+ self._label.setText(text)
+
+ layout = QtGui.QVBoxLayout(self)
+ self.setLayout(layout)
+ layout.addStretch(1)
+ layout.addWidget(self._label, 0)
+ layout.addStretch(1)
+
+
+
+class SplashWidget(QtGui.QWidget):
+ """ A splash widget.
+ """
+ def __init__(self, parent, **kwargs):
+ QtGui.QWidget.__init__(self, parent)
+
+ self._left = LogoWidget(self)
+ self._right = LabelWidget(self, **kwargs)
+
+ # Layout
+ layout = QtGui.QHBoxLayout(self)
+ self.setLayout(layout)
+ #layout.setContentsMargins(0,0,0,0)
+ layout.setSpacing(25)
+ layout.addStretch(1)
+ layout.addWidget(self._left, 0)
+ layout.addWidget(self._right, 0)
+ layout.addStretch(1)
+
+ # Change background of main window to create a splash-screen-efefct
+ iconImage = 'ieplogo256.png'
+ iconImage = os.path.join(iep.iepDir, 'resources','appicons', iconImage)
+ iconImage = iconImage.replace(os.path.sep, '/') # Fix for Windows
+ self.setStyleSheet(STYLESHEET % iconImage)
+
+
+
+
+
+if __name__ == '__main__':
+ w = SplashWidget(None, distro='some arbitrary distro')
+ w.resize(800,600)
+ w.show()
diff --git a/iep/iepkernel/__init__.py b/iep/iepkernel/__init__.py
new file mode 100644
index 0000000..f075e8d
--- /dev/null
+++ b/iep/iepkernel/__init__.py
@@ -0,0 +1,24 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+"""
+The iepkernel package contains the code for the IEP kernel process.
+This kernel is designed to be relatively lightweight; i.e. most of
+the work is done by the IDE.
+
+See iepkernel/start.py for more information.
+
+"""
+
+def printDirect(msg):
+ """ Small function that writes directly to the strm_out channel.
+ This means that regardless if stdout was hijacked, the message ends
+ up at the IEP shell. This keeps any hijacked stdout clean, and gets
+ the message where you want it. In most cases this is just cosmetics:
+ the Python banner is one example.
+ """
+ import sys
+ sys._iepInterpreter.context._strm_out.send(msg)
diff --git a/iep/iepkernel/_nope.py b/iep/iepkernel/_nope.py
new file mode 100644
index 0000000..70a3493
--- /dev/null
+++ b/iep/iepkernel/_nope.py
@@ -0,0 +1,126 @@
+#-----------------------------------------------------------------------------
+# Copyright (C) 2013 Min RK
+#
+# Distributed under the terms of the 2-clause BSD License.
+#-----------------------------------------------------------------------------
+
+from contextlib import contextmanager
+
+import ctypes
+import ctypes.util
+
+objc = ctypes.cdll.LoadLibrary(ctypes.util.find_library('objc'))
+
+void_p = ctypes.c_void_p
+ull = ctypes.c_uint64
+
+objc.objc_getClass.restype = void_p
+objc.sel_registerName.restype = void_p
+objc.objc_msgSend.restype = void_p
+objc.objc_msgSend.argtypes = [void_p, void_p]
+
+msg = objc.objc_msgSend
+
+def _utf8(s):
+ """ensure utf8 bytes"""
+ if not isinstance(s, bytes):
+ s = s.encode('utf8')
+ return s
+
+def n(name):
+ """create a selector name (for methods)"""
+ return objc.sel_registerName(_utf8(name))
+
+def C(classname):
+ """get an ObjC Class by name"""
+ return objc.objc_getClass(_utf8(classname))
+
+# constants from Foundation
+
+NSActivityIdleDisplaySleepDisabled = (1 << 40)
+NSActivityIdleSystemSleepDisabled = (1 << 20)
+NSActivitySuddenTerminationDisabled = (1 << 14)
+NSActivityAutomaticTerminationDisabled = (1 << 15)
+NSActivityUserInitiated = (0x00FFFFFF | NSActivityIdleSystemSleepDisabled)
+NSActivityUserInitiatedAllowingIdleSystemSleep = (NSActivityUserInitiated & ~NSActivityIdleSystemSleepDisabled)
+NSActivityBackground = 0x000000FF
+NSActivityLatencyCritical = 0xFF00000000
+
+def beginActivityWithOptions(options, reason=""):
+ """Wrapper for:
+
+ [ [ NSProcessInfo processInfo]
+ beginActivityWithOptions: (uint64)options
+ reason: (str)reason
+ ]
+ """
+ NSProcessInfo = C('NSProcessInfo')
+ NSString = C('NSString')
+
+ reason = msg(NSString, n("stringWithUTF8String:"), _utf8(reason))
+ info = msg(NSProcessInfo, n('processInfo'))
+ activity = msg(info,
+ n('beginActivityWithOptions:reason:'),
+ ull(options),
+ void_p(reason)
+ )
+ return activity
+
+def endActivity(activity):
+ """end a process activity assertion"""
+ NSProcessInfo = C('NSProcessInfo')
+ info = msg(NSProcessInfo, n('processInfo'))
+ msg(info, n("endActivity:"), void_p(activity))
+
+_theactivity = None
+
+def nope():
+ """disable App Nap by setting NSActivityUserInitiatedAllowingIdleSystemSleep"""
+ global _theactivity
+ _theactivity = beginActivityWithOptions(
+ NSActivityUserInitiatedAllowingIdleSystemSleep,
+ "Because Reasons"
+ )
+
+def nap():
+ """end the caffeinated state started by `nope`"""
+ global _theactivity
+ if _theactivity is not None:
+ endActivity(_theactivity)
+ _theactivity = None
+
+def napping_allowed():
+ """is napping allowed?"""
+ return _theactivity is None
+
+ at contextmanager
+def nope_scope(
+ options=NSActivityUserInitiatedAllowingIdleSystemSleep,
+ reason="Because Reasons"
+ ):
+ """context manager for beginActivityWithOptions.
+
+ Within this context, App Nap will be disabled.
+ """
+ activity = beginActivityWithOptions(options, reason)
+ try:
+ yield
+ finally:
+ endActivity(activity)
+
+__all__ = [
+ "NSActivityIdleDisplaySleepDisabled",
+ "NSActivityIdleSystemSleepDisabled",
+ "NSActivitySuddenTerminationDisabled",
+ "NSActivityAutomaticTerminationDisabled",
+ "NSActivityUserInitiated",
+ "NSActivityUserInitiatedAllowingIdleSystemSleep",
+ "NSActivityBackground",
+ "NSActivityLatencyCritical",
+ "beginActivityWithOptions",
+ "endActivity",
+ "nope",
+ "nap",
+ "napping_allowed",
+ "nope_scope",
+]
diff --git a/iep/iepkernel/debug.py b/iep/iepkernel/debug.py
new file mode 100644
index 0000000..bed03f6
--- /dev/null
+++ b/iep/iepkernel/debug.py
@@ -0,0 +1,483 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import os
+import sys
+import time
+import bdb
+import traceback
+
+
+class Debugger(bdb.Bdb):
+ """ Debugger for the IEP kernel, based on bdb.
+ """
+
+ def __init__(self):
+ self._wait_for_mainpyfile = False # from pdb, do we need this?
+ bdb.Bdb.__init__(self)
+ self._debugmode = 0 # 0: no debug, 1: postmortem, 2: full debug
+
+
+ def interaction(self, frame, traceback=None, pm=False):
+ """ Enter an interaction-loop for debugging. No GUI events are
+ processed here. We leave this event loop at some point, after
+ which the conrol flow will proceed.
+
+ This is called to enter debug-mode at a breakpoint, or to enter
+ post-mortem debugging.
+ """
+ interpreter = sys._iepInterpreter
+
+ # Collect frames
+ frames = []
+ while frame:
+ if frame is self.botframe: break
+ co_filename = frame.f_code.co_filename
+ if 'iepkernel' in co_filename: break # IEP kernel
+ if 'interactiveshell.py' in co_filename: break # IPython kernel
+ frames.insert(0, frame)
+ frame = frame.f_back
+
+ # Tell interpreter our stack
+ if frames:
+ interpreter._dbFrames = frames
+ interpreter._dbFrameIndex = len(interpreter._dbFrames)
+ frame = interpreter._dbFrames[interpreter._dbFrameIndex-1]
+ interpreter._dbFrameName = frame.f_code.co_name
+ interpreter.locals = frame.f_locals
+ interpreter.globals = frame.f_globals
+
+ # Let the IDE know (
+ # "self._debugmode = 1 if pm else 2" does not work not on py2.4)
+ if pm:
+ self._debugmode = 1
+ else:
+ self._debugmode = 2
+ self.writestatus()
+
+ # Enter interact loop. We may hang in here for a while ...
+ self._interacting = True
+ while self._interacting:
+ time.sleep(0.05)
+ interpreter.process_commands()
+ pe = os.getenv('IEP_PROCESS_EVENTS_WHILE_DEBUGGING', '').lower()
+ if pe in ('1', 'true', 'yes'):
+ interpreter.guiApp.process_events()
+
+ # Reset
+ self._debugmode = 0
+ interpreter.locals = interpreter._main_locals
+ interpreter.globals = None
+ interpreter._dbFrames = []
+ self.writestatus()
+
+
+ def stopinteraction(self):
+ """ Stop the interaction loop.
+ """
+ self._interacting = False
+
+
+ def set_on(self):
+ """ To turn debugging on right before executing code.
+ """
+ # Reset and set bottom frame
+ self.reset()
+ self.botframe = sys._getframe().f_back
+ # Don't stop except at breakpoints or when finished
+ # We do: self._set_stopinfo(self.botframe, None, -1) from set_continue
+ # But write it all out because py2.4 does not have _set_stopinfo
+ self.stopframe = self.botframe
+ self.returnframe = None
+ self.quitting = False
+ self.stoplineno = -1
+ # Set tracing or not
+ if self.breaks:
+ sys.settrace(self.trace_dispatch)
+ else:
+ sys.settrace(None)
+
+
+ def message(self, msg):
+ """ Alias for interpreter.write(), but appends a newline.
+ Writes to stderr.
+ """
+ sys._iepInterpreter.write(msg+'\n')
+
+
+ def error(self, msg):
+ """ method used in some code that we copied from pdb.
+ """
+ raise self.message('*** '+msg)
+
+
+ def writestatus(self):
+ """ Write the debug status so the IDE can take action.
+ """
+
+ interpreter = sys._iepInterpreter
+
+ # Collect frames info
+ frames = []
+ for f in interpreter._dbFrames:
+ # Get fname and lineno, and correct if required
+ fname, lineno = f.f_code.co_filename, f.f_lineno
+ fname, lineno = interpreter.correctfilenameandlineno(fname, lineno)
+ if not fname.startswith('<'):
+ fname2 = os.path.abspath(fname)
+ if os.path.isfile(fname2):
+ fname = fname2
+ frames.append((fname, lineno, f.f_code.co_name))
+ # Build string
+ #text = 'File "%s", line %i, in %s' % (
+ # fname, lineno, f.f_code.co_name)
+ #frames.append(text)
+
+ # Send info object
+ state = { 'index': interpreter._dbFrameIndex,
+ 'frames': frames,
+ 'debugmode': self._debugmode}
+ interpreter.context._stat_debug.send(state)
+
+
+ ## Stuff that we need to overload
+
+
+ # Overload set_break to also allow non-existing filenames like "<tmp 1"
+ def set_break(self, filename, lineno, temporary=False, cond=None,
+ funcname=None):
+ filename = self.canonic(filename)
+ list = self.breaks.setdefault(filename, [])
+ if lineno not in list:
+ list.append(lineno)
+ bp = bdb.Breakpoint(filename, lineno, temporary, cond, funcname)
+
+
+ # Prevent stopping in bdb code or iepkernel code
+ def stop_here(self, frame):
+ result = bdb.Bdb.stop_here(self, frame)
+ if result:
+ return ( ('bdb.py' not in frame.f_code.co_filename) and
+ ('iepkernel' not in frame.f_code.co_filename) )
+
+
+ def do_clear(self, arg):
+ """"""
+ # Clear breakpoints, we need to overload from Bdb,
+ # but do not expose this command to the user.
+ """cl(ear) filename:lineno\ncl(ear) [bpnumber [bpnumber...]]
+ With a space separated list of breakpoint numbers, clear
+ those breakpoints. Without argument, clear all breaks (but
+ first ask confirmation). With a filename:lineno argument,
+ clear all breaks at that line in that file.
+ """
+ if not arg:
+ bplist = [bp for bp in bdb.Breakpoint.bpbynumber if bp]
+ self.clear_all_breaks()
+ for bp in bplist:
+ self.message('Deleted %s' % bp)
+ return
+ if ':' in arg:
+ # Make sure it works for "clear C:\foo\bar.py:12"
+ i = arg.rfind(':')
+ filename = arg[:i]
+ arg = arg[i+1:]
+ try:
+ lineno = int(arg)
+ except ValueError:
+ err = "Invalid line number (%s)" % arg
+ else:
+ bplist = self.get_breaks(filename, lineno)
+ err = self.clear_break(filename, lineno)
+ if err:
+ self.error(err)
+ else:
+ for bp in bplist:
+ self.message('Deleted %s' % bp)
+ return
+ numberlist = arg.split()
+ for i in numberlist:
+ try:
+ bp = self.get_bpbynumber(i)
+ except ValueError:
+ self.error("Cannot get breakpoint by number.")
+ else:
+ self.clear_bpbynumber(i)
+ self.message('Deleted %s' % bp)
+
+
+ def user_call(self, frame, argument_list):
+ """This method is called when there is the remote possibility
+ that we ever need to stop in this function."""
+ if self._wait_for_mainpyfile:
+ return
+ if self.stop_here(frame):
+ self.message('--Call--')
+ self.interaction(frame, None)
+
+
+
+ def user_line(self, frame):
+ """This function is called when we stop or break at this line."""
+ if self._wait_for_mainpyfile:
+ if (self.mainpyfile != self.canonic(frame.f_code.co_filename)
+ or frame.f_lineno <= 0):
+ return
+ self._wait_for_mainpyfile = False
+ if True: #self.bp_commands(frame): from pdb
+ self.interaction(frame, None)
+
+
+ def user_return(self, frame, return_value):
+ """This function is called when a return trap is set here."""
+ if self._wait_for_mainpyfile:
+ return
+ frame.f_locals['__return__'] = return_value
+ self.message('--Return--')
+ self.interaction(frame, None)
+
+
+ def user_exception(self, frame, exc_info):
+ """This function is called if an exception occurs,
+ but only if we are to stop at or just below this level."""
+ if self._wait_for_mainpyfile:
+ return
+ exc_type, exc_value, exc_traceback = exc_info
+ frame.f_locals['__exception__'] = exc_type, exc_value
+ self.message(traceback.format_exception_only(exc_type,
+ exc_value)[-1].strip())
+ self.interaction(frame, exc_traceback)
+
+
+ ## Commands
+
+ def do_help(self, arg):
+ """ Get help on debug commands.
+ """
+ # Collect docstrings
+ docs = {}
+ for name in dir(self):
+ if name.startswith('do_'):
+ doc = getattr(self, name).__doc__
+ if doc:
+ docs[name[3:]] = doc.strip()
+
+ if not arg:
+ print('All debug commands:')
+ # Show docs in order
+ for name in [ 'start', 'stop', 'frame', 'up', 'down',
+ 'next', 'step','return', 'continue',
+ 'where', 'events']:
+ doc = docs.pop(name)
+ name= name.rjust(10)
+ print(' %s - %s' % (name, doc))
+ # Show rest
+ for name in docs:
+ doc = docs[name]
+ name= name.rjust(10)
+ print(' %s - %s' % (name, doc))
+
+ else:
+ # Show specific doc
+ name = arg.lower()
+ doc = docs.get(name, None)
+ if doc is not None:
+ print('%s - %s' % (name, doc))
+ else:
+ print('Unknown debug command: %s' % name)
+
+
+ def do_start(self, arg):
+ """ Start postmortem debugging from the last uncaught exception.
+ """
+ interpreter = sys._iepInterpreter
+
+ # Get traceback
+ try:
+ tb = sys.last_traceback
+ except AttributeError:
+ tb = None
+
+ # Get top frame
+ frame = None
+ while tb:
+ frame = tb.tb_frame
+ tb = tb.tb_next
+
+ # Interact, or not
+ if self._debugmode:
+ self.message("Already in debug mode.")
+ elif frame:
+ self.interaction(frame, None, pm=True)
+ else:
+ self.message("No debug information available.")
+
+
+ def do_frame(self, arg):
+ """ Go to the i'th frame in the stack.
+ """
+ interpreter = sys._iepInterpreter
+
+ if not self._debugmode:
+ self.message("Not in debug mode.")
+ else:
+ # Set frame index
+ interpreter._dbFrameIndex = int(arg)
+ if interpreter._dbFrameIndex < 1:
+ interpreter._dbFrameIndex = 1
+ elif interpreter._dbFrameIndex > len(interpreter._dbFrames):
+ interpreter._dbFrameIndex = len(interpreter._dbFrames)
+ # Set name and locals
+ frame = interpreter._dbFrames[interpreter._dbFrameIndex-1]
+ interpreter._dbFrameName = frame.f_code.co_name
+ interpreter.locals = frame.f_locals
+ interpreter.globals = frame.f_globals
+ self.writestatus()
+
+
+ def do_up(self, arg):
+ """ Go one frame up the stack.
+ """
+ interpreter = sys._iepInterpreter
+
+ if not self._debugmode:
+ self.message("Not in debug mode.")
+ else:
+ # Decrease frame index
+ interpreter._dbFrameIndex -= 1
+ if interpreter._dbFrameIndex < 1:
+ interpreter._dbFrameIndex = 1
+ # Set name and locals
+ frame = interpreter._dbFrames[interpreter._dbFrameIndex-1]
+ interpreter._dbFrameName = frame.f_code.co_name
+ interpreter.locals = frame.f_locals
+ interpreter.globals = frame.f_globals
+ self.writestatus()
+
+
+ def do_down(self, arg):
+ """ Go one frame down the stack.
+ """
+ interpreter = sys._iepInterpreter
+
+ if not self._debugmode:
+ self.message("Not in debug mode.")
+ else:
+ # Increase frame index
+ interpreter._dbFrameIndex += 1
+ if interpreter._dbFrameIndex > len(interpreter._dbFrames):
+ interpreter._dbFrameIndex = len(interpreter._dbFrames)
+ # Set name and locals
+ frame = interpreter._dbFrames[interpreter._dbFrameIndex-1]
+ interpreter._dbFrameName = frame.f_code.co_name
+ interpreter.locals = frame.f_locals
+ interpreter.globals = frame.f_globals
+ self.writestatus()
+
+
+ def do_stop(self, arg):
+ """ Stop debugging, terminate process execution.
+ """
+ # Can be done both in postmortem and normal debugging
+ interpreter = sys._iepInterpreter
+
+ if not self._debugmode:
+ self.message("Not in debug mode.")
+ else:
+ self.set_quit()
+ self.stopinteraction()
+
+
+ def do_where(self, arg):
+ """ Print the stack trace and indicate the current frame.
+ """
+ interpreter = sys._iepInterpreter
+
+ if not self._debugmode:
+ self.message("Not in debug mode.")
+ else:
+ lines = []
+ for i in range(len(interpreter._dbFrames)):
+ frameIndex = i+1
+ f = interpreter._dbFrames[i]
+ # Get fname and lineno, and correct if required
+ fname, lineno = f.f_code.co_filename, f.f_lineno
+ fname, lineno = interpreter.correctfilenameandlineno(fname,
+ lineno)
+ # Build string
+ text = 'File "%s", line %i, in %s' % (
+ fname, lineno, f.f_code.co_name)
+ if frameIndex == interpreter._dbFrameIndex:
+ lines.append('-> %i: %s'%(frameIndex, text))
+ else:
+ lines.append(' %i: %s'%(frameIndex, text))
+ lines.append('')
+ sys.stdout.write('\n'.join(lines))
+
+
+ def do_continue(self, arg):
+ """ Continue the program execution.
+ """
+ interpreter = sys._iepInterpreter
+
+ if self._debugmode == 0:
+ self.message("Not in debug mode.")
+ elif self._debugmode == 1:
+ self.message("Cannot use 'continue' in postmortem debug mode.")
+ else:
+ self.set_continue()
+ self.stopinteraction()
+
+
+ def do_step(self, arg):
+ """ Execute the current line, stop ASAP (step into).
+ """
+ interpreter = sys._iepInterpreter
+
+ if self._debugmode == 0:
+ self.message("Not in debug mode.")
+ elif self._debugmode == 1:
+ self.message("Cannot use 'step' in postmortem debug mode.")
+ else:
+ self.set_step()
+ self.stopinteraction()
+
+
+ def do_next(self, arg):
+ """ Continue execution until the next line (step over).
+ """
+ interpreter = sys._iepInterpreter
+
+ if self._debugmode == 0:
+ self.message("Not in debug mode.")
+ elif self._debugmode == 1:
+ self.message("Cannot use 'next' in postmortem debug mode.")
+ else:
+ frame = interpreter._dbFrames[-1]
+ self.set_next(frame)
+ self.stopinteraction()
+
+
+ def do_return(self, arg):
+ """ Continue execution until the current function returns (step out).
+ """
+ interpreter = sys._iepInterpreter
+
+ if self._debugmode == 0:
+ self.message("Not in debug mode.")
+ elif self._debugmode == 1:
+ self.message("Cannot use 'return' in postmortem debug mode.")
+ else:
+ frame = interpreter._dbFrames[-1]
+ self.set_return(frame)
+ self.stopinteraction()
+
+
+ def do_events(self, arg):
+ """ Process GUI events for the integrated GUI toolkit.
+ """
+ interpreter = sys._iepInterpreter
+ interpreter.guiApp.process_events()
diff --git a/iep/iepkernel/guiintegration.py b/iep/iepkernel/guiintegration.py
new file mode 100644
index 0000000..53d4df9
--- /dev/null
+++ b/iep/iepkernel/guiintegration.py
@@ -0,0 +1,460 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+"""
+Module to integrate GUI event loops in the IEP interpreter.
+
+This specifies classes that all have the same interface. Each class
+wraps one GUI toolkit.
+
+Support for PyQt4, WxPython, FLTK, GTK, TK.
+
+"""
+
+import sys
+import time
+
+from iepkernel import printDirect
+
+
+# Warning message.
+mainloopWarning = """
+Note: The GUI event loop is already running in the IEP kernel. Be aware
+that the function to enter the main loop does not block.
+""".strip()+"\n"
+
+# Qt has its own message
+mainloopWarning_qt = """
+Note on using QApplication.exec_():
+The GUI event loop is already running in the IEP kernel, and exec_()
+does not block. In most cases your app should run fine without the need
+for modifications. For clarity, this is what the IEP kernel does:
+- Prevent deletion of objects in the local scope of functions leading to exec_()
+- Prevent system exit right after the exec_() call
+""".strip()+"\n"
+
+
+
+class App_base:
+ """ Defines the interface.
+ """
+
+ def process_events(self):
+ pass
+
+ def _keyboard_interrupt(self, signum=None, frame=None):
+ interpreter = sys._iepInterpreter
+ interpreter.write("\nKeyboardInterrupt\n")
+ interpreter._resetbuffer()
+ if interpreter.more:
+ interpreter.more = 0
+ interpreter.newPrompt = True
+
+ def run(self, repl_callback, sleeptime=0.01):
+ """ Very simple mainloop. Subclasses can overload this to use
+ the native event loop. Attempt to process GUI events at least
+ every sleeptime seconds.
+ """
+
+ # The toplevel while-loop is just to catch Keyboard interrupts
+ # and then proceed. The inner while-loop is the actual event loop.
+ while True:
+ try:
+
+ while True:
+ time.sleep(sleeptime)
+ repl_callback()
+ self.process_events()
+
+ except KeyboardInterrupt:
+ self._keyboard_interrupt()
+ except TypeError:
+ # For some reason, when wx is integrated, keyboard interrupts
+ # result in a TypeError.
+ # I tried to find the source, but did not find it. If anyone
+ # has an idea, please e-mail me!
+ if self.guiName == 'WX':
+ self._keyboard_interrupt()
+
+ def quit(self):
+ raise SystemExit()
+
+
+
+class App_tk(App_base):
+ """ Tries to import tkinter and returns a withdrawn tkinter root
+ window. If tkinter is already imported or not available, this
+ returns None.
+ Modifies tkinter's mainloop with a dummy so when a module calls
+ mainloop, it does not block.
+ """
+ def __init__(self):
+
+ # Try importing
+ import sys
+ if sys.version[0] == '3':
+ import tkinter
+ else:
+ import Tkinter as tkinter
+
+ # Replace mainloop. Note that a root object obtained with
+ # tkinter.Tk() has a mainloop method, which will simply call
+ # tkinter.mainloop().
+ def dummy_mainloop(*args,**kwargs):
+ printDirect(mainloopWarning)
+ tkinter.Misc.mainloop = dummy_mainloop
+ tkinter.mainloop = dummy_mainloop
+
+ # Create tk "main window" that has a Tcl interpreter.
+ # Withdraw so it's not shown. This object can be used to
+ # process events for any other windows.
+ r = tkinter.Tk()
+ r.withdraw()
+
+ # Store the app instance to process events
+ self.app = r
+
+ # Notify that we integrated the event loop
+ self.app._in_event_loop = 'IEP'
+ tkinter._in_event_loop = 'IEP'
+
+ def process_events(self):
+ self.app.update()
+
+
+
+class App_fltk(App_base):
+ """ Hijack fltk 1.
+ This one is easy. Just call fl.wait(0.0) now and then.
+ Note that both tk and fltk try to bind to PyOS_InputHook. Fltk
+ will warn about not being able to and Tk does not, so we should
+ just hijack (import) fltk first. The hook that they try to fetch
+ is not required in IEP, because the IEP interpreter will keep
+ all GUI backends updated when idle.
+ """
+ def __init__(self):
+ # Try importing
+ import fltk as fl
+ import types
+
+ # Replace mainloop with a dummy
+ def dummyrun(*args,**kwargs):
+ printDirect(mainloopWarning)
+ fl.Fl.run = types.MethodType(dummyrun, fl.Fl)
+
+ # Store the app instance to process events
+ self.app = fl.Fl
+
+ # Notify that we integrated the event loop
+ self.app._in_event_loop = 'IEP'
+ fl._in_event_loop = 'IEP'
+
+ def process_events(self):
+ self.app.wait(0)
+
+
+
+class App_fltk2(App_base):
+ """ Hijack fltk 2.
+ """
+ def __init__(self):
+ # Try importing
+ import fltk2 as fl
+
+ # Replace mainloop with a dummy
+ def dummyrun(*args,**kwargs):
+ printDirect(mainloopWarning)
+ fl.run = dummyrun
+
+ # Return the app instance to process events
+ self.app = fl
+
+ # Notify that we integrated the event loop
+ self.app._in_event_loop = 'IEP'
+
+ def process_events(self):
+ # is this right?
+ self.app.wait(0)
+
+
+
+class App_qt(App_base):
+ """ Common functionality for pyqt and pyside
+ """
+
+
+ def __init__(self):
+ import types
+
+ # Try importing qt
+ QtGui, QtCore = self.importCoreAndGui()
+ self._QtGui, self._QtCore = QtGui, QtCore
+
+ # Store the real application class
+ if not hasattr(QtGui, 'real_QApplication'):
+ QtGui.real_QApplication = QtGui.QApplication
+
+
+ class QApplication_hijacked(QtGui.QApplication):
+ """ QApplication_hijacked(*args, **kwargs)
+
+ Hijacked QApplication class. This class has a __new__()
+ method that always returns the global application
+ instance, i.e. QtGui.qApp.
+
+ The QtGui.qApp instance is an instance of the original
+ QtGui.QApplication, but with its __init__() and exec_()
+ methods replaced.
+
+ You can subclass this class; the global application instance
+ will be given the methods and attributes so it will behave
+ like the subclass.
+ """
+ def __new__(cls, *args, **kwargs):
+
+ # Get the singleton application instance
+ theApp = QApplication_hijacked.instance()
+
+ # Instantiate an original QApplication instance if we need to
+ if theApp is None:
+ theApp = QtGui.real_QApplication(*args, **kwargs)
+ QtGui.qApp = theApp
+
+ # Add attributes of cls to the instance to make it
+ # behave as if it were an instance of that class
+ for key in dir(cls):
+ # Skip all magic methods except __init__
+ if key.startswith('__') and key != '__init__':
+ continue
+ # Skip attributes that we already have
+ val = getattr(cls, key)
+ if hasattr(theApp.__class__, key):
+ if hash(val) == hash(getattr(theApp.__class__, key)):
+ continue
+ # Make method?
+ if hasattr(val, '__call__'):
+ if hasattr(val, 'im_func'):
+ val = val.im_func # Python 2.x
+ val = types.MethodType(val, theApp.__class__)
+ # Set attribute on app instance (not the class!)
+ try:
+ setattr(theApp, key, val)
+ except Exception:
+ pass # tough luck
+
+ # Call init function (in case the user overloaded it)
+ theApp.__init__(*args, **kwargs)
+
+ # Return global app object (modified to the users needs)
+ return theApp
+
+ def __init__(self, *args, **kwargs):
+ pass
+
+ def exec_(self, *args, **kwargs):
+ """ This function does nothing, except printing a
+ warning message. The point is that a Qt App can crash
+ quite hard if an object goes out of scope, and the error
+ is not obvious.
+ """
+ printDirect(mainloopWarning_qt+'\n')
+
+ # Store local namespaces (scopes) of any functions that
+ # precede this call. It might have a widget or application
+ # object that should not be deleted ...
+ import inspect, __main__
+ for caller in inspect.stack()[1:]:
+ frame, name = caller[0], caller[3]
+ if name.startswith('<'): # most probably "<module>"
+ break
+ else:
+ __main__.__dict__[name+'_locals'] = frame.f_locals
+
+ # Tell interpreter to ignore any system exits
+ sys._iepInterpreter.ignore_sys_exit = True
+
+ # But re-enable it as soon as *this event* is processed
+ def reEnableSysExit():
+ sys._iepInterpreter.ignore_sys_exit = False
+ self._reEnableSysExitTimer = timer = QtCore.QTimer()
+ timer.singleShot(0, reEnableSysExit)
+
+ def quit(self, *args, **kwargs):
+ """ Do not quit if Qt app quits. """
+ pass
+
+
+ # Instantiate application object
+ self.app = QApplication_hijacked([''])
+
+ # Keep it alive even if all windows are closed
+ self.app.setQuitOnLastWindowClosed(False)
+
+ # Replace app class
+ QtGui.QApplication = QApplication_hijacked
+
+ # Notify that we integrated the event loop
+ self.app._in_event_loop = 'IEP'
+ QtGui._in_event_loop = 'IEP'
+
+ # Use sys.excepthook to catch keyboard interrupts that occur
+ # in event handlers. We also want to call the curren hook
+ self._original_excepthook = sys.excepthook
+ sys.excepthook = self._excepthook
+
+
+ def _excepthook(self, type, value, traceback):
+ if issubclass(type, KeyboardInterrupt):
+ self._keyboard_interrupt()
+ elif self._original_excepthook is not None:
+ return self._original_excepthook(type, value, traceback)
+
+
+ def process_events(self):
+ self.app.flush()
+ self.app.processEvents()
+
+
+ def run(self, repl_callback, sleeptime=None):
+ # Create timer
+ timer = self._timer = self._QtCore.QTimer()
+ timer.setSingleShot(False)
+ timer.setInterval(0.05*1000) # ms
+ timer.timeout.connect(repl_callback)
+ timer.start()
+
+ # Enter Qt mainloop
+ #self._QtGui.real_QApplication.exec_(self.app)
+ self._QtGui.real_QApplication.exec_()
+
+
+ def quit(self):
+ # A nicer way to quit
+ self._QtGui.real_QApplication.quit()
+
+
+
+class App_pyqt4(App_qt):
+ """ Hijack the PyQt4 mainloop.
+ """
+
+ def importCoreAndGui(self):
+ # Try importing qt
+ import PyQt4
+ from PyQt4 import QtGui, QtCore
+ return QtGui, QtCore
+
+
+class App_pyside(App_qt):
+ """ Hijack the PySide mainloop.
+ """
+
+ def importCoreAndGui(self):
+ # Try importing qt
+ import PySide
+ from PySide import QtGui, QtCore
+ return QtGui, QtCore
+
+
+
+class App_wx(App_base):
+ """ Hijack the wxWidgets mainloop.
+ """
+
+ def __init__(self):
+
+ # Try importing
+ try:
+ import wx
+ except ImportError:
+ # For very old versions of WX
+ import wxPython as wx
+
+ # Create dummy mainloop to replace original mainloop
+ def dummy_mainloop(*args, **kw):
+ printDirect(mainloopWarning)
+
+ # Depending on version, replace mainloop
+ ver = wx.__version__
+ orig_mainloop = None
+ if ver[:3] >= '2.5':
+ if hasattr(wx, '_core_'): core = getattr(wx, '_core_')
+ elif hasattr(wx, '_core'): core = getattr(wx, '_core')
+ else: raise ImportError
+ orig_mainloop = core.PyApp_MainLoop
+ core.PyApp_MainLoop = dummy_mainloop
+ elif ver[:3] == '2.4':
+ orig_mainloop = wx.wxc.wxPyApp_MainLoop
+ wx.wxc.wxPyApp_MainLoop = dummy_mainloop
+ else:
+ # Unable to find either wxPython version 2.4 or >= 2.5."
+ raise ImportError
+
+ # Store package wx
+ self.wx = wx
+
+ # Get and store the app instance to process events
+ app = wx.GetApp()
+ if app is None:
+ app = wx.App(False)
+ self.app = app
+
+ # Notify that we integrated the event loop
+ self.app._in_event_loop = 'IEP'
+ wx._in_event_loop = 'IEP'
+
+ def process_events(self):
+ wx = self.wx
+
+ # This bit is really needed
+ old = wx.EventLoop.GetActive()
+ eventLoop = wx.EventLoop()
+ wx.EventLoop.SetActive(eventLoop)
+ while eventLoop.Pending():
+ eventLoop.Dispatch()
+
+ # Process and reset
+ self.app.ProcessIdle() # otherwise frames do not close
+ wx.EventLoop.SetActive(old)
+
+
+
+class App_gtk(App_base):
+ """ Modifies pyGTK's mainloop with a dummy so user code does not
+ block IPython. processing events is done using the module'
+ main_iteration function.
+ """
+ def __init__(self):
+ # Try importing gtk
+ import gtk
+
+ # Replace mainloop with a dummy
+ def dummy_mainloop(*args, **kwargs):
+ printDirect(mainloopWarning)
+ gtk.mainloop = dummy_mainloop
+ gtk.main = dummy_mainloop
+
+ # Replace main_quit with a dummy too
+ def dummy_quit(*args, **kwargs):
+ pass
+ gtk.main_quit = dummy_quit
+ gtk.mainquit = dummy_quit
+
+ # Make sure main_iteration exists even on older versions
+ if not hasattr(gtk, 'main_iteration'):
+ gtk.main_iteration = gtk.mainiteration
+
+ # Store 'app object'
+ self.app = gtk
+
+ # Notify that we integrated the event loop
+ self.app._in_event_loop = 'IEP'
+
+ def process_events(self):
+ gtk = self.app
+ while gtk.events_pending():
+ gtk.main_iteration(False)
+
diff --git a/iep/iepkernel/guisupport.py b/iep/iepkernel/guisupport.py
new file mode 100644
index 0000000..09059a6
--- /dev/null
+++ b/iep/iepkernel/guisupport.py
@@ -0,0 +1,148 @@
+#!/usr/bin/env python
+# coding: utf-8
+"""
+Support for creating GUI apps and starting event loops.
+
+IPython's GUI integration allows interative plotting and GUI usage in IPython
+session. IPython has two different types of GUI integration:
+
+1. The terminal based IPython supports GUI event loops through Python's
+ PyOS_InputHook. PyOS_InputHook is a hook that Python calls periodically
+ whenever raw_input is waiting for a user to type code. We implement GUI
+ support in the terminal by setting PyOS_InputHook to a function that
+ iterates the event loop for a short while. It is important to note that
+ in this situation, the real GUI event loop is NOT run in the normal
+ manner, so you can't use the normal means to detect that it is running.
+2. In the two process IPython kernel/frontend, the GUI event loop is run in
+ the kernel. In this case, the event loop is run in the normal manner by
+ calling the function or method of the GUI toolkit that starts the event
+ loop.
+
+In addition to starting the GUI event loops in one of these two ways, IPython
+will *always* create an appropriate GUI application object when GUi
+integration is enabled.
+
+If you want your GUI apps to run in IPython you need to do two things:
+
+1. Test to see if there is already an existing main application object. If
+ there is, you should use it. If there is not an existing application object
+ you should create one.
+2. Test to see if the GUI event loop is running. If it is, you should not
+ start it. If the event loop is not running you may start it.
+
+This module contains functions for each toolkit that perform these things
+in a consistent manner. Because of how PyOS_InputHook runs the event loop
+you cannot detect if the event loop is running using the traditional calls
+(such as ``wx.GetApp.IsMainLoopRunning()`` in wxPython). If PyOS_InputHook is
+set These methods will return a false negative. That is, they will say the
+event loop is not running, when is actually is. To work around this limitation
+we proposed the following informal protocol:
+
+* Whenever someone starts the event loop, they *must* set the ``_in_event_loop``
+ attribute of the main application object to ``True``. This should be done
+ regardless of how the event loop is actually run.
+* Whenever someone stops the event loop, they *must* set the ``_in_event_loop``
+ attribute of the main application object to ``False``.
+* If you want to see if the event loop is running, you *must* use ``hasattr``
+ to see if ``_in_event_loop`` attribute has been set. If it is set, you
+ *must* use its value. If it has not been set, you can query the toolkit
+ in the normal manner.
+* If you want GUI support and no one else has created an application or
+ started the event loop you *must* do this. We don't want projects to
+ attempt to defer these things to someone else if they themselves need it.
+
+The functions below implement this logic for each GUI toolkit. If you need
+to create custom application subclasses, you will likely have to modify this
+code for your own purposes. This code can be copied into your own project
+so you don't have to depend on IPython.
+
+"""
+
+#-----------------------------------------------------------------------------
+# Copyright (C) 2008-2010 The IPython Development Team
+#
+# Distributed under the terms of the BSD License. The full license is in
+# the file COPYING, distributed as part of this software.
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# wx
+#-----------------------------------------------------------------------------
+
+def get_app_wx(*args, **kwargs):
+ """Create a new wx app or return an exiting one."""
+ import wx
+ app = wx.GetApp()
+ if app is None:
+ if 'redirect' not in kwargs:
+ kwargs['redirect'] = False
+ # app = wx.PySimpleApp(*args, **kwargs) Deprecated!
+ app = wx.App(*args, **kwargs)
+ return app
+
+def is_event_loop_running_wx(app=None):
+ """Is the wx event loop running."""
+ if app is None:
+ app = get_app_wx()
+ if hasattr(app, '_in_event_loop'):
+ return app._in_event_loop
+ else:
+ return app.IsMainLoopRunning()
+
+def start_event_loop_wx(app=None):
+ """Start the wx event loop in a consistent manner."""
+ if app is None:
+ app = get_app_wx()
+ if not is_event_loop_running_wx(app):
+ app._in_event_loop = True
+ app.MainLoop()
+ app._in_event_loop = False
+ else:
+ app._in_event_loop = True
+
+#-----------------------------------------------------------------------------
+# qt4
+#-----------------------------------------------------------------------------
+
+def get_app_qt4(*args, **kwargs):
+ """Create a new qt4 app or return an existing one."""
+ from PyQt4 import QtGui
+ app = QtGui.QApplication.instance()
+ if app is None:
+ if not args:
+ args = ([''],)
+ app = QtGui.QApplication(*args, **kwargs)
+ return app
+
+def is_event_loop_running_qt4(app=None):
+ """Is the qt4 event loop running."""
+ if app is None:
+ app = get_app_qt4([''])
+ if hasattr(app, '_in_event_loop'):
+ return app._in_event_loop
+ else:
+ # Does qt4 provide a other way to detect this?
+ return False
+
+def start_event_loop_qt4(app=None):
+ """Start the qt4 event loop in a consistent manner."""
+ if app is None:
+ app = get_app_qt4([''])
+ if not is_event_loop_running_qt4(app):
+ app._in_event_loop = True
+ app.exec_()
+ app._in_event_loop = False
+ else:
+ app._in_event_loop = True
+
+#-----------------------------------------------------------------------------
+# Tk
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# gtk
+#-----------------------------------------------------------------------------
diff --git a/iep/iepkernel/interpreter.py b/iep/iepkernel/interpreter.py
new file mode 100644
index 0000000..1655f08
--- /dev/null
+++ b/iep/iepkernel/interpreter.py
@@ -0,0 +1,1119 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+""" Module iepkernel.interpreter
+
+Implements the IEP interpreter.
+
+Notes on IPython
+----------------
+We integrate IPython via the IPython.core.interactiveshell.InteractiveShell.
+ * The namespace is set to __main__
+ * We call its run_cell method to execute code
+ * Debugging/breakpoints are "enabled using the pre_run_code_hook
+ * Debugging occurs in our own debugger
+ * GUI integration is all handled by IEP
+ * We need special prompts for IPython input
+
+
+
+"""
+
+import os
+import sys
+import time
+import platform
+import struct
+import shlex
+from codeop import CommandCompiler
+import traceback
+import keyword
+import inspect # Must be in this namespace
+import bdb
+from distutils.version import LooseVersion as LV
+
+import yoton
+from iepkernel import guiintegration, printDirect
+from iepkernel.magic import Magician
+from iepkernel.debug import Debugger
+
+# Init last traceback information
+sys.last_type = None
+sys.last_value = None
+sys.last_traceback = None
+
+# Set Python version and get some names
+PYTHON_VERSION = sys.version_info[0]
+if PYTHON_VERSION < 3:
+ ustr = unicode
+ bstr = str
+ input = raw_input
+else:
+ ustr = str
+ bstr = bytes
+
+
+
+class PS1:
+ """ Dynamic prompt for PS1. Show IPython prompt if available, and
+ show current stack frame when debugging.
+ """
+ def __init__(self, iep):
+ self._iep = iep
+ def __str__(self):
+ if self._iep._dbFrames:
+ # When debugging, show where we are, do not use IPython prompt
+ preamble = '('+self._iep._dbFrameName+')'
+ return '\n\x1b[0;32m%s>>>\x1b[0m ' % preamble
+ elif self._iep._ipython:
+ # IPython prompt
+ return '\n\x1b[0;32mIn [\x1b[1;32m%i\x1b[0;32m]:\x1b[0m ' % (
+ self._iep._ipython.execution_count)
+ #return 'In [%i]: ' % (self._ipython.execution_count)
+ else:
+ # Normal Python prompt
+ return '\n\x1b[0;32m>>>\x1b[0m '
+
+
+class PS2:
+ """ Dynamic prompt for PS2.
+ """
+ def __init__(self, iep):
+ self._iep = iep
+ def __str__(self):
+ if self._iep._dbFrames:
+ # When debugging, show where we are, do not use IPython prompt
+ preamble = '('+self._iep._dbFrameName+')'
+ return '\x1b[0;32m%s...\x1b[0m ' % preamble
+ elif self._iep._ipython:
+ # Dots ala IPython
+ nspaces = len(str(self._iep._ipython.execution_count)) + 2
+ return '\x1b[0;32m%s...:\x1b[0m ' % (nspaces*' ')
+ else:
+ # Just dots
+ return '\x1b[0;32m...\x1b[0m '
+
+
+
+class IepInterpreter:
+ """ IepInterpreter
+
+ The IEP interpreter is the part that makes the IEP kernel interactive.
+ It executes code, integrates the GUI toolkit, parses magic commands, etc.
+ The IEP interpreter has been designed to emulate the standard interactive
+ Python console as much as possible, but with a lot of extra goodies.
+
+ There is one instance of this class, stored at sys._iepInterpreter and
+ at the __iep__ variable in the global namespace.
+
+ The global instance has a couple of interesting attributes:
+ * context: the yoton Context instance at the kernel (has all channels)
+ * introspector: the introspector instance (a subclassed yoton.RepChannel)
+ * magician: the object that handles the magic commands
+ * guiApp: a wrapper for the integrated GUI application
+ * sleeptime: the amount of time (in seconds) to sleep at each iteration
+
+ """
+
+ # Simular working as code.InteractiveConsole. Some code was copied, but
+ # the following things are changed:
+ # - prompts are printed in the err stream, like the default interpreter does
+ # - uses an asynchronous read using the yoton interface
+ # - support for hijacking GUI toolkits
+ # - can run large pieces of code
+ # - support post mortem debugging
+ # - support for magic commands
+
+ def __init__(self, locals, filename="<console>"):
+
+ # Init variables for locals and globals (globals only for debugging)
+ self.locals = locals
+ self.globals = None
+
+ # Store filename
+ self._filename = filename
+
+ # Store ref of locals that is our main
+ self._main_locals = locals
+
+ # Flag to ignore sys exit, to allow running some scripts
+ # interactively, even if they call sys.exit.
+ self.ignore_sys_exit = False
+
+ # Information for debugging. If self._dbFrames, we're in debug mode
+ # _dbFrameIndex starts from 1
+ self._dbFrames = []
+ self._dbFrameIndex = 0
+ self._dbFrameName = ''
+
+ # Init datase to store source code that we execute
+ self._codeCollection = ExecutedSourceCollection()
+
+ # Init buffer to deal with multi-line command in the shell
+ self._buffer = []
+
+ # Init sleep time. 0.001 result in 0% CPU usage at my laptop (Windows),
+ # but 8% CPU usage at my older laptop (on Linux).
+ self.sleeptime = 0.01 # 100 Hz
+
+ # Create compiler
+ self._compile = CommandCompiler()
+
+ # Instantiate magician and tracer
+ self.magician = Magician()
+ self.debugger = Debugger()
+
+ # To keep track of whether to send a new prompt, and whether more
+ # code is expected.
+ self.more = 0
+ self.newPrompt = True
+
+ # Code and script to run on first iteration
+ self._codeToRunOnStartup = None
+ self._scriptToRunOnStartup = None
+
+ # Remove "THIS" directory from the PYTHONPATH
+ # to prevent unwanted imports. Same for iepkernel dir
+ thisPath = os.getcwd()
+ for p in [thisPath, os.path.join(thisPath,'iepkernel')]:
+ while p in sys.path:
+ sys.path.remove(p)
+
+
+ def run(self):
+ """ Run (start the mainloop)
+
+ Here we enter the main loop, which is provided by the guiApp.
+ This event loop calls process_commands on a regular basis.
+
+ We may also enter the debug intereaction loop, either from a
+ request for post-mortem debugging, or *during* execution by
+ means of a breakpoint. When in this debug-loop, the guiApp event
+ loop lays still, but the debug-loop does call process-commands
+ for user interaction.
+
+ When the user wants to quit, SystemExit is raised (one way or
+ another). This is detected in process_commands and the exception
+ instance is stored in self._exitException. Then the debug-loop
+ is stopped if necessary, and the guiApp is told to stop its event
+ loop.
+
+ And that brings us back here, where we exit using in order of
+ preference: self._exitException, the exception with which the
+ event loop was exited (if any), or a new exception.
+
+ """
+
+ # Prepare
+ self._prepare()
+ self._exitException = None
+
+ # Enter main
+ try:
+ self.guiApp.run(self.process_commands, self.sleeptime)
+ except SystemExit:
+ # Set self._exitException if it is not set yet
+ type, value, tb = sys.exc_info(); del tb
+ if self._exitException is None:
+ self._exitException = value
+
+ # Exit
+ if self._exitException is None:
+ self._exitException = SystemExit()
+ raise self._exitException
+
+
+ def _prepare(self):
+ """ Prepare for running the main loop.
+ Here we do some initialization like obtaining the startup info,
+ creating the GUI application wrapper, etc.
+ """
+
+ # Reset debug status
+ self.debugger.writestatus()
+
+ # Get startup info (get a copy, or setting the new version wont trigger!)
+ while self.context._stat_startup.recv() is None:
+ time.sleep(0.02)
+ self.startup_info = startup_info = self.context._stat_startup.recv().copy()
+
+ # Set startup info (with additional info)
+ builtins = __builtins__
+ if not isinstance(builtins, dict):
+ builtins = builtins.__dict__
+ startup_info['builtins'] = [builtin for builtin in builtins.keys()]
+ startup_info['version'] = tuple(sys.version_info)
+ startup_info['keywords'] = keyword.kwlist
+ self.context._stat_startup.send(startup_info)
+
+ # Prepare the Python environment
+ self._prepare_environment(startup_info)
+
+ # Run startup code (before loading GUI toolkit or IPython
+ self._run_startup_code(startup_info)
+
+ # Write Python banner (to stdout)
+ NBITS = 8 * struct.calcsize("P")
+ plat = sys.platform
+ if plat.startswith('win'):
+ plat = 'Windows'
+ plat = '%s (%i bits)' % (plat, NBITS)
+ printDirect("Python %s on %s.\n" %
+ (sys.version.split('[')[0].rstrip(), plat))
+
+ # Integrate GUI
+ guiName, guiError = self._integrate_gui(startup_info)
+
+ # Write IEP part of banner (including what GUI loop is integrated)
+ if True:
+ iepBanner = 'This is the IEP interpreter'
+ if guiError:
+ iepBanner += '. ' + guiError + '\n'
+ elif guiName:
+ iepBanner += ' with integrated event loop for '
+ iepBanner += guiName + '.\n'
+ else:
+ iepBanner += '.\n'
+ printDirect(iepBanner)
+
+ # Try loading IPython
+ if startup_info.get('ipython', '').lower() in ('no', 'false'):
+ self._ipython = None
+ else:
+ try:
+ self._load_ipyhon()
+ except Exception:
+ type, value, tb = sys.exc_info();
+ del tb
+ printDirect('IPython could not be loaded: %s\n' % str(value))
+ self._ipython = None
+
+ # Set prompts
+ sys.ps1 = PS1(self)
+ sys.ps2 = PS2(self)
+
+ # Notify about project path
+ projectPath = startup_info['projectPath']
+ if projectPath:
+ printDirect('Prepending the project path %r to sys.path\n' %
+ projectPath)
+
+ # Write tips message.
+ if self._ipython:
+ import IPython
+ printDirect("\nUsing IPython %s -- An enhanced Interactive Python.\n"
+ % IPython.__version__)
+ printDirect(
+ "? -> Introduction and overview of IPython's features.\n"
+ "%quickref -> Quick reference.\n"
+ "help -> Python's own help system.\n"
+ "object? -> Details about 'object', "
+ "use 'object??' for extra details.\n")
+ else:
+ printDirect("Type 'help' for help, " +
+ "type '?' for a list of *magic* commands.\n")
+
+ # Notify the running of the script
+ if self._scriptToRunOnStartup:
+ printDirect('\x1b[0;33mRunning script: "'+self._scriptToRunOnStartup+'"\x1b[0m\n')
+
+ # Prevent app nap on OSX 9.2 and up
+ # The _nope module is taken from MINRK's appnope package
+ if sys.platform == "darwin" and LV(platform.mac_ver()[0]) >= LV("10.9"):
+ from iepkernel import _nope
+ _nope.nope()
+
+
+ def _prepare_environment(self, startup_info):
+ """ Prepare the Python environment. There are two possibilities:
+ either we run a script or we run interactively.
+ """
+
+ # Get whether we should (and can) run as script
+ scriptFilename = startup_info['scriptFile']
+ if scriptFilename:
+ if not os.path.isfile(scriptFilename):
+ printDirect('Invalid script file: "'+scriptFilename+'"\n')
+ scriptFilename = None
+
+ # Get project path
+ projectPath = startup_info['projectPath']
+
+ if scriptFilename:
+ # RUN AS SCRIPT
+ # Set __file__ (note that __name__ is already '__main__')
+ self.locals['__file__'] = scriptFilename
+ # Set command line arguments
+ sys.argv[:] = []
+ sys.argv.append(scriptFilename)
+ sys.argv.extend(shlex.split(startup_info.get('argv', '')))
+ # Insert script directory to path
+ theDir = os.path.abspath( os.path.dirname(scriptFilename) )
+ if theDir not in sys.path:
+ sys.path.insert(0, theDir)
+ if projectPath is not None:
+ sys.path.insert(0,projectPath)
+ # Go to script dir
+ os.chdir( os.path.dirname(scriptFilename) )
+ # Run script later
+ self._scriptToRunOnStartup = scriptFilename
+ else:
+ # RUN INTERACTIVELY
+ # No __file__ (note that __name__ is already '__main__')
+ self.locals.pop('__file__','')
+ # Remove all command line arguments, set first to empty string
+ sys.argv[:] = []
+ sys.argv.append('')
+ sys.argv.extend(shlex.split(startup_info.get('argv', '')))
+ # Insert current directory to path
+ sys.path.insert(0, '')
+ if projectPath:
+ sys.path.insert(0,projectPath)
+ # Go to start dir
+ startDir = startup_info['startDir']
+ if startDir and os.path.isdir(startDir):
+ os.chdir(startDir)
+ else:
+ os.chdir(os.path.expanduser('~')) # home dir
+
+
+ def _run_startup_code(self, startup_info):
+ """ Execute the startup code or script.
+ """
+
+ # Run startup script (if set)
+ script = startup_info['startupScript']
+ # Should we use the default startupScript?
+ if script == '$PYTHONSTARTUP':
+ script = os.environ.get('PYTHONSTARTUP','')
+
+ if '\n' in script:
+ # Run code later or now
+ firstline = script.split('\n')[0].replace(' ', '')
+ if firstline.startswith('#AFTER_GUI'):
+ self._codeToRunOnStartup = script
+ else:
+ self.context._stat_interpreter.send('Busy')
+ msg = {'source': script, 'fname': '<startup>', 'lineno': 0}
+ self.runlargecode(msg, True)
+ elif script and os.path.isfile(script):
+ # Run script
+ self.context._stat_interpreter.send('Busy')
+ self.runfile(script)
+ else:
+ # Nothing to run
+ pass
+
+
+ def _integrate_gui(self, startup_info):
+ """ Integrate event loop of GUI toolkit (or use pure Python
+ event loop).
+ """
+
+ self.guiApp = guiintegration.App_base()
+ self.guiName = guiName = startup_info['gui'].upper()
+ guiError = ''
+ try:
+ if guiName in ['', 'NONE']:
+ guiName = ''
+ elif guiName == 'TK':
+ self.guiApp = guiintegration.App_tk()
+ elif guiName == 'WX':
+ self.guiApp = guiintegration.App_wx()
+ elif guiName == 'PYSIDE':
+ self.guiApp = guiintegration.App_pyside()
+ elif guiName in ['PYQT4', 'QT4']:
+ self.guiApp = guiintegration.App_pyqt4()
+ elif guiName == 'FLTK':
+ self.guiApp = guiintegration.App_fltk()
+ elif guiName == 'GTK':
+ self.guiApp = guiintegration.App_gtk()
+ else:
+ guiError = 'Unkown gui: %s' % guiName
+ guiName = ''
+ except Exception: # Catch any error
+ # Get exception info (we do it using sys.exc_info() because
+ # we cannot catch the exception in a version independent way.
+ type, value, tb = sys.exc_info(); del tb
+ guiError = 'Failed to integrate event loop for %s: %s' % (
+ guiName, str(value))
+
+ return guiName, guiError
+
+
+ def _load_ipyhon(self):
+ """ Try loading IPython shell. The result is set in self._ipython
+ (can be None if IPython not available).
+ """
+
+ # Init
+ self._ipython = None
+ import __main__
+
+ # Try importing IPython
+ try:
+ import IPython
+ except ImportError:
+ return
+
+ # Version ok?
+ if IPython.version_info < (1,):
+ return
+
+ # Create an IPython shell
+ from IPython.core.interactiveshell import InteractiveShell
+ self._ipython = InteractiveShell(user_module=__main__)
+
+ # Set some hooks / event callbacks
+ # Run hook (pre_run_code_hook is depreacted in 2.0)
+ pre_run_cell_hook = self.ipython_pre_run_cell_hook
+ if IPython.version_info < (2,):
+ self._ipython.set_hook('pre_run_code_hook', pre_run_cell_hook)
+ else:
+ self._ipython.events.register('pre_run_cell', pre_run_cell_hook)
+ # Other hooks
+ self._ipython.set_hook('editor', self.ipython_editor_hook)
+ self._ipython.set_custom_exc((bdb.BdbQuit,), self.dbstop_handler)
+
+ # Some patching
+ self._ipython.ask_exit = self.ipython_ask_exit
+
+ # Make output be shown on Windows
+ if sys.platform.startswith('win'):
+ # IPython wraps std streams just like we do below, but
+ # pyreadline adds *another* wrapper, which is where it
+ # goes wrong. Here we set it back to bypass pyreadline.
+ from IPython.utils import io
+ io.stdin = io.IOStream(sys.stdin)
+ io.stdout = io.IOStream(sys.stdout)
+ io.stderr = io.IOStream(sys.stderr)
+
+ # Ipython uses msvcrt e.g. for pausing between pages
+ # but this does not work in IEP
+ import msvcrt
+ msvcrt.getwch = msvcrt.getch = input # input is deffed above
+
+
+ def process_commands(self):
+ """ Do one iteration of processing commands (the REPL).
+ """
+ try:
+
+ self._process_commands()
+
+ except SystemExit:
+ # It may be that we should ignore sys exit now...
+ if self.ignore_sys_exit:
+ self.ignore_sys_exit = False # Never allow more than once
+ return
+ # Get and store the exception so we can raise it later
+ type, value, tb = sys.exc_info(); del tb
+ self._exitException = value
+ # Stop debugger if it is running
+ self.debugger.stopinteraction()
+ # Exit from interpreter. Exit in the appropriate way
+ self.guiApp.quit() # Is sys.exit() by default
+
+
+ def _process_commands(self):
+
+ # Run startup code/script inside the loop (only the first time)
+ # so that keyboard interrupt will work
+ if self._codeToRunOnStartup:
+ self.context._stat_interpreter.send('Busy')
+ self._codeToRunOnStartup, tmp = None, self._codeToRunOnStartup
+ self.pushline(tmp)
+ if self._scriptToRunOnStartup:
+ self.context._stat_interpreter.send('Busy')
+ self._scriptToRunOnStartup, tmp = None, self._scriptToRunOnStartup
+ self.runfile(tmp)
+
+ # Set status and prompt?
+ # Prompt is allowed to be an object with __str__ method
+ if self.newPrompt:
+ self.newPrompt = False
+ if self.more:
+ ps = sys.ps2
+ else:
+ ps = sys.ps1
+ self.context._strm_prompt.send(str(ps))
+
+ if True:
+ # Determine state. The message is really only send
+ # when the state is different. Note that the kernelbroker
+ # can also set the state ("Very busy", "Busy", "Dead")
+ if self._dbFrames:
+ self.context._stat_interpreter.send('Debug')
+ elif self.more:
+ self.context._stat_interpreter.send('More')
+ else:
+ self.context._stat_interpreter.send('Ready')
+
+
+ # Are we still connected?
+ if sys.stdin.closed or not self.context.connection_count:
+ # Exit from main loop.
+ # This will raise SystemExit and will shut us down in the
+ # most appropriate way
+ sys.exit()
+
+ # Get channel to take a message from
+ ch = yoton.select_sub_channel(self.context._ctrl_command, self.context._ctrl_code)
+
+ if ch is None:
+ pass # No messages waiting
+
+ elif ch is self.context._ctrl_command:
+ # Read command
+ line1 = self.context._ctrl_command.recv(False) # Command
+ if line1:
+ # Notify what we're doing
+ self.context._strm_echo.send(line1)
+ self.context._stat_interpreter.send('Busy')
+ self.newPrompt = True
+ # Convert command
+ # (only a few magics are supported if IPython is active)
+ line2 = self.magician.convert_command(line1.rstrip('\n'))
+ # Execute actual code
+ if line2 is not None:
+ for line3 in line2.split('\n'): # not splitlines!
+ self.more = self.pushline(line3)
+ else:
+ self.more = False
+ self._resetbuffer()
+
+ elif ch is self.context._ctrl_code:
+ # Read larger block of code (dict)
+ msg = self.context._ctrl_code.recv(False)
+ if msg:
+ # Notify what we're doing
+ # (runlargecode() sends on stdin-echo)
+ self.context._stat_interpreter.send('Busy')
+ self.newPrompt = True
+ # Execute code
+ self.runlargecode(msg)
+ # Reset more stuff
+ self._resetbuffer()
+ self.more = False
+
+ else:
+ # This should not happen, but if it does, just flush!
+ ch.recv(False)
+
+
+
+ ## Running code in various ways
+ # In all cases there is a call for compilecode and a call to execcode
+
+ def _resetbuffer(self):
+ """Reset the input buffer."""
+ self._buffer = []
+
+
+ def pushline(self, line):
+ """Push a line to the interpreter.
+
+ The line should not have a trailing newline; it may have
+ internal newlines. The line is appended to a buffer and the
+ interpreter's _runlines() method is called with the
+ concatenated contents of the buffer as source. If this
+ indicates that the command was executed or invalid, the buffer
+ is reset; otherwise, the command is incomplete, and the buffer
+ is left as it was after the line was appended. The return
+ value is 1 if more input is required, 0 if the line was dealt
+ with in some way (this is the same as _runlines()).
+
+ """
+ # Get buffer, join to get source
+ buffer = self._buffer
+ buffer.append(line)
+ source = "\n".join(buffer)
+ # Clear buffer and run source
+ self._resetbuffer()
+ more = self._runlines(source, self._filename)
+ # Create buffer if needed
+ if more:
+ self._buffer = buffer
+ return more
+
+
+ def _runlines(self, source, filename="<input>", symbol="single"):
+ """Compile and run some source in the interpreter.
+
+ Arguments are as for compile_command().
+
+ One several things can happen:
+
+ 1) The input is incorrect; compile_command() raised an
+ exception (SyntaxError or OverflowError). A syntax traceback
+ will be printed by calling the showsyntaxerror() method.
+
+ 2) The input is incomplete, and more input is required;
+ compile_command() returned None. Nothing happens.
+
+ 3) The input is complete; compile_command() returned a code
+ object. The code is executed by calling self.execcode() (which
+ also handles run-time exceptions, except for SystemExit).
+
+ The return value is True in case 2, False in the other cases (unless
+ an exception is raised). The return value can be used to
+ decide whether to use sys.ps1 or sys.ps2 to prompt the next
+ line.
+
+ """
+
+ use_ipython = self._ipython and not self._dbFrames
+
+ # Try compiling.
+ # The IPython kernel does not handle incomple lines, so we check
+ # that ourselves ...
+ error = None
+ try:
+ code = self.compilecode(source, filename, symbol)
+ except (OverflowError, SyntaxError, ValueError):
+ error = sys.exc_info()[1]
+ code = False
+
+ if use_ipython:
+ if code is None:
+ # Case 2
+ #self._ipython.run_cell('', True)
+ return True
+ else:
+ # Case 1 and 3 handled by IPython
+ self._ipython.run_cell(source, True, False)
+ return False
+
+ else:
+ if code is None:
+ # Case 2
+ return True
+ elif not code:
+ # Case 1, a bit awkward way to show the error, but we need
+ # to call showsyntaxerror in an exception handler.
+ try:
+ raise error
+ except Exception:
+ self.showsyntaxerror(filename)
+ return False
+ else:
+ # Case 3
+ self.execcode(code)
+ return False
+
+
+ def runlargecode(self, msg, silent=False):
+ """ To execute larger pieces of code. """
+
+ # Get information
+ source, fname, lineno = msg['source'], msg['fname'], msg['lineno']
+ cellName = msg.get('cellName', '')
+ source += '\n'
+
+ # Construct notification message
+ lineno1 = lineno + 1
+ lineno2 = lineno + source.count('\n')
+ fname_show = fname
+ if not fname.startswith('<'):
+ fname_show = os.path.split(fname)[1]
+ if cellName:
+ runtext = '(executing cell "%s" (line %i of "%s"))\n' % (cellName, lineno1, fname_show)
+ elif lineno1 == lineno2:
+ runtext = '(executing line %i of "%s")\n' % (lineno1, fname_show)
+ else:
+ runtext = '(executing lines %i to %i of "%s")\n' % (
+ lineno1, lineno2, fname_show)
+ # Notify IDE
+ if not silent:
+ self.context._strm_echo.send('\x1b[0;33m%s\x1b[0m' % runtext)
+ # Increase counter
+ if self._ipython:
+ self._ipython.execution_count += 1
+
+ # Put the line number in the filename (if necessary)
+ # Note that we could store the line offset in the _codeCollection,
+ # but then we cannot retrieve it for syntax errors.
+ if lineno:
+ fname = "%s+%i" % (fname, lineno)
+
+ # Try compiling the source
+ code = None
+ try:
+ # Compile
+ code = self.compilecode(source, fname, "exec")
+
+ except (OverflowError, SyntaxError, ValueError):
+ self.showsyntaxerror(fname)
+ return
+
+ if code:
+ # Store the source using the (id of the) code object as a key
+ self._codeCollection.store_source(code, source)
+ # Execute the code
+ self.execcode(code)
+ else:
+ # Incomplete code
+ self.write('Could not run code because it is incomplete.\n')
+
+
+ def runfile(self, fname):
+ """ To execute the startup script. """
+
+ # Get text (make sure it ends with a newline)
+ try:
+ source = open(fname, 'rb').read().decode('UTF-8')
+ except Exception:
+ printDirect('Could not read script (decoding using UTF-8): "' + fname + '"\n')
+ return
+ try:
+ source = source.replace('\r\n', '\n').replace('\r','\n')
+ if source[-1] != '\n':
+ source += '\n'
+ except Exception:
+ printDirect('Could not execute script: "' + fname + '"\n')
+ return
+
+ # Try compiling the source
+ code = None
+ try:
+ # Compile
+ code = self.compilecode(source, fname, "exec")
+ except (OverflowError, SyntaxError, ValueError):
+ time.sleep(0.2) # Give stdout time to be send
+ self.showsyntaxerror(fname)
+ return
+
+ if code:
+ # Store the source using the (id of the) code object as a key
+ self._codeCollection.store_source(code, source)
+ # Execute the code
+ self.execcode(code)
+ else:
+ # Incomplete code
+ self.write('Could not run code because it is incomplete.\n')
+
+
+ def compilecode(self, source, filename, mode, *args, **kwargs):
+ """ Compile source code.
+ Will mangle coding definitions on first two lines.
+
+ * This method should be called with Unicode sources.
+ * Source newlines should consist only of LF characters.
+ """
+
+ # This method solves IEP issue 22
+
+ # Split in first two lines and the rest
+ parts = source.split('\n', 2)
+
+ # Replace any coding definitions
+ ci = 'coding is'
+ contained_coding = False
+ for i in range(len(parts)-1):
+ tmp = parts[i]
+ if tmp and tmp[0] == '#' and 'coding' in tmp:
+ contained_coding = True
+ parts[i] = tmp.replace('coding=', ci).replace('coding:', ci)
+
+ # Combine parts again (if necessary)
+ if contained_coding:
+ source = '\n'.join(parts)
+
+ # Convert filename to UTF-8 if Python version < 3
+ if PYTHON_VERSION < 3:
+ filename = filename.encode('utf-8')
+
+ # Compile
+ return self._compile(source, filename, mode, *args, **kwargs)
+
+
+ def execcode(self, code):
+ """Execute a code object.
+
+ When an exception occurs, self.showtraceback() is called to
+ display a traceback. All exceptions are caught except
+ SystemExit, which is reraised.
+
+ A note about KeyboardInterrupt: this exception may occur
+ elsewhere in this code, and may not always be caught. The
+ caller should be prepared to deal with it.
+
+ The globals variable is used when in debug mode.
+ """
+
+ try:
+ if self._dbFrames:
+ self.apply_breakpoints()
+ exec(code, self.globals, self.locals)
+ else:
+ # Turn debugger on at this point. If there are no breakpoints,
+ # the tracing is disabled for better performance.
+ self.apply_breakpoints()
+ self.debugger.set_on()
+ exec(code, self.locals)
+ except bdb.BdbQuit:
+ self.dbstop_handler()
+ except Exception:
+ time.sleep(0.2) # Give stdout some time to send data
+ self.showtraceback()
+ except KeyboardInterrupt: # is a BaseException, not an Exception
+ time.sleep(0.2)
+ self.showtraceback()
+
+
+ def apply_breakpoints(self):
+ """ Breakpoints are updated at each time a command is given,
+ including commands like "db continue".
+ """
+ try:
+ breaks = self.context._stat_breakpoints.recv()
+ if self.debugger.breaks:
+ self.debugger.clear_all_breaks()
+ if breaks: # Can be None
+ for fname in breaks:
+ for linenr in breaks[fname]:
+ self.debugger.set_break(fname, linenr)
+ except Exception:
+ type, value, tb = sys.exc_info(); del tb
+ print('Error while setting breakpoints: %s' % str(value))
+
+
+ ## Handlers and hooks
+
+ def ipython_pre_run_cell_hook(self, ipython=None):
+ """ Hook that IPython calls right before executing code.
+ """
+ self.apply_breakpoints()
+ self.debugger.set_on()
+
+
+ def ipython_editor_hook(self, ipython, filename, linenum=None, wait=True):
+ # Correct line number for cell offset
+ filename, linenum = self.correctfilenameandlineno(filename, linenum or 0)
+ # Get action string
+ if linenum:
+ action = 'open %i %s' % (linenum, os.path.abspath(filename))
+ else:
+ action = 'open %s' % os.path.abspath(filename)
+ # Send
+ self.context._strm_action.send(action)
+
+
+ def ipython_ask_exit(self):
+ # Ask the user
+ a = input("Do you really want to exit ([y]/n)? ")
+ a = a or 'y'
+ # Close stdin if necessary
+ if a.lower() == 'y':
+ sys.stdin._channel.close()
+
+
+ def dbstop_handler(self, *args, **kwargs):
+ print("Program execution stopped from debugger.")
+
+
+
+
+
+
+ ## Writing and error handling
+
+
+ def write(self, text):
+ """ Write errors. """
+ sys.stderr.write( text )
+
+
+ def showsyntaxerror(self, filename=None):
+ """Display the syntax error that just occurred.
+ This doesn't display a stack trace because there isn't one.
+ If a filename is given, it is stuffed in the exception instead
+ of what was there before (because Python's parser always uses
+ "<string>" when reading from a string).
+
+ IEP version: support to display the right line number,
+ see doc of showtraceback for details.
+ """
+
+ # Get info (do not store)
+ type, value, tb = sys.exc_info(); del tb
+
+ # Work hard to stuff the correct filename in the exception
+ if filename and type is SyntaxError:
+ try:
+ # unpack information
+ msg, (dummy_filename, lineno, offset, line) = value
+ # correct line-number
+ fname, lineno = self.correctfilenameandlineno(filename, lineno)
+ except:
+ # Not the format we expect; leave it alone
+ pass
+ else:
+ # Stuff in the right filename
+ value = SyntaxError(msg, (fname, lineno, offset, line))
+ sys.last_value = value
+
+ # Show syntax error
+ strList = traceback.format_exception_only(type, value)
+ for s in strList:
+ self.write(s)
+
+
+ def showtraceback(self, useLastTraceback=False):
+ """Display the exception that just occurred.
+ We remove the first stack item because it is our own code.
+ The output is written by self.write(), below.
+
+ In the IEP version, before executing a block of code,
+ the filename is modified by appending " [x]". Where x is
+ the index in a list that we keep, of tuples
+ (sourcecode, filename, lineno).
+
+ Here, showing the traceback, we check if we see such [x],
+ and if so, we extract the line of code where it went wrong,
+ and correct the lineno, so it will point at the right line
+ in the editor if part of a file was executed. When the file
+ was modified since the part in question was executed, the
+ fileno might deviate, but the line of code shown shall
+ always be correct...
+ """
+ # Traceback info:
+ # tb_next -> go down the trace
+ # tb_frame -> get the stack frame
+ # tb_lineno -> where it went wrong
+ #
+ # Frame info:
+ # f_back -> go up (towards caller)
+ # f_code -> code object
+ # f_locals -> we can execute code here when PM debugging
+ # f_globals
+ # f_trace -> (can be None) function for debugging? (
+ #
+ # The traceback module is used to obtain prints from the
+ # traceback.
+
+ try:
+ if useLastTraceback:
+ # Get traceback info from buffered
+ type = sys.last_type
+ value = sys.last_value
+ tb = sys.last_traceback
+ else:
+ # Get exception information and remove first, since that's us
+ type, value, tb = sys.exc_info()
+ tb = tb.tb_next
+
+ # Store for debugging, but only store if not in debug mode
+ if not self._dbFrames:
+ sys.last_type = type
+ sys.last_value = value
+ sys.last_traceback = tb
+
+ # Get traceback to correct all the line numbers
+ # tblist = list of (filename, line-number, function-name, text)
+ tblist = traceback.extract_tb(tb)
+
+ # Get frames
+ frames = []
+ while tb:
+ frames.append(tb.tb_frame)
+ tb = tb.tb_next
+
+ # Walk through the list
+ for i in range(len(tblist)):
+ tbInfo = tblist[i]
+ # Get filename and line number, init example
+ fname, lineno = self.correctfilenameandlineno(tbInfo[0], tbInfo[1])
+ if not isinstance(fname, ustr):
+ fname = fname.decode('utf-8')
+ example = tbInfo[3]
+ # Reset info
+ tblist[i] = (fname, lineno, tbInfo[2], example)
+
+ # Format list
+ strList = traceback.format_list(tblist)
+ if strList:
+ strList.insert(0, "Traceback (most recent call last):\n")
+ strList.extend( traceback.format_exception_only(type, value) )
+
+ # Write traceback
+ for s in strList:
+ self.write(s)
+
+ # Clean up (we cannot combine except and finally in Python <2.5
+ tb = None
+ frames = None
+
+ except Exception:
+ self.write('An error occured, but could not write traceback.\n')
+ tb = None
+ frames = None
+
+
+ def correctfilenameandlineno(self, fname, lineno):
+ """ Given a filename and lineno, this function returns
+ a modified (if necessary) version of the two.
+ As example:
+ "foo.py+7", 22 -> "foo.py", 29
+ """
+ j = fname.rfind('+')
+ if j>0:
+ try:
+ lineno += int(fname[j+1:])
+ fname = fname[:j]
+ except ValueError:
+ pass
+ return fname, lineno
+
+
+class ExecutedSourceCollection:
+ """ Stores the source of executed pieces of code, so that the right
+ traceback can be reproduced when an error occurs. The filename
+ (including the +lineno suffix) is used as a key. We monkey-patch
+ the linecache module so that we first try our cache to look up the
+ lines. In that way we also allow third party modules (e.g. IPython)
+ to get the lines for executed cells.
+ """
+
+ def __init__(self):
+ self._cache = {}
+ self._patch()
+
+ def store_source(self, codeObject, source):
+ self._cache[codeObject.co_filename] = source
+
+ def _patch(self):
+ def getlines(filename, module_globals=None):
+ # Try getting the source from our own cache,
+ # otherwise fallback to linecache's own cache
+ src = self._cache.get(filename, '')
+ if src:
+ return [line+'\n' for line in src.splitlines()]
+ else:
+ import linecache
+ return linecache._getlines(filename, module_globals)
+
+ # Monkey patch
+ import linecache
+ linecache._getlines = linecache.getlines
+ linecache.getlines =getlines
+
+ # I hoped this would remove the +lineno for IPython tracebacks,
+ # but it doesn't
+# def extract_tb(tb, limit=None):
+# print('aasdasd')
+# import traceback
+# list1 = traceback._extract_tb(tb, limit)
+# list2 = []
+# for (filename, lineno, name, line) in list1:
+# filename, lineno = sys._iepInterpreter.correctfilenameandlineno(filename, lineno)
+# list2.append((filename, lineno, name, line))
+# return list2
+#
+# import traceback
+# traceback._extract_tb = traceback.extract_tb
+# traceback.extract_tb = extract_tb
diff --git a/iep/iepkernel/introspection.py b/iep/iepkernel/introspection.py
new file mode 100644
index 0000000..4c8f8e6
--- /dev/null
+++ b/iep/iepkernel/introspection.py
@@ -0,0 +1,408 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import os, sys, time
+import yoton
+import inspect
+
+try:
+ import thread # Python 2
+except ImportError:
+ import _thread as thread # Python 3
+
+
+class IepIntrospector(yoton.RepChannel):
+ """ This is a RepChannel object that runs a thread to respond to
+ requests from the IDE.
+ """
+
+ def _getNameSpace(self, name=''):
+ """ _getNameSpace(name='')
+
+ Get the namespace to apply introspection in.
+ If name is given, will find that name. For example sys.stdin.
+
+ """
+
+ # Get namespace
+ NS1 = sys._iepInterpreter.locals
+ NS2 = sys._iepInterpreter.globals
+ if not NS2:
+ NS = NS1
+ else:
+ NS = NS2.copy()
+ NS.update(NS1)
+
+ # Look up a name?
+ if not name:
+ return NS
+ else:
+ try:
+ # Get object
+ ob = eval(name, None, NS)
+
+ # Get namespace for this object
+ if isinstance(ob, dict):
+ NS = ob
+ elif isinstance(ob, (list, tuple)):
+ NS = {}
+ count = -1
+ for el in ob:
+ count += 1
+ NS['[%i]'%count] = el
+ else:
+ keys = dir(ob)
+ NS = {}
+ for key in keys:
+ NS[key] = getattr(ob, key)
+
+ # Done
+ return NS
+
+ except Exception:
+ return {}
+
+
+ def _getSignature(self, objectName):
+ """ _getSignature(objectName)
+
+ Get the signature of builtin, function or method.
+ Returns a tuple (signature_string, kind), where kind is a string
+ of one of the above. When none of the above, both elements in
+ the tuple are an empty string.
+
+ """
+
+ # if a class, get init
+ # not if an instance! -> try __call__ instead
+ # what about self?
+
+ # Get valid object names
+ parts = objectName.rsplit('.')
+ objectNames = ['.'.join(parts[-i:]) for i in range(1,len(parts)+1)]
+
+ # find out what kind of function, or if a function at all!
+ NS = self._getNameSpace()
+ fun1 = eval("inspect.isbuiltin(%s)"%(objectName), None, NS)
+ fun2 = eval("inspect.isfunction(%s)"%(objectName), None, NS)
+ fun3 = eval("inspect.ismethod(%s)"%(objectName), None, NS)
+ fun4 = False
+ fun5 = False
+ if not (fun1 or fun2 or fun3):
+ # Maybe it's a class with an init?
+ if eval("hasattr(%s,'__init__')"%(objectName), None, NS):
+ objectName += ".__init__"
+ fun4 = eval("inspect.ismethod(%s)"%(objectName), None, NS)
+ # Or a callable object?
+ elif eval("hasattr(%s,'__call__')"%(objectName), None, NS):
+ objectName += ".__call__"
+ fun5 = eval("inspect.ismethod(%s)"%(objectName), None, NS)
+
+ sigs = ""
+ if True:
+ # the first line in the docstring is usually the signature
+ tmp = eval("%s.__doc__"%(objectNames[-1]), {}, NS )
+ sigs = ''
+ if tmp:
+ sigs = tmp.splitlines()[0].strip()
+ # Test if doc has signature
+ hasSig = False
+ for name in objectNames: # list.append -> L.apend(objec) -- blabla
+ name +="("
+ if name in sigs:
+ hasSig = True
+ # If not a valid signature, do not bother ...
+ if (not hasSig) or (sigs.count("(") != sigs.count(")")):
+ sigs = ""
+
+ if fun1:
+ # We only have docstring, because we cannot introspect
+ if sigs:
+ kind = 'builtin'
+ else:
+ kind = ''
+
+ elif fun2 or fun3 or fun4 or fun5:
+
+ if fun2:
+ kind = 'function'
+ elif fun3:
+ kind = 'method'
+ elif fun4:
+ kind = 'class'
+ elif fun5:
+ kind = 'callable'
+
+ if not sigs:
+ # Use intospection
+
+ # collect
+ tmp = eval("inspect.getargspec(%s)"%(objectName), None, NS)
+ args, varargs, varkw, defaults = tmp
+
+ # prepare defaults
+ if defaults == None:
+ defaults = ()
+ defaults = list(defaults)
+ defaults.reverse()
+ # make list (back to forth)
+ args2 = []
+ for i in range(len(args)-fun4):
+ arg = args.pop()
+ if i < len(defaults):
+ args2.insert(0, "%s=%s" % (arg, defaults[i]) )
+ else:
+ args2.insert(0, arg )
+ # append varargs and kwargs
+ if varargs:
+ args2.append( "*"+varargs )
+ if varkw:
+ args2.append( "**"+varkw )
+
+ # append the lot to our string
+ funname = objectName.split('.')[-1]
+ sigs = "%s(%s)" % ( funname, ", ".join(args2) )
+
+ else:
+ sigs = ""
+ kind = ""
+
+ return sigs, kind
+
+
+ # todo: variant that also says whether it's a property/function/class/other
+ def dir(self, objectName):
+ """ dir(objectName)
+
+ Get list of attributes for the given name.
+
+ """
+ #sys.__stdout__.write('handling '+objectName+'\n')
+ #sys.__stdout__.flush()
+
+ # Get namespace
+ NS = self._getNameSpace()
+
+ # Init names
+ names = set()
+
+ # Obtain all attributes of the class
+ try:
+ command = "dir(%s.__class__)" % (objectName)
+ d = eval(command, {}, NS)
+ except Exception:
+ pass
+ else:
+ names.update(d)
+
+ # Obtain instance attributes
+ try:
+ command = "%s.__dict__.keys()" % (objectName)
+ d = eval(command, {}, NS)
+ except Exception:
+ pass
+ else:
+ names.update(d)
+
+ # That should be enough, but in case __dir__ is overloaded,
+ # query that as well
+ try:
+ command = "dir(%s)" % (objectName)
+ d = eval(command, {}, NS)
+ except Exception:
+ pass
+ else:
+ names.update(d)
+
+ # Respond
+ return list(names)
+
+
+ def dir2(self, objectName):
+ """ dir2(objectName)
+
+ Get variable names in currently active namespace plus extra information.
+ Returns a list with strings, which each contain a (comma separated)
+ list of elements: name, type, kind, repr.
+
+ """
+ try:
+ name = ''
+ names = ['','']
+ def storeInfo(name, val):
+ # Determine type
+ typeName = type(val).__name__
+ # Determine kind
+ kind = typeName
+ if typeName != 'type':
+ if hasattr(val, '__array__') and hasattr(val, 'dtype'):
+ kind = 'array'
+ elif isinstance(val, list):
+ kind = 'list'
+ elif isinstance(val, tuple):
+ kind = 'tuple'
+ # Determine representation
+ if kind == 'array':
+ tmp = 'x'.join([str(s) for s in val.shape])
+ if tmp:
+ repres = '<array %s %s>' % (tmp, val.dtype.name)
+ elif val.size:
+ tmp = str(float(val))
+ if 'int' in val.dtype.name:
+ tmp = str(int(val))
+ repres = '<array scalar %s (%s)>' % (val.dtype.name, tmp)
+ else:
+ repres = '<array empty %s>' % (val.dtype.name)
+ elif kind == 'list':
+ repres = '<list with %i elements>' % len(val)
+ elif kind == 'tuple':
+ repres = '<tuple with %i elements>' % len(val)
+ else:
+ repres = repr(val)
+ if len(repres) > 80:
+ repres = repres[:77] + '...'
+ # Store
+ tmp = ','.join([name, typeName, kind, repres])
+ names.append(tmp)
+
+ # Get locals
+ NS = self._getNameSpace(objectName)
+ for name in NS.keys():
+ if not name.startswith('__'):
+ try:
+ storeInfo(name, NS[name])
+ except Exception:
+ pass
+
+ return names
+
+ except Exception:
+ return []
+
+
+ def signature(self, objectName):
+ """ signature(objectName)
+
+ Get signature.
+
+ """
+ try:
+ text, kind = self._getSignature(objectName)
+ return text
+ except Exception:
+ return None
+
+
+ def doc(self, objectName):
+ """ doc(objectName)
+
+ Get documentation for an object.
+
+ """
+
+ # Get namespace
+ NS = self._getNameSpace()
+
+ try:
+
+ # collect docstring
+ h_text = ''
+ # Try using the class (for properties)
+ try:
+ className = eval("%s.__class__.__name__"%(objectName), {}, NS)
+ if '.' in objectName:
+ tmp = objectName.rsplit('.',1)
+ tmp[1] += '.'
+ else:
+ tmp = [objectName, '']
+ if className not in ['type', 'module', 'builtin_function_or_method']:
+ cmd = "%s.__class__.%s__doc__"
+ h_text = eval(cmd % (tmp[0],tmp[1]), {}, NS)
+ except Exception:
+ pass
+
+ # Normal doc
+ if not h_text:
+ h_text = eval("%s.__doc__"%(objectName), {}, NS )
+
+ # collect more data
+ h_repr = eval("repr(%s)"%(objectName), {}, NS )
+ try:
+ h_class = eval("%s.__class__.__name__"%(objectName), {}, NS )
+ except Exception:
+ h_class = "unknown"
+
+ # docstring can be None, but should be empty then
+ if not h_text:
+ h_text = ""
+
+ # get and correct signature
+ h_fun, kind = self._getSignature(objectName)
+ if kind == 'builtin' or not h_fun:
+ h_fun = "" # signature already in docstring or not available
+
+ # cut repr if too long
+ if len(h_repr) > 200:
+ h_repr = h_repr[:200] + "..."
+ # replace newlines so we can separates the different parts
+ h_repr = h_repr.replace('\n', '\r')
+
+ # build final text
+ text = '\n'.join([objectName, h_class, h_fun, h_repr, h_text])
+
+ except Exception:
+ text = '\n'.join([objectName, '', '', '', 'No help available.'])
+
+ # The lines below can be uncomented for debugging, but they don't
+ # work on python < 2.6.
+# except Exception as why:
+# text = "No help available." + str(why)
+
+ # Done
+ return text
+
+
+ def eval(self, command):
+ """ eval(command)
+
+ Evaluate a command and return result.
+
+ """
+
+ # Get namespace
+ NS = self._getNameSpace()
+
+ try:
+ # here globals is None, so we can look into sys, time, etc...
+ return eval(command, None, NS)
+ except Exception:
+ return 'Error evaluating: ' + command
+
+
+ def interrupt(self, command=None):
+ """ interrupt()
+
+ Interrupt the main thread. This does not work if the main thread
+ is running extension code.
+
+ A bit of a hack to do this in the introspector, but it's the
+ easeast way and prevents having to launch another thread just
+ to wait for an interrupt/terminare command.
+
+ Note that on POSIX we can send an OS INT signal, which is faster
+ and maybe more effective in some situations.
+
+ """
+ thread.interrupt_main()
+
+
+ def terminate(self, command=None):
+ """ terminate()
+
+ Ask the kernel to terminate by closing the stdin.
+
+ """
+ sys.stdin._channel.close()
diff --git a/iep/iepkernel/magic.py b/iep/iepkernel/magic.py
new file mode 100644
index 0000000..cc80b4d
--- /dev/null
+++ b/iep/iepkernel/magic.py
@@ -0,0 +1,475 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+"""
+Magic commands for the IEP kernel.
+No need to use printDirect here, magic commands are just like normal Python
+commands, in the sense that they print something etc.
+"""
+
+import sys
+import os
+import time
+
+# Set Python version and get some names
+PYTHON_VERSION = sys.version_info[0]
+if PYTHON_VERSION < 3:
+ input = raw_input
+
+MESSAGE = """List of *magic* commands:
+ ? - show this message
+ ?X or X? - show docstring of X
+ ??X or X?? - help(X)
+ cd - show current directory
+ cd X - change directory
+ ls - list current directory
+ who - list variables in current workspace
+ whos - list variables plus their class and representation
+ timeit X - times execution of command X
+ open X - open file X or the Python module that defines object X
+ run X - run file X
+ pip - manage packages using pip
+ conda - manage packages using conda
+ db X - debug commands
+"""
+
+
+TIMEIT_MESSAGE = """Time execution duration. Usage:
+ timeit fun # where fun is a callable
+ timeit 'expression'
+ timeit expression
+ timeit 20 fun/expression # tests 20 passes
+"""
+
+
+class Magician:
+
+ def _eval(self, command):
+
+ # Get namespace
+ NS1 = sys._iepInterpreter.locals
+ NS2 = sys._iepInterpreter.globals
+ if not NS2:
+ NS = NS1
+ else:
+ NS = NS2.copy()
+ NS.update(NS1)
+
+ # Evaluate in namespace
+ return eval(command, {}, NS)
+
+
+ def convert_command(self, line):
+ """ convert_command(line)
+
+ Convert a given command from a magic command to Python code.
+ Returns the converted command if it was a magic command, or
+ the original otherwise.
+
+ """
+ # Get converted command, catch and report errors
+ try:
+ res = self._convert_command(line)
+ except Exception:
+ # Try informing about line number
+ type, value, tb = sys.exc_info()
+ msg = 'Error in handling magic function:\n'
+ msg += ' %s\n' % str(value)
+ if tb.tb_next: tb = tb.tb_next.tb_next
+ while tb:
+ msg += ' line %i in %s\n' % (tb.tb_lineno, tb.tb_frame.f_code.co_filename)
+ tb = tb.tb_next
+ # Clear
+ del tb
+ # Write
+ print(msg)
+ return None
+
+ # Process
+ if res is None:
+ return line
+ else:
+ return res
+
+
+ def _convert_command(self, line):
+
+ # Get interpreter
+ interpreter = sys._iepInterpreter
+
+ # Check if it is a variable
+ command = line.rstrip()
+ if ' ' not in command:
+ if command in interpreter.locals:
+ return
+ if interpreter.globals and command in interpreter.globals:
+ return
+
+ # Clean and make case insensitive
+ command = line.upper().rstrip()
+
+ if not command:
+ return
+
+ # Commands to always support (also with IPython)
+
+ elif command.startswith('DB'):
+ return self.debug(line, command)
+
+ elif command.startswith('CONDA'):
+ return self.conda(line, command)
+
+ elif command.startswith('PIP'):
+ return self.pip(line, command)
+
+ elif command.startswith('OPEN '):
+ return self.open(line, command)
+
+ elif interpreter._ipython:
+ # Patch IPython magic
+
+ # EDIT do not run code after editing
+ if command.startswith('EDIT ') and not ' -X ' in command:
+ parts = line.split(' ')
+ return 'edit -x ' + line[5:]
+
+ # In all cases stop processing magic commands
+ return
+
+ # Commands that we only support in the absense of IPtython
+
+ elif command == '?':
+ return 'print(%s)' % repr(MESSAGE)
+
+ elif command.startswith("??"):
+ return 'help(%s)' % line[2:].rstrip()
+ elif command.endswith("??"):
+ return 'help(%s)' % line.rstrip()[:-2]
+
+ elif command.startswith("?"):
+ return 'print(%s.__doc__)' % line[1:].rstrip()
+
+ elif command.endswith("?"):
+ return 'print(%s.__doc__)' % line.rstrip()[:-1]
+
+ elif command.startswith('CD'):
+ return self.cd(line, command)
+
+ elif command.startswith('LS'):
+ return self.ls(line, command)
+
+ elif command.startswith('TIMEIT'):
+ return self.timeit(line, command)
+
+ elif command == 'WHO':
+ return self.who(line, command)
+
+ elif command == 'WHOS':
+ return self.whos(line, command)
+
+ elif command.startswith('RUN '):
+ return self.run(line, command)
+
+
+ def debug(self, line, command):
+ if command == 'DB':
+ line = 'db help'
+ elif not command.startswith('DB '):
+ return
+
+ # Get interpreter
+ interpreter = sys._iepInterpreter
+ # Get command and arg
+ line += ' '
+ _, cmd, arg = line.split(' ', 2)
+ cmd = cmd.lower()
+ # Get func
+ func = getattr(interpreter.debugger, 'do_'+cmd, None)
+ # Call or show warning
+ if func is not None:
+ func(arg.strip())
+ else:
+ interpreter.write("Unknown debug command: %s.\n" % cmd)
+ # Done (no code to execute)
+ return ''
+
+
+ def cd(self, line, command):
+ if command == 'CD' or command.startswith("CD ") and '=' not in command:
+ path = line[3:].strip()
+ if path:
+ try:
+ os.chdir(path)
+ except Exception:
+ print('Could not change to directory "%s".' % path)
+ return ''
+ newPath = os.getcwd()
+ else:
+ newPath = os.getcwd()
+ # Done
+ print(repr(newPath))
+ return ''
+
+ def ls(self, line, command):
+ if command == 'LS' or command.startswith("LS ") and '=' not in command:
+ path = line[3:].strip()
+ if not path:
+ path = os.getcwd()
+ L = [p for p in os.listdir(path) if not p.startswith('.')]
+ text = '\n'.join(sorted(L))
+ # Done
+ print(text)
+ return ''
+
+
+ def timeit(self, line, command):
+ if command == "TIMEIT":
+ return 'print(%s)' % repr(TIMEIT_MESSAGE)
+ elif command.startswith("TIMEIT "):
+ expression = line[7:]
+ # Get number of iterations
+ N = 1
+ tmp = expression.split(' ',1)
+ if len(tmp)==2:
+ try:
+ N = int(tmp[0])
+ expression = tmp[1]
+ except Exception:
+ N = 1
+ if expression[0] not in '\'\"':
+ if not expression.isidentifier():
+ expression = "'%s'" % expression
+ # Compile expression
+ line2 = 'import timeit; t=timeit.Timer(%s);' % expression
+ line2 += 'print(str( t.timeit(%i)/%i ) ' % (N, N)
+ line2 += '+" seconds on average for %i iterations." )' % N
+ #
+ return line2
+
+
+ def who(self, line, command):
+ L = self._eval('dir()\n')
+ L = [k for k in L if not k.startswith('__')]
+ if L:
+ print(', '.join(L))
+ else:
+ print("There are no variables defined in this scope.")
+ return ''
+
+
+ def _justify(self, line, width, offset):
+ realWidth = width - offset
+ if len(line) > realWidth:
+ line = line[:realWidth-3] + '...'
+ return line.ljust(width)
+
+
+ def whos(self, line, command):
+ # Get list of variables
+ L = self._eval('dir()\n')
+ L = [k for k in L if not k.startswith('__')]
+ # Anny variables?
+ if not L:
+ print("There are no variables defined in this scope.")
+ return ''
+ else:
+ text = "VARIABLE: ".ljust(20,' ') + "TYPE: ".ljust(20,' ')
+ text += "REPRESENTATION: ".ljust(20,' ') + '\n'
+ # Create list item for each variablee
+ for name in L:
+ ob = self._eval(name)
+ cls = ''
+ if hasattr(ob, '__class__'):
+ cls = ob.__class__.__name__
+ rep = repr(ob)
+ text += self._justify(name,20,2) + self._justify(cls,20,2)
+ text += self._justify(rep,40,2) + '\n'
+ # Done
+ print(text)
+ return ''
+
+
+ def open(self, line, command):
+
+ # Get what to open
+ name = line.split(' ',1)[1].strip()
+ fname = ''
+
+ # Is it a file name?
+ tmp = os.path.join(os.getcwd(), name)
+ #
+ if name[0] in '"\'' and name[-1] in '"\'': # Explicitly given
+ fname = name[1:-1]
+ elif os.path.isfile(tmp):
+ fname = tmp
+ elif os.path.isfile(name):
+ fname = name
+
+ else:
+ # Then it maybe is an object
+
+ # Get the object
+ try:
+ ob = self._eval(name)
+ except NameError:
+ print('There is no object known as "%s"' % name)
+ return ''
+
+ # Get its file name
+ fname is None
+ if hasattr(ob, '__file__'):
+ fname = ob.__file__
+ elif hasattr(ob, '__module__'):
+ tmp = sys.modules[ob.__module__]
+ if hasattr(tmp, '__file__'):
+ fname = tmp.__file__
+
+ # Make .py from .pyc
+ if fname and fname.endswith('.pyc') or fname.endswith('.pyo'):
+ fname2 = fname
+ fname = fname[:-1]
+ if not os.path.isfile(fname):
+ print('Could not find source file for "%s".' % fname2)
+ return ''
+
+ # Almost done
+ # todo: shell also supports "open LINENR FILENAME"
+ # IPython's edit now support this via our hook in interpreter.py
+ if not fname:
+ print('Could not determine file name for object "%s".' % name)
+ else:
+ action = 'open %s' % os.path.abspath(fname)
+ sys._iepInterpreter.context._strm_action.send(action)
+ #
+ return ''
+
+
+ def run(self, line, command):
+
+ # Get what to open
+ name = line.split(' ',1)[1].strip()
+ fname = ''
+
+ # Enable dealing with qoutes
+ if name[0] in '"\'' and name[-1] in '"\'':
+ name = name[1:-1]
+
+ # Is it a file name?
+ tmp = os.path.join(os.getcwd(), name)
+ #
+ if os.path.isfile(tmp):
+ fname = tmp
+ elif os.path.isfile(name):
+ fname = name
+
+ # Go run!
+ if not fname:
+ print('Could not find file to run "%s".' % name)
+ else:
+ sys._iepInterpreter.runfile(fname)
+ #
+ return ''
+
+
+ def conda(self, line, command):
+
+ if not (command == 'CONDA' or command.startswith('CONDA ')):
+ return
+
+ # Get command args
+ args = line.split(' ')
+ args = [w for w in args if w]
+ args.pop(0) # remove 'conda'
+
+ # Stop if user does "conda = ..."
+ if args and '=' in args[0]:
+ return
+
+ # Go!
+ # Weird double-try, to make work on Python 2.4
+ oldargs = sys.argv
+ try:
+ try:
+ import conda
+ from conda.cli import main
+ sys.argv = ['conda'] + list(args)
+ if args and args[0] in ('install', 'update', 'remove'):
+ self._check_imported_modules()
+ main()
+ except SystemExit: # as err:
+ type, err, tb = sys.exc_info(); del tb
+ err = str(err)
+ if len(err) > 4: # Only print if looks like a message
+ print(err)
+ except Exception: # as err:
+ type, err, tb = sys.exc_info(); del tb
+ print('Error in conda command:')
+ print(err)
+ finally:
+ sys.argv = oldargs
+
+ return ''
+
+ def _check_imported_modules(self):
+ KNOWN_PURE_PYHON = ('conda', 'yaml', 'IPython', 'requests',
+ 'readline', 'pyreadline')
+ if not sys.platform.startswith('win'):
+ return # Only a problem on Windows
+ # Check what modules are currently imported
+ loaded_modules = set()
+ for name, mod in sys.modules.items():
+ if 'site-packages' in getattr(mod, '__file__', ''):
+ name = name.split('.')[0]
+ if name.startswith('_') or name in KNOWN_PURE_PYHON:
+ continue
+ loaded_modules.add(name)
+ # Add PySide PyQt4 from IEP if prefix is the same
+ if os.getenv('IEP_PREFIX', '') == sys.prefix:
+ loaded_modules.add(os.getenv('IEP_QTLIB', 'qt'))
+ # Warn if we have any such modules
+ loaded_modules = [m.lower() for m in loaded_modules if m]
+ if loaded_modules:
+ print('WARNING! The following modules are currently loaded:\n')
+ print(' ' + ', '.join(sorted(loaded_modules)))
+ print('\nUpdating or removing them may fail if they are not '
+ 'pure Python.\nIf none of the listed packages is updated or '
+ 'removed, it is safe\nto proceed (use "f" if necessary).\n')
+ print('-'*80)
+ time.sleep(2.0) # Give user time to realize there is a warning
+
+ def pip(self, line, command):
+
+ if not (command == 'PIP' or command.startswith('PIP ')):
+ return
+
+ # Get command args
+ args = line.split(' ')
+ args = [w for w in args if w]
+ args.pop(0) # remove 'pip'
+
+ # Stop if user does "pip = ..."
+ if args and '=' in args[0]:
+ return
+
+ # Tweak the args
+ if args[0] == 'uninstall':
+ args.insert(1, '--yes')
+
+ # Go!
+ try:
+ from iepkernel.pipper import pip_command
+ pip_command(*args)
+ except SystemExit: # as err:
+ type, err, tb = sys.exc_info(); del tb
+ err = str(err)
+ if len(err) > 4: # Only print if looks like a message
+ print(err)
+ except Exception:# as err:
+ type, err, tb = sys.exc_info(); del tb
+ print('Error in pip command:')
+ print(err)
+
+ return ''
diff --git a/iep/iepkernel/pipper.py b/iep/iepkernel/pipper.py
new file mode 100644
index 0000000..2fe58c7
--- /dev/null
+++ b/iep/iepkernel/pipper.py
@@ -0,0 +1,79 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, Almar Klein
+
+# From iep/iepkernel
+
+import os
+import sys
+import time
+import subprocess
+
+
+def subprocess_with_callback(callback, cmd, **kwargs):
+ """ Execute command in subprocess, stdout is passed to the
+ callback function. Returns the returncode of the process.
+ If callback is None, simply prints any stdout.
+ """
+
+ # Set callback to void if None
+ if callback is None:
+ callback = lambda x:None
+
+ # Execute command
+ try:
+ p = subprocess.Popen(cmd,
+ stdout=subprocess.PIPE, stderr=subprocess.STDOUT,
+ **kwargs)
+ except OSError:
+ type, err, tb = sys.exc_info(); del tb
+ callback(str(err)+'\n')
+ return -1
+
+ pending = []
+ while p.poll() is None:
+ time.sleep(0.001)
+ # Read text and process
+ c = p.stdout.read(1).decode('utf-8', 'ignore')
+ pending.append(c)
+ if c in '.\n':
+ callback(''.join(pending))
+ pending = []
+
+ # Process remaining text
+ pending.append( p.stdout.read().decode('utf-8') )
+ callback( ''.join(pending) )
+
+ # Done
+ return p.returncode
+
+
+
+def print_(p):
+ sys.stdout.write(p)
+ sys.stdout.flush()
+
+
+
+def pip_command_exe(exe, *args):
+ """ Do a pip command in the interpreter with the given exe.
+ """
+
+ # Get pip command
+ cmd = [exe, '-m', 'pip'] + list(args)
+
+ # Execute it
+ subprocess_with_callback(print_, cmd)
+
+
+
+def pip_command(*args):
+ """ Do a pip command, e.g. "install pyzolib".
+ Installs in the current interpreter.
+ """
+ pip_command_exe(sys.executable, *args)
+
+
+
+if __name__ == '__main__':
+ pip_command('install', 'pyzolib')
+
\ No newline at end of file
diff --git a/iep/iepkernel/start.py b/iep/iepkernel/start.py
new file mode 100644
index 0000000..09b33b2
--- /dev/null
+++ b/iep/iepkernel/start.py
@@ -0,0 +1,165 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+""" iepkernel/start.py
+
+Starting script for remote processes in iep.
+This script connects to the IEP ide using the yoton interface
+and imports remote2 to start the interpreter and introspection thread.
+
+Channels
+--------
+There are four groups of channels. The ctrl channels are streams from
+the ide to the kernel and/or broker. The strm channels are streams to
+the ide. The stat channels are status channels. The reqp channels are
+req/rep channels. All channels are TEXT except for a few OBJECT channels.
+
+ctrl-command: to give simple commands to the interpreter (ala stdin)
+ctrl-code (OBJECT): to let the interpreter execute blocks of code
+ctrl-broker: to control the broker (restarting etc)
+
+strm-out: the stdout of the interpreter
+strm-err: the stderr of the interpreter
+strm-raw: the C-level stdout and stderr of the interpreter (captured by broker)
+strm-echo: the interpreters echos commands here
+strm-prompt: to send the prompts explicitly
+strm-broker: for the broker to send messages to the ide
+strm-action: for the kernel to push actions to the ide
+
+stat-interpreter): status of the interpreter (ready, busy, very busy, more, etc)
+stat-debug (OBJECT): debug status
+stat-startup (OBJECT): Used to pass startup parameters to the kernel
+
+reqp-introspect (OBJECT): To query information from the kernel (and for interruping)
+
+"""
+
+# This file is executed with the active directory one up from this file.
+
+import os
+import sys
+import time
+import yoton
+import __main__ # we will run code in the __main__.__dict__ namespace
+
+
+## Make connection object and get channels
+
+# Create a yoton context. All channels are stored at the context.
+ct = yoton.Context()
+
+# Create control channels
+ct._ctrl_command = yoton.SubChannel(ct, 'ctrl-command')
+ct._ctrl_code = yoton.SubChannel(ct, 'ctrl-code', yoton.OBJECT)
+
+# Create stream channels
+ct._strm_out = yoton.PubChannel(ct, 'strm-out')
+ct._strm_err = yoton.PubChannel(ct, 'strm-err')
+ct._strm_echo = yoton.PubChannel(ct, 'strm-echo')
+ct._strm_prompt = yoton.PubChannel(ct, 'strm-prompt')
+ct._strm_action = yoton.PubChannel(ct, 'strm-action', yoton.OBJECT)
+
+# Create status channels
+ct._stat_interpreter = yoton.StateChannel(ct, 'stat-interpreter')
+ct._stat_debug = yoton.StateChannel(ct, 'stat-debug', yoton.OBJECT)
+ct._stat_startup = yoton.StateChannel(ct, 'stat-startup', yoton.OBJECT)
+ct._stat_breakpoints = yoton.StateChannel(ct, 'stat-breakpoints', yoton.OBJECT)
+
+# Connect (port number given as command line argument)
+# Important to do this *before* replacing the stdout etc, because if an
+# error occurs here, it will be printed in the shell.
+port = int(sys.argv[1])
+ct.connect('localhost:'+str(port), timeout=1.0)
+
+# Create file objects for stdin, stdout, stderr
+sys.stdin = yoton.FileWrapper( ct._ctrl_command, echo=ct._strm_echo )
+sys.stdout = yoton.FileWrapper( ct._strm_out, 256 )
+sys.stderr = yoton.FileWrapper( ct._strm_err, 256 )
+
+
+## Set Excepthook
+
+def iep_excepthook(type, value, tb):
+ import sys
+ def writeErr(err):
+ sys.__stderr__.write(str(err)+'\n')
+ sys.__stderr__.flush()
+ writeErr("Uncaught exception in interpreter:")
+ writeErr(value)
+ if not isinstance(value, (OverflowError, SyntaxError, ValueError)):
+ while tb:
+ writeErr("-> line %i of %s." % (
+ tb.tb_frame.f_lineno, tb.tb_frame.f_code.co_filename) )
+ tb = tb.tb_next
+ import time
+ time.sleep(0.3) # Give some time for the message to be send
+
+# Uncomment to detect error in the interpreter itself.
+# But better not use it by default. For instance errors in qt events
+# are also catched by this function. I think that is because it would
+# allow you to show such exceptions in an error dialog.
+#sys.excepthook = iep_excepthook
+
+
+## Init interpreter and introspector request channel
+
+# Delay import, so we can detect syntax errors using the except hook
+from iepkernel.interpreter import IepInterpreter
+from iepkernel.introspection import IepIntrospector
+
+# Create interpreter instance and give dict in which to run all code
+__iep__ = IepInterpreter( __main__.__dict__, '<console>')
+sys._iepInterpreter = __iep__
+
+# Store context
+__iep__.context = ct
+
+# Create introspection req channel (store at interpreter instance)
+__iep__.introspector = IepIntrospector(ct, 'reqp-introspect')
+
+
+## Clean up
+
+# Delete local variables
+del yoton, IepInterpreter, IepIntrospector, iep_excepthook
+del ct, port
+del os, sys, time
+
+# Delete stuff we do not want
+for name in [ '__file__', # __main__ does not have a corresponding file
+ '__loader__' # prevent lines from this file to be shown in tb
+ ]:
+ globals().pop(name, None)
+
+
+## Start and stop
+
+# Start introspector and enter the interpreter
+__iep__.introspector.set_mode('thread')
+
+try:
+ __iep__.run()
+
+finally:
+ # Restore original streams, so that SystemExit behaves as intended
+ import sys
+ try:
+ sys.stdout, sys.stderr = sys.__stdout__, sys.__stderr__
+ except Exception:
+ pass
+ # Flush pending messages (raises exception if times out)
+ try:
+ __iep__.context.flush(0.1)
+ except Exception:
+ pass
+ # Nicely exit by closing context (closes channels and connections). If we do
+ # not do this on Python 3.2 (at least Windows) the exit delays 10s. (issue 79)
+ try:
+ __iep__.introspector.set_mode(0)
+ __iep__.context.close()
+ except Exception:
+ pass
diff --git a/iep/license.txt b/iep/license.txt
new file mode 100644
index 0000000..29a4b21
--- /dev/null
+++ b/iep/license.txt
@@ -0,0 +1,25 @@
+IEP is subject to the (new) BSD license:
+
+Copyright (C) 2013, the IEP development team
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+* Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+* Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+* Neither the name of its contributors nor their affiliation may be
+ used to endorse or promote products derived from this software without
+ specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ARE DISCLAIMED. IN NO EVENT SHALL THE IEP DEVELOPMENT TEAM BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/iep/resources/appicons/ieplogo.icns b/iep/resources/appicons/ieplogo.icns
new file mode 100644
index 0000000..5d61d7c
Binary files /dev/null and b/iep/resources/appicons/ieplogo.icns differ
diff --git a/iep/resources/appicons/ieplogo.ico b/iep/resources/appicons/ieplogo.ico
new file mode 100644
index 0000000..4183c48
Binary files /dev/null and b/iep/resources/appicons/ieplogo.ico differ
diff --git a/iep/resources/appicons/ieplogo128.png b/iep/resources/appicons/ieplogo128.png
new file mode 100644
index 0000000..b9f6448
Binary files /dev/null and b/iep/resources/appicons/ieplogo128.png differ
diff --git a/iep/resources/appicons/ieplogo16.png b/iep/resources/appicons/ieplogo16.png
new file mode 100644
index 0000000..d06e4f1
Binary files /dev/null and b/iep/resources/appicons/ieplogo16.png differ
diff --git a/iep/resources/appicons/ieplogo256.png b/iep/resources/appicons/ieplogo256.png
new file mode 100644
index 0000000..edb0d76
Binary files /dev/null and b/iep/resources/appicons/ieplogo256.png differ
diff --git a/iep/resources/appicons/ieplogo32.png b/iep/resources/appicons/ieplogo32.png
new file mode 100644
index 0000000..60b37da
Binary files /dev/null and b/iep/resources/appicons/ieplogo32.png differ
diff --git a/iep/resources/appicons/ieplogo48.png b/iep/resources/appicons/ieplogo48.png
new file mode 100644
index 0000000..0b798b2
Binary files /dev/null and b/iep/resources/appicons/ieplogo48.png differ
diff --git a/iep/resources/appicons/ieplogo64.png b/iep/resources/appicons/ieplogo64.png
new file mode 100644
index 0000000..9f86f13
Binary files /dev/null and b/iep/resources/appicons/ieplogo64.png differ
diff --git a/iep/resources/appicons/py.icns b/iep/resources/appicons/py.icns
new file mode 100644
index 0000000..8273c75
Binary files /dev/null and b/iep/resources/appicons/py.icns differ
diff --git a/iep/resources/appicons/py.ico b/iep/resources/appicons/py.ico
new file mode 100644
index 0000000..2d789da
Binary files /dev/null and b/iep/resources/appicons/py.ico differ
diff --git a/iep/resources/appicons/pyzologo128.png b/iep/resources/appicons/pyzologo128.png
new file mode 100644
index 0000000..f51d947
Binary files /dev/null and b/iep/resources/appicons/pyzologo128.png differ
diff --git a/iep/resources/appicons/pyzologo16.png b/iep/resources/appicons/pyzologo16.png
new file mode 100644
index 0000000..4855df0
Binary files /dev/null and b/iep/resources/appicons/pyzologo16.png differ
diff --git a/iep/resources/appicons/pyzologo256.png b/iep/resources/appicons/pyzologo256.png
new file mode 100644
index 0000000..fa15039
Binary files /dev/null and b/iep/resources/appicons/pyzologo256.png differ
diff --git a/iep/resources/appicons/pyzologo32.png b/iep/resources/appicons/pyzologo32.png
new file mode 100644
index 0000000..7cec583
Binary files /dev/null and b/iep/resources/appicons/pyzologo32.png differ
diff --git a/iep/resources/appicons/pyzologo48.png b/iep/resources/appicons/pyzologo48.png
new file mode 100644
index 0000000..82f212c
Binary files /dev/null and b/iep/resources/appicons/pyzologo48.png differ
diff --git a/iep/resources/appicons/pyzologo64.png b/iep/resources/appicons/pyzologo64.png
new file mode 100644
index 0000000..636a29b
Binary files /dev/null and b/iep/resources/appicons/pyzologo64.png differ
diff --git a/iep/resources/defaultConfig.ssdf b/iep/resources/defaultConfig.ssdf
new file mode 100644
index 0000000..fa2a946
--- /dev/null
+++ b/iep/resources/defaultConfig.ssdf
@@ -0,0 +1,124 @@
+# This Simple Structured Data Format (SSDF) file contains the default
+# configuration for IEP. The user configuration is stored in the IEP
+# application data directory.
+
+# Some parameters are named xxx2. This was done in case the representation
+# of a parameter was changed, or if we wanted to "refresh" the parameter for
+# another reason. This enables using the same config file for all versions,
+# which means that users that start using a new version dont have to recreate
+# all their settings each time.
+
+state = dict:
+ find_regExp = 0
+ find_matchCase = 0
+ find_wholeWord = 0
+ find_show = 0
+ find_autoHide = 1
+ editorState2 = [] # What files where loaded and where the cursor was
+ loadedTools = []
+ windowState = '' # Of window and tools
+ windowGeometry = '' # Position and size of window, whether maximized, etc.
+ newUser = 1 # So we can guide new users a bit
+
+view = dict:
+ showWhitespace = 0
+ showLineEndings = 0
+ showWrapSymbols = 0
+ showIndentationGuides = 1
+ showStatusbar = 0
+ #
+ wrap = 1
+ highlightCurrentLine = 1
+ doBraceMatch = 1 # Both in editor and shell
+ codeFolding = 0
+ autoComplete_popupSize = [300, 100]
+ #
+ qtstyle = ''
+ edgeColumn = 80
+ fontname = 'DejaVu Sans Mono'
+ zoom = 0 # Both for editor and shell
+ tabWidth = 4
+
+settings= dict:
+ language = ''
+ defaultStyle = 'python'
+ defaultIndentWidth = 4
+ defaultIndentUsingSpaces = 1
+ defaultLineEndings = '' # Set depending on OS
+ autoIndent = 1
+ autoCallTip = 1
+ autoComplete_keywords = 1
+ autoComplete = 1
+ autoComplete_caseSensitive = 0
+ autoComplete_fillups = '\n'
+ autoComplete_acceptKeys = 'Tab'
+ justificationWidth = 70
+ removeTrailingWhitespaceWhenSaving = 0
+
+advanced = dict:
+ shellMaxLines = 10000
+ fileExtensionsToLoadFromDir = 'py,pyw,pyx,txt,bat'
+ autoCompDelay = 200
+ titleText = '{fileName} ({fullPath}) - Interactive Editor for Python'
+ homeAndEndWorkOnDisplayedLine = 0
+ find_autoHide_timeout = 10
+
+tools = dict:
+ ieplogger = dict:
+ iepinteractivehelp = dict:
+ noNewlines = 1
+ iepsourcestructure = dict:
+ showTypes = ['def', 'cell', 'todo', 'class']
+ level = 3
+
+shellConfigs2 = list:
+ # Empty, let IEP create one on startup
+
+shortcuts2 = dict:
+ edit__comment = 'Ctrl+R,'
+ edit__copy = 'Ctrl+C,Ctrl+Insert'
+ edit__cut = 'Ctrl+X,Shift+Delete'
+ edit__dedent = 'Shift+Tab,'
+ edit__delete_line = 'Ctrl+D,'
+ edit__find_next = 'Ctrl+G,F3'
+ edit__find_or_replace = 'Ctrl+F,'
+ edit__find_previous = 'Ctrl+Shift+G,Shift+F3'
+ edit__find_selection = 'Ctrl+F3,'
+ edit__find_selection_backward = 'Ctrl+Shift+F3,'
+ edit__indent = 'Tab,'
+ edit__justify_commentdocstring = 'Ctrl+J,'
+ edit__paste = 'Ctrl+V,Shift+Insert'
+ edit__redo = 'Ctrl+Y,'
+ edit__select_all = 'Ctrl+A,'
+ edit__uncomment = 'Ctrl+T,'
+ edit__undo = 'Ctrl+Z,'
+ file__close = 'Ctrl+W,'
+ file__new = 'Ctrl+N,'
+ file__open = 'Ctrl+O,'
+ file__save = 'Ctrl+S,'
+ run__run_file_as_script = 'Ctrl+Shift+E,Ctrl+F5'
+ run__run_main_file_as_script = 'Ctrl+Shift+M,Ctrl+F6'
+ run__execute_selection = 'Alt+Return,F9'
+ run__execute_cell = 'Ctrl+Return,Ctrl+Enter'
+ run__execute_cell_and_advance = 'Ctrl+Shift+Return,Ctrl+Shift+Enter'
+ run__execute_file = 'Ctrl+E,F5'
+ run__execute_main_file = 'Ctrl+M,F6'
+ shell__clear_screen = 'Ctrl+L,'
+ shell__close = 'Alt+K,'
+ shell__create_shell_1_ = 'Ctrl+1,'
+ shell__create_shell_2_ = 'Ctrl+2,'
+ shell__create_shell_3_ = 'Ctrl+3,'
+ shell__create_shell_4_ = 'Ctrl+4,'
+ shell__create_shell_5_ = 'Ctrl+5,'
+ shell__create_shell_6_ = 'Ctrl+6,'
+ shell__create_shell_7_ = 'Ctrl+7,'
+ shell__create_shell_8_ = 'Ctrl+8,'
+ shell__interrupt = 'Ctrl+I,Meta+C'
+ shell__restart = 'Ctrl+K,'
+ shell__terminate = 'Ctrl+Shift+K,'
+ view__select_editor = 'Ctrl+9,F2'
+ view__select_previous_file = 'Ctrl+Tab,' # On Mac, this is replaced by Alt+Tab in iep.py
+ view__select_shell = 'Ctrl+0,F1'
+ view__zooming__zoom_in = 'Ctrl+=,Ctrl++'
+ view__zooming__zoom_out = 'Ctrl+-,'
+ view__zooming__zoom_reset = 'Ctrl+\,'
diff --git a/iep/resources/fonts/DejaVuSansMono-Bold.ttf b/iep/resources/fonts/DejaVuSansMono-Bold.ttf
new file mode 100644
index 0000000..09d4279
Binary files /dev/null and b/iep/resources/fonts/DejaVuSansMono-Bold.ttf differ
diff --git a/iep/resources/fonts/DejaVuSansMono-BoldOblique.ttf b/iep/resources/fonts/DejaVuSansMono-BoldOblique.ttf
new file mode 100644
index 0000000..0344c22
Binary files /dev/null and b/iep/resources/fonts/DejaVuSansMono-BoldOblique.ttf differ
diff --git a/iep/resources/fonts/DejaVuSansMono-Oblique.ttf b/iep/resources/fonts/DejaVuSansMono-Oblique.ttf
new file mode 100644
index 0000000..bc16d51
Binary files /dev/null and b/iep/resources/fonts/DejaVuSansMono-Oblique.ttf differ
diff --git a/iep/resources/fonts/DejaVuSansMono.ttf b/iep/resources/fonts/DejaVuSansMono.ttf
new file mode 100644
index 0000000..7260bd6
Binary files /dev/null and b/iep/resources/fonts/DejaVuSansMono.ttf differ
diff --git a/iep/resources/fonts/SourceCodePro-Bold.otf b/iep/resources/fonts/SourceCodePro-Bold.otf
new file mode 100644
index 0000000..b8a2f57
Binary files /dev/null and b/iep/resources/fonts/SourceCodePro-Bold.otf differ
diff --git a/iep/resources/fonts/SourceCodePro-Regular.otf b/iep/resources/fonts/SourceCodePro-Regular.otf
new file mode 100644
index 0000000..40208be
Binary files /dev/null and b/iep/resources/fonts/SourceCodePro-Regular.otf differ
diff --git a/iep/resources/icons/accept.png b/iep/resources/icons/accept.png
new file mode 100644
index 0000000..89c8129
Binary files /dev/null and b/iep/resources/icons/accept.png differ
diff --git a/iep/resources/icons/add.png b/iep/resources/icons/add.png
new file mode 100644
index 0000000..6332fef
Binary files /dev/null and b/iep/resources/icons/add.png differ
diff --git a/iep/resources/icons/application.png b/iep/resources/icons/application.png
new file mode 100644
index 0000000..1dee9e3
Binary files /dev/null and b/iep/resources/icons/application.png differ
diff --git a/iep/resources/icons/application_add.png b/iep/resources/icons/application_add.png
new file mode 100644
index 0000000..2e94507
Binary files /dev/null and b/iep/resources/icons/application_add.png differ
diff --git a/iep/resources/icons/application_delete.png b/iep/resources/icons/application_delete.png
new file mode 100644
index 0000000..0a335ac
Binary files /dev/null and b/iep/resources/icons/application_delete.png differ
diff --git a/iep/resources/icons/application_double.png b/iep/resources/icons/application_double.png
new file mode 100644
index 0000000..647592f
Binary files /dev/null and b/iep/resources/icons/application_double.png differ
diff --git a/iep/resources/icons/application_edit.png b/iep/resources/icons/application_edit.png
new file mode 100644
index 0000000..fb2efb8
Binary files /dev/null and b/iep/resources/icons/application_edit.png differ
diff --git a/iep/resources/icons/application_eraser.png b/iep/resources/icons/application_eraser.png
new file mode 100644
index 0000000..e869b7f
Binary files /dev/null and b/iep/resources/icons/application_eraser.png differ
diff --git a/iep/resources/icons/application_go.png b/iep/resources/icons/application_go.png
new file mode 100644
index 0000000..5cc2b0d
Binary files /dev/null and b/iep/resources/icons/application_go.png differ
diff --git a/iep/resources/icons/application_lightning.png b/iep/resources/icons/application_lightning.png
new file mode 100644
index 0000000..7e91545
Binary files /dev/null and b/iep/resources/icons/application_lightning.png differ
diff --git a/iep/resources/icons/application_link.png b/iep/resources/icons/application_link.png
new file mode 100644
index 0000000..f8fbb3e
Binary files /dev/null and b/iep/resources/icons/application_link.png differ
diff --git a/iep/resources/icons/application_refresh.png b/iep/resources/icons/application_refresh.png
new file mode 100644
index 0000000..9c1da53
Binary files /dev/null and b/iep/resources/icons/application_refresh.png differ
diff --git a/iep/resources/icons/application_shell.png b/iep/resources/icons/application_shell.png
new file mode 100644
index 0000000..491c1e8
Binary files /dev/null and b/iep/resources/icons/application_shell.png differ
diff --git a/iep/resources/icons/application_view_tile.png b/iep/resources/icons/application_view_tile.png
new file mode 100644
index 0000000..3bc0bd3
Binary files /dev/null and b/iep/resources/icons/application_view_tile.png differ
diff --git a/iep/resources/icons/application_wrench.png b/iep/resources/icons/application_wrench.png
new file mode 100644
index 0000000..4c83fb3
Binary files /dev/null and b/iep/resources/icons/application_wrench.png differ
diff --git a/iep/resources/icons/arrow_left.png b/iep/resources/icons/arrow_left.png
new file mode 100644
index 0000000..5dc6967
Binary files /dev/null and b/iep/resources/icons/arrow_left.png differ
diff --git a/iep/resources/icons/arrow_redo.png b/iep/resources/icons/arrow_redo.png
new file mode 100644
index 0000000..fdc394c
Binary files /dev/null and b/iep/resources/icons/arrow_redo.png differ
diff --git a/iep/resources/icons/arrow_refresh.png b/iep/resources/icons/arrow_refresh.png
new file mode 100644
index 0000000..0de2656
Binary files /dev/null and b/iep/resources/icons/arrow_refresh.png differ
diff --git a/iep/resources/icons/arrow_rotate_anticlockwise.png b/iep/resources/icons/arrow_rotate_anticlockwise.png
new file mode 100644
index 0000000..46c75aa
Binary files /dev/null and b/iep/resources/icons/arrow_rotate_anticlockwise.png differ
diff --git a/iep/resources/icons/arrow_rotate_clockwise.png b/iep/resources/icons/arrow_rotate_clockwise.png
new file mode 100644
index 0000000..aa65210
Binary files /dev/null and b/iep/resources/icons/arrow_rotate_clockwise.png differ
diff --git a/iep/resources/icons/arrow_undo.png b/iep/resources/icons/arrow_undo.png
new file mode 100644
index 0000000..6972c5e
Binary files /dev/null and b/iep/resources/icons/arrow_undo.png differ
diff --git a/iep/resources/icons/bug.png b/iep/resources/icons/bug.png
new file mode 100644
index 0000000..2d5fb90
Binary files /dev/null and b/iep/resources/icons/bug.png differ
diff --git a/iep/resources/icons/bug_delete.png b/iep/resources/icons/bug_delete.png
new file mode 100644
index 0000000..e81d757
Binary files /dev/null and b/iep/resources/icons/bug_delete.png differ
diff --git a/iep/resources/icons/bug_error.png b/iep/resources/icons/bug_error.png
new file mode 100644
index 0000000..c4e8c28
Binary files /dev/null and b/iep/resources/icons/bug_error.png differ
diff --git a/iep/resources/icons/bullet_yellow.png b/iep/resources/icons/bullet_yellow.png
new file mode 100644
index 0000000..6469cea
Binary files /dev/null and b/iep/resources/icons/bullet_yellow.png differ
diff --git a/iep/resources/icons/cancel.png b/iep/resources/icons/cancel.png
new file mode 100644
index 0000000..c149c2b
Binary files /dev/null and b/iep/resources/icons/cancel.png differ
diff --git a/iep/resources/icons/cog.png b/iep/resources/icons/cog.png
new file mode 100644
index 0000000..67de2c6
Binary files /dev/null and b/iep/resources/icons/cog.png differ
diff --git a/iep/resources/icons/comment_add.png b/iep/resources/icons/comment_add.png
new file mode 100644
index 0000000..75e78de
Binary files /dev/null and b/iep/resources/icons/comment_add.png differ
diff --git a/iep/resources/icons/comment_delete.png b/iep/resources/icons/comment_delete.png
new file mode 100644
index 0000000..643fdbe
Binary files /dev/null and b/iep/resources/icons/comment_delete.png differ
diff --git a/iep/resources/icons/comments.png b/iep/resources/icons/comments.png
new file mode 100644
index 0000000..39433cf
Binary files /dev/null and b/iep/resources/icons/comments.png differ
diff --git a/iep/resources/icons/cross.png b/iep/resources/icons/cross.png
new file mode 100644
index 0000000..1514d51
Binary files /dev/null and b/iep/resources/icons/cross.png differ
diff --git a/iep/resources/icons/cut.png b/iep/resources/icons/cut.png
new file mode 100644
index 0000000..f215d6f
Binary files /dev/null and b/iep/resources/icons/cut.png differ
diff --git a/iep/resources/icons/debug_continue.png b/iep/resources/icons/debug_continue.png
new file mode 100644
index 0000000..998b73e
Binary files /dev/null and b/iep/resources/icons/debug_continue.png differ
diff --git a/iep/resources/icons/debug_next.png b/iep/resources/icons/debug_next.png
new file mode 100644
index 0000000..df70015
Binary files /dev/null and b/iep/resources/icons/debug_next.png differ
diff --git a/iep/resources/icons/debug_quit.png b/iep/resources/icons/debug_quit.png
new file mode 100644
index 0000000..871ac8c
Binary files /dev/null and b/iep/resources/icons/debug_quit.png differ
diff --git a/iep/resources/icons/debug_return.png b/iep/resources/icons/debug_return.png
new file mode 100644
index 0000000..f2e119f
Binary files /dev/null and b/iep/resources/icons/debug_return.png differ
diff --git a/iep/resources/icons/debug_step.png b/iep/resources/icons/debug_step.png
new file mode 100644
index 0000000..501fd97
Binary files /dev/null and b/iep/resources/icons/debug_step.png differ
diff --git a/iep/resources/icons/delete.png b/iep/resources/icons/delete.png
new file mode 100644
index 0000000..08f2493
Binary files /dev/null and b/iep/resources/icons/delete.png differ
diff --git a/iep/resources/icons/disk.png b/iep/resources/icons/disk.png
new file mode 100644
index 0000000..99d532e
Binary files /dev/null and b/iep/resources/icons/disk.png differ
diff --git a/iep/resources/icons/disk_as.png b/iep/resources/icons/disk_as.png
new file mode 100644
index 0000000..2198152
Binary files /dev/null and b/iep/resources/icons/disk_as.png differ
diff --git a/iep/resources/icons/disk_multiple.png b/iep/resources/icons/disk_multiple.png
new file mode 100644
index 0000000..fc5a52f
Binary files /dev/null and b/iep/resources/icons/disk_multiple.png differ
diff --git a/iep/resources/icons/drive.png b/iep/resources/icons/drive.png
new file mode 100644
index 0000000..37b7c9b
Binary files /dev/null and b/iep/resources/icons/drive.png differ
diff --git a/iep/resources/icons/error_add.png b/iep/resources/icons/error_add.png
new file mode 100644
index 0000000..4c97484
Binary files /dev/null and b/iep/resources/icons/error_add.png differ
diff --git a/iep/resources/icons/filter.png b/iep/resources/icons/filter.png
new file mode 100644
index 0000000..9676045
Binary files /dev/null and b/iep/resources/icons/filter.png differ
diff --git a/iep/resources/icons/find.png b/iep/resources/icons/find.png
new file mode 100644
index 0000000..1547479
Binary files /dev/null and b/iep/resources/icons/find.png differ
diff --git a/iep/resources/icons/flag_green.png b/iep/resources/icons/flag_green.png
new file mode 100644
index 0000000..e4bc611
Binary files /dev/null and b/iep/resources/icons/flag_green.png differ
diff --git a/iep/resources/icons/folder.png b/iep/resources/icons/folder.png
new file mode 100644
index 0000000..784e8fa
Binary files /dev/null and b/iep/resources/icons/folder.png differ
diff --git a/iep/resources/icons/folder_hg.png b/iep/resources/icons/folder_hg.png
new file mode 100644
index 0000000..9f23005
Binary files /dev/null and b/iep/resources/icons/folder_hg.png differ
diff --git a/iep/resources/icons/folder_page.png b/iep/resources/icons/folder_page.png
new file mode 100644
index 0000000..1ef6e11
Binary files /dev/null and b/iep/resources/icons/folder_page.png differ
diff --git a/iep/resources/icons/folder_parent.png b/iep/resources/icons/folder_parent.png
new file mode 100644
index 0000000..8714730
Binary files /dev/null and b/iep/resources/icons/folder_parent.png differ
diff --git a/iep/resources/icons/folder_svn.png b/iep/resources/icons/folder_svn.png
new file mode 100644
index 0000000..1228b80
Binary files /dev/null and b/iep/resources/icons/folder_svn.png differ
diff --git a/iep/resources/icons/help.png b/iep/resources/icons/help.png
new file mode 100644
index 0000000..5c87017
Binary files /dev/null and b/iep/resources/icons/help.png differ
diff --git a/iep/resources/icons/information.png b/iep/resources/icons/information.png
new file mode 100644
index 0000000..12cd1ae
Binary files /dev/null and b/iep/resources/icons/information.png differ
diff --git a/iep/resources/icons/keyboard.png b/iep/resources/icons/keyboard.png
new file mode 100644
index 0000000..898d402
Binary files /dev/null and b/iep/resources/icons/keyboard.png differ
diff --git a/iep/resources/icons/layout.png b/iep/resources/icons/layout.png
new file mode 100644
index 0000000..ea086b0
Binary files /dev/null and b/iep/resources/icons/layout.png differ
diff --git a/iep/resources/icons/link.png b/iep/resources/icons/link.png
new file mode 100644
index 0000000..25eacb7
Binary files /dev/null and b/iep/resources/icons/link.png differ
diff --git a/iep/resources/icons/magifier_zoom_out.png b/iep/resources/icons/magifier_zoom_out.png
new file mode 100644
index 0000000..81f2819
Binary files /dev/null and b/iep/resources/icons/magifier_zoom_out.png differ
diff --git a/iep/resources/icons/magnifier.png b/iep/resources/icons/magnifier.png
new file mode 100644
index 0000000..cf3d97f
Binary files /dev/null and b/iep/resources/icons/magnifier.png differ
diff --git a/iep/resources/icons/magnifier_zoom_in.png b/iep/resources/icons/magnifier_zoom_in.png
new file mode 100644
index 0000000..af4fe07
Binary files /dev/null and b/iep/resources/icons/magnifier_zoom_in.png differ
diff --git a/iep/resources/icons/monitor.png b/iep/resources/icons/monitor.png
new file mode 100644
index 0000000..d040bd0
Binary files /dev/null and b/iep/resources/icons/monitor.png differ
diff --git a/iep/resources/icons/overlay_disk.png b/iep/resources/icons/overlay_disk.png
new file mode 100644
index 0000000..d502a7e
Binary files /dev/null and b/iep/resources/icons/overlay_disk.png differ
diff --git a/iep/resources/icons/overlay_hg.png b/iep/resources/icons/overlay_hg.png
new file mode 100644
index 0000000..a182da5
Binary files /dev/null and b/iep/resources/icons/overlay_hg.png differ
diff --git a/iep/resources/icons/overlay_link.png b/iep/resources/icons/overlay_link.png
new file mode 100644
index 0000000..8e7888b
Binary files /dev/null and b/iep/resources/icons/overlay_link.png differ
diff --git a/iep/resources/icons/overlay_star.png b/iep/resources/icons/overlay_star.png
new file mode 100644
index 0000000..e65e75d
Binary files /dev/null and b/iep/resources/icons/overlay_star.png differ
diff --git a/iep/resources/icons/overlay_svn.png b/iep/resources/icons/overlay_svn.png
new file mode 100644
index 0000000..268df32
Binary files /dev/null and b/iep/resources/icons/overlay_svn.png differ
diff --git a/iep/resources/icons/overlay_thumbnail.png b/iep/resources/icons/overlay_thumbnail.png
new file mode 100644
index 0000000..db6067e
Binary files /dev/null and b/iep/resources/icons/overlay_thumbnail.png differ
diff --git a/iep/resources/icons/page_add.png b/iep/resources/icons/page_add.png
new file mode 100644
index 0000000..d5bfa07
Binary files /dev/null and b/iep/resources/icons/page_add.png differ
diff --git a/iep/resources/icons/page_delete.png b/iep/resources/icons/page_delete.png
new file mode 100644
index 0000000..3141467
Binary files /dev/null and b/iep/resources/icons/page_delete.png differ
diff --git a/iep/resources/icons/page_delete_all.png b/iep/resources/icons/page_delete_all.png
new file mode 100644
index 0000000..0c2ce23
Binary files /dev/null and b/iep/resources/icons/page_delete_all.png differ
diff --git a/iep/resources/icons/page_save.png b/iep/resources/icons/page_save.png
new file mode 100644
index 0000000..caea546
Binary files /dev/null and b/iep/resources/icons/page_save.png differ
diff --git a/iep/resources/icons/page_white.png b/iep/resources/icons/page_white.png
new file mode 100644
index 0000000..70e65ff
Binary files /dev/null and b/iep/resources/icons/page_white.png differ
diff --git a/iep/resources/icons/page_white_copy.png b/iep/resources/icons/page_white_copy.png
new file mode 100644
index 0000000..a9f31a2
Binary files /dev/null and b/iep/resources/icons/page_white_copy.png differ
diff --git a/iep/resources/icons/page_white_dirty.png b/iep/resources/icons/page_white_dirty.png
new file mode 100644
index 0000000..b4d14fd
Binary files /dev/null and b/iep/resources/icons/page_white_dirty.png differ
diff --git a/iep/resources/icons/page_white_gear.png b/iep/resources/icons/page_white_gear.png
new file mode 100644
index 0000000..106f5aa
Binary files /dev/null and b/iep/resources/icons/page_white_gear.png differ
diff --git a/iep/resources/icons/page_white_py.png b/iep/resources/icons/page_white_py.png
new file mode 100644
index 0000000..adb4a05
Binary files /dev/null and b/iep/resources/icons/page_white_py.png differ
diff --git a/iep/resources/icons/page_white_pyx.png b/iep/resources/icons/page_white_pyx.png
new file mode 100644
index 0000000..44b733d
Binary files /dev/null and b/iep/resources/icons/page_white_pyx.png differ
diff --git a/iep/resources/icons/page_white_text.png b/iep/resources/icons/page_white_text.png
new file mode 100644
index 0000000..813f712
Binary files /dev/null and b/iep/resources/icons/page_white_text.png differ
diff --git a/iep/resources/icons/paste_plain.png b/iep/resources/icons/paste_plain.png
new file mode 100644
index 0000000..c0490eb
Binary files /dev/null and b/iep/resources/icons/paste_plain.png differ
diff --git a/iep/resources/icons/plugin.png b/iep/resources/icons/plugin.png
new file mode 100644
index 0000000..6187b15
Binary files /dev/null and b/iep/resources/icons/plugin.png differ
diff --git a/iep/resources/icons/plugin_refresh.png b/iep/resources/icons/plugin_refresh.png
new file mode 100644
index 0000000..c741b27
Binary files /dev/null and b/iep/resources/icons/plugin_refresh.png differ
diff --git a/iep/resources/icons/report.png b/iep/resources/icons/report.png
new file mode 100644
index 0000000..779ad58
Binary files /dev/null and b/iep/resources/icons/report.png differ
diff --git a/iep/resources/icons/run_cell.png b/iep/resources/icons/run_cell.png
new file mode 100644
index 0000000..fbc469d
Binary files /dev/null and b/iep/resources/icons/run_cell.png differ
diff --git a/iep/resources/icons/run_file.png b/iep/resources/icons/run_file.png
new file mode 100644
index 0000000..7e62a92
Binary files /dev/null and b/iep/resources/icons/run_file.png differ
diff --git a/iep/resources/icons/run_file_script.png b/iep/resources/icons/run_file_script.png
new file mode 100644
index 0000000..f33d920
Binary files /dev/null and b/iep/resources/icons/run_file_script.png differ
diff --git a/iep/resources/icons/run_lines.png b/iep/resources/icons/run_lines.png
new file mode 100644
index 0000000..e7eab1c
Binary files /dev/null and b/iep/resources/icons/run_lines.png differ
diff --git a/iep/resources/icons/run_mainfile.png b/iep/resources/icons/run_mainfile.png
new file mode 100644
index 0000000..25d2192
Binary files /dev/null and b/iep/resources/icons/run_mainfile.png differ
diff --git a/iep/resources/icons/run_mainfile_script.png b/iep/resources/icons/run_mainfile_script.png
new file mode 100644
index 0000000..5cefe7f
Binary files /dev/null and b/iep/resources/icons/run_mainfile_script.png differ
diff --git a/iep/resources/icons/script.png b/iep/resources/icons/script.png
new file mode 100644
index 0000000..0f9ed4d
Binary files /dev/null and b/iep/resources/icons/script.png differ
diff --git a/iep/resources/icons/star.png b/iep/resources/icons/star.png
new file mode 100644
index 0000000..b88c857
Binary files /dev/null and b/iep/resources/icons/star.png differ
diff --git a/iep/resources/icons/star2.png b/iep/resources/icons/star2.png
new file mode 100644
index 0000000..bff9775
Binary files /dev/null and b/iep/resources/icons/star2.png differ
diff --git a/iep/resources/icons/star3.png b/iep/resources/icons/star3.png
new file mode 100644
index 0000000..5410ddb
Binary files /dev/null and b/iep/resources/icons/star3.png differ
diff --git a/iep/resources/icons/style.png b/iep/resources/icons/style.png
new file mode 100644
index 0000000..81e41de
Binary files /dev/null and b/iep/resources/icons/style.png differ
diff --git a/iep/resources/icons/sum.png b/iep/resources/icons/sum.png
new file mode 100644
index 0000000..fd7b32e
Binary files /dev/null and b/iep/resources/icons/sum.png differ
diff --git a/iep/resources/icons/text_align_justify.png b/iep/resources/icons/text_align_justify.png
new file mode 100644
index 0000000..2fbdd69
Binary files /dev/null and b/iep/resources/icons/text_align_justify.png differ
diff --git a/iep/resources/icons/text_align_right.png b/iep/resources/icons/text_align_right.png
new file mode 100644
index 0000000..a150257
Binary files /dev/null and b/iep/resources/icons/text_align_right.png differ
diff --git a/iep/resources/icons/text_indent.png b/iep/resources/icons/text_indent.png
new file mode 100644
index 0000000..9364532
Binary files /dev/null and b/iep/resources/icons/text_indent.png differ
diff --git a/iep/resources/icons/text_indent_remove.png b/iep/resources/icons/text_indent_remove.png
new file mode 100644
index 0000000..1651b07
Binary files /dev/null and b/iep/resources/icons/text_indent_remove.png differ
diff --git a/iep/resources/icons/text_padding_right.png b/iep/resources/icons/text_padding_right.png
new file mode 100644
index 0000000..106edae
Binary files /dev/null and b/iep/resources/icons/text_padding_right.png differ
diff --git a/iep/resources/icons/text_replace.png b/iep/resources/icons/text_replace.png
new file mode 100644
index 0000000..877f82f
Binary files /dev/null and b/iep/resources/icons/text_replace.png differ
diff --git a/iep/resources/icons/tick.png b/iep/resources/icons/tick.png
new file mode 100644
index 0000000..a9925a0
Binary files /dev/null and b/iep/resources/icons/tick.png differ
diff --git a/iep/resources/icons/wand.png b/iep/resources/icons/wand.png
new file mode 100644
index 0000000..44ccbf8
Binary files /dev/null and b/iep/resources/icons/wand.png differ
diff --git a/iep/resources/icons/wrench.png b/iep/resources/icons/wrench.png
new file mode 100644
index 0000000..5c8213f
Binary files /dev/null and b/iep/resources/icons/wrench.png differ
diff --git a/iep/resources/icons/wrench_orange.png b/iep/resources/icons/wrench_orange.png
new file mode 100644
index 0000000..565a933
Binary files /dev/null and b/iep/resources/icons/wrench_orange.png differ
diff --git a/iep/resources/images/iep_editor.png b/iep/resources/images/iep_editor.png
new file mode 100644
index 0000000..612559e
Binary files /dev/null and b/iep/resources/images/iep_editor.png differ
diff --git a/iep/resources/images/iep_run1.png b/iep/resources/images/iep_run1.png
new file mode 100644
index 0000000..47b9a76
Binary files /dev/null and b/iep/resources/images/iep_run1.png differ
diff --git a/iep/resources/images/iep_shell1.png b/iep/resources/images/iep_shell1.png
new file mode 100644
index 0000000..e1d4147
Binary files /dev/null and b/iep/resources/images/iep_shell1.png differ
diff --git a/iep/resources/images/iep_shell2.png b/iep/resources/images/iep_shell2.png
new file mode 100644
index 0000000..ff8b263
Binary files /dev/null and b/iep/resources/images/iep_shell2.png differ
diff --git a/iep/resources/images/iep_tools1.png b/iep/resources/images/iep_tools1.png
new file mode 100644
index 0000000..26eb9dc
Binary files /dev/null and b/iep/resources/images/iep_tools1.png differ
diff --git a/iep/resources/images/iep_tools2.png b/iep/resources/images/iep_tools2.png
new file mode 100644
index 0000000..751ac9d
Binary files /dev/null and b/iep/resources/images/iep_tools2.png differ
diff --git a/iep/resources/images/iep_two_components.png b/iep/resources/images/iep_two_components.png
new file mode 100644
index 0000000..af77421
Binary files /dev/null and b/iep/resources/images/iep_two_components.png differ
diff --git a/iep/resources/style_scintilla.ssdf b/iep/resources/style_scintilla.ssdf
new file mode 100644
index 0000000..e69de29
diff --git a/iep/resources/style_solarizeddark.ssdf b/iep/resources/style_solarizeddark.ssdf
new file mode 100644
index 0000000..e69de29
diff --git a/iep/resources/style_solarizedlight.ssdf b/iep/resources/style_solarizedlight.ssdf
new file mode 100644
index 0000000..e69de29
diff --git a/iep/resources/translations/iep_ca_ES.tr b/iep/resources/translations/iep_ca_ES.tr
new file mode 100644
index 0000000..541f6fb
--- /dev/null
+++ b/iep/resources/translations/iep_ca_ES.tr
@@ -0,0 +1,1139 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="ca_ES">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation>Pila</translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation>Filtre de noms arxius</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation>Cercar en arxius</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation>Projectes:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation>Cliqueu l'estrella per senyalitzar el directori actual</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation>Esborrar projecte</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation>Canviar nom projecte</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation>Afegeix ruta a rutes de Python</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation>Nom projecte</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation>Nou nom projecte:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation>Coincidir entre majúscules i minúscules</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation>Expressió Regular</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation>Cerca en subdirs</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation>Desmarcar directori</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation>Marcar directori</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation>Obrir</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation>Obrir fora d'iep</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation>Mostra al Finder</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation>Copia ruta</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation>Rebatejar</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation>Esborrar</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation>Crear arxiu</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation>Crear directori</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation>Dona nom al arxiu</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation>Dona nom al directori</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation>Duplicar</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation>Dona nom al arxiu</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation>Segur que vols esborrar-ho</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation>Anar a aquest directori en el terminal actual</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation>Importa dades...</translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation>Arxiu</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation>Editar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation>Visualitza</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation>Opcions</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation>Consola</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation>Executar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation>Eines</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation>Ajuda</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation>Utilitza Tabuladors</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation>espais</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation>espais</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation>Sangria ::: Sangria emprada arxiu actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation>Analitzador sintaxi ::: Analitzador sintaxi arxiu actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation>Final línia ::: Caràcter final línia arxiu actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation>Codificació ::: Codificació de caràcters en l'arxiu actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation>Nou ::: Crear arxiu nou (o temporal).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation>Obrir ::: Obrir un arxiu del disc.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation>Desa ::: Desa arxiu disc.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation>Anomena i desa... ::: Desa l'arxiu actual amb un nom diferent.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation>Desa-ho tot ::: Desa tots el arxius oberts.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation>Tanca ::: Tanca l'arxiu actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation>Tanca tots ::: Tanca tots els arxius.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation>Reinicia IEP ::: Reinicia l'aplicació.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation>Tanca IEP ::: Tanca l'aplicació.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation>Desfés ::: Desfés el darrer canvi d'edició.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation>Refés ::: Refés el darrer canvi desfet. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation>Talla ::: Talla el text seleccionat.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation>Copia ::: Copia el text seleccionat al portapapers.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation>Enganxa ::: Enganxa el text present en el portapapers.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation>Selecciona-ho tot ::: Selecciona tot el text. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation>Sagnar ::: Sagnar la línia seleccionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation>Dessagnar ::: Dessagnar línia seleccionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation>Comentar ::: Comenteu la línia seleccionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation>Descomentar ::: Descomenteu la línia seleccionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation>Justificar comentari / docstring ::: Remodelar el text seleccionat perquè s'alineï a uns 70 caràcters.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation>Vés línia ::: Vés a un número especific línia.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation>Esborra línia ::: Esborra línia seleccionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation>Cercar o reemplaçar ::: Mostra giny cercar/reemplaçar. Inicialitzar amb el text seleccionat.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation>Cercar selecció ::: Cercar la següent ocurrència del text seleccionat.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation>Cercar selecció cap enrere ::: Cerca la ocurrència anterior del text seleccionat.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation>Cercar següent ::: Cerca la següent ocurrència de la cadena de cerca.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation>Cercar anterior ::: Cerca l'anterior ocurrència de la cadena de cerca.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation>Acostar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation>Allunyar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation>Zoom original</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation>Ubicació indicador línia llarga ::: Seleccionar ubicació de l'indicador de línia llarga.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation>Tema Qt ::: Estil dels ginys de la interfície d'usuari.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation>Selecciona consola ::: Selecciona la consola actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation>Selecciona editor ::: Selecciona l'editor actual. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation>Selecciona l'arxiu anterior ::: Selecciona l'arxiu seleccionat anteriorment.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation>Mostra espais en blanc ::: Mostra espais i tabuladors.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation>Mostra els finals de línia ::: Mostra final de cada línia.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation>Mostra guies de sangria ::: Mostra línies verticals per indicar la sagria.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation>Ajustar línies llargues ::: Ajustar línies llargues que no caben a la pantalla.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation>Destacar línia actual ::: Remarca la línia on es troba el cursor.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation>Font</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation>Zoom</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation>Esborrar pantalla ::: Esborrar la pantalla.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation>Interrompre ::: Interrompre el codi en execució. No funciona per extensions codi).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation>Reiniciar ::: Finalitza l'execució i reinicia l'intèrpret.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation>Finalitzar ::: Finalitza l'intèrpret deixant la consola oberta.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation>Tanca ::: Finalitza l'intèrpret i tanca la consola.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation>Edita configuració consola... ::: Afegeix configuracions a la consola i edita les propietats de l'intèrpret. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation>Consola nova... ::: Crear una consola nova per executar codi.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Executa selecció ::: Executa les línies seleccionades a l'editor o la selecció de paraules en la línia actual o la línia actual si no s'ha fet cap selecció.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation>Tanca altres ::: Tanca tots els arxius excepte aquest.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation>Rebatejat ::: Rebateja aquest arxiu.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation>Pinçar/desprendre ::: Arxius pinçats són més difícils de tancar.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation>Marcar/desmarcar com arxiu mestre ::: L'arxiu mestre es pot executar mentre un altre està seleccionat. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation>Executar arxiu ::: Executa el codi en aquest arxiu.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation>Executa l'arxiu com script ::: Executa aquest arxiu com script (reinicia l'intèrpret). </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation>Ajuda per executant el codi ::: Obre l'assistentjuda d'IEP a la pàgina de com executar el codi.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation>Recarregar eines ::: Per programadors que desenvolupen eines.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation>Pàgina web Pyzo ::: Obre la pàgina web de Pyzo en el teu buscador.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation>Pàgina web IEP ::: Obre la pàgina web de IEP en el teu buscador.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation>Fes una pregunta ::: Necessites ajuda? </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation>Reportar un problema ::: Has trobat alguna errada a IEP, o troves a faltar alguna caracteristica o funció?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation>Assistent IEP ::: Comença ràpidament.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation>Busca actualizacions ::: Tens l'última versión de IEP?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation>Quant al IEP ::: Més informació sobre IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation>Selecciona idioma ::: Selecciona ldioma per IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation>Sangria automàtica ::: Sangrar codi automaticament quan pressiones tecla retorn després de dos punts.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation>Habilitar ajuda funcions ::: Ensenyar ajuda prototip funcions.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation>Habilitar autocompletat ::: Mostrar autocompletar amb noms coneguts.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation>Autocompletet paraules clau ::: La llista d'autocopletat inclou paraules clau.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation>Edita assignacions de tecles... ::: Edita els accessos directes per elements de menú.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation>Edició estil sintàxis... ::: Canvia colors sintaxi texte del teu códic.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation>Opciones avanzadas... ::: Configura IEP encara més.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation>Depuració següent: continuar fins a la següent línia</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation>Depuració retorn: Depuració fins retorn</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation>Depuració continuar: procedir al següent punt d'interrupció</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation>Aturar depuració</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation>Esborrar tots els punts d'interrupció {}</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation>Etapa de depuració a dins: procedir un pas</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation>Executar l'arxiu com un script ::: Reiniciar i executar el fitxer actual com un script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation>Executar arxiu principal com a script ::: Reiniciar i executar el fitxer principal com un script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Executar selecció ::: Executar línies de l'editor seleccionades, paraules seleccionades en la línia actual, o la línia actual si no hi ha cap selecció.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation>Executar cel la ::: Executar la cel la de l'editor actual en el terminal actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation>Executar cel la i avançar ::: Executar cel la actual i avançar a la següent.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation>Executar fitxer ::: Executeu el fitxer actual al terminal actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation>Executar fitxer principal ::: Executear el fitxer principal al terminal actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation>No és pot executar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation>No es pot executar l'script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation>Comproveu si és la versió més recent.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation>Edita estil sintaxis</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation>Configuració avançada</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation>
+ L'idiona s'ha canviat.
+ IEP té que reiniciar-se per fer efectius els canvis.
+ </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation>Idioma canviat</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation>Edita assignació d'accessos directes</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation>Assignacions d'accés directe</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation>Manega claus llicèncie IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation>Afegir clau llicència</translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation>Amaga giny cerca (Escape)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation>Busca patró</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation>Anterior ::: Cerca l'anterior ocurrència del patró.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation>Següent ::: Cerca la següent ocurrència del patró.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation>Reemplaçar patró</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation>Reemplaçar tots ::: Reemplaçar totes les coincidències en aquest document. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation>Reemplaça ::: Reemplaça aquesta occurrència.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation>Sensible majúsculas ::: Sensible entre majúsculas y minúsculas.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation>Expressió regular ::: Cercar utilitzant expressions regulars.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation>Paraules senceres ::: Cercar només paraules senceres.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation>Auto amagar ::: Amaga automàticament cerca/reemplaça quan no es fa servir durant 10 s.</translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation>Empra opcions per defecte del sistema</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation>Nom ::: El nom d'aquesta configuració.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation>exe ::: L'executable de Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation>gui ::: Kit d'eines de GUI per integrar (per traçat interactiu, etc.).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation>pythonPath ::: Llista de directoris on cercar mòduls i paquets. Introdueix cada ruta en una nova línia, o separa-les mitjançant el separador per defecto del teu sistema operatiu. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation>ScriptInici ::: Script a executar al inici (no en mode script).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation>DirInici ::: Directori al inici ( no en mode script).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation>Esborrar ::: Esborra la configuració d'aquesta consola</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation>Configuració consola</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation>Afegeix configuració</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation>ipython ::: Emprar terminal IPython si disponible.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation>Arxiu a executar a l'inici</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation>Codi a executar a l'inici</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation>argv ::: Arguments linía de comandes (sys.argv).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation>environ ::: Variables d'entorn addicionals (os.environ).</translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation>Primers passos amb IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation>Pas</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation>Benvingut a l'(E)ditor (I)nteractiu de (P)ython - IEP!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation>Aquest assistent us ajuda a familiaritzar-vos amb el funcionament del IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation>IEP és un entorn integrat de desenvolupament (IDE) de python multi-plataforma
+ centrat en la interactivitat ** i * introspecció *, el que fa que sigui
+ molt adequat per a la computació científica. El seu disseny pràctic
+ està dirigit a * senzillesa * i * Eficiència *.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation>Aquest assistent es pot obrir amb "Ajuda> IEP assistent'</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation>Mostra aquest assistent a l'inici</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation>Selecciona idioma</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation>
+ El llenguatge s'ha canviat per aquest assistent.
+ Necessita reiniciar IEP perquè el canvi tingui efecte en tota l'aplicació.
+ </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation>Idioma canviat</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation>IEP consta de dos components principals</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation>Podeu executar comandaments directament a la *consola*,</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation>o pot escriure codi en l'*editor* i posteriorment executar-ho.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation>L'editor és on s'escriur el codi</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation>A l'*editor*, cada arxiu obert es representa com una pestanya. En
+ fer clic dret sobre una pestanya, els arxius es poden executar, guardar, tancar, etc.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation>El botó dret del ratolí també ens permet fer d'un arxiu qualsevol
+ l'*arxiu mestre* d'un projecte. Aquest arxiu pot ser reconegut pel símbol de
+ l'estrella, i ens permet executar-lo amb més facilitat.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation>La consola és on el teu codi s'executa</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation>Quan s'inicia IEP, es crea una *consola* per defecte. Es poden afegir més
+ consoles que s'executen simultàniament, que fins i tot poden correspondre
+ a diferents versions de Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation>Les consoles s'executen en un sub-procés, d'aquest manera IEP
+ es manté receptiu, el que li permet seguir treballant i inclús
+ executar codi en una altre consola.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation>Configurar les consoles</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation>IEP pot integrar el cicle d'esdeveniments de cinc *eines GUI* diferents,
+ el que permet per exemple, fer gràfiques interactivament amb Visvis o Matplotlib.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation>Mediante 'Consola > Edita propietats consola', es pot editar i afegir
+ *propietats a la consola*. Això per expemple permet seleccionar un
+ un directori d'inici nou, o emprar un Pythonpath personalitzat.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation>Executant codi</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation>IEP admet diverses formes d'executar codi font a l'editor. (Vegeu el menú 'Executar').</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation>* Executar selecció: * si no hi ha text seleccionat, s'executa la línia actual,
+ si la selecció està en una sola línia, la selecció s'avalua, si la selecció inclou
+ diverses línies, IEP executará les línies seleccionades al complet.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation>*Executar cel·la:* Una cel·la és tot el que hi ha entre dues línies que comencen amb '##'.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation>*Executar arxiu:* executar tot el codi en el fitxer actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation>*Executar arxiu mestre de projecte:* executar el codi de l'arxiu mestre del projecte actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation>Mode interactiu vs execució com a script</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation>Podeu executar el fitxer actual o l'arxiu mestre normalment o com un script.
+ Quan s'executa com a script, la consola es reiniciarà per proporcionar un entorn
+ net. La consola també s'inicialitza de manera diferent així que s'assembla molt
+ a l'execució d'un script normal.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation>En el mode interactiu, sys.path [0] és una cadena buida (és a dir,
+ el directori actual), i sys.argv s'estableix com [''].</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation>En el mode script, __file__ i sys.argv[0] s'ajusten al nom del arxiu script, sys.path[0] i el directori de treball s'ajusten al directori que conté l'script.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation>Eines per a la seva comoditat</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation>A través del menú * Eines, es pot seleccionar quines eines utilitzar.
+ Les eines es poden col·locar en la forma més convenient, fins i tot es poden desacobla.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation>Tingueu en compte que el sistema d'eines està dissenyat de tal manera
+ que és fàcil de crear les seves pròpies eines. Mira la wiki en línia per obtenir
+ més informació, o utilitzar una de les eines existents, com a exemple.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation>Eines recomanades</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation>Recomanem especialment les següents eines:</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation>L'*eina estructura codi* ofereix un esbós del codi font.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation>El *Navegador d'arxius* ajuda a mantenir una visió general de tots els arxius en un directori. Per gestionar els projectes, feu clic a la icona d'estrella.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation>Comença a programar!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation>Amb això conclou l'assistent de IEP. Ara, comença a programar i diverteix-te!</translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_ca_ES.tr.qm b/iep/resources/translations/iep_ca_ES.tr.qm
new file mode 100644
index 0000000..9d1c187
Binary files /dev/null and b/iep/resources/translations/iep_ca_ES.tr.qm differ
diff --git a/iep/resources/translations/iep_de_DE.tr b/iep/resources/translations/iep_de_DE.tr
new file mode 100644
index 0000000..a24818f
--- /dev/null
+++ b/iep/resources/translations/iep_de_DE.tr
@@ -0,0 +1,1114 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="de_DE">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation>Stapel</translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation>Dateinamenfilter</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation>Suche in Dateien</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation>Projekte:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation>Stern klicken um das aktuelle Verzeichnis als Lesezeichen zu markieren</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation>Projekt entfernen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation>Projektname aendern</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation>Zu Python Pfad hinzufuegen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation>Projektname</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation>Neuer Projektname:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation>Groß-/Kleinschreibung</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation>Regulaerer Ausdruck</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation>Suche in Unterverzeichnissen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation>Markierung dieses Verzeichnisses entfernen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation>Dieses Verzeichnis markieren</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation>Oeffnen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation>Ausserhalb von IEP oeffnen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation>Im Finder anzeigen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation>Pfad kopieren</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation>Umbenennen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation>Loeschen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation>Datei neu</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation>Neues Verzeichnis erstellen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation>Neuer Dateiname</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation>Neuer Verzeichnisname</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation>Duplikat</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation>Name der neuen Datei</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation>Loeschen - Sind Sie sicher ?</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation>In dieses Verzeichnis der aktuellen Shell wechseln</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation>Daten werden importiert....</translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation>Datei</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation>Edit</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation>Ansicht</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation>Einstellungen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation>Shell</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation>Ausfuehren</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation>Tools</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation>Hilfe</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation>Tabstopps benutzen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation>Leerzeichen benutzen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation>Leerzeichen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation>Das Einrücken ::: Der von der aktuellen Datei verwendete Einzug.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation>Syntax-Parser ::: Syntax-Parser der aktuellen Datei.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation>Zeilenenden ::: Das Zeilenendzeichen der aktuellen Datei. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation>Kodierung ::: Die Zeichensatzkodierung der aktuellen Datei.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation>Neu ::: Erzeugen einer neuen (oder temporaeren) Datei.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation>Oeffnen... ::: Oeffnen einer bestehenden Datei.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation>Speichern ::: Speichern der aktuellen Datei auf der Festplatte.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation>Speichern unter... ::: Speichert die aktuelle Datei unter einem anderen Namen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation>Alles speichern ::: Alle geoeffneten Dateien speichern.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation>Schliessen ::: Schliessen der aktuellen Datei.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation>Alles schliessen ::: Alle Dateien schliessen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation>IEP neu starten ::: Programm neu starten.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation>IEP Beenden ::: Programm schliessen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation>Undo/Zurück ::: Letzte Bearbeitung rückgaengig machen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation>Wiederholen ::: Wiederholen des letzten unerledigten Bearbeitungsschrittes.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation>Ausschneiden ::: Ausgewaehlten Text ausschneiden.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation>Kopieren ::: Ausgewaehlten Text in die Zwischenablage kopieren.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation>Einfuegen ::: Einfügen von Text aus der Zwischenablage.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation>Alles markieren ::: Ganzen Text markieren.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation>Einrücken ::: Einrücken der markierten Zeile.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation>Einrücken ::: Einrücken der ausgewaehlten Zeile rückgängig machen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation>Kommentar ::: Ausgewaehlte Zeile kommentieren.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation>Kommentierung bearbeiten ::: Kommentierung der gewaehlten Zeile entfernen. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation>Berichtigung Kommentar/DocString ::: Markierten Text so umformen, dass auf ca. 70 Zeichen ausgerichtet. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation>Gehe zur Zeile ::: Gehe zu einer spezifischen Liniennummer.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation>Zeile loeschen ::: Die ausgewaehlte Zeile löschen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation>Finden oder Ersetzen ::: Zeige Finden- oder Ersetzen-Widget. Mit ausgewähltem Text initialisieren. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation>Finde Auswahl ::: Finde das naechste Vorkommen des markierten Textes. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation>Finde Auswahl rückwaerts ::: Finde das vorherige Vorkommen des markierten Textes.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation>Weiter suchen ::: Finde das naechste Auftreten des Suchbegriffs. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation>Finde vorherige ::: Finde das vorherige Vorkommen der Suchzeichenfolge.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation>Hereinzoomen / Zoom in</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation>Herauszoomen / Zoom out</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation>Zoom zurücksetzen / Zoom reset</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation>Position der Zeilenlängenanzeige ::: Position der Zeilenlängeanzeige.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation>Qt Thema ::: Das Aussehen von UI-Widgets.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation>Shell auswaehlen ::: Cursor auf die aktuelle Shell setzen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation>Editor auswaehlen ::: Cursor auf den aktuellen Editor setzen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation>Vorhergehende Datei auswaehlen ::: Die vorher gewaehlte Datei auswaehlen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation>Zeige Leerzeichen ::: Leerzeichen und Tabulatoren anzeigen. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation>Zeige Zeilenenden ::: Zeige das Ende jeder Zeile.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation>Zeige Einzug Einstellungen ::: Zeige vertikale Linien um die Einzuege anzuzeigen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation>Lange Zeilen umbrechen ::: Lange Zeilen, die nicht auf den Bildschirm passen, umbrechen (z.B. kein horizontales scrollen).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation>Markieren der aktuellen Zeile ::: Markieren der Zeile in der sich der Cursor befindet.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation>Schriftart</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation>Zoomen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation>Bildschirm löschen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation>Unterbrechen ::: Unterbrechung des des momentan ausgeführten Codes (funktioniert nicht bei Erweiterungscode).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation>Neustart ::: Interpreter schliessen und neu starten.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation>Abbrechen ::: Interpreter abbrechen, shell bleibt offen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation>Schliessen ::: Interpreter beenden und Shell schliessen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation>Shell-Konfigurationen bearbeiten... ::: Neue Shell-Konfigurationen und Interpreter-Eigenschaften bearbeiten. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation>Neue Shell ... ::: Erzeugen einer neuen Shell zur Ausführung von Code.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Markierten Bereich ausfuehren ::: Ausführen der im aktuellen Editor markierten Zeilen, die selktierten Wörter in der aktuellen Zeile oder die aktuelle Zeile, wenn nichts markiert ist. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation>Alle anderen schliessen ::: Alle Dateien ausser dieser schliessen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation>Umbenennen ::: Diese Datei umbenennen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation>Markieren / Unmarkieren von Dateienr ::: Markierte Dateien können weniger leicht geschlossen werden.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation>Setzen/Rücksetzen als MAIN-Datei ::: Die MAIN-Datei kann ausgefuehrt werden, waehrend eine andere Datei ausgewaehlt ist.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation>Datei ausfuehren ::: Code in dieser Datei ausfuehren.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation>Datei als Script ausfuehren ::: Ausführen der aktuellen Datei als Script (Interpreter wird neu gestartet).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation>Hilfe zur Ausführung von Code ::: IEP-Wizard über die Ausführung von Code oeffnen. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation>Werkzeuge neu laden ::: Für Nutzer die eigen Werkzeuge entwickeln. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation>Pyzo Webseite ::: Pyzo Webseite im Browser oeffnen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation>IEP Webseite ::: Oeffnet die IEP Webseite im Browser.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation>Eine Frage stellen ::: Brauchen Sie Hilfe ?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation>Fehler melden ::: Haben Sie einen Bug in IEP gefunden oder haben Sie einen Verbesserungsvorschlag ?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation>IEP Wizard ::: Schneller Einstieg. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation>Nach Updates suchen ::: Benutzen Sie die aktuellste Version ?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation>Über IEP ::: Weitere Information zu IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation>Sprache wählen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation>Automatischer Einzug ::: Einzug wenn "Enter" nach einem Doppelpunkt gedrückt wird. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation>Methodentipps aktivieren ::: Zeige Methodentipps mit Funktionssignaturen. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation>Auto-Vervollstaendigen aktivieren ::: Zeige bestehende Einträge der Auto-Vervollstaendigung.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation>Auto-Vervollständigen Schlüsselwörter ::: Die "Auto-Vervollständigen" Schlüsselwortliste.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation>Tastenzuordnungen bearbeiten ::: Tastaturkuerzel für die Menuepunkte bearbeiten. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation>Syntax-Stil bearbeiten... ::: Code-Farben verändern.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation>Erweiterte Einstellungen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation>Debug weiter: Bis zur naechsten Zeile </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation>Debug zurück: Bis zur Umkehr</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation>Debug weiter: Sprung zum naechsten Haltepunkt</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation>Debug stoppen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation>Alle {} Haltepunkte deaktivieren</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation>Postmortal: Debug vom letzten Traceback</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation>Debug Einsprung: Ein Schritt</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation>Datei als Script ausfuehren ::: Neu starten und Ausführen der aktuellen Datei als Script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation>Main-Datei als Script ausführen ::: Neu starten und Main-Datei als Script ausführen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Markierte Elemente ausführen ::: Ausführen der im aktuellen Editor markierten Zeilen, die selktierten Wörter in der aktuellen Zeile oder die aktuelle Zeile, wenn nichts markiert ist.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation>Element ausführen ::: Aktuelles Element des Editors in der Shell ausführen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation>Element ausführen und weiter ::: Aktuelles Element des Editors ausführen und dann zum nächsten Element wechseln.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation>Datei ausführen ::: Datei in der aktuellen Shell ausführen. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation>Main-Datei ausfuehren ::: Main-Datei in der aktuellen Shell ausfuehren.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation>Konnte nicht ausgeführt werden</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation>Script konnte nicht ausgefuehrt werden.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation>Auf aktualisierte Version prüfen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation>Syntax-Stil (Codefarben) bearbeiten</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation>Erweiterte Einstellungen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation> Die Benutzersprache wurde geändert.
+ IEP muss neu gestartet werden damit die Änderungen wirksam werden. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation>Sprache geändert</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation>Tastaturkürzel bearbeiten</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation>Tastaturkürzel</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation>Lizenzschlüssel verwalten</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation>Lizenzschlüssel eingeben</translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation>Such-Widget ausblenden (Escape)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation>Pattern/Suchmuster finden</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation>Vorheriges ::: Finde vorheriges Vorkommen des Patterns/Suchmusters.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation>Nächstes ::: Finde nächstes Vorkommen des Patterns/Suchmusters.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation>Pattern/Suchmuster ersetzen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation>Alle ersetzen ::: Ersetze alle Treffer in aktuellem Dokument.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation>Ersetzen ::: Ersetze diesen Treffer.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation>Groß-/Kleinschreibung ::: Passende Worte finden.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation>Regulärer Ausdruck / Regex ::: Finden mit Regulärem Ausdruck.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation>Ganze Wörter ::: Nur ganze Wörter suchen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation>Automatisch ausblenden ::: Suchen/Ersetzen ausblenden, wenn 10 s unbenutzt.</translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation>System-Standard benutzen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation>name ::: Der Name dieser Konfiguration.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation>exe ::: Die Python-Ausführungsdatei.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation>gui ::: GUI-Toolkit zu integrieren (für interaktives plotten o.ä.). </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation>pythonPath :::Eine Liste der Verzeichnisse um Module und Pakete zu suchen. Schreiben Sie jeden Pfad in eine neue Zeile, oder trennen Sie sie mit den Standardtrennzeichen für dieses Betriebssystem. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation>startupScript ::: Das Script welches beim Start ausgeführt wird (nicht im Script-Modus).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation>startDir ::: Das Start-Verzeichnis (nicht im Script-Modus).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation>Löschen ::: Diese Shell-Konfiguration löschen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation>Shell Konfiguration</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation>Konfiguration hinzufügen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation>ipython ::: Verwende iPython-Shell falls verfügbar. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation>Datei beim Start auszuführen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation>Code beim Start auszuführen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation>arg ::: Kommandozeilen-Argumente (sys.argv).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation>Umgebung ::: Extra Umgebungsvariablen (os.environ).</translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation>Erste Schritte mit IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation>Step</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation>Willkommen imr Interactive-Editor für Python!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation>Dieser Assistent hilft Ihnen, sich mit der Funktionsweise von IEP vertraut zu machen.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation>IEP ist eine Cross-Plattform-Python-IDE. Sie hat * Interaktivität * und * Introspektion * zum Ziel.,Dadurch ist IEP favorisiert für Scientific Computing. Das praktische Design zielt auf * Einfachheit * und * Effizienz *.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation>Dieser Assistent con durch die Hilfe geöffnet werden. IEP Assistent</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation>Diesen Wizard beim Start anzeigen</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation>Sprache wählen</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation> Die Sprache wurde für diesen Assistenten geändert.
+ IEP muss neu gestartet werden, damit die Änderungen wirksam werden.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation>Sprache geändert</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation>IEP besteht aus zwei Hauptkomponenten</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation>Sie können Befehle direkt in der *Shell* ausführen</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation>oder Sie können Code im Editor schreiben und diesen dann ausführen.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation>Im Editor schreiben Sie Ihren Code</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation>In der *Editor* wird jede geöffnete Datei als Registerkarte dargestellt. Mit einem Rechtsklick auf eine Registerkarte, können Dateien ausgeführt, gespeichert und geschlossen usw. werden.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation>Mit der rechten Maustaste kann eine Datei zur MAIN-Datei des Projekts geändert werden. Diese Datei ist an einem Sternsymbol zu erkennen und sie kann leichter ausgeführt werden.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation>In der Sell wird Ihr Code ausgeführt</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation>Beim Start von IEP, wird eine Standard * Shell * erstellt. Sie können mehrere Shells, die gleichzeitig ausgeführt werden, hinzuzufügen. Die verschiedenen Shells können verschiedene Python-Versionen ausführen.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation>Shells werden in einem Sub-Prozess ausgeführt, so dass, wenn sie beschäftigt sind, IEP selbst ansprechbar bleibt. So können Sie Programmierung und Ausführen von weiterem Code in einer anderen Shell halten.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation>Shell Konfiguration</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation>Mit IEP können die Ereignisse von fünf verschiedenen* GUI-Toolkits * integriert werden, so dass interaktives Plotten mit z.B. Visvis oder Matplotlib möglich ist.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation>Über Shell > Shell Konfiguration bearbeiten können Sie eine Shell-Konfiguration hinzufügen oder bearbeiten. Sie können ein Heimverzeichnis wählen oder einen benutzerdefinierten Python-Pfad anlegen.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation>Laufender Code</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation>IEP unterstützt mehrere verschiedene Möglichkeiten, um Quellcode im Editor auszuführen. (siehe "Ausführen"-Menü).</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation>*Auswahl ausführen:* wenn kein Text ausgewählt ist, wird die aktuelle Zeile ausgeführt; wenn die Auswahl die ganze Zeile umfasst, wird die Auswahl ausgewertet; dehnt sich die Auswahl über mehrere Zeilen aus, wird IEP alle ausgewählten (die kompletten) Zeilen ausführen.
+</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation>*Ausführen Zelle:* eine Zelle ist alles zwischen zwei Zeilen, startend mit '##'.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation>*Ausführen Datei:* führt den kompletten Code innerhalb einer Datei aus.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation>*Ausführen Prjekt MAIN-Datei:* führt den Code innerhalb der MAIN-Datei aus. </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation>"Interaktiver Modus" gegenüber "Script-Modus"</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation>Sie können die aktuelle Datei oder die MAIN-Datei normal ausführen oder als Skript. Wenn Sie sie als Skript ausführen, wird die Shell wieder hergestellt, damit eine fest definierte Umgebung vorliegt. Die Shell ist so initialisiert, dass sie das Skript in einer Umgebung, ähnlich einer "normalen" Umgebung, ausführen kann.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation>Im interaktiven Modus ist "sys.path" eine leere Zeichenfolge [0] (z.B. das aktuelle Verzeichnis), und sys.argv wird auf [''] eingestellt.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation>Im Script-Modus werden __ file__ und sys.argv [0] auf den Script Dateinamen benannt, sys.path [0] und das Arbeitsverzeichnis werden in das Verzeichnis welches das Skript enthält, gesetzt.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation>Extras für Ihren Komfort</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation>Über das "*Werkzeug-Menü*", kann man auswählen, welche Tools genutzt werden. Die Werkzeuge können frei positioniert werden und angedockt als auch un-angedockt genutzt werden.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation>Das Werkzeug (Tool)-System ist so ausgelegt, dass es sehr einfach ist, Ihre eigenen Werkzeuge (Tools) zu erstellen. Infos dazu finden Sie in der Online-Wiki, oder verwenden Sie ein vorhandenes Tool als Vorlage.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation>Empfohlene Werkzeuge</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation>Wir empfehlen vor allem die folgenden Tools:</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation>Das Tool *Quell-Struktur* gibt einen Überblick über den Quellcode.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation>Das * Datei-Browser-Tool * hilft den Überblick über alle Dateien eines Projekts zu behalten. Zum Bearbeiten Ihrer Projekte, klicken Sie auf das Sternsymbol.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation>Auf geht's !</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation>Dies schliesst den IEP-Assistenten Und jetzt: Coden und Spass haben !</translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_de_DE.tr.qm b/iep/resources/translations/iep_de_DE.tr.qm
new file mode 100644
index 0000000..4a40215
Binary files /dev/null and b/iep/resources/translations/iep_de_DE.tr.qm differ
diff --git a/iep/resources/translations/iep_es_ES.tr b/iep/resources/translations/iep_es_ES.tr
new file mode 100644
index 0000000..6027cfb
--- /dev/null
+++ b/iep/resources/translations/iep_es_ES.tr
@@ -0,0 +1,1139 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="es_ES">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation>Pila</translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation>Filtros de nombres archivos</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation>Busca en archivos</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation>Proyectos:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation>Apretar la estrella para marcar el directorio actual </translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation>Borrar proyecto</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation>Cambiar nombre proyecto</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation>Añade ruta a rutas de Python</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation>Nombre proyecto</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation>Nuevo nomre proyecto:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation>Sensible entre mayúsculas y minúsculas</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation>Expresión Regular</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation>Buscar en subdirs</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation>Desmarcar directorio</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation>Marcar directorio</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation>Abrir</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation>Abrir fuera de iep</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation>Muestra en Finder</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation>Copia ruta</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation>Renombrar</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation>Eliminar</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation>Crear archivo</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation>Crear directorio</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation>Da nomre al archivo</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation>Da nombre al directorio</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation>Duplicar</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation>Da nomre al archivo</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation>Seguro que quieres borrarlo</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation>Ir a este directorio en el terminal actual</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation>Importar datos...</translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation>Archivo</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation>Editar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation>Ver</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation>Opciones</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation>Consola</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation>Ejecutar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation>Herramientas</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation>Ayuda</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation>Utiliza tabuladores</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation>Utiliza espacios</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation>espacios</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation>Sangría ::: Sangría usada en el archivo actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation>Analizador sintaxis ::: Analizador sintaxis archivo actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation>Final línea ::: Carácter final línea archivo actual. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation>Codificación ::: Codificacion carácteres archivo actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation>Nuevo ::: Crear archivo nuevo (o temporal).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation>Abrir... ::: Abrir archivo del disco.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation>Guardar ::: Guardar archivo en disco.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation>Guardar como... ::: Guardar archivo actual con otro nombre.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation>Guardar todos ::: Guardar todos los archivos abiertos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation>Cerrar ::: Cerrar archivo actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation>Cerrar todos ::: Cerrar todos los archivos abiertos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation>Reiniciar IEP ::: Reiniciar la aplicación.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation>Cerrar IEP ::: Cerrar la applicación.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation>Deshacer ::: Desacer última edición.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation>Rehacer ::: Rehacer la última edición deshecha.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation>Cortar ::: Cortar el texto seleccionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation>Copiar ::: Copiar el texto seleccionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation>Pegar ::: Pegar el texto del portapapeles.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation>Selecionar todo ::: Seleccionar todo el texto.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation>Sangrar ::: Sangrar línea seleccionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation>Desangrar ::: Desangrar línea seleccionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation>Comentar ::: Comentar líneas selección.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation>Descomentar ::: descomentar líneas selección.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation>Justifica cometario/docstring ::: Remodela el texto seleccionado para que se alinee a 70 carácteres.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation>Ir línea ::: Ir a una línea specifica.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation>Borrar línea ::: Borrar línea seleccionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation>Buscar o remplazar ::: Muestra widget buscar/remplazar. Se inicializa con el texto seleccionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation>Buscar selección ::: Busca la siguiente ocurrencia del texto seleccionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation>Buscar selección hacia atrás ::: Busca la ocurrencia anterior del texto seleccionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation>Buscar siguiente ::: Buscar siguiente ocurrencia de la cadena de busca.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation>Buscar anterior ::: Buscar anterior ocurrencia de la cadena de busca.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation>Acercar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation>Alejar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation>Zoom original</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation>Ubicación indicador línea larga ::: Seleccionar ubicacción indicador de línea larga.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation>Tema Qt ::: Estilo de los widgets de la interfaz de usuario.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation>Seleccionar consola ::: Selecciona consola actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation>Seleccionar editor ::: Selecciona el editor actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation>Selecciona el archivo anterior ::: Selecciona el archivo seleccionado anteriormente.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation>Muestra espacios en blanco ::: Muestra espacios y tabuladores.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation>Muestra los finales de línea ::: Muestra el final de cada línia.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation>Muestra guías sangría ::: Muestra líneas verticales para indicar el sangrado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation>Ajustar líneas largas ::: Ajustar líneas largas que no caben el la pantalla.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation>Destacar línea actual ::: Remarca la línia donde se encuentra el cursor.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation>Fuente</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation>Zoom</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation>Borrar pantalla ::: Borra la pantalla.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation>Interrumpir ::: Interrumpe el código en ejecución. No funciona para extensiones código.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation>Reiniciar ::: Finaliza la ejecución y reinicia el intérprete.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation>Finalizar ::: Finaliza el intérprete dejando la consola abierta.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation>Cerrar ::: Finaliza el intérprete y cierra la consola.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation>Edita configuración consola... ::: Añade configuraciones a la consola y edita las propiedades del intérprete.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation>Consola nueva... ::: Crea una consola nueva donde ejecutar código. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Ejecuta selección ::: Ejecuta las líneas selecionadas en el editor o la selección de palabras en la línia actual o la línia actual si no se ha efectuado ninguna selección.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation>Cerrar otros ::: Cierra todos los archivos a excepción de este.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation>Renombra ::: Renombra este archivo.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation>Pinzar/desprender ::: Archivos pinzados son más difíciles de cerrar.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation>Marcar/desmarcar como archivo MAESTRO ::: El archivo maestro se puede ejecutar mientras otro está seleccionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation>Ejecuta archivo ::: Ejecuta el código en este archivo.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation>Ejecuta el archivo como guión ::: Ejecuta el archivo com un guión (reinicia el intérprete).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation>Ajuda para ejecutar código ::: Abre el asistente de IEP en la página de como ejecutar el código.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation>Recarga herramientas ::: Para programadores que desarrollan herramientas.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation>Pyzo página web ::: Abre la página web de Pyzo en tu buscador. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation>IEP página web ::: Abre la página web de IEP en tu buscador. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation>Haz una pregunta ::: Necesitas ayuda?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation>Reportar un problema ::: Has encontrado algun error en IEP, o echá en falta alguna caracteristica o función?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation>Ayudante IEP ::: Comienza rápidamente. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation>Busca actualizaciones ::: Tienes la última version de IEP?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation>Sobre IEP ::: Mas información sobre IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation>Selecciona idioma ::: Idioma usado por IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation>Sangría automática ::: Sangrar código automaticamente cuando presiones tecla retorno después de dos puntos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation>Habilitar ayuda funcions ::: Enseñar ayudas prototipo funciones.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation>Habilitar autocompletado ::: Muestra autocompletado con nombres conocidos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation>Autocompletado palabras clave ::: La lista de autocompletado incluye palabras clave.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation>Editar asignaciones de teclas... ::: Editar los accesos directos para elementos de menú.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation>Edita estilo sintaxis... ::: Cambiar colores sintaxis texto de tu código.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation>Opciones avanzadas... ::: Configura IEP aún más.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation>Depuración siguiente: proceder hasta la siguiente línea</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation>Depuración retorno: Depurar hasta el retorno</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation>Depuración continuar: proceder al siguiente punto de interrupción</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation>Detener depuración</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation>Borrar todos los puntos de interrupción {}</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation>Postmortem: Depurar desde el último traceback</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation>Etapa de depuración a dentro: proceder a un paso</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation>Ejecutar el archivo como un script ::: Reiniciar ejecutar el archivo actual como un script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation>Ejecutar el archivo principal como script ::: Reiniciar y ejecutar el archivo principal como un script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Ejecutar selección ::: Ejecutar líneas del editor seleccionadas, palabras seleccionados en la línea actual, o la línea actual si no hay ninguna selección.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation>Ejecutar celda ::: Ejecutar la celda del editor actual en el terminal actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation>Ejecutar celda y avanzar ::: Ejecutar celda actual y avance a la siguiente.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation>Ejecutar fichero ::: Ejecute el archivo actual en el terminal actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation>Ejecutar fichero principal ::: Ejecute el archivo principal en el terminal actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation>No se puede ejecutar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation>No se puede ejecutar el guión.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation>Compruebe si es la versión más reciente.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation>Edita estilo sintaxis</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation>Configuración avanzada</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation>
+ El idiona se ha cambiado.
+ IEP tiene que reiniciarse para hace efectivo los cambios.
+ </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation>Idioma cambiado</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation>Editar asignación de accesos directos</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation>Asignaciones de acceso directo</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation>Administrar clave licencia IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation>Añadir clave licencia</translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation>Oculta widget busqueda (Escape)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation>Busca patrón</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation>Anterior ::: Buscar anterior ocurrencia del patrón.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation>Siguiente ::: Buscar siguiente ocurrencia del patrón.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation>Reemplazar patrón</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation>Reemplazar todos ::: reemplazar todas las coincidencias en este documento.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation>Reemplaza ::: Reemplaza esta occurencia.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation>Sensible mayúsculas ::: Sensible entre mayúsculas y minúsculas.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation>Expresión regular ::: Buscar usando expresiones regulares.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation>Palabras enteras ::: Buscar sólo palabras enteras.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation>Auto ocultar ::: Ocultar automáticamente buscar/reemplazar cuando no se usa durante 10s.</translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation>Usa opcions por defecto del sistema</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation>Nombre ::: El nombre de esta configuración.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation>exe ::: El ejecutable de Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation>gui ::: Kit de herramientas de GUI para integrar (para trazado interactivo, etc.).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation>pythonPath ::: Lista de directorios donde buscar módulos y paquetes. Introduce cada ruta en un nueva línea, o separalas mediante el separador por defecto de tu sistema operativo. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation>GuiónInicio ::: Guión a ejecutar al inicio (no en modo guión).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation>DirInicio ::: Directorio al inició (no en modo guión).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation>Borrar ::: Borra la configuracion de esta consola</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation>Configuración consola</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation>Añadir configuración</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation>ipython ::: Usar terminal IPython si disponible.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation>Archivo a ejecutar al inicio</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation>Código a ejecutar al inicio</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation>argv ::: Argumentos línea de comandos (sys.argv).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation>environ ::: Variables de entorno addicionales (os.environ).</translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation>Primeros pasos con IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation>Paso</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation>Bienvenido al (E)ditor (I)nteractivo de (P)ython - IEP!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation>Este asistente le ayudará a familiarizarse con el funcionamiento del IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation>IEP es un entorno de desarrollo integrado (IDE) de python multi-plattaforma
+ centrado en la interactividad * * y * introspección *, lo que hace que sea
+ muy adecuado para la computación científica. Su diseño práctico
+ está dirigido a * sencillez * y * Eficiencia *.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation>Este asistente se puede abrir con "Ayuda> IEP assistente '</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation>Mostrar este asistente en el inicio</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation>Selecciona idioma</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation>
+ El lenguaje se ha cambiado para este asistente.
+ IEP debe reiniciarse para que los cambios surtan efecto en toda la aplicación.
+ </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation>Idioma cambiado</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation>IEP consta de dos componentes principales</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation>Puede ejecutar comandos directamente en *la consola*,</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation>o puede escribir código en el *editor* y posterioment ejecutarlo.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation>El editor es donde se escribe el código</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation>En el *editor*, cada archivo abierto se representa como una pestaña. Al
+ hacer clic derecho sobre una pestaña, los archivos se pueden ejecutar, guardar, cerrar, etc.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation>El botón derecho del ratón también nos permite hacer de un archivo qualquiera
+ el *archivo maestro* de un proyecto. Este archivo puede ser reconocido por su símbolo
+ de la estrella, y permite ejecutarlo con mayor facilidad.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation>La consola es donde tu código se ejecuta</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation>Cuando se inicia IEP, se crea una *consola* por defecto. Puedes añadir más
+ consolas que se ejecutas simultaneamente, que pueden incluso corresponder
+ a diferentes versiones de Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation>Las consolas se ejecutan en un sub-proceso, de esta manera IEP
+ se mantiene siempre receptivo, lo que le permite seguir trabajando e incluso
+ ejecutar código en otra consola.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation>Configurar las consolas</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation>IEP puede integrar el ciclo de eventos de cinco *herramientas GUI* distintas,
+ lo que permite por ejemplo, hacer gráficas interactivament con Visvis o Matplotlib.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation>Mediante 'Consola > Edita propiedades consola', se puede editar y añadir
+ *propiedades a la consola*. Esto permite por ejemplo seleccionar un
+ directorio de inicio nuevo, o usar un Pythonpath personalizado.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation>Ejecutando código</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation>IEP admite varias formas de ejecutar código fuente en el editor. (véase el menu 'Ejecutar').</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation>*Ejecutar selección:* si no hay texto seleccionado, la línea actual se ejecuta,
+ si la selección está en una sola línea, la selección se evalúa, si la selección incluye
+ varias líneas, el IEP ejecutará las líneas (completas) seleccionados.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation>*Ejecutar celda:* una celda es todo lo que hay entre dos líneas que comienzan con '##'.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation>*Ejecutar archivo:* ejecutar todo el código en el archivo actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation>*Ejecutar archivo maestro de proyecto:* ejecutar el código en el archivo maestro del proyecto actual.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation>Modo interactivo vs ejecución como guión</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation>Puede ejecutar el archivo actual o al archivo maestro normalmente o como un guión.
+ Cuando se ejecuta como guión, la shell se reinicializará para proporcionar un entorno limpio.
+ La consola también se inicializa de manera diferente de modo que se parece mucho a la
+ ejecución de un guión normal.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation>En el modo interactivo, sys.path [0] es una cadena vacía (es decir,
+ el directorio actual), y sys.argv se establece como [''].</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation>En el modo guión, __file__ y sys.argv[0] se ajustan al nombre del archivo guión, sys.path[0] y el directorio de trabajo se ajustan al directorio que contiene el script.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation>Herramientas para su comodidad</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation>A través del menú *Herramientas*, se puede seleccionar qué herramientas utilizar.
+ Las herramientas se pueden colocar en cualquier forma que desee. También pueden desacoplarse.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation>Tenga en cuenta que el sistema de herramientas está diseñado de tal
+ manera que es fácil de crear sus propias herramientas. Mira la wiki en línea para obtener
+ más información, o utilizar una de las herramientas existentes, como ejemplo.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation>Herramientas recomendadas</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation>Recomendamos especialmente las siguientes herramientas:</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation>La *herramienta estructura código* ofrece un esbozo del código fuente.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation>El *Navegador de archivos* ayuda a mantener una visión general de todos los archivos en un directorio. Para gestionar sus proyectos, haga clic en el icono de estrella.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation>Comienza a programar!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation>Con esto concluye el asistente de IEP. Ahora, empieza a programar y diviértete!</translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_es_ES.tr.qm b/iep/resources/translations/iep_es_ES.tr.qm
new file mode 100644
index 0000000..d6fe790
Binary files /dev/null and b/iep/resources/translations/iep_es_ES.tr.qm differ
diff --git a/iep/resources/translations/iep_fr_FR.tr b/iep/resources/translations/iep_fr_FR.tr
new file mode 100644
index 0000000..4d2a360
--- /dev/null
+++ b/iep/resources/translations/iep_fr_FR.tr
@@ -0,0 +1,1143 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="fr_FR">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation>Pile</translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation>Filtre</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation>Rechercher dans les fichiers</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation>Projets :</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation>Cliquez sur l'étoile pour ajouter le répertoire à la liste des projets</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation>Enlever de la liste des projets</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation>Renommer le projet</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation>Ajouter le chemin au path de Python</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation>Nom du projet</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation>Nouveau nom du projet :</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation>Respecter la casse</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation>Recherche avec une expression rationelle</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation>Rechercher dans les sous-répertoires</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation>Enlever ce répertoire de la liste des projets</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation>Ajouter ce répertoire à la liste des projets</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation>Ouvrir</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation>Ouvrir à l'extérieur d'IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation>Ouvrir dans le Finder</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation>Copier le nom complet (chemin) du fichier</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation>Renommer</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation>Effacer</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation>Nouveau fichier</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation>Nouveau dossier</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation>Nouveau nom du fichier</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation>Nom du nouveau dossier</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation>Faire une copie</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation>Nom du nouveau fichier</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation>Êtes-vous sûr de vouloir effacer</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation>Aller dans ce dossier (shell courant)</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation>Importer un fichier de données...</translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation>Fichier</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation>Édition</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation>Affichage</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation>Paramètres</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation>Shell</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation>Exécuter</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation>Outils</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation>Aide</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation>Utiliser des tabulations</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation>Utiliser des espaces</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation>espaces</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation>Indentation ::: Indentation utilisée pour le fichier courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation>Analyse syntaxique ::: Analyseur du fichier courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation>Fins de ligne ::: Caractère de fin de ligne pour le fichier courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation>Encodage ::: Encodage du fichier courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation>Nouveau ::: Crée un nouveau fichier (ou un fichier temporaire).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation>Ouvrir... ::: Ouvre un fichier sur le disque.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation>Enregistrer ::: Enregistre le fichier courant sur le disque.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation>Enregistrer sous... ::: Enregistre le fichier sous un autre nom.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation>Tout Enregistrer ::: Enregistre tous les fichiers ouverts.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation>Fermer ::: Ferme le fichier courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation>Tout fermer ::: Ferme tous les fichiers.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation>Redémarrer IEP ::: Redémarre l'application.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation>Quitter IEP ::: Ferme l'application.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation>Annuler ::: Annule la dernière opération d'édition.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation>Recommencer ::: Refait la dernière action d'édition annulée.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation>Couper ::: Coupe le texte sélectionné.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation>Copier ::: Copie le texte sélectionné dans le presse-papier.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation>Coller ::: Colle le texte qui est dans le presse-papier.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation>Tout sélectionner ::: Sélectionne tout le texte.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation>Indenter ::: Indente la ligne sélectionnée.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation>Dédenter ::: Supprime l'indentation de la ligne sélectionnée.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation>Commenter ::: Commente la ligne sélectionnée.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation>Décommenter ::: Décommente la ligne sélectionnée.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation>Justifier les commentaires/docstrings ::: Remet en forme le texte sélectionné en lignes de 70 caractères environ.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation>Aller à la ligne ::: Va à un numéro de ligne spécifique.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation>Effacer la ligne ::: Efface la ligne sélectionnée.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation>Rechercher et remplacer ::: Affiche la boîte rechercher/remplacer. L'initialise avec le texte sélectionné.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation>Rechercher la sélection ::: Recherche la prochaine occurence du texte sélectionné.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation>Rechercher la sélection en arrière ::: Recherche l'occurence précédente du texte sélectionné.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation>Rechercher suivant ::: Recherche la prochaine occurence de la chaîne.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation>Rechercher précédent ::: Recherche l'occurence précédente de la chaîne.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation>Zoomer</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation>Dézommer</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation>Réinitialiser le zoom</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation>Emplacement de l'indicateur de ligne trop longue ::: Emplacement du long-line-indicator.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation>Thème QT ::: Style des widgets de l'interface.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation>Aller dans le Shell ::: Donne le focus au shell courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation>Aller dans l'éditeur ::: Donne le focus à l'éditeur courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation>Aller au fichier précédent ::: Donne le focus au fichier précédent.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation>Afficher les espaces ::: Affiche les espaces et les caractères de tabulation.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation>Afficher les fins de lignes ::: Affiche la fin de chaque ligne.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation>Afficher les guide d'indentation ::: Affiche des lignes verticales pour visualiser l'indentation.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation>Couper les lignes trop longues ::: Coupe les lignes qui ne tiennent pas sur l'écran (pas de défilement horizontal).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation>Mettre en évidence la ligne courante ::: Met en surbrillance la ligne qui contient le curseur.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation>Police de caractères</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation>Zoom</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation>Effacer l'écran ::: Efface l'écran.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation>Interrompre ::: Arrêter l'exécution (ne fonctionne pas pour les extensions).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation>Redémarrer ::: Arrête puis redémarre l'interpréteur.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation>Terminer ::: Arrête l'interpréteur et laisse le shell ouvert.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation>Fermer ::: Arrête l'interpréteur et ferme le shell.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation>Configuration des shells ::: Ajoute des shells, et modifie les paramètres de l'interpréteur.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation>Nouveau shell... ::: Crée un nouveau shell.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Exécuter la sélection ::: Exécute les lignes sélectionnées dans l'éditeur, une partie de la ligne courante, ou la ligne courante entière si la sélection est vide.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation>Fermer les autres onglets ::: Ferme tous les fichiers sauf celui-ci.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation>Renommer ::: Renomme ce fichier.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation>Ajouter/Enlever un épingle ::: Les fichiers épinglés sont moins facilement fermés.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation>(Dé)sélectionner comme fichier principal (MAIN) ::: Le fichier principal peu être exécuté alors qu'un autre fichier est sélectionné.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation>Exécuter le fichier ::: Exécute le code de ce fichier.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation>Exécuter en tant que script ::: Exécute ce fichier comme un script (redémarre l'interpréteur).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation>Aide sur l'exécution du code ::: Ouvre le guide d'IEP à la page sur l'exécution de code.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation>Recharger les outils ::: Pour ceux qui développent des outils.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation>Site Web de Pyzo ::: Ouvre le site web de Pizo dans le navigateur.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation>Site Web d'IEP ::: Ouvre le site web d'IEP dans le navigateur.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation>Poser une question ::: Besoin d'aide ?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation>Reporter un problème ::: Vous avez trouvé un bug dans IEP ? Vous demandez une nouvelle fonctionnalité ?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation>Guide IEP ::: Démarrer rapidement.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation>Rechercher des mises à jour ::: Utilisez-vous la dernière version ?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation>À propos d'IEP ::: Plus d'informations sur IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation>Choisir la langue ::: Langue utilisée par IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation>Indentation automatique ::: Indente automatiquement lors d'un passage à la ligne après deux point.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation>Activer les bulles d'aides ::: Affiche les bulles d'aide avec le prototype des fonctions.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation>Activer la complétion automatique ::: Affiche des proposition de complétion automatique.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation>Complétion automatique des mots clés ::: La liste de complétion automatique contient aussi les mots clés.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation>Éditer les racourcis... ::: Modifie les raccourcis pour accéder aux éléments des menus.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation>Éditer les style du code... ::: Modifie la coloration syntaxique du code.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation>Paramètres avancés ::: Permet de configurer encore plus IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation>Débugage pas à pas principal (next)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation>Débugage pas à pas sortant</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation>Débugage : exécuter jusqu'à prochain point d'arrêt</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation>Arrêter le débugage</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation>Effacer tous les points d'arrêt</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation>Postmortem : débuguer à partir de la dernière pile des appels</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation>Débugage pas à pas entrant (step)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation>Démarrer le script ::: Redémarre le shell et exécute le fichier courant en tant que script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation>Démarrer le script principal::: Redémarre le shell et exécute le fichier principal en tant que script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Exécuter la sélection ::: Exécute les instructions, les lignes sélectionnées dans l'éditeur ou la ligne courante (en l'absence de sélection).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation>Exécuter la cellule ::: Exécute la cellule courante dans le shell courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation>Exécute la cellule et avancer ::: Exécute la cellule courante dans le shell courant et passe à la cellule suivante.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation>Exécuter le fichier ::: Exécute le fichier courant dans le shell courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation>Exécuter le fichier principal ::: Exécute le fichier principal dans le shell courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation>Impossible de lancer l'exécution</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation>Impossible de lancer l'exécution du script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation>Rechercher la dernière version.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation>Modifier la coloration syntaxique</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation>Paramètres avancés</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation>La langue a été modifiée.
+Redémarrez IEP pour rendre les changements effectifs. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation>Langue modifiée</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation>Édition des raccourcis clavier</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation>Raccourcis clavier</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation>Gérer la clé de licence IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation>Ajouter une clé de licence</translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation>Cacher le widget de recherche (Escape)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation>Recherche un motif</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation>Précédent ::: Recherche l'occurence précédente du motif.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation>Suivant ::: Recherche la prochaine occurence du motif.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation>Remplacer le motif</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation>Tout remplacer ::: Remplace toutes les occurences dans le document courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation>Remplacer ::: Remplace cette occurrence.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation>Respecter la casse ::: Recherche des mots en respectant la casse.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation>Expression Rationnelle ::: Rechercher avec des expressions rationnelles.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation>Mots complets ::: Recherche uniquement des mots complets.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation>Affichage/Disparition automatique ::: Cache Rechercher/Remplacer s'il n'ets pas utilisé pendant 10s.</translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation>Configuration par défaut du système</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation>nom ::: Nom de la configuration.
+</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation>exe ::: Exécutable Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation>Gui ::: Intégration d'un toolkit graphique (GUI toolkit) (pour tracer des courbes de manière interactive etc.).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation>pythonPath ::: Liste des répertoires dans lesquels rechercher des module et paquetages.
+ Chaque chemin doit figurer sur une ligne, ou être séparé des autres par le séparateur par défaut du système.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation>startupScript ::: Script à exécuter au démarrage (ne s'applique pas lors de l'exécution en tant que script).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation>startDir ::: Répertoire de démarrage (ne s'applique pas lors de l'exécution en tant que script).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation>Supprimer ::: Supprimer ce shell</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation>Configurations du shell</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation>Ajouter une configuration</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation>IPython ::: Utilise IPython s'il est disponible.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation>Fichier à exécuter au démarrage</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation>Code à exécuter au démarrage</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation>argv ;:; Arguments en ligne de commande (sys.argv).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation>environ ::: Variables d'environnement (os.environ).</translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation>Démarrer avec IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation>Étape
+</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation>Bienvenue dans IEP (Interactive Editor for Python)!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation>Ce guide va vous aider à vous familiariser avec IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation>IEP est un EDI Python multi plate-forme
+ qui met l'accent sur l'*interactivité* et l'*introspection*, ce qui le rend
+ très adapté à un usage scientifique. Son design
+ est axé vers la *simplicité* et l'*efficacité*. </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation>Ce guide peut être ouvert via 'Aide>Guie IEP'</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation>Afficher ce guide au démarrage</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation>Choisir une langue</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation>
+ La langue de ce guide a été modifiée.
+ IEP doit être redémarré pour que la modification prenne effet dans toute l'application.
+</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation>Langue modifiée</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation>IEP est constitué de deux composants principaux</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation>Vous pouvez exécuter des commandes directement dans le *shell*,</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation>ou vous pouvez écrire du code dans l'*éditeur* et l'exécuter.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation>L'éditeur est l'endroit où vous écrivez le code</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation>Dans l'*éditeur*, chaque fichier ouvert est représenté par un onglet. En
+ faisant un clic droit sur l'onglet, le fichier correspondant peut être exécuté, sauvegardé, fermé etc. </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation>Le bouton droit de la souris permet aussi de paramétrer le fichier comme
+ *fichier principal* du projet. Ce fichier peut être repéré par le symbole
+ étoile, et cela permet de l'exécuter plus facilement.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation>Le shell est l'endroit où* le code est exécuté</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation>Quand IEP démarre, un *shell* par défaut est créé. Vous pouvez ajouter d'autres
+ shells qui s'exécuteront simultanément, et qui peuvent correspondre à
+ différentes versions de Python. </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation>Un shell s'exécute dans un processus fils, de manière à ce que, même lorsque ce shell est occupé,
+ l'interface d'IEP n'est pas gelée, vous permettant ainsi de continuer à coder, et même d'exécuter
+ du code dans un autre shell.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation>Configuration des shells</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation>IEP peut intégrer la boucle des événements de cinq *toolkits graphiques* différents,
+ permettant ainsi le tracé interactif de courbes avec, par exemple Visvis ou Matplotlib.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation>Via 'Shell > Configuration des shells', vous pouvez éditer et ajouter
+ *des configurations de shells*. Ceci vous permet par exemple de paramétrer
+ le répertoire de démarrage, ou d'utiliser un chemin python (PythonPath) de votre choix.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation>Exécuter du code</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation>IEP permet d'exécuter le code source de l'éditeur de différentes manières (voir le menu 'Exécuter').</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation>*Exécuter la sélection :* S'il n'y a pas de texte sélectionné, la ligne en cours
+ est exécutée ; si la sélection est entièrement contenue dans une ligne, seule la
+ sélection est exécutée ; si la sélection s'étend sur plusieurs lignes, IEP exécutera
+ chacune des lignes (entièrement).</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation>*Exécuter une cellule : * une cellule est tout ce qui se trouve entre deux lignes commençant par '##'.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation>*Exécuter le fichier :* Exécute tout le code contenu dans le fichier courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation>*Exécuter le fichier principal du projet :* exécute tout le code contenu dans le fichier principal du projet courant.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation>Mode interactif vs exécution en tant que script</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation>Vous pouvez exécuter le fichier courant ou le fichier principal normalement, ou en tant que script.
+ Dans le second cas, le shell est redémarré et l'environnement est donc propre.
+ Le shell est aussi initialisé différemment de manière à être presque similaire à
+ celui utilisé lors d'une exécution de script ordinaire.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation>En mode interactif, , sys.path[0] est une chaîne vide (i.e. le répertoire courant),
+ et sys.argv vaut [''].</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation>En mode script, __file__ et sys.argv[0] sont égaux au nom du script,
+ sys.path[0] et le répertoire de travail sont modifiés et pris égaux au répertoire contenant le script.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation>Des outils pratiques</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation>Via the menu *Outils*, il est possible de sélectionner quels outils utiliser. Les outils peuvent
+ être placés dans la fenêtre de la manière que vous voulez, et peuvent aussi être détachés de la fenêtre principale.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation>Notez que le système d'outils est réalisé de telle manière qu'il est facile de
+ créer vos propres outils. Jetez un oeil au wiki pour avoir plus d'informations,
+ ou utilisez un des outils existants comme exemple.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation>Outils recommandés</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation>Nous recommandons tout spécialement les outils suivants :</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation>L'outil *Source structure tool* (Structure du fichier source) fournit un *plan* du code source.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation>L'outil *File browser tool* (gestionnaire de fichiers) permet de garder un oeil sur tous les fichiers
+ d'un répertoire. Pour gérer vos projets, cliquez sur le symbole étoile.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation>En route pour le code !</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation>Ceci termine le guide IEP. Maintenant, c'est parti pour le code. Amusez vous bien !</translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_fr_FR.tr.qm b/iep/resources/translations/iep_fr_FR.tr.qm
new file mode 100644
index 0000000..4c95c3c
Binary files /dev/null and b/iep/resources/translations/iep_fr_FR.tr.qm differ
diff --git a/iep/resources/translations/iep_nl_NL.tr b/iep/resources/translations/iep_nl_NL.tr
new file mode 100644
index 0000000..87436e1
--- /dev/null
+++ b/iep/resources/translations/iep_nl_NL.tr
@@ -0,0 +1,1124 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="nl_NL">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation>Stack</translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation>Bestandsnaam filter</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation>Zoek in bestanden</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation>Projecten:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation>Verwijder project</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation>Verander de naam van dit project</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation>Voeg directory toe aan Pythonpath</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation>Project naam</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation>Nieuwe project naam:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation>Hoofdlettergevoelig</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation>RegExp</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation>Zoek in subdirectories</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation>Openen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation>Openen buiten IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation>Laat zien in Finder</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation>Hernoemen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation>Verwijderen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation>Maak nieuw bestand</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation>Maak nieuwe directorie</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation>Geef de nieuwe naam voor het bestand</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation>Geef de naam voor de directorie</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation>Dupliceren</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation>Geef de naam van het nieuwe bestand</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation>Weet je zeker dat je wilt verwijderen</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation>Kopier directorie pad</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation>Klik de ster om de huidige dir op te slaan</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation>Verwijder deze dir uit de projecten</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation>Voeg deze dir toe aan de projecten</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation>Ga naar deze directorie in de huidige shell</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation>Importeer data...</translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation>Bestand</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation>Bewerken</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation>Uiterlijk</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation>Instellingen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation>Shell</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation>Uitvoeren</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation>Gereedschap</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation>Help</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation>Gebruik tabs</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation>Gebruik spaties</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation>spaties</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation>Inspring niveau ::: The mate van inspringen voor het huidige bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation>Syntax parser ::: De syntax parser voor het huidige bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation>Regel uiteinden ::: Het soort regel uiteinden van het huidige bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation>Codering ::: The karakter codering voor het huidige bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation>Nieuw ::: Maak een nieuw (of tijdelijk) bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation>Open ::: Open een bestaand bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation>Opslaan ::: Sla het huidige bestand op.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation>Opslaan als ... ::: Sla het huidige bestand op onder een andere naam.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation>Alles opslaan ::: Sla alle geopende bestanden op.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation>Sluiten ::: Sluit het huidige bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation>Alles sluiten ::: Sluit alle geopende bestanden.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation>Herstart IEP ::: Herstart de applicatie.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation>IEP afsluiten</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation>Ongedaan maken ::: Maak de laatste bewerking ongedaan.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation>Opnieuw doen ::: Doe de laatste ongedaan gemaakte bewerking opnieuw.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation>Knippen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation>Kopieren</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation>Plakken</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation>Alles selecteren</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation>Inspringen ::: Spring de geselecteerde regel in.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation>Terugspringen ::: Zet het inspringen een stap kleiner.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation>Commentaar ::: Voeg een commentaar teken toe aan de geselecteerde regel.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation>Verwijder commentaar ::: Verwijder een commentaar teken van de huidige regel.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation>Uitlijnen commentaar of docstring ::: Hervorm de geselecteerde tekst door het uit te lijnen op 70 karakters.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation>Ga naar regel ::: Ga naar een specifiek regel nummer.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation>Verwijder regel ::: Verwijder de geselecteerde regel.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation>Vind of vervang ::: Laat het vind/vervang paneel zien. Initializeer met de geselecteerde tekst.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation>Vind selectie ::: Vind het volgende voorkomen van de geselecteerde tekst.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation>Vind vorige selectie ::: Vind het vorige voorkomen van de geselecteerde tekst.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation>Vind volgende ::: Vind het volgende voorkomen van de zoek tekst.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation>Vind vorige ::: Vind het vorige voorkomen van de zoek tekst.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation>Inzoomen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation>Uitzoomen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation>Reset zoom</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation>Qt thema ::: De stijl van de gebruikersinterface.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation>Selecteer shell ::: Focus de cursor op de huidige shell.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation>Selecteer editor ::: Focus de cursor op de huidige editor.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation>Selecteer vorige bestand</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation>Laat whitespace zien ::: Laat spaties en tabs zien.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation>Laat regeluiteindes zien</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation>Laat inspring hulplijnen zien</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation>Vouw lange regels ::: Vouw lange regels als ze niet op het scherm passen.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation>Markeer huidige regel ::: Geef de huidige regel een andere achtergrondkleur.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation>Zoomen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation>Maak scherm schoon</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation>Onderbreken ::: Onderbreek de nu uitgevoerde code (werkt niet voor extension-code).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation>Herstart ::: Stop en herstart de interpreter.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation>Stoppen ::: Stop de interpreter, maar laat de shell open.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation>Afsluiten ::: Stop de interpreter en sluit de shell af.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation>Aanpassen shell configuraties... ::: Voeg shell configuraties toe en pas de eigenschappen aan.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation>Nieuwe shell ... ::: Maak een nieuwe shell aan om code in uit te voeren.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation>Anderen sluiten ::: Sluit alle bestanden behalve deze.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation>Hernoemen ::: Hernoem dit bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation>Vastpinnen/ontpinnen :::Pin dit bestand vast.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation>Stel dit bestand in als MAIN bestand/gewoon bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation>Voer bestand uit ::: Voer de code in dit bestand uit.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation>Voer bestand uit als script ::: Voer de code in dit bestand uit als script (dit herstart de interpreter).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Voer selectie uit ::: Uitvoeren van: huidig geselecteerde regels, geselecteerde woorden op een regel, of de huidige regel als er geen selectie is.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation>Hulp over het uitvoeren van code ::: Opent de IEP wizard op de pagina over het uitvoeren van code.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation>Herlaad gereedschap.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation>Pyzo website</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation>IEP website</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation>Stel een vraag</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation>Rapporteer een probleem</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation>IEP wizard</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation>Kijk of er updates zijn</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation>Over IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation>Automatisch inspringen ::: Inspringen bij een nieuwe regel na een dubbele punt.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation>Pas uitvoertips toe ::: Laat uitvoertips zien.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation>Pas autocompletion toe ::: Laat de autocompletion met bekende namen zien.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation>Autocomplete keywords ::: De autocomple lijst laat ook keywords zien.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation>Bewerk sneltoetsen...</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation>Bewerk syntax stijlen...</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation>Geavanceerde instellingen...</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation>Selecteer taal ::: De taal gebruikt door IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation>Locatie van de lange-regel indicator</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation>Lettertype</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation>Debug volgende: ga een regel verder</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation>Debug return: ga verder tot function return</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation>Debug verder: ga verder tot volgend breakpoint</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation>Stop debuggen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation>Verwijder alle {} breakpoints</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation>Postmortem: debuggen met laatste traceback </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation>Debug instappen: ga een stap verder</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation>Voer bestand uit als script ::: Herstart en voer het huidige bestand uit als script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation>Voer main bestand uit als script ::: Herstart en voer het main bestand uit als script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Executeer selectie ::: Executeer de geselecteerde regels, de geselecteerde text op de huidige regel, of the huidige regel als er geen selectie is.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation>Executeer cell ::: Executeer de huidige cell.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation>Executeer cell en ga verder ::: Executeer de huidige cell en ga verder naar de volgende cell.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation>Executeer bestand ::: Executeer het huidige bestand.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation>Executeer main bestand ::: Executeer het main bestand in de huidige shell. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation>Kon niet uitvoeren</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation>Kon script niet uitvoeren.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation>Check laatste versie.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation>Pas syntax stijlen aan</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation>Geavanceerde instellingen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation>Pas sneltoetsen aan</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation>Sneltoets lijst</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation>Taal aangepast</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation>De taal is aangepast. IEP moet herstarten om de aanpassing zichtbaar te maken.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation>Manage IEP licentie keys </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation>Voeg licentie key toe</translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation>Verber zoek scherm (Escape)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation>Zoekpatroon</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation>Vorige ::: Vind de vorige instantie van het zoekpatroon. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation>Volgende :::Vind de volgende instantie van het zoekpatroon.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation>Vervangpatroon</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation>Verv. alles ::: Vervang alle instanties in het huidige document.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation>Vervang ::: Vervang de huidige instantie.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation>Hoofdlettergevoelig ::: Houd rekening met hoofdletters bij het zoeken.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation>RegExp ::: Zoek met regular expressions.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation>Hele woorden ::: Vind alleen hele woorden.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation>Automatisch verbergen ::: Verberg het zoek/vervang scherm als het 10 s ongebruikt is.</translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation>Gebruik standaard van het systeem</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation>naam ::: De naam van deze configuratie.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation>exe ::: Het Python executable bestand. </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation>gui ::: Welke GUI toolkit geintegreerd wordt (b.v. voor interactief plotten). </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation>pythonPath ::: Een lijst met directories om te zoeken naar modules. Elke directorie moet op een nieuwe regel.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation>opstartscript ::: Het script dat uitgevoerd wordt bij het opstarten (niet in script modus).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation>start directorie ::: De directorie waar gestart wordt (niet in script modus). </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation>Verwijderen ::: Verwijder deze shell configuratie</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation>Shell configuraties</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation>Config toevoegen</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation>ipython ::: Gebruik IPython shell als deze beschikbaar is.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation>Bestand dat uitgevoerd wordt bij het opstarten</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation>Code die uitgevoerd wordt bij het opstarten</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation>argv ::: Command line argumenten (sys.argv).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation>environ ::: Extra omgevings variabelen (os.environ).</translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation>Beginnen met IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation>Welkom bij de Interactieve Editor voor Python!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation>IEP bestaat uit twee componenten </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation>De editor is waar je je code schrijft</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation>De shell is waar de code uitgevoerd wordt</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation>Shells configureren</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation>Code uitvoeren</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation>Interactieve modus versus script modus</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation>Gereedschap</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation>Aanbevolen gereedschap</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation>Begin met coden!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation>Stap</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation>Deze wizard kan je ook openen via 'Help > IEP wizard'</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation>Laat deze wizard zien als IEP opstart</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation>Selecteer taal</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation>De taal is veranderd voor deze wizard.
+Om de nieuwe taal voor de hele applicatie actief te maken moet deze herstart worden. </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation>Taal aangepast</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation>Deze wizard helpt je op de weg met IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation>IEP is een cross-platform Python IDE gericht op *interactiviteit* en *introspectie*, wat het erg geschikt
+maakt voor wetenschappelijke toepassingen. IEP's praktische ontwerp is gericht op *simpelheid* en *efficientie*.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation>of je kan je code in the *editor* schrijven en deze vervolgens uitvoeren.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation>In the *editor* wordt elk geopend bestand gerepresenteerd met een tab. Door met de rechtermuisknop op een tab te
+klikken, kunnen bestanden worden uitgevoerd, opgeslagen, afgesloten, etc.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation>The rechtermuisknop maakt het ook mogelijk om een file te markeren als de *main file* van je project.
+Dit bestand kan je herkennen aan het ster-symbool, en kan vervolgens uitgevoerd w</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation>Als IEP start, wordt er een standaard *shell* gemaakt. Je kan zelf shells toevoegen, welke
+simultaan draaien en ook van verschillende Python versies kunnen zijn.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation>Shells draaien in een sub-process, zodat als ze actief zijn, IEP zelf goed werkbaar blijft.
+Je kan dus gewoon verder programmeren en zelfs code uitvoeren in een andere shell.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation>IEP kan de event-loops van vijf verschillende *GUI toolkits* integreren. Daarmee is het mogelijk
+om bijvoorbeeld interactieve plotjes te maken, zoals met Visvis of Matplotlib.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation>Via 'Shell > Aanpasses shell configuraties' kan je *shell configuraties* aanpassen en toevoegen. Zo kun je bijvoorbeeld
+de start directorie insteller, of het Pythonpath.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation>IEP ondersteund verschillende manieren om code van de editor uit te voeren (zie ook het 'Uitvoeren' menu).</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation>*Voer selectie uit:* als er geen selectie is wordt de huidige regel uitgevoerd; als de selectie een enkele regel beslaat, wordt de selectie geevalueerd; als de selectie meerde regels beslaat, zal IEP die regels (volledig) uitvoeren. </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation>*Voer cell uit:* een cell is alle code tussen twee regels die met '##' beginnen.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation>*Voer bestand uit:* alle code in het huidige bestand wordt uitgevoerd.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation>*Voer project main bestand uit:* alle code in de huidige main file wordt uitgevoerd.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation>In interactieve modus is sys.path[0] een lege string (ofwel de huidige dir), en sys.argv wordt [''].</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation>In script modus worden __file__ en sys.argv[0] gezet naar de bestandsnaam van het script.
+sys.path[0] en de start directorie worden gezet naar de directorie waar het script in staat.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation>Via het *gereedschap menu* kan je eenvoudig selecteren wel gereedschap je wilt gebruiken. Het gereedschap besaat uit kleine schermen die naar eigen voorkeur gepositioneerd kunnen worden.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation>Het gereedschapsysteem is zo ontworpen dat het vrij eenvoudig is om ook zelf gereedschap te maken. Kijk
+op de online wiki.voor meer informatie.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation>We raden met name de volgende gereedschappen aan:</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation>De *Sourc structure* geeft de structuur van de broncode aan.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation>De *File browser* geeft een overzicht van alle bestanden in een directorie. Klik op het ster-icoon om je project te markeren en managen.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation>Hiermee eindigd de IEP wizard. Veel programmeerplezier!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation>Je kan commandos direct in the *shell* uitvoeren.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation>Je kan het huidige bestand of de main file normaal uitvoeren, of als script.
+In het laatste geval wordt de shell eerst herstart om een schone omgeving te realizeren.
+Ook wordt de shell anders geinitializeerd zodat het gedrag overeenkomt met het
+normaal uitvoeren van een script in Python.</translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_nl_NL.tr.qm b/iep/resources/translations/iep_nl_NL.tr.qm
new file mode 100644
index 0000000..f6e4f33
Binary files /dev/null and b/iep/resources/translations/iep_nl_NL.tr.qm differ
diff --git a/iep/resources/translations/iep_pt_PT.tr b/iep/resources/translations/iep_pt_PT.tr
new file mode 100644
index 0000000..3c77a8a
--- /dev/null
+++ b/iep/resources/translations/iep_pt_PT.tr
@@ -0,0 +1,1112 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="pt">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation>Montão</translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation>filtro do nome do arquivo</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation>Procurar em ficheiros</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation>Projetos:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation>Clique estrela para marcar o seu favorito corrente dir</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation>Remover projeto</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation>Alterar nome do projeto</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation>Adicionar caminho para Python caminho</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation>Vá para este diretório no shell corrente</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation>Novo nome do projeto:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation>maiúsculas de minúsculas</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation>Expressão regular</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation>Procurar em subdiretórios</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation>Remover estrela este diretório</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation>Estrela este diretório</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation>Abrir</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation>Abrir fora da IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation>Revelar no Finder</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation>Copiar caminho</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation>Importar dados ...</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation>Renomear</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation>Apagar</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation>Criar novo arquivo</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation>Criar novo diretório</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation>Dê um novo nome para o arquivo</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation>Dar um nome para o novo diretório</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation>duplicar</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation>Dar um nome para o novo arquivo</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation>Você tem certeza que deseja deletar</translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation>Arquivo</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation>editar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation>Vista</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation>Configurações</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation>Concha</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation>Corrida</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation>Ferramentas</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation>Ajudar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation>Utilize os separadores</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation>Utilize espaços</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation>espaços</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation>Recuo ::: O recuo usado do arquivo atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation>Sintaxe parser ::: O analisador de sintaxe do arquivo atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation>Finais de linha ::: A linha de caracteres do arquivo atual de término.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation>Codificação ::: A codificação de caracteres do arquivo atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation>Novo ::: Criar um novo (ou temporária) de arquivos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation>Abrir ... ::: Abra um arquivo existente do disco.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation>Salve ::: Salve o arquivo atual no disco.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation>Salvar como ... ::: Salve o arquivo atual com outro nome.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation>Salve todo ::: Salve todos os arquivos abertos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation>Fechar ::: Feche o arquivo atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation>Feche todos ::: Fechar todos os arquivos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation>Restart IEP ::: Reinicie o aplicativo.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation>Saia do IEP ::: Feche o aplicativo.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation>Desfazer ::: Desfazer a última ação de edição.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation>Refazer ::: Refazer a última ação editong desfeita.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation>Cortar ::: Cortar o texto selecionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation>Copiar ::: Copie o texto selecionado para a área de transferência.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation>Cole ::: Cole o texto que está agora na área de transferência.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation>Selecionar todos ::: Selecione todo o texto.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation>Recuo ::: recuo da linha selecionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation>Dedent ::: Unindent da linha selecionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation>Comentário ::: Comente a linha selecionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation>Descomente ::: Remova o comentário da linha selecionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation>Justificar comentário / docstring ::: Remodelar o texto selecionado para que ele está alinhado com cerca de 70 caracteres.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation>Ir para linha ::: Ir para um número de linha específico.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation>Apagar linha ::: Apagar a linha selecionada.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation>Localizar ou substituir ::: Mostrar localizar / substituir widget. Inicializar com o texto selecionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation>Encontre seleção ::: Localizar a próxima ocorrência do texto selecionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation>Encontre seleção backward ::: Localizar a ocorrência anterior do texto selecionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation>Localizar próxima ::: Localizar a próxima ocorrência da seqüência de pesquisa.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation>Encontre anterior ::: Localizar a ocorrência anterior da seqüência de pesquisa.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation>ampliar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation>Diminuir o zoom</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation>redefinição Zoom</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation>Localização do indicador de linha longa ::: A localização do indicador de longo-line.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation>Qt tema ::: O estilo dos widgets de interface de usuário.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation>Selecione shell ::: Foco o cursor sobre o shell atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation>Selecione editor ::: Foco o cursor sobre o editor atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation>Selecione o arquivo anterior ::: Selecione o arquivo selecionado anteriormente.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation>Mostrar espaço em branco ::: Mostrar espaços e tabulações.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation>Terminações Mostrar linha ::: Mostrar ao final de cada linha.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation>Mostrar recuo orienta ::: Mostrar linhas verticais para indicar recuo.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation>Enrole longas filas ::: linhas envoltório que não cabem na tela (ou seja, sem a rolagem horizontal).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation>Destaque linha atual ::: Selecione a linha onde está o cursor.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation>fonte</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation>zunir</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation>Limpar ecrã ::: Limpe a tela.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation>Interromper ::: Interromper o código de execução atual (não funciona para o código de extensão).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation>Reinicie ::: Encerrar e reiniciar o intérprete.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation>Terminar ::: Terminar o intérprete, deixando a casca.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation>Fechar ::: Terminar o intérprete e fechar a shell.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation>Depurar seguinte: continue até a próxima linha</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation>Retorno Depurar: Prosseguir Ate a Volta</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation>Depurar retorno: prosseguir até a volta</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation>Depurar continuar: proceder ao próximo ponto de interrupção</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation>Pare de depuração</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation>Limpe todos os {} pontos de interrupção</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation>Postmortem: debug do último rastreamento</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation>Editar configurações do shell ... ::: Adicionar novas configs shell e editar as propriedades do intérprete.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation>New shell ... ::: Criar novo shell para executar um código dentro.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Seleção Corrida ::: Corrida linhas do editor atual selecionados, palavras selecionadas na linha atual, ou a linha atual se não houver nenhuma seleção.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation>Fechar outros ::: Fechar todos os arquivos, mas este.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation>Renomeie ::: Renomeie esse arquivo.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation>Arquivos Pin / Unpin ::: Fixado ficar fechado menos facilmente.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation>Activado / desactivado como arquivo principal ::: O arquivo principal pode ser executado enquanto um outro arquivo é selecionado.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation>Corrida arquivo ::: Execute o código neste arquivo.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation>Corrida arquivo como script ::: Corrida o arquivo como um script (reinicia o intérprete).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation>Corrida arquivo como script ::: Restart e execute o arquivo atual como um script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation>Corrida arquivo principal como script ::: Reinicie e execute o arquivo principal como um script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Executar seleção ::: Executar linhas do editor atual selecionados, palavras selecionadas na linha atual, ou a linha atual se não houver nenhuma seleção.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation>Executar celular ::: Executar célula do atual editores no shell atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation>Executar celular e avanço ::: Executar celular e avanço do atual editores para a próxima célula.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation>Executa o ficheiro ::: Execute o arquivo atual no shell atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation>Executa o ficheiro principal ::: Execute o arquivo principal no shell atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation>Ajuda sobre a execução de código ::: Abra o assistente IEP na página sobre a execução de código.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation>Atualizar ferramentas ::: Para as pessoas que desenvolvem ferramentas.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation>Pyzo Site ::: Abra o site da Pyzo no seu browser.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation>IEP Site ::: Abra o site do IEP no seu browser.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation>Faça uma pergunta ::: precisar de ajuda?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation>Identificar um problema ::: Você encontrou um bug no IEP, ou você tem um pedido de recurso?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation>Assistente IEP ::: Comece rapidamente.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation>Verificar atualizações ::: Você está usando a versão mais recente?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation>Sobre o IEP ::: Mais informações sobre IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation>Selecione o idioma ::: A linguagem utilizada pelo IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation>Automaticamente travessão ::: recuo ao pressionar enter depois de dois pontos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation>Ativar calltips ::: Mostrar calltips com assinaturas de função.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation>Ativar autocompletar ::: Mostrar autocompletar com nomes conhecidos.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation>Palavras preenchimento automático ::: A lista inclui autocompletar palavras.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation>Edite mapeamentos de teclas ... ::: Edite os atalhos para os itens do menu.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation>Editar estilos de sintaxe ... ::: Mude a cor do seu código.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation>Configurações avançadas ... ::: Configure IEP ainda mais.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation>Não foi possível executar</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation>Não foi possível executar script.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation>Verifique se a versão mais recente.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation>Editar sintaxe estilo</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation>configurações avançadas</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation>O idioma foi mudado. IEP precisa ser reiniciado para que as alterações tenham efeito.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation>Idioma alterado</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation>Mapeamento Editar atalho</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation>mapeamentos de atalho</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation>Gerenciar as chaves de licença do IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation>Adicionar chave de licença</translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation>Esconder widget de busca (Escape)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation>Encontre padrão</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation>Anterior ::: Localizar ocorrência anterior do padrão.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation>Próxima ::: Localizar próxima ocorrência do padrão.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation>Substituir padrão</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation>Subst. todos ::: Substitua todas as partidas em documento atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation>Substitua ::: Substituir este jogo.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation>Maiúsculas de minúsculas ::: Encontre palavras que correspondem caso.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation>RegExp ::: Encontre usando expressões regulares.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation>Palavras inteiras ::: encontrar somente palavras inteiras.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation>Esconder Auto ::: Esconder busca / substituição quando não for utilizado por 10 s.</translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation>nomear ::: O nome desta configuração.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation>ipython ::: Use IPython shell if available.
+</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation>Utilize padrão do sistema</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation>Arquivo para executar na inicialização</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation>Código para executar na inicialização</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation>exe ::: O executável Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation>gui ::: O kit de ferramentas GUI para integrar (para plotagem interativo, etc.).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation>PythonPath ::: A lista de diretórios para procurar por módulos e pacotes. Escreva cada caminho em uma nova linha, ou separar com o separador padrão para este sistema operacional.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation>StartupScript ::: O script para ser executado na inicialização (não no modo de script).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation>startDir ::: O diretório de partida (não no modo de script).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation>argv ::: Os argumentos de linha de comando (sys.argv).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation>ambiente ::: variáveis de ambiente extra (os.environ).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation>Excluir ::: Apagar esta configuração shell</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation>configurações Concha</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation>Adicionar configuração</translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation>Começando com o IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation>passo</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation>Bem-vindo ao editor interativo para Python!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation>Este assistente ajuda você a se familiarizar com o funcionamento do IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation>IEP é um multi-plataforma Python IDE focada em * interatividade * e * introspecção *, o que torna muito adequado para computação científica. Seu design prático destina-se a * simplicidade * e * eficiência *.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation>Este assistente pode ser aberto usando o 'Assistente Ajudar> IEP'</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation>Mostrar este assistente no arranque</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation>Selecione o idioma</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation>O idioma foi mudado para este assistente. IEP precisa ser reiniciado para que as alterações entrem em vigor em toda a aplicação.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation>Idioma alterado</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation>IEP é constituído por dois componentes principais</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation>Você pode executar comandos diretamente no shell * *</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation>ou você pode escrever código no * editor * e executar isso.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation>O editor é onde você escreve seu código</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation>No * editor *, cada arquivo aberto é representado como um guia. Clicando com o botão direito em uma guia, os arquivos podem ser executados, salvo, fechado, etc.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation>O botão direito do mouse também permite que se faça um arquivo * o arquivo principal * de um projeto. Este arquivo pode ser reconhecida por seu símbolo estrela, e permite executar o arquivo com mais facilidade.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation>A casca é onde o código é executado</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation>Quando começa IEP, um padrão * shell * é criado. Você pode adicionar mais conchas que são executados simultaneamente, e que podem ser de diferentes versões do Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation>Shells são executados em um sub-processo, de modo que quando ele está ocupado, o próprio IEP permanece ágil, permitindo-lhe manter a codificação e até mesmo executar o código em outro shell.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation>Configurando conchas</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation>IEP pode integrar o ciclo de eventos de cinco diferentes kits de ferramentas GUI * *, permitindo assim plotagem interativa com eg Visvis ou Matplotlib.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation>Via 'Concha configurações> Editar shell', você pode editar e adicionar * configurações do shell *. Isto permite-lhe, por exemplo, selecione o diretório inicial, ou usar um PythonPath personalizado.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation>código em execução</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation>IEP suporta várias formas de executar o código-fonte no editor. (veja o menu "Executar").</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation>* Seleção de execução: * se não houver texto selecionado, a linha atual é executado, se a seleção é em uma única linha, a seleção é avaliada, se a seleção se estende por várias linhas, IEP vai executar os os (completos) linhas selecionadas.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation>* Célula de execução: * a célula é tudo entre duas linhas que começam com '# #'.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation>* Arquivo de execução: * executar todo o código no arquivo atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation>* Arquivo principal projeto Run: * executar o código no arquivo principal do projeto atual.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation>O modo interativo vs executado como roteiro</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation>Você pode executar o arquivo atual ou o arquivo principal normalmente, ou como um script. Quando executado como script, o shell é restared para proporcionar um ambiente limpo. O escudo também é inicializado de forma diferente, de modo que ela se assemelhe a execução normal do script.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation>No modo interativo, sys.path [0] é uma cadeia vazia (ou seja, o diretório atual) e sys.argv está definido para [''].</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation>No modo de script, __ file__ e sys.argv [0] são definidas para o nome do arquivo scripts, sys.path [0] eo diretório de trabalho são definidas para o diretório que contém o script.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation>Ferramentas para a sua conveniência</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation>Via o * menu Ferramentas *, pode-se selecionar quais ferramentas usar. As ferramentas podem ser posicionados em qualquer maneira que você quiser, e também pode ser un-encaixado.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation>Note-se que o sistema de ferramentas é projetado de tal forma que é fácil criar suas próprias ferramentas. Olhe para o wiki on-line para obter mais informações, ou utilizar uma das ferramentas existentes como exemplo.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation>ferramentas recomendadas</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation>Recomendamos especialmente as seguintes ferramentas:</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation>O * estrutura ferramenta Fonte * dá um esboço do código fonte.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation>A ferramenta * navegador Arquivo * ajuda a manter uma visão geral de todos os arquivos em um diretório. Para gerenciar seus projetos, clique no ícone de estrela.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation>Obter codificação!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation>Isto conclui o assistente IEP. Agora, começar a codificação e divirta-se!</translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_pt_PT.tr.qm b/iep/resources/translations/iep_pt_PT.tr.qm
new file mode 100644
index 0000000..dac3070
Binary files /dev/null and b/iep/resources/translations/iep_pt_PT.tr.qm differ
diff --git a/iep/resources/translations/iep_ru_RU.tr b/iep/resources/translations/iep_ru_RU.tr
new file mode 100644
index 0000000..54ce21b
--- /dev/null
+++ b/iep/resources/translations/iep_ru_RU.tr
@@ -0,0 +1,1146 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="ru_RU">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation>Стек</translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation>Фильтр названия</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation>Искать в файлах</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation>Проекты:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation>Добавить каталог в закладки</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation>Удалить проект</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation>Переименовать проект</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation>Добавить путь в Python path</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation>Имя проекта</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation>Новое имя проекта:</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation>Учитывать регистр</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation>RegExp</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation>Искать в подкаталогах</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation>Удалить из закладок</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation>В закладки</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation>Открыть</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation>Открыть в системе</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation>Показать в Finder</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation>Копировать путь</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation>Переименовать</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation>Удалить</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation>Создать новый файл</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation>Создать новый каталог</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation>Новое имя файла</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation>Новое имя каталога</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation>Дублировать</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation>Имя файла</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation>Вы собираетесь удалить</translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation>Файл</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation>Правка</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation>Вид</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation>Настройки</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation>Оболочка</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation>Запуск</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation>Инструменты</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation>Помощь</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation>Использовать табуляцию</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation>Использовать пробелы</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation>пробела(ов)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation>Отступы ::: Отступы в текущем файле.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation>Синтаксис ::: Синтаксис текущего файла.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation>Конец строки ::: Символ конца строки текущего файла.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation>Кодировка ::: Кодировка текущего файла.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation>Новый ::: Создать новый (или временный) файл.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation>Открыть... ::: Открыть файл с диска.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation>Сохранить ::: Сохранить текущий файл на диск.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation>Сохранить как... ::: Сохранить текущий файл под другим именем.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation>Сохранить все ::: Сохранить все открытые файлы.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation>Закрыть ::: Закрыть текущий файл.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation>Закрыть все ::: Закрыть все файлы.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation>Перезапустить IEP ::: Перезапустить программу.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation>Закрыть IEP ::: Закрыть программу.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation>Отмена ::: Отменить последнюю правку.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation>Повтор ::: Повторить последнюю правку.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation>Вырезать ::: Вырезать выделенный текст.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation>Копировать ::: Копировать выделенный текст в буфер обмена.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation>Вставить ::: Вставить текст из буфера обмена.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation>Выделить все ::: Выделить весь текст.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation>Отступ ::: Добавить отступ выбранной строке.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation>Конец отступа ::: Убрать отступ у выбранной строки.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation>Закомментировать ::: Закомментировать выбранную строку.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation>Раскомментировать ::: Раскомментировать выбранную строку.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation>Выравнивание комментария/строки документации::: Выравнивание выделенного текста до 70 символов на строку.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation>Перейти к строке ::: Перейти к строке по номеру.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation>Удалить строку ::: Удалить выбранную строку.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation>Искать/Заменить ::: Открывает виджет поиска/замены для выделенного текста.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation>Искать выделенное далее ::: Искать далее выделенный текст.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation>Искать выделенное ранее ::: Искать ранее выделенный текст.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation>Искать далее ::: Искать следующее совпадение.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation>Искать ранее ::: Искать предыдущее совпадание.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation>Увеличить</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation>Уменьшить</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation>Сбросить</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation>Длина индикатора длинной строки ::: Расположение индикатора длинной строки.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation>Qt тема ::: Стиль оформления пользовательского интерфейса.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation>Выбрать оболочку ::: Отправляет курсор в текущую оболочку.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation>Выбрать редактор ::: Отправляет курсор в текущий редактор.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation>Выбрать предыдущий файл ::: Выбрать предыдущий файл.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation>Показывать пробелы ::: Показывать пробелы и табуляции.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation>Показывать конец строки ::: Показывать символ конца строки.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation>Показывать линию отступа ::: Показывать вертикальную линию, индикатор отступа.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation>Переносить длинные строки ::: Перенос строк, которые не помещаются на экране (т.е. негоризонтальная прокрутка).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation>Подсвечивать выбранную линию ::: Подсвечивать линию с курсором.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation>Шрифт</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation>Масштаб</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation>Очистить экран ::: Очистить экран.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation>Прервать ::: Прервать выполнение работающего кода (не работает для расширений).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation>Перезапустить ::: Принудительно завершить и перезапустить интерпретатор.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation>Завершить ::: Принудительно завершить интерпретатор, но оставить оболочку открытой.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation>Закрыть ::: Принудительно завершить интерпретатор и закрыть оболочку.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation>Настройки оболочки ::: Добавить новые конфигурации оболочки и редактировать свойства интерпретатора.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation>Новая оболочка ... ::: Создать новую оболочку для запуска кода.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation>Запустить выделенное ::: Запустить выделенные строки, выделенные слова в строке, или выбранную линию, если нет выделения.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation>Закрыть остальное::: Закрыть все файлы, кроме этого.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation>Переименовать ::: Переименовать этот файл.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation>Закрепить/Открепить ::: Закрепленный файл не так просто закрыть.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation>Установить/Сбросить как ГЛАВНЫЙ файл ::: Главный файл может быть запущен, пока выбран другой файл.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation>Запустить файл ::: Запустить код в этом файле.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation>Запустить файл как скрипт ::: Запустить этот файл как сценарий (перезапускает интерпретатор).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation>Помощь по запуску кода ::: Открыть IEP-мастера на странице о запуске кода.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation>Перезапустить инструменты ::: Для разработчиков инструментов.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation>Pyzo веб-сайт ::: Открыть веб-сайт Pyzo в вашем браузере.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation>IEP веб-сайт ::: Открыть веб-сайт IEP в вашем браузере.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation>Задать вопрос ::: Нужна помощь?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation>Сообщить о проблеме ::: Нашли баг в IEP, или хотите новую функциональность?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation>IEP-мастер ::: Быстрое знакомство.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation>Проверить обновления ::: Вы используете последнюю версию?</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation>О программе ::: Больше информации о IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation>Выбрать язык ::: Выбрать язык программы.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation>Автоматический отступ ::: Автоматический отступ после двоеточия и нажатия Enter.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation>Включить подсказки ::: Показывать подсказку сигнатуры функции при ее вводе.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation>Включить автодополнение ::: Показывать варианты автодополнения для известных имен.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation>Дополнять ключевые слова ::: Автоматически дополнять ключевые слова.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation>Горячие клавиши... ::: Редактировать горячие клавиши для элементов меню.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation>Стиль оформления... ::: Изменить цветовую схему кода.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation>Продвинутые настройки ::: Дополнительные настройки IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation>Отладка: на следующую строку</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation>Отладка: шаг назад</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation>Отладка: к следующему брейкпоинту</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation>Остановить отладку</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation>Снять все брейкпоинты {}</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation>Отладка после падения: с последней трассировки</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation>Не удалось запустить</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation>Не удалось запустить сценарий.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation>Проверка наличия новой версии.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation>Редактировать стиль оформления</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation>Продвинутые настройки</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation>
+ Язык был изменен.
+ IEP необходимо перезапустить для вступления изменений в силу.
+ </translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation>Язык изменен</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation>Редактировать горячие клавиши</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation>Горячие клавиши</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation>Управление лицензиями IEP</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation>Добавить лицензионный ключ</translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation>Скрыть поисковый виджет (Escape)</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation>Шаблон поиска</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation>Ранее ::: Найти предыдущий результат.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation>Далее ::: Найти следующий результат.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation>Шаблон замены</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation>Зам. все ::: Заменить все совпадения в текущем документе.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation>Заменить ::: Заменить это совпадение.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation>Учитывать регистр ::: Найти слова с учетом регистра.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation>RegExp ::: Найти с использованием регулярного выражения.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation>Целые слова ::: Найти только целые слова.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation>Автоматически скрывать ::: Скрывать поиск/замену при простаивании после 10 секунд.</translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation>Значение в системе</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation>name ::: Название этой конфигурации.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation>exe ::: Исполняемый файл Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation>gui ::: GUI инструментарий для интеграции (для интерактивного построения и т.д.).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation>pythonPath ::: Список каталогов для поиска пакетов и модулей. Указывайте каждый путь на новой строке, или с разделителями в этой системе по умолчанию.</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation>startupScript ::: Скрипт, выполняемый при запуске (не в режиме сценария).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation>startDir ::: Стартовый каталог (не в режиме сценария).</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation>Удалить ::: Удалить эту конфигурацию</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation>Конфигурации оболочки</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation>Добавить</translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation>Быстрое знакомство</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation>Шаг</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation>Добро пожаловать в интерактивный редактор для Python!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation>Этот мастер поможет вам познакомиться с работой в IEP.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation>IEP является кроссплатформенной IDE для Python,
+ сосредоточенной на *интерактивности* и *интроспекции*, что делает
+ его очень подходящим для научных вычислений. Его практичный дизайн
+ направлен на *простоту* и *эффективность*.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation>В этот мастер можно попасть нажав 'Помощь > IEP-мастер'</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation>Показывать этот мастер при запуске</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation>Выберите язык</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation>
+ Язык был изменен для этого мастера.
+ Необходимо перезапустить IEP для вступления изменений в силу.
+ </translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation>Язык изменен</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation>IEP состоит из двух основных компонентов</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation>Вы можете выполнять команды непосредственно в *оболочке*,</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation>или ввести их в *редактор* кода и запустить.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation>Редактор, где вы пишете код</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation>Каждый открытый файл в *редакторе* выглядит как вкладка. Правым
+ щелчком мыши на вкладке файл может быть запущен, сохранен, закрыт и т.д.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation>Правым щелчком мыши можно сделать файл *главным* в проекте.
+ Такой файл помечается символом звездочки, и запустить его
+ становится легче обычного.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation>Оболочка где выполняется ваш код</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation>Когда IEP запускается, создается *оболочка* по умолчанию. Вы можете добавить
+ больше оболочек, которые работают одновременно и могут быть
+ разных версий Python.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation>Оболочка работает в субпроцессе, и если он занят и не отвечает, IEP
+ продолжит работать, а вы сможете редактировать код и
+ запускать его в другой оболочке.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation>Конфигурация оболочек</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation>IEP может интегрироваться в цикл обработки событий пяти различных
+ *графических инструментариев*, что позволяет интерактивное
+ построение, например, с Visvis или Matplotlib.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation>Нажав 'Оболочка > Настройки оболочки', вы можете
+ редактировать *конфигурации оболочки*. Это позволяет
+ выбрать исходный каталог, или указать пользовательский Pythonpath.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation>Запуск кода</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation>IEP поддерживает несколько вариантов запуска исходного кода в редакторе. (смотрите меню 'Запуск').</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation>*Запустить выделенное:* если текст не выделен, то запустится
+ выбранная строка; если выделена одна строка, то результат будет
+ отображен в оболочке; если выделено несколько строк, то IEP
+ выполнит их все.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation>*Запустить ячейку:* ячейкой является весь код между двумя строками '##'.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation>*Запустить файл:* запускает весь код в текущем файле.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation>*Запустить главный файл:* запускает код в текущем главном файле проекта.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation>Интерактивный режим или запустить как сценарий</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation>Вы можете запустить текущий файл или главный файл в обычном режиме,
+ или как сценарий. При работе в качестве сценария, оболочка
+ перезапускается чтобы обеспечить чистую среду. Оболочка также
+ инициализируется по-разному, так, что она очень напоминает
+ среду обычного выполнения скрипта.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation>В интерактивном режиме, sys.path[0] - пустая строка (т.е. текущая директория),
+ и sys.argv имеет значение [''].</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation>В режиме сценария, __file__ и sys.argv[0] устанавливаются в название
+ файла скрипта, sys.path[0] и рабочий каталог получают значение
+ названия текущего расположения каталога со сценарием.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation>Инструменты для вашего удобства</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation>Через меню *Инструменты*, можно выбрать, какие инструменты будут
+ использоваться. Инструменты могут быть закреплены в любом месте,
+ или откреплены вовсе.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation>Система инструментов разработана так, что можно легко
+ создать свой собственный инструмент. Посетите вики для получения
+ дополнительной информации, или используйте один из существующих инструментов как пример.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation>Рекомендуемые инструменты</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation>Мы настоятельно рекомендуем следующие инструменты:</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation>Инструмент *Source structure* дает вам схему исходного кода.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation>Инструмент *File browser* помогает следить за всеми файлами в каталоге.
+ Для управления своим проектом нажмите на иконку звезды.</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation>Программируйте!</translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation>На этом мы завершаем работу IEP-мастера. Программируйте с удовольствием!</translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_ru_RU.tr.qm b/iep/resources/translations/iep_ru_RU.tr.qm
new file mode 100644
index 0000000..c97debb
Binary files /dev/null and b/iep/resources/translations/iep_ru_RU.tr.qm differ
diff --git a/iep/resources/translations/iep_sk_SK.tr b/iep/resources/translations/iep_sk_SK.tr
new file mode 100644
index 0000000..fb7cb87
--- /dev/null
+++ b/iep/resources/translations/iep_sk_SK.tr
@@ -0,0 +1,1111 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="sk_SK">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_sk_SK.tr.qm b/iep/resources/translations/iep_sk_SK.tr.qm
new file mode 100644
index 0000000..1776294
Binary files /dev/null and b/iep/resources/translations/iep_sk_SK.tr.qm differ
diff --git a/iep/resources/translations/iep_zh_CN.tr b/iep/resources/translations/iep_zh_CN.tr
new file mode 100644
index 0000000..251459d
--- /dev/null
+++ b/iep/resources/translations/iep_zh_CN.tr
@@ -0,0 +1,1111 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE TS><TS version="1.1" language="zh_CN">
+<context>
+ <name>debug</name>
+ <message>
+ <location filename="iep/iepcore/shellStack.py" line="478"/>
+ <source>Stack</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>filebrowser</name>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="46"/>
+ <source>Filename filter</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="51"/>
+ <source>Search in files</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="450"/>
+ <source>Projects:</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="453"/>
+ <source>Click star to bookmark current dir</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="461"/>
+ <source>Remove project</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="466"/>
+ <source>Change project name</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="473"/>
+ <source>Add path to Python path</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="500"/>
+ <source>Project name</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="501"/>
+ <source>New project name:</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="652"/>
+ <source>Match case</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="653"/>
+ <source>RegExp</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="654"/>
+ <source>Search in subdirs</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="792"/>
+ <source>Unstar this directory</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="794"/>
+ <source>Star this directory</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="799"/>
+ <source>Open</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="804"/>
+ <source>Open outside IEP</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="807"/>
+ <source>Reveal in Finder</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="810"/>
+ <source>Copy path</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="917"/>
+ <source>Rename</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="942"/>
+ <source>Delete</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="888"/>
+ <source>Create new file</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="891"/>
+ <source>Create new directory</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="918"/>
+ <source>Give the new name for the file</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="894"/>
+ <source>Give the name for the new directory</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="920"/>
+ <source>Duplicate</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="921"/>
+ <source>Give the name for the new file</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="944"/>
+ <source>Are you sure that you want to delete</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/browser.py" line="482"/>
+ <source>Go to this directory in the current shell</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/tools/iepFileBrowser/tree.py" line="818"/>
+ <source>Import data...</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="35"/>
+ <source>File</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="36"/>
+ <source>Edit</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="37"/>
+ <source>View</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="38"/>
+ <source>Settings</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="39"/>
+ <source>Shell</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="40"/>
+ <source>Run</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="41"/>
+ <source>Tools</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="42"/>
+ <source>Help</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="412"/>
+ <source>Use tabs</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="414"/>
+ <source>Use spaces</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="419"/>
+ <source>spaces</source>
+ <comment>plural of spacebar character</comment>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="443"/>
+ <source>Indentation ::: The indentation used of the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="448"/>
+ <source>Syntax parser ::: The syntax parser of the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="453"/>
+ <source>Line endings ::: The line ending character of the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="458"/>
+ <source>Encoding ::: The character encoding of the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="465"/>
+ <source>New ::: Create a new (or temporary) file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="467"/>
+ <source>Open... ::: Open an existing file from disk.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1076"/>
+ <source>Save ::: Save the current file to disk.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1078"/>
+ <source>Save as... ::: Save the current file under another name.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="475"/>
+ <source>Save all ::: Save all open files.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1080"/>
+ <source>Close ::: Close the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1084"/>
+ <source>Close all ::: Close all files.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="496"/>
+ <source>Restart IEP ::: Restart the application.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="498"/>
+ <source>Quit IEP ::: Close the application.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="610"/>
+ <source>Undo ::: Undo the latest editing action.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="612"/>
+ <source>Redo ::: Redo the last undone editong action.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1028"/>
+ <source>Cut ::: Cut the selected text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1030"/>
+ <source>Copy ::: Copy the selected text to the clipboard.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1032"/>
+ <source>Paste ::: Paste the text that is now on the clipboard.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1034"/>
+ <source>Select all ::: Select all text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1037"/>
+ <source>Indent ::: Indent the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1039"/>
+ <source>Dedent ::: Unindent the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1041"/>
+ <source>Comment ::: Comment the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1043"/>
+ <source>Uncomment ::: Uncomment the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1045"/>
+ <source>Justify comment/docstring::: Reshape the selected text so it is aligned to around 70 characters.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="634"/>
+ <source>Go to line ::: Go to a specific line number.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="636"/>
+ <source>Delete line ::: Delete the selected line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="639"/>
+ <source>Find or replace ::: Show find/replace widget. Initialize with selected text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="641"/>
+ <source>Find selection ::: Find the next occurrence of the selected text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="643"/>
+ <source>Find selection backward ::: Find the previous occurrence of the selected text.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="645"/>
+ <source>Find next ::: Find the next occurrence of the search string.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="647"/>
+ <source>Find previous ::: Find the previous occurrence of the search string.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="663"/>
+ <source>Zoom in</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="664"/>
+ <source>Zoom out</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="665"/>
+ <source>Zoom reset</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="719"/>
+ <source>Location of long line indicator ::: The location of the long-line-indicator.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="727"/>
+ <source>Qt theme ::: The styling of the user interface widgets.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="739"/>
+ <source>Select shell ::: Focus the cursor on the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="741"/>
+ <source>Select editor ::: Focus the cursor on the current editor.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="743"/>
+ <source>Select previous file ::: Select the previously selected file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="746"/>
+ <source>Show whitespace ::: Show spaces and tabs.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="748"/>
+ <source>Show line endings ::: Show the end of each line.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="750"/>
+ <source>Show indentation guides ::: Show vertical lines to indicate indentation.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="753"/>
+ <source>Wrap long lines ::: Wrap lines that do not fit on the screen (i.e. no horizontal scrolling).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="755"/>
+ <source>Highlight current line ::: Highlight the line where the cursor is.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="759"/>
+ <source>Font</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="760"/>
+ <source>Zooming</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="827"/>
+ <source>Clear screen ::: Clear the screen.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="829"/>
+ <source>Interrupt ::: Interrupt the current running code (does not work for extension code).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="831"/>
+ <source>Restart ::: Terminate and restart the interpreter.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="833"/>
+ <source>Terminate ::: Terminate the interpreter, leaving the shell open.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="835"/>
+ <source>Close ::: Terminate the interpreter and close the shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="948"/>
+ <source>Edit shell configurations... ::: Add new shell configs and edit interpreter properties.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="951"/>
+ <source>New shell ... ::: Create new shell to run code in.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1050"/>
+ <source>Run selection ::: Run the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1082"/>
+ <source>Close others::: Close all files but this one.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1086"/>
+ <source>Rename ::: Rename this file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1091"/>
+ <source>Pin/Unpin ::: Pinned files get closed less easily.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1093"/>
+ <source>Set/Unset as MAIN file ::: The main file can be run while another file is selected.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1097"/>
+ <source>Run file ::: Run the code in this file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1099"/>
+ <source>Run file as script ::: Run this file as a script (restarts the interpreter).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1171"/>
+ <source>Help on running code ::: Open the IEP wizard at the page about running code.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1392"/>
+ <source>Reload tools ::: For people who develop tools.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1422"/>
+ <source>Pyzo Website ::: Open the Pyzo website in your browser.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1424"/>
+ <source>IEP Website ::: Open the IEP website in your browser.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1426"/>
+ <source>Ask a question ::: Need help?</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1428"/>
+ <source>Report an issue ::: Did you found a bug in IEP, or do you have a feature request?</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1431"/>
+ <source>IEP wizard ::: Get started quickly.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1436"/>
+ <source>Check for updates ::: Are you using the latest version?</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1441"/>
+ <source>About IEP ::: More information about IEP.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1513"/>
+ <source>Select language ::: The language used by IEP.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1518"/>
+ <source>Automatically indent ::: Indent when pressing enter after a colon.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1520"/>
+ <source>Enable calltips ::: Show calltips with function signatures.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1522"/>
+ <source>Enable autocompletion ::: Show autocompletion with known names.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1524"/>
+ <source>Autocomplete keywords ::: The autocompletion list includes keywords.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1528"/>
+ <source>Edit key mappings... ::: Edit the shortcuts for menu items.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1530"/>
+ <source>Edit syntax styles... ::: Change the coloring of your code.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1533"/>
+ <source>Advanced settings... ::: Configure IEP even further.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="845"/>
+ <source>Debug next: proceed until next line</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="849"/>
+ <source>Debug return: proceed until returns</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="851"/>
+ <source>Debug continue: proceed to next breakpoint</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="853"/>
+ <source>Stop debugging</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="874"/>
+ <source>Clear all {} breakpoints</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="876"/>
+ <source>Postmortem: debug from last traceback</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="847"/>
+ <source>Debug step into: proceed one step</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1150"/>
+ <source>Run file as script ::: Restart and run the current file as a script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1152"/>
+ <source>Run main file as script ::: Restart and run the main file as a script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1157"/>
+ <source>Execute selection ::: Execute the current editor's selected lines, selected words on the current line, or current line if there is no selection.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1159"/>
+ <source>Execute cell ::: Execute the current editors's cell in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1161"/>
+ <source>Execute cell and advance ::: Execute the current editors's cell and advance to the next cell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1164"/>
+ <source>Execute file ::: Execute the current file in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1166"/>
+ <source>Execute main file ::: Execute the main file in the current shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="481"/>
+ <source>Export to PDF ::: Export current file to PDF (e.g. for printing).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>menu dialog</name>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1203"/>
+ <source>Could not run</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1379"/>
+ <source>Could not run script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1474"/>
+ <source>Check for the latest version.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1548"/>
+ <source>Edit syntax styling</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1569"/>
+ <source>Advanced settings</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1594"/>
+ <source>
+ The language has been changed.
+ IEP needs to restart for the change to take effect.
+ </source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1595"/>
+ <source>Language changed</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="1940"/>
+ <source>Edit shortcut mapping</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/menu.py" line="2084"/>
+ <source>Shortcut mappings</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="166"/>
+ <source>Manage IEP license keys</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/license.py" line="203"/>
+ <source>Add license key</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>search</name>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="175"/>
+ <source>Hide search widget (Escape)</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="194"/>
+ <source>Find pattern</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="202"/>
+ <source>Previous ::: Find previous occurrence of the pattern.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="211"/>
+ <source>Next ::: Find next occurrence of the pattern.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="227"/>
+ <source>Replace pattern</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="235"/>
+ <source>Repl. all ::: Replace all matches in current document.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="243"/>
+ <source>Replace ::: Replace this match.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="258"/>
+ <source>Match case ::: Find words that match case.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="264"/>
+ <source>RegExp ::: Find using regular expressions.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="277"/>
+ <source>Whole words ::: Find only whole words.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/editorTabs.py" line="284"/>
+ <source>Auto hide ::: Hide search/replace when unused for 10 s.</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>shell</name>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="349"/>
+ <source>Use system default</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="488"/>
+ <source>name ::: The name of this configuration.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="489"/>
+ <source>exe ::: The Python executable.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="491"/>
+ <source>gui ::: The GUI toolkit to integrate (for interactive plotting, etc.).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="492"/>
+ <source>pythonPath ::: A list of directories to search for modules and packages. Write each path on a new line, or separate with the default seperator for this OS.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="493"/>
+ <source>startupScript ::: The script to run at startup (not in script mode).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="494"/>
+ <source>startDir ::: The start directory (not in script mode).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="534"/>
+ <source>Delete ::: Delete this shell configuration</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="610"/>
+ <source>Shell configurations</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="640"/>
+ <source>Add config</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="490"/>
+ <source>ipython ::: Use IPython shell if available.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="357"/>
+ <source>File to run at startup</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="363"/>
+ <source>Code to run at startup</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="495"/>
+ <source>argv ::: The command line arguments (sys.argv).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/iepcore/shellInfoDialog.py" line="496"/>
+ <source>environ ::: Extra environment variables (os.environ).</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+<context>
+ <name>wizard</name>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="40"/>
+ <source>Getting started with IEP</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="95"/>
+ <source>Step</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="161"/>
+ <source>Welcome to the Interactive Editor for Python!</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="163"/>
+ <source>This wizard helps you get familiarized with the workings of IEP.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="168"/>
+ <source>IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="176"/>
+ <source>This wizard can be opened using 'Help > IEP wizard'</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="177"/>
+ <source>Show this wizard on startup</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="182"/>
+ <source>Select language</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="233"/>
+ <source>
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ </source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="234"/>
+ <source>Language changed</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="254"/>
+ <source>IEP consists of two main components</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="257"/>
+ <source>You can execute commands directly in the *shell*,</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="259"/>
+ <source>or you can write code in the *editor* and execute that.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="266"/>
+ <source>The editor is where you write your code</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="270"/>
+ <source>In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="274"/>
+ <source>The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="281"/>
+ <source>The shell is where your code gets executed</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="286"/>
+ <source>When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="290"/>
+ <source>Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="297"/>
+ <source>Configuring shells</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="301"/>
+ <source>IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="305"/>
+ <source>Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="312"/>
+ <source>Running code</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="315"/>
+ <source>IEP supports several ways to run source code in the editor. (see the 'Run' menu).</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="320"/>
+ <source>*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="322"/>
+ <source>*Run cell:* a cell is everything between two lines starting with '##'.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="324"/>
+ <source>*Run file:* run all the code in the current file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="326"/>
+ <source>*Run project main file:* run the code in the current project's main file.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="333"/>
+ <source>Interactive mode vs running as script</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="339"/>
+ <source>You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="342"/>
+ <source>In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to [''].</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="345"/>
+ <source>In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="352"/>
+ <source>Tools for your convenience</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="356"/>
+ <source>Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="360"/>
+ <source>Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="367"/>
+ <source>Recommended tools</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="370"/>
+ <source>We especially recommend the following tools:</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="372"/>
+ <source>The *Source structure tool* gives an outline of the source code.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="375"/>
+ <source>The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon.</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="382"/>
+ <source>Get coding!</source>
+ <translation type="unfinished"></translation>
+ </message>
+ <message>
+ <location filename="iep/util/iepwizard.py" line="385"/>
+ <source>This concludes the IEP wizard. Now, get coding and have fun!</source>
+ <translation type="unfinished"></translation>
+ </message>
+</context>
+</TS>
diff --git a/iep/resources/translations/iep_zh_CN.tr.qm b/iep/resources/translations/iep_zh_CN.tr.qm
new file mode 100644
index 0000000..be651ee
--- /dev/null
+++ b/iep/resources/translations/iep_zh_CN.tr.qm
@@ -0,0 +1 @@
+<�d��!
�`���
\ No newline at end of file
diff --git a/iep/resources/translations/notes_on_translating.txt b/iep/resources/translations/notes_on_translating.txt
new file mode 100644
index 0000000..5b152a3
--- /dev/null
+++ b/iep/resources/translations/notes_on_translating.txt
@@ -0,0 +1,58 @@
+Notes on translating
+====================
+
+In short
+--------
+
+Apply the following steps (in the IEP logger shell):
+
+ * Run lupdate() to update .tr files
+ * Translators run linguist(TheirLanguage) to launch Qt linguist
+ * Translators write translations (stored in one .tr file per language)
+ * Translators send modified version of .tr file back to us
+ * Run lrelease()
+
+The lupdate tool parses the source code of the files specified
+in iep.pro and detects usages of any "translate()" function call.
+
+
+For translaters
+---------------
+
+We send translaters a .tr file, which they translate using Qt linguist
+and then send back to us.
+
+
+About tooltips
+--------------
+
+I like tooltips. And I think its best to specify them in the same string
+as the text/label that they apply to. In IEP we use the convention that
+a translation string can contain tooltips by writing three colons followed
+by the tooltip text: ``"This is a label ::: This is the tooltip text"``
+
+The iep.translate function returns a string object that contains only
+the label text, but which has an attribute called "tt" that contains
+the tooltip text (or an empty string).
+
+In this way, in places where you do not need a tooltip, things behave as
+normal. In cases where you need a tooltip, things are now easier (especially
+for the translater).
+
+
+From the PyQt website
+---------------------
+
+ * The programmer uses pylupdate4 to create or update a .ts translation
+ file for each language that the application is to be translated into.
+ A .ts file is an XML file that contains the strings to be translated
+ and the corresponding translations that have already been made.
+ pylupdate4 can be run any number of times during development to update
+ the .ts files with the latest strings for translation.
+ * The translator uses Qt Linguist to update the .ts files with translations
+ of the strings.
+ * The release manager then uses Qt’s lrelease utility to
+ convert the .ts files to .qm files which are compact binary equivalents
+ used by the application. If an application cannot find an appropriate .qm
+ file, or a particular string hasn’t been translated, then the strings used
+ in the original source code are used instead.
diff --git a/iep/resources/tutorial.py b/iep/resources/tutorial.py
new file mode 100644
index 0000000..7194d59
--- /dev/null
+++ b/iep/resources/tutorial.py
@@ -0,0 +1,202 @@
+## Introduction
+"""
+Welcome to the tutorial for IEP! This tutorial should get you
+familiarized with IEP in just a few minutes. If you feel this tutorial
+contains errors or lacks some information, please let us know via
+iep_ at googlegroups.com.
+
+IEP is a cross-platform Python IDE focused on interactivity and
+introspection, which makes it very suitable for scientific computing.
+Its practical design is aimed at simplicity and efficiency.
+
+IEP consists of two main components, the editor and the shell, and
+uses a set of pluggable tools to help the programmer in various ways.
+
+"""
+
+
+## The editor
+"""
+The editor (this window) is where your code is located; it is the central
+component of IEP.
+
+In the editor, each open file is represented as a tab. By right-clicking on
+a tab, files can be run, saved, closed, etc.
+
+The right mouse button also enables one to make a file the MAIN FILE of
+a project. This file can be recognized by its star symbol and its blue filename,
+and it enables running the file more easily (as we will see later in this
+tutorial).
+
+For larger projects, the Project manager tool can be used to manage your files
+(also described later in this tutorial)
+"""
+
+
+## The shells
+"""
+The other main component is the window that holds the shells. When IEP
+starts, a default shell is created. You can add more shells that run
+simultaneously, and which may be of different Python versions.
+
+It is good to know that the shells run in a sub-process, such that
+when it is busy, IEP itself stays responsive, which allows you to
+keep coding and even run code in another shell.
+
+Another notable feature is that IEP can integrate the event loop of
+five different GUI toolkits, thus enabling interactive plotting with
+e.g., Visvis or Matplotlib.
+
+Via "Shell > Edit shell configurations", you can edit and add shell
+configurations. This allows you to for example select the initial
+directory, or use a custom PYTHONPATH.
+
+"""
+
+
+## The tools
+"""
+Via the "Tools" menu, one can select which tools to use. The tools can
+be positioned in any way you want, and can also be un-docked.
+
+Try the "Source Structure" tool to see the outline of this tutorial!
+
+Note that the tools system is designed such that it's quite easy to
+create your own tools. Look at the online wiki for more information,
+or use one of the existing tools as an example. Also, IEP does not
+need to restart to see new tools, or to update existing tools.
+
+"""
+
+
+## Running code
+"""
+IEP supports several ways to run source code in the editor. (see
+also the "Run" menu).
+
+ * Run selected lines. If a line is partially selected, the whole
+ line is executed. If there is no selection, IEP will run the
+ current line.
+
+ * Run cell. A cell is everything between two commands starting
+ with '##', such as the headings in this tutorial. Try running
+ the code at the bottom of this cell!
+
+ * Run file. This runs all the code in the current file.
+
+ * Run project main file. Runs the code in the current project's
+ main file.
+
+Additionally, you can run the current file or the current project's
+main file as a script. This will first restart the shell to provide
+a clean environment. The shell is also initialized differently:
+
+Things done on shell startup in INTERACTIVE MODE:
+ * sys.argv = ['']
+ * sys.path is prepended with an empty string (current working directory)
+ * The working dir is set to the "Initial directory" of the shell config.
+ * The PYTHONSTARTUP script is run.
+
+Things done on shell startup in SCRIPT MODE:
+ * __file__ = <script_filename>
+ * sys.argv = [ <script_filename> ]
+ * sys.path is prepended with the directory containing the script.
+ * The working dir is set to the directory containing the script.
+
+Depending on the settings of the Project mananger, the current project
+directory may also be inserted in sys.path.
+"""
+
+a = 3
+b = 4
+print('The answer is ' + str(a+b))
+
+
+## The menu
+"""
+Almost all functionality of IEP can be accessed via the menu. For more
+advanced/specific stuff, you can use the logger tool (see also
+Settings > Advanced settings)
+
+All actions in the menu can be accessed via a shortcut. Change the
+shortcuts using the shortcut editor: Settings > Edit key mappings.
+
+"""
+
+
+## Introspection
+"""
+IEP has strong introspection capabilities. IEP knows about the objects
+in the shell, and parses (not runs) the source code in order to detect
+the structure of your code. This enables powerful instospection such
+as autocompletion, calltips, interactive help and source structure.
+
+"""
+
+
+## Debugging
+"""
+IEP supports post-mortem debugging, which means that after something
+went wrong, you can inspect the stack trace to find the error.
+
+The easiest way to start debugging is to press the "Debug" button
+at the upper right corner of the shells.
+
+Once in debug mode, the button becomes expandable, allowing you to
+see the stack trace and go to any frame you like. (Starting debug mode
+brings you to the bottom frame.) Changing a frame will make all objects
+in that frame available in the shell. If possible, IEP will also show
+the source file belonging to that frame, and select the line where the
+error occurred.
+
+Debugging can also be controlled via magic commands, enter "?" in the
+shell for more information.
+
+Below follows an example that you can run to test the debugging.
+
+"""
+
+import random
+someModuleVariable = True
+
+def getNumber():
+ return random.choice(range(10))
+
+def foo():
+ spam = 'yum'
+ eggs = 7
+ value = bar()
+
+def bar():
+ total = 0
+ for i1 in range(100):
+ i2 = getNumber()
+ total += i1/i2
+ return total
+
+foo()
+
+## The Project manager
+"""
+For working on projects, the Project manager tool can help you to keep
+an overview of all your files. To open up the Project manager tool,
+select it from the menu (Tools > Project manager).
+
+To add, remove, or edit your projects, click the button with the
+wrench icon. In the dialog, select 'New project' to add a project and
+select the directory where your project is located. When the project
+is added, you can change the Project description (name).
+
+You can select wether the project path is added to the Python
+sys.path. This feature allows you to import project modules from the
+shell, or from scripts which are not in the project root directory.
+Note that this feature requires a restart of the shell to take effect
+(Shell > Restart)
+
+The Project manager allows you to switch between your projects easily
+using the selection box at the top. The tree view shows the files and
+directories in your project. Files can be hidden using the filter that
+is specified at the bottom of the Project manager, e.g. !*.pyc to hide
+all files that have the extension pyc.
+"""
+
diff --git a/iep/tools/__init__.py b/iep/tools/__init__.py
new file mode 100644
index 0000000..8b21eb9
--- /dev/null
+++ b/iep/tools/__init__.py
@@ -0,0 +1,390 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+""" Package tools of iep
+
+A tool consists of a module which contains a class. The id of
+a tool is its module name made lower case. The module should
+contain a class corresponding to its id. We advise to follow the
+common python style and start the class name with a capital
+letter, case does not matter for the tool to work though.
+For instance, the tool "ieplogger" is the class "IepLogger" found
+in module "iepLogger"
+
+The module may contain the following extra variables (which should
+be placed within the first 50 lines of code):
+
+tool_name - A readable name for the tool (may contain spaces,
+will be shown in the tab)
+
+tool_summary - A single line short summary of the tool. To be
+displayed in the statusbar.
+"""
+
+# tools I'd like:
+# - find in files
+# - workspace
+# - source tree
+# - snipet manager
+# - file browser
+# - pythonpath editor, startupfile editor (or as part of IEP?)
+
+import os, sys, imp
+from pyzolib.qt import QtCore, QtGui
+import iep
+
+from pyzolib import ssdf
+
+
+class ToolDockWidget(QtGui.QDockWidget):
+ """ A dock widget that holds a tool.
+ It sets all settings, initializes the tool widget, and notifies the
+ tool manager on closing.
+ """
+
+ def __init__(self, parent, toolManager):
+ QtGui.QDockWidget.__init__(self, parent)
+
+ # Store stuff
+ self._toolManager = toolManager
+
+ # Allow docking anywhere, othwerise restoring state wont work properly
+
+ # Set other settings
+ self.setFeatures( QtGui.QDockWidget.DockWidgetMovable |
+ QtGui.QDockWidget.DockWidgetClosable |
+ QtGui.QDockWidget.DockWidgetFloatable
+ #QtGui.QDockWidget.DockWidgetVerticalTitleBar
+ )
+
+
+ def setTool(self, toolId, toolName, toolClass):
+ """ Set the tool information. Call this right after
+ initialization. """
+
+ # Store id and set object name to enable saving/restoring state
+ self._toolId = toolId
+ self.setObjectName(toolId)
+
+ # Set name
+ self.setWindowTitle(toolName)
+
+ # Create tool widget
+ self.reload(toolClass)
+
+
+ def closeEvent(self, event):
+ if self._toolManager:
+ self._toolManager.onToolClose(self._toolId)
+ self._toolManager = None
+ # Close and delete widget
+ old = self.widget()
+ if old:
+ old.close()
+ old.deleteLater()
+ # Close and delete dock widget
+ self.close()
+ self.deleteLater()
+ # We handled the event
+ event.accept()
+
+
+ def reload(self, toolClass):
+ """ Reload the widget with a new widget class. """
+ old = self.widget()
+ new = toolClass(iep.main)
+ self.setWidget(new)
+ if old:
+ old.close()
+ old.deleteLater()
+
+
+
+class ToolDescription:
+ """ Provides a description of a tool and has a reference to
+ the tool dock instance if it is loaded.
+ """
+
+ def __init__(self, modulePath, name='', description=''):
+ # Set names
+ self.modulePath = modulePath
+ self.moduleName = os.path.splitext(os.path.basename(modulePath))[0]
+ self.id = self.moduleName.lower()
+ if name:
+ self.name = name
+ else:
+ self.name = self.id
+
+ # Set description
+ self.description = description
+ # Init instance to None, will be set when loaded
+ self.instance = None
+
+ def menuLauncher(self, value):
+ """ Function that is called by the menu when this tool is selected.
+ """
+ if value is None:
+ return bool(self.instance)
+ #return self.id in iep.toolManager._activeTools
+ elif value:
+ iep.toolManager.loadTool(self.id)
+ else:
+ self.widget = None
+ iep.toolManager.closeTool(self.id)
+
+
+
+class ToolManager(QtCore.QObject):
+ """ Manages the tools. """
+
+ # This signal indicates a change in the loaded tools
+ toolInstanceChange = QtCore.Signal()
+
+ def __init__(self, parent = None):
+ QtCore.QObject.__init__(self, parent)
+
+ # list of ToolDescription instances
+ self._toolInfo = None
+ self._activeTools = {}
+
+
+ def loadToolInfo(self):
+ """ (re)load the tool information.
+ """
+ # Get paths to load files from
+ toolDir1 = os.path.join(iep.iepDir, 'tools')
+ toolDir2 = os.path.join(iep.appDataDir, 'tools')
+
+ # Create list of tool files
+ toolfiles = []
+ for toolDir in [toolDir1, toolDir2]:
+ tmp = [os.path.join(toolDir, f) for f in os.listdir(toolDir)]
+ toolfiles.extend(tmp)
+
+ # Note: we do not use the code below anymore, since even the frozen
+ # app makes use of the .py files.
+# # Get list of files, also when we're in a zip file.
+# i = tooldir.find('.zip')
+# if i>0:
+# # Get list of files from zipfile
+# tooldir = tooldir[:i+4]
+# import zipfile
+# z = zipfile.ZipFile(tooldir)
+# toolfiles = [os.path.split(i)[1] for i in z.namelist()
+# if i.startswith('visvis') and i.count('functions')]
+# else:
+# # Get list of files from file system
+# toolfiles = os.listdir(tooldir)
+
+ # Iterate over tool modules
+ newlist = []
+ for file in toolfiles:
+ modulePath = file
+
+ # Check
+ if os.path.isdir(file):
+ file = os.path.join(file, '__init__.py') # A package perhaps
+ if not os.path.isfile(file):
+ continue
+ elif file.endswith('__.py') or not file.endswith('.py'):
+ continue
+ elif file.endswith('iepFileBrowser.py'):
+ # Skip old file browser (the file can be there from a previous install)
+ continue
+
+ #
+ toolName = ""
+ toolSummary = ""
+ # read file to find name or summary
+ linecount = 0
+ for line in open(file, encoding='utf-8'):
+ linecount += 1
+ if linecount > 50:
+ break
+ if line.startswith("tool_name"):
+ i = line.find("=")
+ if i<0: continue
+ line = line.rstrip("\n").rstrip("\r")
+ line = line[i+1:].strip(" ")
+ toolName = line.strip("'").strip('"')
+ elif line.startswith("tool_summary"):
+ i = line.find("=")
+ if i<0: continue
+ line = line.rstrip("\n").rstrip("\r")
+ line = line[i+1:].strip(" ")
+ toolSummary = line.strip("'").strip('"')
+ else:
+ pass
+
+ # Add stuff
+ tmp = ToolDescription(modulePath, toolName, toolSummary)
+ newlist.append(tmp)
+
+ # Store and return
+ self._toolInfo = sorted( newlist, key=lambda x:x.id )
+ self.updateToolInstances()
+ return self._toolInfo
+
+
+ def updateToolInstances(self):
+ """ Make tool instances up to date, so that it can be seen what
+ tools are now active. """
+ for toolDes in self.getToolInfo():
+ if toolDes.id in self._activeTools:
+ toolDes.instance = self._activeTools[toolDes.id]
+ else:
+ toolDes.instance = None
+
+ # Emit update signal
+ self.toolInstanceChange.emit()
+
+
+ def getToolInfo(self):
+ """ Like loadToolInfo(), but use buffered instance if available.
+ """
+ if self._toolInfo is None:
+ self.loadToolInfo()
+ return self._toolInfo
+
+
+ def getToolClass(self, toolId):
+ """ Get the class of the tool.
+ It will import (and reload) the module and get the class.
+ Some checks are performed, like whether the class inherits
+ from QWidget.
+ Returns the class or None if failed...
+ """
+
+ # Make sure we have the info
+ if self._toolInfo is None:
+ self.loadToolInfo()
+
+ # Get module name and path
+ for toolDes in self._toolInfo:
+ if toolDes.id == toolId:
+ moduleName = toolDes.moduleName
+ modulePath = toolDes.modulePath
+ break
+ else:
+ print("WARNING: could not find module for tool", repr(toolId))
+ return None
+
+ # Remove from sys.modules, to force the module to reload
+ for key in [key for key in sys.modules]:
+ if key and key.startswith('iep.tools.'+moduleName):
+ del sys.modules[key]
+
+ # Load module
+ try:
+ m_file, m_fname, m_des = imp.find_module(moduleName, [os.path.dirname(modulePath)])
+ mod = imp.load_module('iep.tools.'+moduleName, m_file, m_fname, m_des)
+ except Exception as why:
+ print("Invalid tool " + toolId +":", why)
+ return None
+
+ # Is the expected class present?
+ className = ""
+ for member in dir(mod):
+ if member.lower() == toolId:
+ className = member
+ break
+ else:
+ print("Invalid tool, Classname must match module name '%s'!" % toolId)
+ return None
+
+ # Does it inherit from QWidget?
+ plug = mod.__dict__[className]
+ if not (isinstance(plug,type) and issubclass(plug,QtGui.QWidget)):
+ print("Invalid tool, tool class must inherit from QWidget!")
+ return None
+
+ # Succes!
+ return plug
+
+
+ def loadTool(self, toolId):
+ """ Load a tool by creating a dock widget containing the tool widget.
+ """
+
+ # A tool id should always be lower case
+ toolId = toolId.lower()
+
+ # Close old one
+ if toolId in self._activeTools:
+ old = self._activeTools[toolId].widget()
+ self._activeTools[toolId].setWidget(QtGui.QWidget(iep.main))
+ if old:
+ old.close()
+ old.deleteLater()
+
+ # Get tool class (returns None on failure)
+ toolClass = self.getToolClass(toolId)
+ if toolClass is None:
+ return
+
+ # Already loaded? reload!
+ if toolId in self._activeTools:
+ self._activeTools[toolId].reload(toolClass)
+ return
+
+ # Obtain name from buffered list of names
+ for toolDes in self._toolInfo:
+ if toolDes.id == toolId:
+ name = toolDes.name
+ break
+ else:
+ name = toolId
+
+ # Make sure there is a config entry for this tool
+ if not hasattr(iep.config.tools, toolId):
+ iep.config.tools[toolId] = ssdf.new()
+
+ # Create dock widget and add in the main window
+ dock = ToolDockWidget(iep.main, self)
+ dock.setTool(toolId, name, toolClass)
+ iep.main.addDockWidget(QtCore.Qt.RightDockWidgetArea, dock)
+
+ # Add to list
+ self._activeTools[toolId] = dock
+ self.updateToolInstances()
+
+
+ def reloadTools(self):
+ """ Reload all tools. """
+ for id in self.getLoadedTools():
+ self.loadTool(id)
+
+
+ def closeTool(self, toolId):
+ """ Close the tool with specified id.
+ """
+ if toolId in self._activeTools:
+ dock = self._activeTools[toolId]
+ dock.close()
+
+ def getTool(self, toolId):
+ """ Get the tool widget instance, or None
+ if not available. """
+ if toolId in self._activeTools:
+ return self._activeTools[toolId].widget()
+ else:
+ return None
+
+ def onToolClose(self, toolId):
+ # Remove from dict
+ self._activeTools.pop(toolId, None)
+ # Set instance to None
+ self.updateToolInstances()
+
+
+ def getLoadedTools(self):
+ """ Get a list with id's of loaded tools. """
+ tmp = []
+ for toolDes in self.getToolInfo():
+ if toolDes.id in self._activeTools:
+ tmp.append(toolDes.id)
+ return tmp
diff --git a/iep/tools/iepFileBrowser/__init__.py b/iep/tools/iepFileBrowser/__init__.py
new file mode 100644
index 0000000..ed847e7
--- /dev/null
+++ b/iep/tools/iepFileBrowser/__init__.py
@@ -0,0 +1,144 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+tool_name = "File browser"
+tool_summary = "Browse the files in your projects."
+
+
+""" File browser tool
+
+A powerfull tool for managing your projects in a lightweight manner.
+It has a few file management utilities as well.
+
+
+Config
+======
+
+The config consists of three fields:
+
+ * list expandedDirs, with each element a directory
+ * list starredDirs, with each element a dict with fields:
+ * str path, the directory that is starred
+ * str name, the name of the project (path.basename by default)
+ * bool addToPythonpath
+ * searchMatchCase, searchRegExp, searchSubDirs
+ * nameFilter
+
+"""
+
+# todo: List!
+"""
+ * see easily which files are opened (so it can be used as a secondary tab bar)
+ * make visible the "current file" (if applicable)
+ * single click on an file that is open selects it in the editor?
+ * context menu items to run scripts
+ * Support for multiple browsers.
+
+"""
+
+import os
+import sys
+
+from pyzolib import ssdf
+from pyzolib.path import Path
+
+from pyzolib.qt import QtCore, QtGui
+import iep
+
+from .browser import Browser
+
+
+
+class IepFileBrowser(QtGui.QWidget):
+ """ The main tool widget. An instance of this class contains one or
+ more Browser instances. If there are more, they can be selected
+ using a tab bar.
+ """
+
+ def __init__(self, parent):
+ QtGui.QWidget.__init__(self, parent)
+
+ # Get config
+ toolId = self.__class__.__name__.lower() + '2' # This is v2 of the file browser
+ if toolId not in iep.config.tools:
+ iep.config.tools[toolId] = ssdf.new()
+ self.config = iep.config.tools[toolId]
+
+ # Ensure three main attributes in config
+ for name in ['expandedDirs', 'starredDirs']:
+ if name not in self.config:
+ self.config[name] = []
+
+ # Ensure path in config
+ if 'path' not in self.config or not os.path.isdir(self.config.path):
+ self.config.path = os.path.expanduser('~')
+
+ # Check expandedDirs and starredDirs.
+ # Make Path instances and remove invalid dirs. Also normalize case,
+ # should not be necessary, but maybe the config was manually edited.
+ expandedDirs, starredDirs = [], []
+ for d in self.config.starredDirs:
+ if 'path' in d and 'name' in d and 'addToPythonpath' in d:
+ if os.path.isdir(d.path):
+ d.path = Path(d.path).normcase()
+ starredDirs.append(d)
+ for p in set([str(p) for p in self.config.expandedDirs]):
+ if os.path.isdir(p):
+ p = Path(p).normcase()
+ # Add if it is a subdir of a starred dir
+ for d in starredDirs:
+ if p.startswith(d.path):
+ expandedDirs.append(p)
+ break
+ self.config.expandedDirs, self.config.starredDirs = expandedDirs, starredDirs
+
+ # Create browser(s).
+ self._browsers = []
+ for i in [0]:
+ self._browsers.append( Browser(self, self.config) )
+
+ # Layout
+ layout = QtGui.QVBoxLayout(self)
+ self.setLayout(layout)
+ layout.addWidget(self._browsers[0])
+ layout.setSpacing(0)
+ layout.setContentsMargins(4,4,4,4)
+
+
+ def getAddToPythonPath(self):
+ """
+ Returns the path to be added to the Python path when starting a shell
+ If a project is selected, which has the addToPath checkbox selected,
+ returns the path of the project. Otherwise, returns None
+ """
+ # Select browser
+ browser = self._browsers[0]
+ # Select active project
+ d = browser.currentProject()
+ if d and d.addToPythonpath:
+ return d.path
+ return None
+
+
+ def getDefaultSavePath(self):
+ """
+ Returns the path to be used as default when saving a new file in iep.
+ Or None if the no path could be determined
+ """
+ # Select current browser
+ browser = self._browsers[0]
+ # Select its path
+ path = browser._tree.path()
+ # Return
+ if os.path.isabs(path) and os.path.isdir(path):
+ return path
+
+
+ def closeEvent(self, event):
+ # Close all browsers so they can clean up the file system proxies
+ for browser in self._browsers:
+ browser.close()
+ return QtGui.QWidget.closeEvent(self, event)
diff --git a/iep/tools/iepFileBrowser/browser.py b/iep/tools/iepFileBrowser/browser.py
new file mode 100644
index 0000000..084f962
--- /dev/null
+++ b/iep/tools/iepFileBrowser/browser.py
@@ -0,0 +1,680 @@
+import os
+import sys
+
+from pyzolib.path import Path
+from pyzolib import ssdf
+from . import QtCore, QtGui
+
+import iep
+from iep import translate
+
+from .tree import Tree
+from . import proxies
+
+
+class Browser(QtGui.QWidget):
+ """ A browser consists of an address bar, and tree view, and other
+ widets to help browse the file system. The browser object is responsible
+ for tying the different browser-components together.
+
+ It is also provides the API for dealing with starred dirs.
+ """
+
+ def __init__(self, parent, config, path=None):
+ QtGui.QWidget.__init__(self, parent)
+
+ # Store config
+ self.config = config
+
+ # Create star button
+ self._projects = Projects(self)
+
+ # Create path input/display lineEdit
+ self._pathEdit = PathInput(self)
+
+ # Create file system proxy
+ self._fsProxy = proxies.NativeFSProxy()
+ self.destroyed.connect(self._fsProxy.stop)
+
+ # Create tree widget
+ self._tree = Tree(self)
+ self._tree.setPath(Path(self.config.path))
+
+ # Create name filter
+ self._nameFilter = NameFilter(self)
+ #self._nameFilter.lineEdit().setToolTip('File filter pattern')
+ self._nameFilter.setToolTip(translate('filebrowser', 'Filename filter'))
+ self._nameFilter.setPlaceholderText(self._nameFilter.toolTip())
+
+ # Create search filter
+ self._searchFilter = SearchFilter(self)
+ self._searchFilter.setToolTip(translate('filebrowser', 'Search in files'))
+ self._searchFilter.setPlaceholderText(self._searchFilter.toolTip())
+
+ # Signals to sync path.
+ # Widgets that can change the path transmit signal to _tree
+ self._pathEdit.dirUp.connect(self._tree.setFocus)
+ self._pathEdit.dirUp.connect(self._tree.setPathUp)
+ self._pathEdit.dirChanged.connect(self._tree.setPath)
+ self._projects.dirChanged.connect(self._tree.setPath)
+ #
+ self._nameFilter.filterChanged.connect(self._tree.onChanged) # == update
+ self._searchFilter.filterChanged.connect(self._tree.onChanged)
+ # The tree transmits signals to widgets that need to know the path
+ self._tree.dirChanged.connect(self._pathEdit.setPath)
+ self._tree.dirChanged.connect(self._projects.setPath)
+
+ self._layout()
+
+ # Set and sync path ...
+ if path is not None:
+ self._tree.SetPath(path)
+ self._tree.dirChanged.emit(self._tree.path())
+
+ def getImportWizard(self):
+ # Lazy loading
+ try:
+ return self._importWizard
+ except AttributeError:
+
+ from .importwizard import ImportWizard
+ self._importWizard = ImportWizard()
+
+ return self._importWizard
+
+ def _layout(self):
+ layout = QtGui.QVBoxLayout(self)
+ layout.setContentsMargins(0,0,0,0)
+ #layout.setSpacing(6)
+ self.setLayout(layout)
+ #
+ layout.addWidget(self._projects)
+ layout.addWidget(self._pathEdit)
+ layout.addWidget(self._tree)
+ #
+ subLayout = QtGui.QHBoxLayout()
+ subLayout.setSpacing(2)
+ subLayout.addWidget(self._nameFilter, 5)
+ subLayout.addWidget(self._searchFilter, 5)
+ layout.addLayout(subLayout)
+
+ def closeEvent(self, event):
+ #print('Closing browser, stopping file system proxy')
+ super().closeEvent(event)
+ self._fsProxy.stop()
+
+ def nameFilter(self):
+ #return self._nameFilter.lineEdit().text()
+ return self._nameFilter.text()
+
+ def searchFilter(self):
+ return {'pattern': self._searchFilter.text(),
+ 'matchCase': self.config.searchMatchCase,
+ 'regExp': self.config.searchRegExp,
+ 'subDirs': self.config.searchSubDirs,
+ }
+
+ @property
+ def expandedDirs(self):
+ """ The list of the expanded directories.
+ """
+ return self.parent().config.expandedDirs
+
+ @property
+ def starredDirs(self):
+ """ A list of the starred directories.
+ """
+ return [d.path for d in self.parent().config.starredDirs]
+
+ def dictForStarredDir(self, path):
+ """ Return the dict of the starred dir corresponding to
+ the given path, or None if no starred dir was found.
+ """
+ if not path:
+ return None
+ for d in self.parent().config.starredDirs:
+ if d['path'] == path:
+ return d
+ else:
+ return None
+
+ def addStarredDir(self, path):
+ """ Add the given path to the starred directories.
+ """
+ # Create new dict
+ newProject = ssdf.new()
+ newProject.path = path.normcase() # Normalize case!
+ newProject.name = path.basename
+ newProject.addToPythonpath = False
+ # Add it to the config
+ self.parent().config.starredDirs.append(newProject)
+ # Update list
+ self._projects.updateProjectList()
+
+ def removeStarredDir(self, path):
+ """ Remove the given path from the starred directories.
+ The path must exactlty match.
+ """
+ # Remove
+ starredDirs = self.parent().config.starredDirs
+ pathn = path.normcase()
+ for d in starredDirs:
+ if pathn == d.path:
+ starredDirs.remove(d)
+ # Update list
+ self._projects.updateProjectList()
+
+ def test(self, sort=False):
+ items = []
+ for i in range(self._tree.topLevelItemCount()):
+ item = self._tree.topLevelItem(i)
+ items.append(item)
+ #self._tree.removeItemWidget(item, 0)
+ self._tree.clear()
+
+ #items.sort(key=lambda x: x._path)
+ items = [item for item in reversed(items)]
+
+ for item in items:
+ self._tree.addTopLevelItem(item)
+
+ def currentProject(self):
+ """ Return the ssdf dict for the current project, or None.
+ """
+ return self._projects.currentDict()
+
+
+class LineEditWithToolButtons(QtGui.QLineEdit):
+ """ Line edit to which tool buttons (with icons) can be attached.
+ """
+
+ def __init__(self, parent):
+ QtGui.QLineEdit.__init__(self, parent)
+ self._leftButtons = []
+ self._rightButtons = []
+
+ def addButtonLeft(self, icon, willHaveMenu=False):
+ return self._addButton(icon, willHaveMenu, self._leftButtons)
+
+ def addButtonRight(self, icon, willHaveMenu=False):
+ return self._addButton(icon, willHaveMenu, self._rightButtons)
+
+ def _addButton(self, icon, willHaveMenu, L):
+ # Create button
+ button = QtGui.QToolButton(self)
+ L.append(button)
+ # Customize appearance
+ button.setIcon(icon)
+ button.setIconSize(QtCore.QSize(16,16))
+ button.setStyleSheet("QToolButton { border: none; padding: 0px; }")
+ #button.setStyleSheet("QToolButton { border: none; padding: 0px; background-color:red;}");
+ # Set behavior
+ button.setCursor(QtCore.Qt.ArrowCursor)
+ button.setPopupMode(button.InstantPopup)
+ # Customize alignment
+ if willHaveMenu:
+ button.setToolButtonStyle(QtCore.Qt.ToolButtonTextBesideIcon)
+ if sys.platform.startswith('win'):
+ button.setText(' ')
+ # Update self
+ self._updateGeometry()
+ return button
+
+ def setButtonVisible(self, button, visible):
+ for but in self._leftButtons:
+ if but is button:
+ but.setVisible(visible)
+ for but in self._rightButtons:
+ if but is button:
+ but.setVisible(visible)
+ self._updateGeometry()
+
+ def resizeEvent(self, event):
+ QtGui.QLineEdit.resizeEvent(self, event)
+ self._updateGeometry(True)
+
+ def showEvent(self, event):
+ QtGui.QLineEdit.showEvent(self, event)
+ self._updateGeometry()
+
+ def _updateGeometry(self, light=False):
+ if not self.isVisible():
+ return
+
+ # Init
+ rect = self.rect()
+
+ # Determine padding and height
+ paddingLeft, paddingRight, height = 1, 1, 0
+ #
+ for but in self._leftButtons:
+ if but.isVisible():
+ sz = but.sizeHint()
+ height = max(height, sz.height())
+ but.move( 1+paddingLeft,
+ (rect.bottom() + 1 - sz.height())/2 )
+ paddingLeft += sz.width() + 1
+ #
+ for but in self._rightButtons:
+ if but.isVisible():
+ sz = but.sizeHint()
+ paddingRight += sz.width() + 1
+ height = max(height, sz.height())
+ but.move( rect.right()-1-paddingRight,
+ (rect.bottom() + 1 - sz.height())/2 )
+
+ # Set padding
+ ss = "QLineEdit { padding-left: %ipx; padding-right: %ipx} "
+ self.setStyleSheet( ss % (paddingLeft, paddingRight) );
+
+ # Set minimum size
+ if not light:
+ fw = QtGui.qApp.style().pixelMetric(QtGui.QStyle.PM_DefaultFrameWidth)
+ msz = self.minimumSizeHint()
+ w = max(msz.width(), paddingLeft + paddingRight + 10)
+ h = max(msz.height(), height + fw*2 + 2)
+ self.setMinimumSize(w,h)
+
+
+
+class PathInput(LineEditWithToolButtons):
+ """ Line edit for selecting a path.
+ """
+
+ dirChanged = QtCore.Signal(Path) # Emitted when the user changes the path (and is valid)
+ dirUp = QtCore.Signal() # Emitted when user presses the up button
+
+ def __init__(self, parent):
+ LineEditWithToolButtons.__init__(self, parent)
+
+ # Create up button
+ self._upBut = self.addButtonLeft(iep.icons.folder_parent)
+ self._upBut.clicked.connect(self.dirUp)
+
+ # To receive focus events
+ self.setFocusPolicy(QtCore.Qt.StrongFocus)
+
+ # Set completion mode
+ self.setCompleter(QtGui.QCompleter())
+ c = self.completer()
+ c.setCompletionMode(c.InlineCompletion)
+
+ # Set dir model to completer
+ dirModel = QtGui.QDirModel(c)
+ dirModel.setFilter(QtCore.QDir.Dirs | QtCore.QDir.NoDotAndDotDot)
+ c.setModel(dirModel)
+
+ # Connect signals
+ #c.activated.connect(self.onActivated)
+ self.textEdited.connect(self.onTextEdited)
+ #self.textChanged.connect(self.onTextEdited)
+ #self.cursorPositionChanged.connect(self.onTextEdited)
+
+
+ def setPath(self, path):
+ """ Set the path to display. Does nothing if this widget has focus.
+ """
+ if not self.hasFocus():
+ self.setText(path)
+ self.checkValid() # Reset style if it was invalid first
+
+
+ def checkValid(self):
+ # todo: This kind of violates the abstraction of the file system
+ # ok for now, but we should find a different approach someday
+ # Check
+ text = self.text()
+ dir = Path(text)
+ isvalid = text and dir.isdir and os.path.isabs(dir)
+ # Apply styling
+ ss = self.styleSheet().replace('font-style:italic; ', '')
+ if not isvalid:
+ ss = ss.replace('QLineEdit {', 'QLineEdit {font-style:italic; ')
+ self.setStyleSheet(ss)
+ # Return
+ return isvalid
+
+
+ def event(self, event):
+ # Capture key events to explicitly apply the completion and
+ # invoke checking whether the current text is a valid directory.
+ # Test if QtGui is not None (can happen when reloading tools)
+ if QtGui and isinstance(event, QtGui.QKeyEvent):
+ qt = QtCore.Qt
+ if event.key() in [qt.Key_Tab, qt.Key_Enter, qt.Key_Return]:
+ self.setText(self.text()) # Apply completion
+ self.onTextEdited() # Check if this is a valid dir
+ return True
+ return super().event(event)
+
+
+ def onTextEdited(self, dummy=None):
+ text = self.text()
+ if self.checkValid():
+ self.dirChanged.emit(Path(text))
+
+
+ def focusOutEvent(self, event=None):
+ """ focusOutEvent(event)
+ On focusing out, make sure that the set path is correct.
+ """
+ if event is not None:
+ QtGui.QLineEdit.focusOutEvent(self, event)
+
+ path = self.parent()._tree.path()
+ self.setPath(path)
+
+
+
+class Projects(QtGui.QWidget):
+
+ dirChanged = QtCore.Signal(Path) # Emitted when the user changes the project
+
+ def __init__(self, parent):
+ QtGui.QWidget.__init__(self, parent)
+
+ # Init variables
+ self._path = ''
+
+ # Create combo button
+ self._combo = QtGui.QComboBox(self)
+ self._combo.setEditable(False)
+ self.updateProjectList()
+
+ # Create star button
+ self._but = QtGui.QToolButton(self)
+ self._but.setIcon( iep.icons.star3 )
+ self._but.setStyleSheet("QToolButton { padding: 0px; }");
+ self._but.setIconSize(QtCore.QSize(18,18))
+ self._but.setToolButtonStyle(QtCore.Qt.ToolButtonTextBesideIcon)
+ self._but.setPopupMode(self._but.InstantPopup)
+ #
+ self._menu = QtGui.QMenu(self._but)
+ self._menu.triggered.connect(self.onMenuTriggered)
+ self.buildMenu()
+
+ # Make equal height
+ h = max(self._combo.sizeHint().height(), self._but.sizeHint().height())
+ self._combo.setMinimumHeight(h); self._but.setMinimumHeight(h)
+
+ # Connect signals
+ self._but.pressed.connect(self.onButtonPressed)
+ self._combo.activated .connect(self.onProjectSelect)
+
+ # Layout
+ layout = QtGui.QHBoxLayout(self)
+ self.setLayout(layout)
+ layout.addWidget(self._but)
+ layout.addWidget(self._combo)
+ layout.setSpacing(2)
+ layout.setContentsMargins(0,0,0,0)
+
+
+ def currentDict(self):
+ """ Return the current project-dict, or None.
+ """
+ path = self._combo.itemData(self._combo.currentIndex())
+ return self.parent().dictForStarredDir(path)
+
+
+ def setPath(self, path):
+ self._path = path
+ # Find project index
+ projectIndex, L = 0, 0
+ pathn = path.normcase() + os.path.sep
+ for i in range(self._combo.count()):
+ projectPath = self._combo.itemData(i) + os.path.sep
+ if pathn.startswith(projectPath) and len(projectPath) > L:
+ projectIndex, L = i, len(projectPath)
+ # Select project or not ...
+ self._combo.setCurrentIndex(projectIndex)
+ if projectIndex:
+ self._but.setIcon( iep.icons.star2 )
+ self._but.setMenu(self._menu)
+ else:
+ self._but.setIcon( iep.icons.star3 )
+ self._but.setMenu(None)
+
+
+ def updateProjectList(self):
+ # Get sorted version of starredDirs
+ starredDirs = self.parent().starredDirs
+ starredDirs.sort(key=lambda p:p.lower())
+ # Refill the combo box
+ self._combo.clear()
+ for p in starredDirs:
+ name = self.parent().dictForStarredDir(p).name
+ self._combo.addItem(name, p)
+ # Insert dummy item
+ if starredDirs:
+ self._combo.insertItem(0, translate('filebrowser', 'Projects:'), '') # No-project item
+ else:
+ self._combo.addItem(
+ translate('filebrowser', 'Click star to bookmark current dir'), '')
+
+
+ def buildMenu(self):
+ menu = self._menu
+ menu.clear()
+
+ # Add action to remove bookmark
+ action = menu.addAction(translate('filebrowser', 'Remove project'))
+ action._id = 'remove'
+ action.setCheckable(False)
+
+ # Add action to change name
+ action = menu.addAction(translate('filebrowser', 'Change project name'))
+ action._id = 'name'
+ action.setCheckable(False)
+
+ menu.addSeparator()
+
+ # Add check action for adding to Pythonpath
+ action = menu.addAction(translate('filebrowser', 'Add path to Python path'))
+ action._id = 'pythonpath'
+ action.setCheckable(True)
+ d = self.currentDict()
+ if d:
+ checked = bool( d and d['addToPythonpath'] )
+ action.setChecked(checked)
+
+ # Add action to cd to the project directory
+ action = menu.addAction(translate('filebrowser', 'Go to this directory in the current shell'))
+ action._id = 'cd'
+ action.setCheckable(False)
+
+
+
+ def onMenuTriggered(self, action):
+ d = self.currentDict()
+ if not d:
+ return
+
+ if action._id == 'remove':
+ # Remove this project
+ self.parent().removeStarredDir(d.path)
+
+ elif action._id == 'name':
+ # Open dialog to ask for name
+ name = QtGui.QInputDialog.getText(self.parent(),
+ translate('filebrowser', 'Project name'),
+ translate('filebrowser', 'New project name:'),
+ text=d['name'],
+ )
+ if isinstance(name, tuple):
+ name = name[0] if name[1] else ''
+ if name:
+ d['name'] = name
+ self.updateProjectList()
+
+ elif action._id == 'pythonpath':
+ # Flip add-to-pythonpath flag
+ d['addToPythonpath'] = not d['addToPythonpath']
+
+ elif action._id == 'cd':
+ # cd to the directory
+ shell = iep.shells.getCurrentShell()
+ if shell:
+ shell.executeCommand('cd '+d.path+'\n')
+
+ def onButtonPressed(self):
+ if self._but.menu():
+ # The directory is starred and has a menu. The user just
+ # used the menu (or not). Update so it is up-to-date next time.
+ self.buildMenu()
+ else:
+ # Not starred right now, create new project!
+ self.parent().addStarredDir(self._path)
+ # Update
+ self.setPath(self._path)
+
+
+ def onProjectSelect(self, index):
+ path = self._combo.itemData(index)
+ if path:
+ # Go to dir
+ self.dirChanged.emit(Path(path))
+ else:
+ # Dummy item, reset
+ self.setPath(self._path)
+
+
+
+class NameFilter(LineEditWithToolButtons):
+ """ Combobox to filter by name.
+ """
+
+ filterChanged = QtCore.Signal()
+
+ def __init__(self, parent):
+ LineEditWithToolButtons.__init__(self, parent)
+
+ # Create tool button, and attach the menu
+ self._menuBut = self.addButtonRight(iep.icons['filter'], True)
+ self._menu = QtGui.QMenu(self._menuBut)
+ self._menu.triggered.connect(self.onMenuTriggered)
+ self._menuBut.setMenu(self._menu)
+ #
+ # Add common patterns
+ for pattern in ['*', '!*.pyc',
+ '*.py *.pyw', '*.py *.pyw *.pyx *.pxd',
+ '*.h *.c *.cpp']:
+ self._menu.addAction(pattern)
+
+ # Emit signal when value is changed
+ self._lastValue = ''
+ self.returnPressed.connect(self.checkFilterValue)
+ self.editingFinished.connect(self.checkFilterValue)
+
+ # Ensure the namefilter is in the config and initialize
+ config = self.parent().config
+ if 'nameFilter' not in config:
+ config.nameFilter = '!*.pyc'
+ self.setText(config.nameFilter)
+
+ def setText(self, value, test=False):
+ """ To initialize the name filter.
+ """
+ QtGui.QLineEdit.setText(self, value)
+ if test:
+ self.checkFilterValue()
+ self._lastValue = value
+
+ def checkFilterValue(self):
+ value = self.text()
+ if value != self._lastValue:
+ self.parent().config.nameFilter = value
+ self._lastValue = value
+ self.filterChanged.emit()
+
+ def onMenuTriggered(self, action):
+ self.setText(action.text(), True)
+
+
+
+class SearchFilter(LineEditWithToolButtons):
+ """ Line edit to do a search in the files.
+ """
+
+ filterChanged = QtCore.Signal()
+
+ def __init__(self, parent):
+ LineEditWithToolButtons.__init__(self, parent)
+
+ # Create tool button, and attach the menu
+ self._menuBut = self.addButtonRight(iep.icons['magnifier'], True)
+ self._menu = QtGui.QMenu(self._menuBut)
+ self._menu.triggered.connect(self.onMenuTriggered)
+ self._menuBut.setMenu(self._menu)
+ self.buildMenu()
+
+ # Create cancel button
+ self._cancelBut = self.addButtonRight(iep.icons['cancel'])
+ self._cancelBut.setVisible(False)
+
+ # Keep track of last value of search (initialized empty)
+ self._lastValue = ''
+
+ # Connect signals
+ self._cancelBut.pressed.connect(self.onCancelPressed)
+ self.textChanged.connect(self.updateCancelButton)
+ self.editingFinished.connect(self.checkFilterValue)
+ self.returnPressed.connect(self.forceFilterChanged)
+
+ def onCancelPressed(self):
+ """ Clear text or build menu.
+ """
+ if self.text():
+ QtGui.QLineEdit.clear(self)
+ self.checkFilterValue()
+ else:
+ self.buildMenu()
+
+ def checkFilterValue(self):
+ value = self.text()
+ if value != self._lastValue:
+ self._lastValue = value
+ self.filterChanged.emit()
+
+ def forceFilterChanged(self):
+ self._lastValue = value = self.text()
+ self.filterChanged.emit()
+
+ def updateCancelButton(self, text):
+ visible = bool(self.text())
+ self.setButtonVisible(self._cancelBut, visible)
+
+ def buildMenu(self):
+ config = self.parent().config
+ menu = self._menu
+ menu.clear()
+
+ map = [ ('searchMatchCase', False, translate("filebrowser", "Match case")),
+ ('searchRegExp', False, translate("filebrowser", "RegExp")),
+ ('searchSubDirs', True, translate("filebrowser", "Search in subdirs"))
+ ]
+
+ # Fill menu
+ for option, default, description in map:
+ if option is None:
+ menu.addSeparator()
+ else:
+ # Make sure the option exists
+ if option not in config:
+ config[option] = default
+ # Make action in menu
+ action = menu.addAction(description)
+ action._option = option
+ action.setCheckable(True)
+ action.setChecked( bool(config[option]) )
+
+ def onMenuTriggered(self, action):
+ config = self.parent().config
+ option = action._option
+ # Swap this option
+ if option in config:
+ config[option] = not config[option]
+ else:
+ config[option] = True
+ # Update
+ self.filterChanged.emit()
diff --git a/iep/tools/iepFileBrowser/importwizard.py b/iep/tools/iepFileBrowser/importwizard.py
new file mode 100644
index 0000000..34b2b53
--- /dev/null
+++ b/iep/tools/iepFileBrowser/importwizard.py
@@ -0,0 +1,559 @@
+"""
+
+The import wizard helps the user importing CSV-like data from a file into a
+numpy array. The wizard containst three pages:
+
+SelectFilePage:
+ - The user selects a file and previews its contents (or, the beginning of it)
+
+SetParametersPage:
+ - The user selects delimiters, etc. and selects which columns to import
+ - A preview of the data in tabualar form is shown, with colors indicating
+ how the file is parsed: yellow for header rows, green for the comments
+ column and red for values that could not be parsed
+
+ResultPage:
+ - The wizard shows the generated code that is to be used to import the file
+ according to the settings
+ - The user chooses to execute the code in the current shell or paste the
+ code into the editor
+
+
+"""
+
+from PySide import QtGui, QtCore
+import os
+import itertools
+import iep.codeeditor
+from pyzolib.qt import QtCore, QtGui
+from iep import translate
+import unicodedata
+
+# All keywords in Python 2 and 3. Obtained using: import keyword; keyword.kwlist
+# Merged from Py2 and 3
+keywords = ['False', 'None', 'True', 'and', 'as', 'assert', 'break',
+ 'class', 'continue', 'def', 'del', 'elif', 'else', 'except', 'exec',
+ 'finally', 'for', 'from', 'global', 'if', 'import', 'in', 'is',
+ 'lambda', 'nonlocal', 'not', 'or', 'pass', 'print', 'raise', 'return',
+ 'try', 'while', 'with', 'yield']
+
+
+class CodeView(
+ iep.codeeditor.IndentationGuides,
+ iep.codeeditor.CodeFolding,
+ iep.codeeditor.Indentation,
+ iep.codeeditor.HomeKey,
+ iep.codeeditor.EndKey,
+ iep.codeeditor.NumpadPeriodKey,
+
+ iep.codeeditor.AutoIndent,
+ iep.codeeditor.PythonAutoIndent,
+
+ iep.codeeditor.SyntaxHighlighting,
+
+ iep.codeeditor.CodeEditorBase): #CodeEditorBase must be the last one in the list
+ """
+ Code viewer, stripped down version of the CodeEditor
+ """
+ pass
+
+
+
+class SelectFilePage(QtGui.QWizardPage):
+ """
+ First page of the wizard, select file and preview contents
+ """
+ def __init__(self):
+ QtGui.QWizardPage.__init__(self)
+
+ self.setTitle(translate('importwizard', 'Select file'))
+
+ self.txtFilename = QtGui.QLineEdit()
+ self.btnBrowse = QtGui.QPushButton(translate('importwizard', 'Browse...'))
+ self.preview = QtGui.QPlainTextEdit()
+ self.preview.setReadOnly(True)
+
+ vlayout = QtGui.QVBoxLayout()
+ hlayout = QtGui.QHBoxLayout()
+
+
+ hlayout.addWidget(self.txtFilename)
+ hlayout.addWidget(self.btnBrowse)
+ vlayout.addLayout(hlayout)
+ vlayout.addWidget(QtGui.QLabel(translate('importwizard', 'Preview:')))
+ vlayout.addWidget(self.preview)
+
+ self.setLayout(vlayout)
+
+ self.registerField('fname', self.txtFilename)
+
+ self.btnBrowse.clicked.connect(self.onBrowseClicked)
+ self.txtFilename.editingFinished.connect(self.updatePreview)
+ self._isComplete = False
+
+ def onBrowseClicked(self):
+ # Difference between PyQt4 and PySide: PySide returns filename, filter
+ # while PyQt4 returns only the filename
+ filename = QtGui.QFileDialog.getOpenFileName(filter = 'Text files (*.txt *.csv);;All files (*.*)')
+ if isinstance(filename, tuple):
+ filename = filename[0]
+
+ filename = str(filename).replace('/', os.sep) # Show native file separator
+
+ self.txtFilename.setText(filename)
+ self.updatePreview()
+
+ def updatePreview(self):
+ filename = self.txtFilename.text()
+ if not filename:
+ data = ''
+ self._isComplete = False
+ self.wizard().setPreviewData(None)
+ else:
+ try:
+ with open(filename,'rb') as file:
+ maxsize = 151
+ data = file.read(maxsize)
+ more = bool(file.read(1)) # See if there is more data available
+
+ data = data.decode('ascii', 'replace')
+
+ self.wizard().setPreviewData(data)
+
+ if more:
+ data += '...'
+
+ self._isComplete = True # Allow to proceed to the next page
+ except Exception as e:
+ data = str(e)
+ self._isComplete = False
+ self.wizard().setPreviewData(None)
+
+ self.preview.setPlainText(data)
+ self.completeChanged.emit()
+
+ def isComplete(self):
+ return self._isComplete
+
+
+
+class SetParametersPage(QtGui.QWizardPage):
+ def __init__(self):
+ QtGui.QWizardPage.__init__(self)
+
+ self.setTitle("Select parameters")
+
+ self._columnNames = None
+
+ def genComboBox(choices):
+ cbx = QtGui.QComboBox()
+ for choice in choices:
+ cbx.addItem(choice)
+ cbx.setEditable(True)
+ return cbx
+
+ self.cbxDelimiter = genComboBox(",;")
+ self.cbxComments = genComboBox("#%'")
+ self.sbSkipHeader = QtGui.QSpinBox()
+
+ self.preview = QtGui.QTableWidget()
+ self.preview.setSelectionModel(QtGui.QItemSelectionModel(self.preview.model())) # Work-around for reference tracking bug in PySide
+ self.preview.setSelectionBehavior(self.preview.SelectColumns)
+ self.preview.setSelectionMode(self.preview.MultiSelection)
+
+
+ # Layout
+
+ formlayout = QtGui.QFormLayout()
+ formlayout.addRow('Delimiter', self.cbxDelimiter)
+ formlayout.addRow('Comments', self.cbxComments)
+ formlayout.addRow('Header rows to skip', self.sbSkipHeader)
+
+ layout = QtGui.QVBoxLayout()
+ layout.addLayout(formlayout)
+ layout.addWidget(QtGui.QLabel(
+ translate('importwizard', 'Select columns to import:')))
+ layout.addWidget(self.preview)
+
+ self.setLayout(layout)
+
+ # Wizard fields
+ self.registerField('delimiter', self.cbxDelimiter, "currentText")
+ self.registerField('comments', self.cbxComments, "currentText")
+ self.registerField('skip_header', self.sbSkipHeader)
+
+
+ # Signals
+ self.cbxComments.editTextChanged.connect(self.updatePreview)
+ self.cbxDelimiter.editTextChanged.connect(self.updatePreview)
+ self.sbSkipHeader.valueChanged.connect(self.updatePreview)
+ self.preview.verticalHeader().sectionClicked.connect(self.onRowHeaderClicked)
+
+ def columnNames(self):
+ if self._columnNames is None:
+ return list(['d' + str(i + 1) for i in range(self.preview.columnCount()-1)])
+
+ return list(self._columnNames)
+
+
+ def updateHorizontalHeaderLabels(self):
+ self.preview.setHorizontalHeaderLabels(self.columnNames() + ['Comments'])
+
+
+ def onRowHeaderClicked(self, row):
+ names = self.parseColumnNames(row)
+ self._columnNames = names
+ self.updateHorizontalHeaderLabels()
+
+
+ def parseColumnNames(self, row):
+ """
+ Use the data in the given row to create column names. First, try the
+ data in the data columns. If these are all empty, use the comments
+ column, split by the given delimiter.
+
+ Names are fixed up to be valid Python 2 / Python 3 identifiers
+ (chars a-z A-Z _ 0-9 , no Python 2 or 3 keywords, not starting with 0-9)
+
+ returns: list of names, exactly as many as there are data columns
+ """
+ names = []
+ columnCount = self.preview.columnCount()-1
+ for col in range(columnCount):
+ cell = self.preview.item(row, col)
+ if cell is None:
+ names.append('')
+ else:
+ names.append(cell.text().strip())
+
+ # If no values found, try the comments:
+ if not any(names):
+ cell = self.preview.item(row, columnCount)
+ if cell is not None:
+ comment = cell.text()[1:].strip() # Remove comment char and whitespace
+ delimiter = self.cbxDelimiter.currentText()
+ names = list(name.strip() for name in comment.split(delimiter))
+
+ # Ensure names is exactly columnCount long
+ names += [''] * columnCount
+ names = names[:columnCount]
+
+
+ # Fixup names
+ def fixname(name, col):
+ # Remove accents
+ name = ''.join(c for c in unicodedata.normalize('NFD', name)
+ if unicodedata.category(c) != 'Mn')
+ # Replace invalid chars with _
+ name = ''.join(c if (c.lower()>='a' and c.lower()<='z') or (c>='0' and c<='9') else '_' for c in name)
+
+ if not name:
+ return 'd' + str(col)
+
+ if name[0]>='0' and name<='9':
+ name = 'd' + name
+
+ if name in keywords:
+ name = name + '_'
+
+ return name
+
+ names = list(fixname(name, i + 1) for i, name in enumerate(names))
+
+ return names
+
+ def selectedColumns(self):
+ """
+ Returns a tuple of the columns that are selected, or None if no columns
+ are selected
+ """
+ selected = []
+ for selrange in self.preview.selectionModel().selection():
+ selected += range(selrange.left(), selrange.right() + 1)
+
+ selected.sort()
+
+ if not selected:
+ return None
+ else:
+ return tuple(selected)
+
+ def initializePage(self):
+ self.updatePreview()
+
+ def updatePreview(self):
+ # Get settings from the currently specified values in the wizard
+ comments = self.cbxComments.currentText()
+ delimiter = self.cbxDelimiter.currentText()
+ skipheader = self.sbSkipHeader.value()
+ if not comments or not delimiter:
+ return
+
+ # Store current selection, will be restored at the end
+ selectedColumns = self.selectedColumns()
+
+ # Clear the complete table
+ self.preview.clear()
+ self.preview.setColumnCount(0)
+ self.preview.setRowCount(0)
+
+ # Iterate through the source file line by line
+ # Process like genfromtxt, with names = False
+ # However, we do keep the header lines and comments; we show them in
+ # distinct colors so that the user can see how the data is selected
+
+ source = iter(self.wizard().previewData().splitlines())
+
+
+
+
+ def split_line(line):
+ """Chop off comments, strip, and split at delimiter."""
+ line, sep, commentstr = line.partition(comments)
+ line = line.strip(' \r\n')
+ if line:
+ return line.split(delimiter), sep + commentstr
+ else:
+ return [], sep + commentstr
+
+
+ # Insert comments column
+ self.preview.insertColumn(0)
+
+ ncols = 0 # Number of columns, excluding comments column
+ headerrows = 0 # Number of header rows, including empty header rows
+
+ inheader = True
+
+ for lineno, line in enumerate(source):
+ fields, commentstr = split_line(line)
+
+ # Process header like genfromtxt, with names = False
+ if lineno>=skipheader and fields:
+ inheader = False
+
+ if inheader:
+ headerrows = lineno + 1 # +1 since lineno = 0 is the first line
+
+ self.preview.insertRow(lineno)
+
+ # Add columns to fit all fields
+ while len(fields)>ncols:
+ self.preview.insertColumn(ncols)
+ ncols += 1
+
+ # Add fields to the table
+ for col, field in enumerate(fields):
+ cell = QtGui.QTableWidgetItem(field)
+ if not inheader:
+ try:
+ float(field)
+ except ValueError:
+ cell.setBackground(QtGui.QBrush(QtGui.QColor("pink")))
+
+ self.preview.setItem(lineno,col, cell)
+
+ # Add the comment
+ cell = QtGui.QTableWidgetItem(commentstr)
+ cell.setBackground(QtGui.QBrush(QtGui.QColor("lightgreen")))
+
+ self.preview.setItem(lineno,ncols, cell)
+
+ # Colorize the header cells. This is done as the last step, since
+ # meanwhile new columns (and thus new cells) may have been added
+ for row in range(headerrows):
+ for col in range(ncols):
+ cell = self.preview.item(row, col)
+ if not cell:
+ cell = QtGui.QTableWidgetItem('')
+ self.preview.setItem(row, col, cell)
+
+ cell.setBackground(QtGui.QBrush(QtGui.QColor("khaki")))
+
+ # Try to restore selection
+ if selectedColumns is not None:
+ for column in selectedColumns:
+ self.preview.selectColumn(column)
+
+ # Restore column names
+ self.updateHorizontalHeaderLabels()
+
+
+class ResultPage(QtGui.QWizardPage):
+ """
+ The resultpage lets the user select wether to import the data as a single
+ 2D-array, or as one variable (1D-array) per column
+
+ Then, the code to do the import is generated (Py2 and Py3 compatible). This
+ code can be executed in the current shell, or copied into the current editor
+
+ """
+ def __init__(self):
+ QtGui.QWizardPage.__init__(self)
+ self.setTitle("Execute import")
+ self.setButtonText(QtGui.QWizard.FinishButton,
+ translate('importwizard', 'Close'))
+
+ self.rbAsArray = QtGui.QRadioButton(translate('importwizard', 'Import data as single array'))
+ self.rbPerColumn = QtGui.QRadioButton(translate('importwizard', 'Import data into one variable per column'))
+ self.rbAsArray.setChecked(True)
+
+ self.codeView = CodeView()
+ self.codeView.setParser('python')
+ self.codeView.setZoom(iep.config.view.zoom)
+ self.codeView.setFont(iep.config.view.fontname)
+
+ self.btnExecute = QtGui.QPushButton('Execute in current shell')
+ self.btnInsert = QtGui.QPushButton('Paste into current file')
+
+ layout = QtGui.QVBoxLayout()
+ layout.addWidget(self.rbAsArray)
+ layout.addWidget(self.rbPerColumn)
+
+ layout.addWidget(QtGui.QLabel('Resulting import code:'))
+ layout.addWidget(self.codeView)
+ layout.addWidget(self.btnExecute)
+ layout.addWidget(self.btnInsert)
+ self.setLayout(layout)
+
+
+ self.btnExecute.clicked.connect(self.onBtnExecuteClicked)
+ self.btnInsert.clicked.connect(self.onBtnInsertClicked)
+ self.rbAsArray.clicked.connect(self.updateCode)
+ self.rbPerColumn.clicked.connect(self.updateCode)
+
+
+ def initializePage(self):
+ self.updateCode()
+
+ def updateCode(self):
+ perColumn = self.rbPerColumn.isChecked()
+
+ if perColumn:
+ columnNames = self.wizard().field('columnnames')
+ usecols = self.wizard().field('usecols')
+
+ if usecols is not None: # User selected a subset of all columns
+ # Pick corrsponding column names
+ columnNames = [columnNames[i] for i in usecols]
+
+ variables = ', '.join(columnNames)
+ else:
+ variables = 'data'
+
+ code = "import numpy\n"
+
+ code += variables + " = numpy.genfromtxt(\n"
+ for param, default in (
+ ('fname', None),
+ ('skip_header', 0),
+ ('comments', '#'),
+ ('delimiter', None),
+ ('usecols', None),
+ ):
+ value = self.wizard().field(param)
+ if value != default:
+ code += "\t%s = %r,\n" % (param, value)
+ if perColumn:
+ code += '\tunpack = True,\n'
+ code += '\t)\n'
+
+ self.codeView.setPlainText(code)
+
+ def getCode(self):
+ return self.codeView.toPlainText()
+
+ def onBtnExecuteClicked(self):
+ shell = iep.shells.getCurrentShell()
+ if shell is None:
+ QtGui.QMessageBox.information(self,
+ translate('importwizard', 'Import data wizard'),
+ translate('importwizard', 'No current shell active'))
+ return
+
+ shell.executeCode(self.getCode(), 'importwizard')
+
+ def onBtnInsertClicked(self):
+ editor = iep.editors.getCurrentEditor()
+ if editor is None:
+ QtGui.QMessageBox.information(self,
+ translate('importwizard', 'Import data wizard'),
+ translate('importwizard', 'No current file open'))
+ return
+
+ code = self.getCode()
+
+ # Format tabs/spaces according to editor setting
+ if editor.indentUsingSpaces():
+ code = code.replace('\t', ' ' * editor.indentWidth())
+
+
+ # insert code at start of line
+ cursor = editor.textCursor()
+ cursor.movePosition(cursor.StartOfBlock)
+ cursor.insertText(code)
+
+
+class ImportWizard(QtGui.QWizard):
+ def __init__(self):
+ QtGui.QWizard.__init__(self)
+ self.setMinimumSize(500,400)
+ self.resize(700,500)
+
+ self.setPreviewData(None)
+
+ self.selectFilePage = SelectFilePage()
+ self.setParametersPage = SetParametersPage()
+ self.resultPage = ResultPage()
+
+
+ self.addPage(self.selectFilePage)
+ self.addPage(self.setParametersPage)
+ self.addPage(self.resultPage)
+
+ self.setWindowTitle(translate('importwizard', 'Import data'))
+
+ self.currentIdChanged.connect(self.onCurrentIdChanged)
+
+ def onCurrentIdChanged(self, id):
+ # Hide the 'cancel' button on the last page
+ if self.nextId() == -1:
+ self.button(QtGui.QWizard.CancelButton).hide()
+ else:
+ self.button(QtGui.QWizard.CancelButton).show()
+
+ def open(self, filename):
+ if self.isVisible():
+ QtGui.QMessageBox.information(self,
+ translate('importwizard', 'Import data wizard'),
+ translate('importwizard', 'The import data wizard is already open'))
+ return
+
+ self.restart()
+ self.setField('fname', filename)
+ self.selectFilePage.updatePreview()
+ self.show()
+
+ def field(self, name):
+ # Allow access to all data via field, some properties are not avaialble
+ # as actual controls and therefore we have to handle them ourselves
+ if name == 'usecols':
+ return self.setParametersPage.selectedColumns()
+ elif name == 'columnnames':
+ return self.setParametersPage.columnNames()
+ else:
+ return QtGui.QWizard.field(self, name)
+
+ def setPreviewData(self, data):
+ self._previewData = data
+ def previewData(self):
+ if self._previewData is None:
+ raise RuntimeError('Preview data not loaded')
+
+ return self._previewData
+
+if __name__=='__main__':
+ iw = ImportWizard()
+ iw.open('test.txt')
+
+
diff --git a/iep/tools/iepFileBrowser/proxies.py b/iep/tools/iepFileBrowser/proxies.py
new file mode 100644
index 0000000..fecf0f8
--- /dev/null
+++ b/iep/tools/iepFileBrowser/proxies.py
@@ -0,0 +1,447 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+
+"""
+This module defines file system proxies to be used for the file browser.
+For now, there is only one: the native file system. But in time,
+we may add proxies for ftp, S3, remote computing, etc.
+
+This may seem like an awkward way to use the file system, but (with
+small modifications) this approach can probably be used also for
+opening/saving files to any file system that we implement here. This
+will make IEP truly powerful for use in remote computing.
+
+"""
+
+from . import QtCore, QtGui
+
+import time
+import threading
+from queue import Queue, Empty
+
+
+class Task:
+ """ Task(**params)
+
+ A task object. Accepts params as keyword arguments.
+ When overloading, dont forget to set __slots__.
+
+ Overload and implement the 'process' method to create a task.
+ Then use pushTask on a pathProxy object. Use the 'result' method to
+ obtain the result (or raise an error).
+ """
+ __slots__ = ['_params', '_result', '_error']
+
+ def __init__(self, **params):
+ if not params:
+ params = None
+ self._params = params
+ self._result = None
+ self._error = None
+
+ def process(self, proxy, **params):
+ """ process(pathProxy, **params):
+ This is the method that represents the task. Overload this to make
+ the task do what is intended.
+ """
+ pass
+
+ def _run(self, proxy):
+ """ Run the task. Don't overload or use this.
+ """
+ try:
+ params = self._params or {}
+ self._result = self.process(proxy, **params)
+ except Exception as err:
+ self._error = 'Task failed: {}:\n{}'.format(self, str(err))
+ print(self._error)
+
+ def result(self):
+ """ Get the result. Raises an error if the task failed.
+ """
+ if self._error:
+ raise Exception(self._error)
+ else:
+ return self._result
+
+
+## Proxy classes for directories and files
+
+
+class PathProxy(QtCore.QObject):
+ """ Proxy base class for DirProxy and FileProxy.
+
+ A proxy object is used to get information on a path (folder
+ contents, or file modification time), and keep being updated about
+ changes in that information.
+
+ One uses an object by connecting to the 'changed' or 'deleted' signal.
+ Use setActive(True) to receive updates on these signals. If the proxy
+ is no longer needed, use close() to unregister it.
+
+ """
+
+ changed = QtCore.Signal()
+ deleted = QtCore.Signal()
+ errored = QtCore.Signal(str) # Or should we pass an error per 'action'?
+
+ taskFinished = QtCore.Signal(Task)
+
+ def __init__(self, fsProxy, path):
+ QtCore.QObject.__init__(self)
+ self._lock = threading.RLock()
+ self._fsProxy = fsProxy
+ self._path = path
+ self._cancelled = False
+ # For tasks
+ self._pendingTasks = []
+ self._finishedTasks = []
+
+ def __repr__(self):
+ return '<{} "{}">'.format(self.__class__.__name__, self._path)
+
+ def path(self):
+ """ Get the path of this proxy.
+ """
+ return self._path
+
+ def track(self):
+ """ Start tracking this proxy object in the idle time of the
+ FSProxy thread.
+ """
+ self._fsProxy._track(self)
+
+ def push(self):
+ """ Process this proxy object asap; the object is put in the queue
+ of the FSProxy, so it is updated as fast as possible.
+ """
+ self._cancelled = False
+ self._fsProxy._push(self)
+
+ def cancel(self):
+ """ Stop tracking this proxy object. Cancel processing if this
+ object was in the queue.
+ """
+ self._fsProxy._unTrack(self)
+ self._cancelled = True
+
+ def pushTask(self, task):
+ """ pushTask(task)
+ Give a task to the proxy to be executed in the FSProxy
+ thread. The taskFinished signal will be emitted with the given
+ task when it is done.
+ """
+ shouldPush = False
+ with self._lock:
+ if not self._pendingTasks:
+ shouldPush = True
+ self._pendingTasks.append(task)
+ if shouldPush:
+ self.push()
+
+ def _processTasks(self):
+ # Get pending tasks
+ with self._lock:
+ pendingTasks = self._pendingTasks
+ self._pendingTasks = []
+ # Process pending tasks
+ finishedTasks = []
+ for task in pendingTasks:
+ task._run(self)
+ finishedTasks.append(task)
+ # Emit signal if there are finished tasks
+ for task in finishedTasks:
+ self.taskFinished.emit(task)
+
+
+
+class DirProxy(PathProxy):
+ """ Proxy object for a directory. Obtain an instance of this class
+ using filesystemProx.dir()
+ """
+
+ def __init__(self, *args):
+ PathProxy.__init__(self, *args)
+ self._dirs = set()
+ self._files = set()
+
+ def dirs(self):
+ with self._lock:
+ return set(self._dirs)
+
+ def files(self):
+ with self._lock:
+ return set(self._files)
+
+ def _process(self, forceUpdate=False):
+ # Get info
+ dirs = self._fsProxy.listDirs(self._path)
+ files = self._fsProxy.listFiles(self._path)
+ # Is it deleted?
+ if dirs is None or files is None:
+ self.deleted.emit()
+ return
+ # All seems ok. Update if necessary
+ dirs, files = set(dirs), set(files)
+ if (dirs != self._dirs) or (files != self._files):
+ with self._lock:
+ self._dirs, self._files = dirs, files
+ self.changed.emit()
+ elif forceUpdate:
+ self.changed.emit()
+
+
+
+class FileProxy(PathProxy):
+ """ Proxy object for a file. Obtain an instance of this class
+ using filesystemProx.dir()
+ """
+
+ def __init__(self, *args):
+ PathProxy.__init__(self, *args)
+ self._modified = 0
+
+ def modified(self):
+ with self._lock:
+ return self._modified
+
+ def _process(self, forceUpdate=False):
+ # Get info
+ modified = self._fsProxy.modified(self._path)
+ # Is it deleted?
+ if modified is None:
+ self.deleted.emit()
+ return
+ # All seems ok. Update if necessary
+ if modified != self._modified:
+ with self._lock:
+ self._modified = modified
+ self.changed.emit()
+ elif forceUpdate:
+ self.changed.emit()
+
+ def read(self):
+ pass # ?
+
+ def save(self):
+ pass # ?
+
+
+## Proxy classes for the file system
+
+
+class BaseFSProxy(threading.Thread):
+ """ Abstract base class for file system proxies.
+
+ The file system proxy defines an interface that subclasses can implement
+ to "become" a usable file system proxy.
+
+ This class implements the polling of information for the DirProxy
+ and FileProxy objects, and keeping them up-to-date. For this purpose
+ it keeps a set of PathProxy instances that are polled when idle.
+ There is also a queue for items that need processing asap. This is
+ where objects are put in when they are activated.
+
+ This class has methods to use the file system (list files and
+ directories, etc.). These can be used directly, but may be slow.
+ Therefor it is recommended to use the FileProxy and DirProxy objects
+ instead.
+
+ """
+
+ # Define how often the registered dirs and files are checked
+ IDLE_TIMEOUT = 1.0
+
+ # For testing to induce extra delay. Should normally be close to zero,
+ # but not exactly zero!
+ IDLE_DELAY = 0.01
+ QUEUE_DELAY = 0.01 # 0.5
+
+ def __init__(self):
+ threading.Thread.__init__(self)
+ self.setDaemon(True)
+ #
+ self._interrupt = False
+ self._exit = False
+ #
+ self._lock = threading.RLock()
+ self._q = Queue()
+ self._pathProxies = set()
+ #
+ self.start()
+
+ def _track(self, pathProxy):
+ # todo: use weak references
+ with self._lock:
+ self._pathProxies.add(pathProxy)
+
+ def _unTrack(self, pathProxy):
+ with self._lock:
+ self._pathProxies.discard(pathProxy)
+
+ def _push(self, pathProxy):
+ # todo: use weak ref here too?
+ self._q.put(pathProxy)
+ self._interrupt = True
+
+ def stop(self, timeout=1.0):
+ with self._lock:
+ self._exit = True
+ self._interrupt = True
+ self._pathProxies.clear()
+ self.join(timeout)
+
+ def dir(self, path):
+ """ Convenience function to create a new DirProxy object.
+ """
+ return DirProxy(self, path)
+
+ def file(self, path):
+ """ Convenience function to create a new FileProxy object.
+ """
+ return FileProxy(self, path)
+
+
+ def run(self):
+
+ try:
+ try:
+ self._run()
+ except Exception as err:
+ if Empty is None or self._lock is None:
+ pass # Shutting down ...
+ else:
+ print('Exception in proxy thread: ' + str(err))
+
+ except Exception:
+ pass # Interpreter is shutting down
+
+
+ def _run(self):
+
+ last_sleep = time.time()
+
+ while True:
+
+ # Check and reset
+ self._interrupt = False
+ if self._exit:
+ return
+
+ # Sleep
+ now = time.time()
+ if now - last_sleep > 0.1:
+ last_sleep = now
+ time.sleep(0.05)
+
+ try:
+ # Process items from the queue
+ item = self._q.get(True, self.IDLE_TIMEOUT)
+ if item is not None and not item._cancelled:
+ self._processItem(item, True)
+ except Empty:
+ # Queue empty, check items periodically
+ self._idle()
+
+ def _idle(self):
+ # Make a copy of the set if item
+ with self._lock:
+ items = set(self._pathProxies)
+ # Process them
+ for item in items:
+ if self._interrupt:
+ return
+ self._processItem(item)
+
+ def _processItem(self, pathProxy, forceUpdate=False):
+
+ # Slow down a bit
+ if forceUpdate:
+ time.sleep(self.QUEUE_DELAY)
+ else:
+ time.sleep(self.IDLE_DELAY)
+
+ # Process
+ try:
+ pathProxy._process(forceUpdate)
+ except Exception as err:
+ pathProxy.errored.emit(str(err))
+
+ # Process tasks
+ pathProxy._processTasks()
+
+
+ # To overload ...
+
+ def listDirs(self, path):
+ raise NotImplemented() # Should rerurn None if it does not exist
+
+ def listFiles(self, path):
+ raise NotImplemented() # Should rerurn None if it does not exist
+
+ def modified(self, path):
+ raise NotImplemented() # Should rerurn None if it does not exist
+
+ def fileSize(self, path):
+ raise NotImplemented() # Should rerurn None if it does not exist
+
+ def read(self, path):
+ raise NotImplemented() # Should rerurn None if it does not exist
+
+ def write(self, path, bb):
+ raise NotImplemented()
+
+ def rename(self, path):
+ raise NotImplemented()
+
+ def remove(self, path):
+ raise NotImplemented()
+
+ def createDir(self, path):
+ raise NotImplemented()
+
+
+import os
+
+class NativeFSProxy(BaseFSProxy):
+ """ File system proxy for the native file system.
+ """
+
+ def listDirs(self, path):
+ if os.path.isdir(path):
+ pp = [os.path.join(path, p) for p in os.listdir(path)]
+ return [str(p) for p in pp if os.path.isdir(p)]
+
+ def listFiles(self, path):
+ if os.path.isdir(path):
+ pp = [os.path.join(path, p) for p in os.listdir(path)]
+ return [str(p) for p in pp if os.path.isfile(p)]
+
+ def modified(self, path):
+ if os.path.isfile(path):
+ return os.path.getmtime(path)
+
+ def fileSize(self, path):
+ if os.path.isfile(path):
+ return os.path.getsize(path)
+
+ def read(self, path):
+ if os.path.isfile(path):
+ return open(path, 'rb').read()
+
+ def write(self, path, bb):
+ with open(path, 'wb') as f:
+ f.write(bb)
+
+ def rename(self, path1, path2):
+ os.rename(path1, path2)
+
+ def remove(self, path):
+ if os.path.isfile(path):
+ os.remove(path)
+ elif os.path.isdir(path):
+ os.rmdir(path)
+
+ def createDir(self, path):
+ if not os.path.isdir(path):
+ os.makedirs(path)
diff --git a/iep/tools/iepFileBrowser/tasks.py b/iep/tools/iepFileBrowser/tasks.py
new file mode 100644
index 0000000..d32d54f
--- /dev/null
+++ b/iep/tools/iepFileBrowser/tasks.py
@@ -0,0 +1,344 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+
+"""
+Define tasks that can be executed by the file browser.
+These inherit from proxies.Task and implement that specific interface.
+"""
+
+import re
+from . import proxies
+
+
+class SearchTask(proxies.Task):
+ __slots__ = []
+
+ def process(self, proxy, pattern=None, matchCase=False, regExp=False, **rest):
+
+ # Quick test
+ if not pattern:
+ return
+
+ # Get text
+ text = self._getText(proxy)
+ if not text:
+ return
+
+ # Get search text. Deal with case sensitivity
+ searchText = text
+ if not matchCase:
+ searchText = searchText.lower()
+ pattern = pattern.lower()
+
+ # Search indices
+ if regExp:
+ indices = self._getIndicesRegExp(searchText, pattern)
+ else:
+ indices = self._getIndicesNormal1(searchText, pattern)
+
+ # Return as lines
+ if indices:
+ return self._indicesToLines(text, indices)
+ else:
+ return []
+
+
+ def _getText(self, proxy):
+
+ # Init
+ path = proxy.path()
+ fsProxy = proxy._fsProxy
+
+ # Get file size
+ try:
+ size = fsProxy.fileSize(path)
+ except NotImplementedError:
+ pass
+ size = size or 0
+
+ # Search all Python files. Other files need be < xx bytes
+ if path.lower().endswith('.py') or size < 100*1024:
+ pass
+ else:
+ return None
+
+ # Get text
+ bb = fsProxy.read(path)
+ if bb is None:
+ return
+ try:
+ return bb.decode('utf-8')
+ except UnicodeDecodeError:
+ # todo: right now we only do utf-8
+ return None
+
+
+ def _getIndicesRegExp(self, text, pattern):
+ indices = []
+ for match in re.finditer(pattern, text, re.MULTILINE | re.UNICODE):
+ indices.append( match.start() )
+ return indices
+
+
+ def _getIndicesNormal1(self, text, pattern):
+ indices = []
+ i = -1
+ while True:
+ i = text.find(pattern,i+1)
+ if i>=0:
+ indices.append(i)
+ else:
+ break
+ return indices
+
+
+ def _getIndicesNormal2(self, text, pattern):
+ indices = []
+ i = 0
+ for line in text.splitlines(True):
+ i2 = line.find(pattern)
+ if i2>=0:
+ indices.append(i+i2)
+ i += len(line)
+ return indices
+
+
+ def _indicesToLines(self, text, indices):
+
+ # Determine line endings
+ LE = self._determineLineEnding(text)
+
+ # Obtain line and line numbers
+ lines = []
+ for i in indices:
+ # Get linenr and index of the line
+ linenr = text.count(LE, 0, i) + 1
+ i1 = text.rfind(LE, 0, i)
+ i2 = text.find(LE, i)
+ # Get line and strip
+ if i1<0:
+ i1 = 0
+ line = text[i1:i2].strip()[:80]
+ # Store
+ lines.append( (linenr, repr(line)) )
+
+ # Set result
+ return lines
+
+
+ def _determineLineEnding(self, text):
+ """ function to determine quickly whether LF or CR is used
+ as line endings. Windows endings (CRLF) result in LF
+ (you can split lines with either char).
+ """
+ i = 0
+ LE = '\n'
+ while i < len(text):
+ i += 128
+ LF = text.count('\n', 0, i)
+ CR = text.count('\r', 0, i)
+ if LF or CR:
+ if CR > LF:
+ LE = '\r'
+ break
+ return LE
+
+
+
+class PeekTask(proxies.Task):
+ """ To peek the high level structure of a task.
+ """
+ __slots__ = []
+
+ stringStart = re.compile('("""|\'\'\'|"|\')|#')
+ endProgs = {
+ "'": re.compile(r"(^|[^\\])(\\\\)*'"),
+ '"': re.compile(r'(^|[^\\])(\\\\)*"'),
+ "'''": re.compile(r"(^|[^\\])(\\\\)*'''"),
+ '"""': re.compile(r'(^|[^\\])(\\\\)*"""')
+ }
+
+ definition = re.compile(r'^(def|class)\s*(\w*)')
+
+ def process(self, proxy):
+ path = proxy.path()
+ fsProxy = proxy._fsProxy
+
+ # Search only Python files
+ if not path.lower().endswith('.py'):
+ return None
+
+ # Get text
+ bb = fsProxy.read(path)
+ if bb is None:
+ return
+ try:
+ text = bb.decode('utf-8')
+ del bb
+ except UnicodeDecodeError:
+ # todo: right now we only do utf-8
+ return
+
+ # Parse
+ return list(self._parseLines(text.splitlines()))
+
+ def _parseLines(self, lines):
+
+ stringEndProg = None
+
+ linenr = 0
+ for line in lines:
+ linenr += 1
+
+ # If we are in a triple-quoted multi-line string, find the end
+ if stringEndProg == None:
+ pos = 0
+ else:
+ endMatch = stringEndProg.search(line)
+ if endMatch is None:
+ continue
+ else:
+ pos = endMatch.end()
+ stringEndProg = None
+
+ # Now process all tokens
+ while True:
+ match = self.stringStart.search(line, pos)
+
+ if pos == 0: # If we are at the start of the line, see if we have a top-level class or method definition
+ end = len(line) if match is None else match.start()
+ definitionMatch = self.definition.search(line[:end])
+ if definitionMatch is not None:
+ if definitionMatch.group(1) == 'def':
+ yield (linenr, 'def ' + definitionMatch.group(2))
+ else:
+ yield (linenr, 'class ' + definitionMatch.group(2))
+
+ if match is None:
+ break # Go to next line
+ if match.group()=="#":
+ # comment
+ # yield 'C:'
+ break # Go to next line
+ else:
+ endMatch = self.endProgs[match.group()].search(line[match.end():])
+ if endMatch is None:
+ if len(match.group()) == 3 or line.endswith('\\'):
+ # Multi-line string
+ stringEndProg = self.endProgs[match.group()]
+ break
+ else: # incorrect end of single-quoted string
+ break
+
+ # yield 'S:' + (match.group() + line[match.end():][:endMatch.end()])
+ pos = match.end() + endMatch.end()
+
+
+
+class DocstringTask(proxies.Task):
+ __slots__ = []
+
+ def process(self, proxy):
+ path = proxy.path()
+ fsProxy = proxy._fsProxy
+
+ # Search only Python files
+ if not path.lower().endswith('.py'):
+ return None
+
+ # Get text
+ bb = fsProxy.read(path)
+ if bb is None:
+ return
+ try:
+ text = bb.decode('utf-8')
+ del bb
+ except UnicodeDecodeError:
+ # todo: right now we only do utf-8
+ return
+
+ # Find docstring
+ lines = []
+ delim = None # Not started, in progress, done
+ count = 0
+ for line in text.splitlines():
+ count += 1
+ if count > 200:
+ break
+ # Try to find a start
+ if not delim:
+ if line.startswith('"""'):
+ delim = '"""'
+ line = line.lstrip('"')
+ elif line.startswith("'''"):
+ delim = "'''"
+ line = line.lstrip("'")
+ # Try to find an end (may be on the same line as the start)
+ if delim and delim in line:
+ line = line.split(delim, 1)[0]
+ count = 999999999 # Stop; we found the end
+ # Add this line
+ if delim:
+ lines.append(line)
+
+ # Limit number of lines
+ if len(lines) > 16:
+ lines = lines[:16] + ['...']
+ # Make text and strip
+ doc = '\n'.join(lines)
+ doc = doc.strip()
+
+ return doc
+
+
+
+class RenameTask(proxies.Task):
+ __slots__ = []
+
+ def process(self, proxy, newpath=None, removeold=False):
+ path = proxy.path()
+ fsProxy = proxy._fsProxy
+
+ if not newpath:
+ return
+
+ if removeold:
+ # Works for files and dirs
+ fsProxy.rename(path, newpath)
+ # The fsProxy will detect that this file is now deleted
+ else:
+ # Work only for files: duplicate
+ # Read bytes
+ bb = fsProxy.read(path)
+ if bb is None:
+ return
+ # write back with new name
+ fsProxy.write(newpath, bb)
+
+
+class CreateTask(proxies.Task):
+ __slots__ = []
+
+ def process(self, proxy, newpath=None, file=True):
+ path = proxy.path()
+ fsProxy = proxy._fsProxy
+
+ if not newpath:
+ return
+
+ if file:
+ fsProxy.write(newpath, b'')
+ else:
+ fsProxy.createDir(newpath)
+
+
+class RemoveTask(proxies.Task):
+ __slots__ = []
+
+ def process(self, proxy):
+ path = proxy.path()
+ fsProxy = proxy._fsProxy
+
+ # Remove
+ fsProxy.remove(path)
+ # The fsProxy will detect that this file is now deleted
diff --git a/iep/tools/iepFileBrowser/tree.py b/iep/tools/iepFileBrowser/tree.py
new file mode 100644
index 0000000..91a01eb
--- /dev/null
+++ b/iep/tools/iepFileBrowser/tree.py
@@ -0,0 +1,949 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+
+"""
+Defines the tree widget to display the contents of a selected directory.
+"""
+
+
+import os
+import sys
+import time
+import subprocess
+import fnmatch
+from pyzolib.path import Path
+
+from . import QtCore, QtGui
+import iep
+from iep import translate
+
+from . import tasks
+from .utils import hasHiddenAttribute, getMounts
+
+# How to name the list of drives/mounts (i.e. 'my computer')
+MOUNTS = 'drives'
+
+
+# Create icon provider
+iconprovider = QtGui.QFileIconProvider()
+
+
+def addIconOverlays(icon, *overlays, offset=(8,0), overlay_offset=(0,0)):
+ """ Create an overlay for an icon.
+ """
+ # Create painter and pixmap
+ pm0 = QtGui.QPixmap(16+offset[0],16)#icon.pixmap(16+offset[0],16+offset[1])
+ pm0.fill(QtGui.QColor(0,0,0,0))
+ painter = QtGui.QPainter()
+ painter.begin(pm0)
+ # Draw original icon
+ painter.drawPixmap(offset[0], offset[1], icon.pixmap(16,16))
+ # Draw overlays
+ for overlay in overlays:
+ pm1 = overlay.pixmap(16,16)
+ painter.drawPixmap(overlay_offset[0],overlay_offset[1], pm1)
+ # Finish
+ painter.end()
+ # Done (return resulting icon)
+ return QtGui.QIcon(pm0)
+
+
+
+def _filterFileByName(basename, filter):
+
+ # Get the current filter spec and split it into separate filters
+ filters = filter.replace(',', ' ').split()
+ filters = [f for f in filters if f]
+
+ # Init default; return True if there are no filters
+ default = True
+
+ for filter in filters:
+ # Process filters in order
+ if filter.startswith('!'):
+ # If the filename matches a filter starting with !, hide it
+ if fnmatch.fnmatch(basename,filter[1:]):
+ return False
+ default = True
+ else:
+ # If the file name matches a filter not starting with!, show it
+ if fnmatch.fnmatch(basename, filter):
+ return True
+ default = False
+
+ return default
+
+
+def createMounts(browser, tree):
+ """ Create items for all known mount points (i.e. drives on Windows).
+ """
+ fsProxy = browser._fsProxy
+
+ mountPoints = getMounts()
+ mountPoints.sort(key=lambda x: x.lower())
+ for entry in mountPoints:
+ entry = Path(entry)
+ item = DriveItem(tree, fsProxy.dir(entry))
+
+
+def createItemsFun(browser, parent):
+ """ Create the tree widget items for a Tree or DirItem.
+ """
+
+ # Get file system proxy and dir proxy for which we shall create items
+ fsProxy = browser._fsProxy
+ dirProxy = parent._proxy
+
+ # Get meta information from browser
+ nameFilter = browser.nameFilter()
+ searchFilter = browser.searchFilter()
+ searchFilter = searchFilter if searchFilter['pattern'] else None
+ expandedDirs = browser.expandedDirs
+ starredDirs = browser.starredDirs
+
+
+ # Filter the contents of this folder
+ try:
+ dirs = []
+ for entry in dirProxy.dirs():
+ entry = Path(entry)
+ if entry.basename.startswith('.'):
+ continue # Skip hidden files
+ if hasHiddenAttribute(entry):
+ continue # Skip hidden files on Windows
+ if entry.basename == '__pycache__':
+ continue
+ dirs.append(entry)
+
+ files = []
+ for entry in dirProxy.files():
+ entry = Path(entry)
+ if entry.basename.startswith('.'):
+ continue # Skip hidden files
+ if hasHiddenAttribute(entry):
+ continue # Skip hidden files on Windows
+ if not _filterFileByName(entry.basename, nameFilter):
+ continue
+ files.append(entry)
+
+ except (OSError, IOError) as err:
+ ErrorItem(parent, str(err))
+ return
+
+ # Sort dirs (case insensitive)
+ dirs.sort(key=lambda x: x.lower())
+
+ # Sort files
+ # (first by name, then by type, so finally they are by type, then name)
+ files.sort(key=lambda x: x.lower())
+ files.sort(key=lambda x: x.ext.lower())
+
+
+ if not searchFilter:
+
+ # Create dirs
+ for path in dirs:
+ starred = path.normcase() in starredDirs
+ item = DirItem(parent, fsProxy.dir(path), starred)
+ # Set hidden, we can safely expand programmatically when hidden
+ item.setHidden(True)
+ # Set expanded and visibility
+ if path.normcase() in expandedDirs:
+ item.setExpanded(True)
+ item.setHidden(False)
+
+ # Create files
+ for path in files:
+ item = FileItem(parent, fsProxy.file(path))
+
+ else:
+
+ # If searching, inject everything in the tree
+ # And every item is hidden at first
+ parent = browser._tree
+ if parent.topLevelItemCount():
+ searchInfoItem = parent.topLevelItem(0)
+ else:
+ searchInfoItem = SearchInfoItem(parent)
+
+ # Increase number of found files
+ searchInfoItem.increaseTotal(len(files))
+
+ # Create temporary file items
+ for path in files:
+ item = TemporaryFileItem(parent, fsProxy.file(path))
+ item.search(searchFilter)
+
+ # Create temporary dir items
+ if searchFilter['subDirs']:
+ for path in dirs:
+ item = TemporaryDirItem(parent, fsProxy.dir(path))
+
+
+ # Return number of files added
+ return len(dirs) + len(files)
+
+
+
+class BrowserItem(QtGui.QTreeWidgetItem):
+ """ Abstract item in the tree widget.
+ """
+
+ def __init__(self, parent, pathProxy, *args):
+ self._proxy = pathProxy
+ QtGui.QTreeWidgetItem.__init__(self, parent, [], *args)
+ # Set pathname to show, and icon
+ strippedParentPath = parent.path().rstrip('/\\')
+ if self.path().startswith(strippedParentPath):
+ basename = self.path()[len(strippedParentPath)+1:]
+ else:
+ basename = self.path() # For mount points
+ self.setText(0, basename)
+ self.setFileIcon()
+ # Setup interface with proxy
+ self._proxy.changed.connect(self.onChanged)
+ self._proxy.deleted.connect(self.onDeleted)
+ self._proxy.errored.connect(self.onErrored)
+ self._proxy.taskFinished.connect(self.onTaskFinished)
+
+ def path(self):
+ return self._proxy.path()
+
+ def _createDummyItem(self, txt):
+ ErrorItem(self, txt)
+ #QtGui.QTreeWidgetItem(self, [txt])
+
+ def onDestroyed(self):
+ self._proxy.cancel()
+
+ def clear(self):
+ """ Clear method that calls onDestroyed on its children.
+ """
+ for i in reversed(range(self.childCount())):
+ item = self.child(i)
+ if hasattr(item, 'onDestroyed'):
+ item.onDestroyed()
+ self.removeChild(item)
+
+
+ # To overload ...
+
+ def onChanged(self):
+ pass
+
+ def onDeleted(self):
+ pass
+
+ def onErrored(self, err):
+ self.clear()
+ self._createDummyItem('Error: ' + err)
+
+ def onTaskFinished(self, task):
+ # Getting the result raises exception if an error occured.
+ # Which is what we want; so it is visible in the logger shell
+ task.result()
+
+
+
+class DriveItem(BrowserItem):
+ """ Tree widget item for directories.
+ """
+
+ def __init__(self, parent, pathProxy):
+ BrowserItem.__init__(self, parent, pathProxy)
+ # Item is not expandable
+
+ def setFileIcon(self):
+ # Use folder icon
+ self.setIcon(0, iep.icons.drive)
+
+ def onActivated(self):
+ self.treeWidget().setPath(self.path())
+
+
+
+class DirItem(BrowserItem):
+ """ Tree widget item for directories.
+ """
+
+ def __init__(self, parent, pathProxy, starred=False):
+ self._starred = starred
+ BrowserItem.__init__(self, parent, pathProxy)
+
+ # Create dummy item so that the dir is expandable
+ self._createDummyItem('Loading contents ...')
+
+ def setFileIcon(self):
+ # Use folder icon
+ icon = iconprovider.icon(iconprovider.Folder)
+ overlays = []
+ if self._starred:
+ overlays.append(iep.icons.bullet_yellow)
+ icon = addIconOverlays(icon, *overlays, offset=(8,0), overlay_offset=(-4,0))
+ self.setIcon(0, icon)
+
+ def onActivated(self):
+ self.treeWidget().setPath(self.path())
+
+ def onExpanded(self):
+ # Update list of expanded dirs
+ expandedDirs = self.treeWidget().parent().expandedDirs
+ p = self.path().normcase() # Normalize case!
+ if p not in expandedDirs:
+ expandedDirs.append(p)
+ # Keep track of changes in our contents
+ self._proxy.track()
+ self._proxy.push()
+
+ def onCollapsed(self):
+ # Update list of expanded dirs
+ expandedDirs = self.treeWidget().parent().expandedDirs
+ p = self.path().normcase() # Normalize case!
+ while p in expandedDirs:
+ expandedDirs.remove(p)
+ # Stop tracking changes in our contents
+ self._proxy.cancel()
+ # Clear contents and create a single placeholder item
+ self.clear()
+ self._createDummyItem('Loading contents ...')
+
+
+ # No need to implement onDeleted: the parent will get a changed event.
+
+ def onChanged(self):
+ """ Called when a change in the contents has occured, or when
+ we just activated the proxy. Update our items!
+ """
+ if not self.isExpanded():
+ return
+ tree = self.treeWidget()
+ tree.createItems(self)
+
+
+
+class FileItem(BrowserItem):
+ """ Tree widget item for files.
+ """
+
+ def __init__(self, parent, pathProxy, mode='normal'):
+ BrowserItem.__init__(self, parent, pathProxy)
+ self._mode = mode
+ self._timeSinceLastDocString = 0
+
+ if self._mode=='normal' and self.path().lower().endswith('.py'):
+ self._createDummyItem('Loading high level structure ...')
+
+ def setFileIcon(self):
+ # Create dummy file in iep user dir
+ dummy_filename = Path(iep.appDataDir) / 'dummyFiles' / 'dummy' + self.path().ext
+ # Create file?
+ if not dummy_filename.isfile:
+ if not dummy_filename.dirname.isdir:
+ os.makedirs(dummy_filename.dirname)
+ f = open(dummy_filename, 'wb')
+ f.close()
+ # Use that file
+ if sys.platform.startswith('linux') and \
+ not QtCore.__file__.startswith('/usr/'):
+ icon = iconprovider.icon(iconprovider.File)
+ else:
+ icon = iconprovider.icon(QtCore.QFileInfo(dummy_filename))
+ icon = addIconOverlays(icon)
+ self.setIcon(0, icon)
+
+ def searchContents(self, needle, **kwargs):
+ self.setHidden(True)
+ self._proxy.setSearch(needle, **kwargs)
+
+ def onActivated(self):
+ # todo: someday we should be able to simply pass the proxy object to the editors
+ # so that we can open files on any file system
+ path = self.path()
+ if path.ext not in ['.pyc','.pyo','.png','.jpg','.ico']:
+ # Load and get editor
+ fileItem = iep.editors.loadFile(path)
+ editor = fileItem._editor
+ # Give focus
+ iep.editors.getCurrentEditor().setFocus()
+
+ def onExpanded(self):
+ if self._mode == 'normal':
+ # Create task to retrieve high level structure
+ if self.path().lower().endswith('.py'):
+ self._proxy.pushTask(tasks.DocstringTask())
+ self._proxy.pushTask(tasks.PeekTask())
+
+ def onCollapsed(self):
+ if self._mode == 'normal':
+ self.clear()
+ if self.path().lower().endswith('.py'):
+ self._createDummyItem('Loading high level structure ...')
+
+# def onClicked(self):
+# # Limit sending events to prevent flicker when double clicking
+# if time.time() - self._timeSinceLastDocString < 0.5:
+# return
+# self._timeSinceLastDocString = time.time()
+# # Create task
+# if self.path().lower().endswith('.py'):
+# self._proxy.pushTask(tasks.DocstringTask())
+
+ def onChanged(self):
+ pass
+
+ def onTaskFinished(self, task):
+
+ if isinstance(task, tasks.DocstringTask):
+ result = task.result()
+ self.clear() # Docstring task is done *before* peek task
+ if result:
+ DocstringItem(self, result)
+# if isinstance(task, tasks.DocstringTask):
+# result = task.result()
+# if result:
+# #self.setToolTip(0, result)
+# # Show tooltip *now* if mouse is still over this item
+# tree = self.treeWidget()
+# pos = tree.mapFromGlobal(QtGui.QCursor.pos())
+# if tree.itemAt(pos) is self:
+# QtGui.QToolTip.showText(QtGui.QCursor.pos(), result)
+ elif isinstance(task, tasks.PeekTask):
+ result = task.result()
+ #self.clear() # Cleared when docstring task result is received
+ if result:
+ for r in result:
+ SubFileItem(self, *r)
+ else:
+ self._createDummyItem('No classes or functions found.')
+ else:
+ BrowserItem.onTaskFinished(self, task)
+
+
+
+class SubFileItem(QtGui.QTreeWidgetItem):
+ """ Tree widget item for search items.
+ """
+ def __init__(self, parent, linenr, text, showlinenr=False):
+ QtGui.QTreeWidgetItem.__init__(self, parent)
+ self._linenr = linenr
+ if showlinenr:
+ self.setText(0, 'Line %i: %s' % (linenr, text))
+ else:
+ self.setText(0, text)
+
+ def path(self):
+ return self.parent().path()
+
+ def onActivated(self):
+ path = self.path()
+ if path.ext not in ['.pyc','.pyo','.png','.jpg','.ico']:
+ # Load and get editor
+ fileItem = iep.editors.loadFile(path)
+ editor = fileItem._editor
+ # Goto line
+ editor.gotoLine(self._linenr)
+ # Give focus
+ iep.editors.getCurrentEditor().setFocus()
+
+
+
+class DocstringItem(QtGui.QTreeWidgetItem):
+ """ Tree widget item for docstring placeholder items.
+ """
+
+ def __init__(self, parent, docstring):
+ QtGui.QTreeWidgetItem.__init__(self, parent)
+ self._docstring = docstring
+ # Get one-line version of docstring
+ shortText = self._docstring.split('\n',1)[0].strip()
+ if len(shortText) < len(self._docstring):
+ shortText += '...'
+ # Set short version now
+ self.setText(0, 'doc: '+shortText)
+ # Long version is the tooltip
+ self.setToolTip(0, docstring)
+
+ def path(self):
+ return self.parent().path()
+
+ def onClicked(self):
+ tree = self.treeWidget()
+ pos = tree.mapFromGlobal(QtGui.QCursor.pos())
+ if tree.itemAt(pos) is self:
+ QtGui.QToolTip.showText(QtGui.QCursor.pos(), self._docstring)
+
+
+
+class ErrorItem(QtGui.QTreeWidgetItem):
+ """ Tree widget item for errors and information.
+ """
+ def __init__(self, parent, info):
+ QtGui.QTreeWidgetItem.__init__(self, parent)
+ self.setText(0, info)
+ self.setFlags(QtCore.Qt.NoItemFlags)
+ font = self.font(0)
+ font.setItalic(True)
+ self.setFont(0, font)
+
+
+class SearchInfoItem(ErrorItem):
+ """ Tree widget item that displays info on the search.
+ """
+ def __init__(self, parent):
+ ErrorItem.__init__(self, parent, 'Searching ...')
+ self._totalCount = 0
+ self._checkCount = 0
+ self._hitCount = 0
+
+ def increaseTotal(self, c):
+ self._totalCount += c
+ self.updateCounts()
+
+ def addFile(self, hit):
+ self._checkCount += 1
+ if hit:
+ self._hitCount += 1
+ # Update appearance
+ self.updateCounts()
+
+ def updateCounts(self):
+ counts = self._checkCount, self._totalCount, self._hitCount
+ self.setText(0, 'Searched {}/{} files: {} hits'.format(*counts))
+
+
+
+class TemporaryDirItem:
+ """ Created when searching. This object posts a requests for its contents
+ which are then processed, after which this object disbands itself.
+ """
+ __slots__ = ['_tree', '_proxy', '__weakref__']
+
+ def __init__(self, tree, pathProxy):
+ self._tree = tree
+ self._proxy = pathProxy
+ self._proxy.changed.connect(self.onChanged)
+ # Process asap, but do not track
+ self._proxy.push()
+ # Store ourself
+ tree._temporaryItems.add(self)
+
+ def clear(self):
+ pass # tree.createItems() calls this ...
+
+ def onChanged(self):
+ # Disband
+ self._tree._temporaryItems.discard(self)
+ # Process contents
+ self._tree.createItems(self)
+
+
+
+class TemporaryFileItem:
+ """ Created when searching. This object posts a requests to search
+ its contents which are then processed, after which this object
+ disbands itself, passin the proxy object to a real FileItem if the
+ search had results.
+ """
+ __slots__ = ['_tree', '_proxy', '__weakref__']
+
+ def __init__(self, tree, pathProxy):
+ self._tree = tree
+ self._proxy = pathProxy
+ self._proxy.taskFinished.connect(self.onSearchResult)
+ # Store ourself
+ tree._temporaryItems.add(self)
+
+ def search(self, searchFilter):
+ self._proxy.pushTask(tasks.SearchTask(**searchFilter))
+
+ def onSearchResult(self, task):
+ # Disband now
+ self._tree._temporaryItems.discard(self)
+
+ # Get result. May raise an error
+ result = task.result()
+ # Process contents
+ if result:
+ item = FileItem(self._tree, self._proxy, 'search') # Search mode
+ for r in result:
+ SubFileItem(item, *r, showlinenr=True)
+ # Update counter
+ searchInfoItem = self._tree.topLevelItem(0)
+ if isinstance(searchInfoItem, SearchInfoItem):
+ searchInfoItem.addFile(bool(result))
+
+
+
+class Tree(QtGui.QTreeWidget):
+ """ Representation of the tree view.
+ Instances of this class are responsible for keeping the contents
+ up-to-date. The Item classes above are dumb objects.
+ """
+
+ dirChanged = QtCore.Signal(Path) # Emitted when user goes into a subdir
+
+ def __init__(self, parent):
+ QtGui.QTreeWidget.__init__(self, parent)
+
+ # Initialize
+ self.setMinimumWidth(150)
+ self.setMinimumHeight(150)
+ #
+ self.setColumnCount(1)
+ self.setHeaderHidden(True)
+ self.setIconSize(QtCore.QSize(24,16))
+
+ # Connecy signals
+ self.itemExpanded.connect(self.onItemExpanded)
+ self.itemCollapsed.connect(self.onItemCollapsed)
+ self.itemClicked.connect(self.onItemClicked)
+ self.itemActivated.connect(self.onItemActivated)
+
+ # Variables for restoring the view after updating
+ self._selectedPath = '' # To restore a selection after updating
+ self._selectedScrolling = 0
+
+ # Set of temporary items
+ self._temporaryItems = set()
+
+ # Define context menu
+ self.setContextMenuPolicy(QtCore.Qt.CustomContextMenu)
+ self.customContextMenuRequested.connect(self.contextMenuTriggered)
+
+ # Initialize proxy (this is where the path is stored)
+ self._proxy = None
+
+
+ def path(self):
+ """ Get the current path shown by the treeview.
+ """
+ return self._proxy.path()
+
+
+ def setPath(self, path):
+ """ Set the current path shown by the treeview.
+ """
+ # Close old proxy
+ if self._proxy is not None:
+ self._proxy.cancel()
+ self._proxy.changed.disconnect(self.onChanged)
+ self._proxy.deleted.disconnect(self.onDeleted)
+ self._proxy.errored.disconnect(self.onErrored)
+ self.destroyed.disconnect(self._proxy.cancel)
+ # Create new proxy
+ if True:
+ self._proxy = self.parent()._fsProxy.dir(path)
+ self._proxy.changed.connect(self.onChanged)
+ self._proxy.deleted.connect(self.onDeleted)
+ self._proxy.errored.connect(self.onErrored)
+ self.destroyed.connect(self._proxy.cancel)
+ # Activate the proxy, we'll get a call at onChanged() asap.
+ if path.lower() == MOUNTS.lower():
+ self.clear()
+ createMounts(self.parent(), self)
+ else:
+ self._proxy.track()
+ self._proxy.push()
+ # Store dir in config
+ self.parent().config.path = path
+ # Signal that the dir has changed
+ # Note that our contents may not be visible yet.
+ self.dirChanged.emit(self.path())
+
+
+ def setPathUp(self):
+ """ Go one directory up.
+ """
+ newPath = self.path().dirname
+
+ if newPath == self.path():
+ self.setPath(Path(MOUNTS))
+ else:
+ self.setPath(newPath)
+
+
+ def clear(self):
+ """ Overload the clear method to remove the items in a nice
+ way, alowing the pathProxy instance to be closed correctly.
+ """
+ # Clear temporary (invisible) items
+ for item in self._temporaryItems:
+ item._proxy.cancel()
+ self._temporaryItems.clear()
+ # Clear visible items
+ for i in reversed(range(self.topLevelItemCount())):
+ item = self.topLevelItem(i)
+ if hasattr(item, 'clear'):
+ item.clear()
+ if hasattr(item, 'onDestroyed'):
+ item.onDestroyed()
+ QtGui.QTreeWidget.clear(self)
+
+
+ def mouseDoubleClickEvent(self, event):
+ """ Bypass expanding an item when double-cliking it.
+ Only activate the item.
+ """
+ item = self.itemAt(event.x(), event.y())
+ if item is not None:
+ self.onItemActivated(item)
+
+
+ def onChanged(self):
+ """ Called when our contents change or when we just changed directories.
+ """
+ self.createItems(self)
+
+
+ def createItems(self, parent):
+ """ High level method to create the items of the tree or a DirItem.
+ This method will handle the restoring of state etc.
+ The actual filtering of entries and creation of tree widget items
+ is done in the createItemsFun() function.
+ """
+ # Store state and clear
+ self._storeSelectionState()
+ parent.clear()
+ # Create sub items
+ count = createItemsFun(self.parent(), parent)
+ if not count and isinstance(parent, QtGui.QTreeWidgetItem):
+ ErrorItem(parent, 'Empty directory')
+ # Restore state
+ self._restoreSelectionState()
+
+
+ def onErrored(self, err='...'):
+ self.clear()
+ ErrorItem(self, 'Error: ' + err)
+
+ def onDeleted(self):
+ self.setPathUp()
+
+ def onItemExpanded(self, item):
+ if hasattr(item, 'onExpanded'):
+ item.onExpanded()
+
+ def onItemCollapsed(self, item):
+ if hasattr(item, 'onCollapsed'):
+ item.onCollapsed()
+
+ def onItemClicked(self, item):
+ if hasattr(item, 'onClicked'):
+ item.onClicked()
+
+ def onItemActivated(self, item):
+ """ When an item is "activated", make that the new directory,
+ or open that file.
+ """
+ if hasattr(item, 'onActivated'):
+ item.onActivated()
+
+
+ def _storeSelectionState(self):
+ # Store selection
+ items = self.selectedItems()
+ self._selectedPath = items[0].path() if items else ''
+ # Store scrolling
+ self._selectedScrolling = self.verticalScrollBar().value()
+
+
+ def _restoreSelectionState(self):
+ # First select the first item
+ # (otherwise the scrolling wont work for some reason)
+ if self.topLevelItemCount():
+ self.setCurrentItem(self.topLevelItem(0))
+ # Restore selection
+ if self._selectedPath:
+ items = self.findItems(self._selectedPath.basename, QtCore.Qt.MatchExactly, 0)
+ items = [item for item in items if item.path() == self._selectedPath]
+ if items:
+ self.setCurrentItem(items[0])
+ # Restore scrolling
+ self.verticalScrollBar().setValue(self._selectedScrolling)
+ self.verticalScrollBar().setValue(self._selectedScrolling)
+
+
+ def contextMenuTriggered(self, p):
+ """ Called when context menu is clicked """
+ # Get item that was clicked on
+ item = self.itemAt(p)
+ if item is None:
+ item = self
+
+ # Create and show menu
+ if isinstance(item, (Tree, FileItem, DirItem)):
+ menu = PopupMenu(self, item)
+ menu.popup(self.mapToGlobal(p+QtCore.QPoint(3,3)))
+
+
+
+class PopupMenu(iep.iepcore.menu.Menu):
+ def __init__(self, parent, item):
+ self._item = item
+ iep.iepcore.menu.Menu.__init__(self, parent, " ")
+
+ def build(self):
+
+ isplat = sys.platform.startswith
+
+ # The star object
+ if isinstance(self._item, DirItem):
+ if self._item._starred:
+ self.addItem(translate("filebrowser", "Unstar this directory"), None, self._star)
+ else:
+ self.addItem(translate("filebrowser", "Star this directory"), None, self._star)
+ self.addSeparator()
+
+ # The normal "open" function
+ if isinstance(self._item, FileItem):
+ self.addItem(translate("filebrowser", "Open"), None, self._item.onActivated)
+
+ # Create items for open and copy path
+ if isinstance(self._item, (FileItem, DirItem)):
+ if isplat('win') or isplat('darwin') or isplat('linux'):
+ self.addItem(translate("filebrowser", "Open outside IEP"),
+ None, self._openOutsideIep)
+ if isplat('darwin'):
+ self.addItem(translate("filebrowser", "Reveal in Finder"),
+ None, self._showInFinder)
+ if True:
+ self.addItem(translate("filebrowser", "Copy path"),
+ None, self._copyPath)
+
+
+ self.addSeparator()
+
+ # Import data wizard
+ if isinstance(self._item, FileItem):
+ self.addItem(translate("filebrowser", "Import data..."),
+ None, self._importData)
+
+ self.addSeparator()
+
+
+ # Create items for file management
+ if isinstance(self._item, FileItem):
+ self.addItem(translate("filebrowser", "Rename"), None, self.onRename)
+ self.addItem(translate("filebrowser", "Delete"), None, self.onDelete)
+ #self.addItem(translate("filebrowser", "Duplicate"), None, self.onDuplicate)
+ if isinstance(self._item, (Tree, DirItem)):
+ self.addItem(translate("filebrowser", "Create new file"), None, self.onCreateFile)
+ self.addItem(translate("filebrowser", "Create new directory"), None, self.onCreateDir)
+ if isinstance(self._item, DirItem):
+ self.addSeparator()
+ self.addItem(translate("filebrowser", "Rename"), None, self.onRename)
+ self.addItem(translate("filebrowser", "Delete"), None, self.onDelete)
+
+
+ def _star(self):
+ # Prepare
+ browser = self.parent().parent()
+ path = self._item.path()
+ if self._item._starred:
+ browser.removeStarredDir(path)
+ else:
+ browser.addStarredDir(path)
+ # Refresh
+ self.parent().setPath(self.parent().path())
+
+ def _openOutsideIep(self):
+ if sys.platform.startswith('darwin'):
+ subprocess.call(('open', self._item.path()))
+ elif sys.platform.startswith('win'):
+ subprocess.call(('start', self._item.path()), shell=True)
+ elif sys.platform.startswith('linux'):
+ # xdg-open is available on all Freedesktop.org compliant distros
+ # http://superuser.com/questions/38984/linux-equivalent-command-for-open-command-on-mac-windows
+ subprocess.call(('xdg-open', self._item.path()))
+
+ def _showInFinder(self):
+ subprocess.call(('open', '-R', self._item.path()))
+
+ def _copyPath(self):
+ QtGui.qApp.clipboard().setText(self._item.path())
+
+ def _importData(self):
+ browser = self.parent().parent()
+ wizard = browser.getImportWizard()
+ wizard.open(self._item.path())
+
+ def onDuplicate(self):
+ return self._duplicateOrRename(False)
+
+ def onRename(self):
+ return self._duplicateOrRename(True)
+
+ def onCreateFile(self):
+ self._createDirOrFile(True)
+
+ def onCreateDir(self):
+ self._createDirOrFile(False)
+
+
+ def _createDirOrFile(self, file=True):
+
+ # Get title and label
+ if file:
+ title = translate("filebrowser", "Create new file")
+ label = translate("filebrowser", "Give the new name for the file")
+ else:
+ title = translate("filebrowser", "Create new directory")
+ label = translate("filebrowser", "Give the name for the new directory")
+
+ # Ask for new filename
+ s = QtGui.QInputDialog.getText(self.parent(), title,
+ label + ':\n%s' % self._item.path(),
+ QtGui.QLineEdit.Normal,
+ 'new name'
+ )
+ if isinstance(s, tuple):
+ s = s[0] if s[1] else ''
+
+ # Push rename task
+ if s:
+ newpath = os.path.join(self._item.path(), s)
+ task = tasks.CreateTask(newpath=newpath, file=file)
+ self._item._proxy.pushTask(task)
+
+
+ def _duplicateOrRename(self, rename):
+
+ # Get dirname and filename
+ dirname, filename = os.path.split(self._item.path())
+
+ # Get title and label
+ if rename:
+ title = translate("filebrowser", "Rename")
+ label = translate("filebrowser", "Give the new name for the file")
+ else:
+ title = translate("filebrowser", "Duplicate")
+ label = translate("filebrowser", "Give the name for the new file")
+ filename = 'Copy of ' + filename
+
+ # Ask for new filename
+ s = QtGui.QInputDialog.getText(self.parent(), title,
+ label + ':\n%s' % self._item.path(),
+ QtGui.QLineEdit.Normal,
+ filename
+ )
+ if isinstance(s, tuple):
+ s = s[0] if s[1] else ''
+
+ # Push rename task
+ if s:
+ newpath = os.path.join(dirname, s)
+ task = tasks.RenameTask(newpath=newpath, removeold=rename)
+ self._item._proxy.pushTask(task)
+
+
+ def onDelete(self):
+ # Ask for new filename
+ b = QtGui.QMessageBox.question(self.parent(),
+ translate("filebrowser", "Delete"),
+ translate("filebrowser", "Are you sure that you want to delete") +
+ ':\n%s' % self._item.path(),
+ QtGui.QMessageBox.Yes | QtGui.QMessageBox.Cancel,
+ )
+ # Push delete task
+ if b is QtGui.QMessageBox.Yes:
+ self._item._proxy.pushTask(tasks.RemoveTask())
diff --git a/iep/tools/iepFileBrowser/utils.py b/iep/tools/iepFileBrowser/utils.py
new file mode 100644
index 0000000..89fa1f4
--- /dev/null
+++ b/iep/tools/iepFileBrowser/utils.py
@@ -0,0 +1,39 @@
+
+import os
+import ctypes
+import sys
+import string
+
+# todo: also include available remote file systems
+def getMounts():
+ if sys.platform.startswith('win'):
+ return getDrivesWin()
+ elif sys.platform.startswith('darwin'):
+ return '/'
+ elif sys.platform.startswith('linux'):
+ return ['/'] + [os.path.join('/media', e) for e in os.listdir('/media')]
+ else:
+ return '/'
+
+
+def getDrivesWin():
+ drives = []
+ bitmask = ctypes.windll.kernel32.GetLogicalDrives()
+ for letter in string.ascii_uppercase:
+ if bitmask & 1:
+ drives.append(letter)
+ bitmask >>= 1
+ return [drive+':\\' for drive in drives]
+
+
+def hasHiddenAttribute(path):
+ """ Test (on Windows) whether a file should be hidden.
+ """
+ if not sys.platform.startswith('win'):
+ return False
+ try:
+ attrs = ctypes.windll.kernel32.GetFileAttributesW(path)
+ assert attrs != -1
+ return bool(attrs & 2)
+ except (AttributeError, AssertionError):
+ result = False
diff --git a/iep/tools/iepInteractiveHelp.py b/iep/tools/iepInteractiveHelp.py
new file mode 100644
index 0000000..ccad280
--- /dev/null
+++ b/iep/tools/iepInteractiveHelp.py
@@ -0,0 +1,375 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+import sys, os, time, re
+from pyzolib.qt import QtCore, QtGui
+import iep
+
+tool_name = "Interactive help"
+tool_summary = "Shows help on an object when using up/down in autocomplete."
+
+#
+htmlWrap = """<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.0//EN"
+"http://www.w3.org/TR/REC-html40/strict.dtd">
+<html>
+<head>
+<style type="text/css">
+</style>
+</head>
+<body style=" font-family:'Sans Serif'; font-size:{}pt; font-weight:400; font-style:normal;">
+{}
+</body>
+</html>
+"""
+
+# Define title text (font-size percentage does not seem to work sadly.)
+def get_title_text(objectName, h_class='', h_repr=''):
+ title_text = "<p style='background-color:#def;'>"
+ title_text += "<b>Object:</b> {}".format(objectName)
+ if h_class:
+ title_text += ", <b>class:</b> {}".format(h_class)
+ if h_repr:
+ if len(h_repr) > 40:
+ h_repr = h_repr[:37] + '...'
+ title_text += ", <b>repr:</b> {}".format(h_repr)
+
+ # Finish
+ title_text += '</p>\n'
+ return title_text
+
+initText = """
+Help information is queried from the current shell
+when moving up/down in the autocompletion list
+and when double clicking on a name.
+"""
+
+
+class IepInteractiveHelp(QtGui.QWidget):
+
+ def __init__(self, parent):
+ QtGui.QWidget.__init__(self, parent)
+
+
+ # Create text field, checkbox, and button
+ self._text = QtGui.QLineEdit(self)
+ self._printBut = QtGui.QPushButton("Print", self)
+
+ # Create options button
+ self._options = QtGui.QToolButton(self)
+ self._options.setIcon(iep.icons.wrench)
+ self._options.setIconSize(QtCore.QSize(16,16))
+ self._options.setPopupMode(self._options.InstantPopup)
+ self._options.setToolButtonStyle(QtCore.Qt.ToolButtonTextBesideIcon)
+
+ # Create options menu
+ self._options._menu = QtGui.QMenu()
+ self._options.setMenu(self._options._menu)
+
+ # Create browser
+ self._browser = QtGui.QTextBrowser(self)
+ self._browser_text = initText
+
+ # Create two sizers
+ self._sizer1 = QtGui.QVBoxLayout(self)
+ self._sizer2 = QtGui.QHBoxLayout()
+
+ # Put the elements together
+ self._sizer2.addWidget(self._text, 4)
+ self._sizer2.addWidget(self._printBut, 0)
+ self._sizer2.addWidget(self._options, 2)
+ #
+ self._sizer1.addLayout(self._sizer2, 0)
+ self._sizer1.addWidget(self._browser, 1)
+ #
+ self._sizer1.setSpacing(2)
+ self._sizer1.setContentsMargins(4,4,4,4)
+ self.setLayout(self._sizer1)
+
+ # Set config
+ toolId = self.__class__.__name__.lower()
+ self._config = config = iep.config.tools[toolId]
+ #
+ if not hasattr(config, 'smartNewlines'):
+ config.smartNewlines = True
+ if not hasattr(config, 'fontSize'):
+ if sys.platform == 'darwin':
+ config.fontSize = 12
+ else:
+ config.fontSize = 10
+
+ # Create callbacks
+ self._text.returnPressed.connect(self.queryDoc)
+ self._printBut.clicked.connect(self.printDoc)
+ #
+ self._options.pressed.connect(self.onOptionsPress)
+ self._options._menu.triggered.connect(self.onOptionMenuTiggered)
+
+ # Start
+ self.setText() # Set default text
+ self.onOptionsPress() # Fill menu
+
+
+ def onOptionsPress(self):
+ """ Create the menu for the button, Do each time to make sure
+ the checks are right. """
+
+ # Get menu
+ menu = self._options._menu
+ menu.clear()
+
+ # Add smart format option
+ action = menu.addAction('Smart format')
+ action.setCheckable(True)
+ action.setChecked(bool(self._config.smartNewlines))
+
+ # Add delimiter
+ menu.addSeparator()
+
+ # Add font size options
+ currentSize = self._config.fontSize
+ for i in range(8,15):
+ action = menu.addAction('font-size: %ipx' % i)
+ action.setCheckable(True)
+ action.setChecked(i==currentSize)
+
+
+ def onOptionMenuTiggered(self, action):
+ """ The user decides what to show in the structure. """
+
+ # Get text
+ text = action.text().lower()
+
+ if 'smart' in text:
+ # Swap value
+ current = bool(self._config.smartNewlines)
+ self._config.smartNewlines = not current
+ # Update
+ self.queryDoc()
+
+ elif 'size' in text:
+ # Get font size
+ size = int( text.split(':',1)[1][:-2] )
+ # Update
+ self._config.fontSize = size
+ # Update
+ self.setText()
+
+
+ def setText(self, text=None):
+
+ # (Re)store text
+ if text is None:
+ text = self._browser_text
+ else:
+ self._browser_text = text
+
+ # Set text with html header
+ size = self._config.fontSize
+ self._browser.setHtml(htmlWrap.format(size,text))
+
+
+ def setObjectName(self, name):
+ """ Set the object name programatically
+ and query documentation for it. """
+ self._text.setText(name)
+ self.queryDoc()
+
+
+ def printDoc(self):
+ """ Print the doc for the text in the line edit. """
+ # Get name
+ name = self._text.text()
+ # Tell shell to print doc
+ shell = iep.shells.getCurrentShell()
+ if shell and name:
+ shell.processLine('print({}.__doc__)'.format(name))
+
+
+ def queryDoc(self):
+ """ Query the doc for the text in the line edit. """
+ # Get name
+ name = self._text.text()
+ # Get shell and ask for the documentation
+ shell = iep.shells.getCurrentShell()
+ if shell and name:
+ future = shell._request.doc(name)
+ future.add_done_callback(self.queryDoc_response)
+ elif not name:
+ self.setText(initText)
+
+
+ def queryDoc_response(self, future):
+ """ Process the response from the shell. """
+
+ # Process future
+ if future.cancelled():
+ #print('Introspect cancelled') # No living kernel
+ return
+ elif future.exception():
+ print('Introspect-queryDoc-exception: ', future.exception())
+ return
+ else:
+ response = future.result()
+ if not response:
+ return
+
+ try:
+ # Get parts
+ parts = response.split('\n')
+ objectName, h_class, h_fun, h_repr = tuple(parts[:4])
+ h_text = '\n'.join(parts[4:])
+
+ # Obtain newlines that we hid for repr
+ h_repr.replace('/r', '/n')
+
+ # Make all newlines \n in h_text and strip
+ h_text = h_text.replace('\r\n', '\n').replace('\r', '\n')
+ h_text = h_text.lstrip()
+
+ # Init text
+ text = ''
+
+ # These signs will fool the html
+ h_repr = h_repr.replace("<","<")
+ h_repr = h_repr.replace(">",">")
+ h_text = h_text.replace("<","<")
+ h_text = h_text.replace(">",">")
+
+ if self._config.smartNewlines:
+
+ # Make sure the signature is separated from the rest using at
+ # least two newlines
+ header = ''
+ if True:
+ # Get short version of objectName
+ name = objectName.split('.')[-1]
+ # Is the signature in the docstring?
+ docs = h_text.replace('\n','|')
+ tmp = re.search('[a-zA-z_\.]*?'+name+'\(.*?\)', docs)
+ if tmp and tmp.span(0)[0]<5:
+ header = tmp.group(0)
+ h_text = h_text[len(header):].lstrip(':').lstrip()
+ header = header.replace('|','')
+ #h_text = header + '\n\n' + h_text
+ elif h_text.startswith(objectName) or h_text.startswith(name):
+ header, sep, docs = h_text.partition('\n')
+ #h_text = header + '\n\n' + docs
+ h_text = docs
+
+ # Parse the text as rest/numpy like docstring
+ h_text = self.smartFormat(h_text)
+ if header:
+ h_text = "<p style='color:#005;'><b>%s</b></p>\n%s" % (
+ header, h_text)
+ #h_text = "<b>%s</b><br /><br />\n%s" % (header, h_text)
+ else:
+ # Make newlines html
+ h_text = h_text.replace("\n","<br />")
+
+ # Compile rich text
+ text += get_title_text(objectName, h_class, h_repr)
+ text += '{}<br />'.format(h_text)
+
+ except Exception as why:
+ try:
+ text += get_title_text(objectName, h_class, h_repr)
+ text += h_text
+ except Exception:
+ text = response
+
+ # Done
+ size = self._config.fontSize
+ self.setText(text)
+
+
+ def smartFormat(self, text):
+
+ # Get lines
+ lines = text.splitlines()
+
+ # Test minimal indentation
+ minIndent = 9999
+ for line in lines[1:]:
+ line_ = line.lstrip()
+ indent = len(line) - len(line_)
+ if line_:
+ minIndent = min(minIndent, indent)
+
+ # Remove minimal indentation
+ lines2 = [lines[0]]
+ for line in lines[1:]:
+ lines2.append( line[minIndent:] )
+
+ # Prepare
+ prevLine_ = ''
+ prevIndent = 0
+ prevWasHeader = False
+ inExample = False
+ forceNewline = False
+
+ # Format line by line
+ lines3 = []
+ for line in lines2:
+
+
+ # Get indentation
+ line_ = line.lstrip()
+ indent = len(line) - len(line_)
+ #indentPart = line[:indent-minIndent]
+ indentPart = line[:indent]
+
+ if not line_:
+ lines3.append("<br />")
+ forceNewline = True
+ continue
+
+ # Indent in html
+ line = " " * len(indentPart) + line
+
+ # Determine if we should introduce a newline
+ isHeader = False
+ if ("---" in line or "===" in line) and indent == prevIndent:
+ # Header
+ lines3[-1] = '<b>' + lines3[-1] + '</b>'
+ line = ''#'<br /> ' + line
+ isHeader = True
+ inExample = False
+ # Special case, examples
+ if prevLine_.lower().startswith('example'):
+ inExample = True
+ else:
+ inExample = False
+ elif ' : ' in line:
+ tmp = line.split(' : ',1)
+ line = '<br /><u>' + tmp[0] + '</u> : ' + tmp[1]
+ elif line_.startswith('* '):
+ line = '<br /> •' + line_[2:]
+ elif prevWasHeader or inExample or forceNewline:
+ line = '<br />' + line
+ else:
+ if prevLine_:
+ line = " " + line_
+ else:
+ line = line_
+
+ # Force next line to be on a new line if using a colon
+ if ' : ' in line:
+ forceNewline = True
+ else:
+ forceNewline = False
+
+ # Prepare for next line
+ prevLine_ = line_
+ prevIndent = indent
+ prevWasHeader = isHeader
+
+ # Done with line
+ lines3.append(line)
+
+ # Done formatting
+ return ''.join(lines3)
+
diff --git a/iep/tools/iepLogger.py b/iep/tools/iepLogger.py
new file mode 100644
index 0000000..6748e49
--- /dev/null
+++ b/iep/tools/iepLogger.py
@@ -0,0 +1,108 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+import sys, os, code
+from pyzolib.qt import QtCore, QtGui
+import iep
+from iep.iepcore.shell import BaseShell
+from iep.iepcore.iepLogging import splitConsole
+
+
+tool_name = "Logger"
+tool_summary = "Logs messages, warnings and errors within IEP."
+
+
+class IepLogger(BaseShell):
+ """ Shell that logs all messages produced by IEP. It also
+ allows to look inside IEP, which can be handy for debugging
+ and developing.
+ """
+
+ def __init__(self, parent):
+ BaseShell.__init__(self, parent)
+
+ # Set style to Python, or autocompletion does not work
+ self.setParser('python')
+
+ # Change background color to make the logger look different from shell
+ # Use color as if all lines are highlighted
+ f1 = self.getStyleElementFormat('Editor.text')
+ f2 = self.getStyleElementFormat('Editor.Highlight current line')
+ newStyle = 'back:%s, fore:%s' % (f2.back.name(), f1.fore.name())
+ self.setStyle(editor_text=newStyle)
+
+ # Create namespace for logger interpreter
+ locals = {'iep':iep, 'sys':sys, 'os':os}
+ # Include linguist tools
+ for name in ['linguist', 'lrelease', 'lupdate', 'lhelp']:
+ locals[name] = getattr(iep.util.locale, name)
+
+ # Create interpreter to run code
+ self._interpreter = code.InteractiveConsole(locals, "<logger>")
+
+ # Show welcome text
+ moreBanner = "This is the IEP logger shell."
+ self.write("Python %s on %s - %s\n\n" %
+ (sys.version[:5], sys.platform, moreBanner))
+ self.write(sys.ps1, 2)
+
+ # Split console
+ history = splitConsole(self.write, self.writeErr)
+ self.write(history)
+
+
+ def executeCommand(self, command):
+ """ Execute the command here! """
+ # Use writeErr rather than sys.stdout.write. This prevents
+ # the prompts to be logged by the history. Because if they
+ # are, the text does not look good due to missing newlines
+ # when loading the history.
+
+ # "Echo" stdin
+ self.write(command, 1)
+ more = self._interpreter.push(command.rstrip('\n'))
+ if more:
+ self.write(sys.ps2, 2)
+ else:
+ self.write(sys.ps1, 2)
+
+
+ def writeErr(self, msg):
+ """ This is what the logger uses to write errors.
+ """
+ self.write(msg, 0, '#C00')
+
+
+ # Note that I did not (yet) implement calltips
+
+ def processAutoComp(self, aco):
+ """ Processes an autocomp request using an AutoCompObject instance.
+ """
+
+ # Try using buffer first
+ if aco.tryUsingBuffer():
+ return
+
+ # Include buildins?
+ if not aco.name:
+ command = "__builtins__.keys()"
+ try:
+ names = eval(command, {}, self._interpreter.locals)
+ aco.addNames(names)
+ except Exception:
+ pass
+
+ # Query list of names
+ command = "dir({})".format(aco.name)
+ try:
+ names = eval(command, {}, self._interpreter.locals)
+ aco.addNames(names)
+ except Exception:
+ pass
+
+ # Done
+ aco.finish()
diff --git a/iep/tools/iepSourceStructure.py b/iep/tools/iepSourceStructure.py
new file mode 100644
index 0000000..af1cc6a
--- /dev/null
+++ b/iep/tools/iepSourceStructure.py
@@ -0,0 +1,255 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+import time
+from pyzolib.qt import QtCore, QtGui
+import iep
+
+tool_name = "Source structure"
+tool_summary = "Shows the structure of your source code."
+
+
+class IepSourceStructure(QtGui.QWidget):
+ def __init__(self, parent):
+ QtGui.QWidget.__init__(self, parent)
+
+ # Make sure there is a configuration entry for this tool
+ # The IEP tool manager makes sure that there is an entry in
+ # config.tools before the tool is instantiated.
+ toolId = self.__class__.__name__.lower()
+ self._config = iep.config.tools[toolId]
+ if not hasattr(self._config, 'showTypes'):
+ self._config.showTypes = ['class', 'def', 'cell', 'todo']
+ if not hasattr(self._config, 'level'):
+ self._config.level = 2
+
+ # Create icon for slider
+ self._sliderIcon = QtGui.QToolButton(self)
+ self._sliderIcon.setIcon(iep.icons.text_align_right)
+ self._sliderIcon.setIconSize(QtCore.QSize(16,16))
+ self._sliderIcon.setStyleSheet("QToolButton { border: none; padding: 0px; }")
+
+ # Create slider
+ self._slider = QtGui.QSlider(QtCore.Qt.Horizontal, self)
+ self._slider.setTickPosition(QtGui.QSlider.TicksBelow)
+ self._slider.setSingleStep(1)
+ self._slider.setPageStep(1)
+ self._slider.setRange(1,9)
+ self._slider.setValue(self._config.level)
+ self._slider.valueChanged.connect(self.updateStructure)
+
+ # Create options button
+ #self._options = QtGui.QPushButton(self)
+ #self._options.setText('Options'))
+ #self._options.setToolTip("What elements to show.")
+ self._options = QtGui.QToolButton(self)
+ self._options.setIcon(iep.icons.filter)
+ self._options.setIconSize(QtCore.QSize(16,16))
+ self._options.setPopupMode(self._options.InstantPopup)
+ self._options.setToolButtonStyle(QtCore.Qt.ToolButtonTextBesideIcon)
+
+ # Create options menu
+ self._options._menu = QtGui.QMenu()
+ self._options.setMenu(self._options._menu)
+
+ # Create tree widget
+ self._tree = QtGui.QTreeWidget(self)
+ self._tree.setHeaderHidden(True)
+ self._tree.itemCollapsed.connect(self.updateStructure) # keep expanded
+ self._tree.itemClicked.connect(self.onItemClick)
+
+ # Create two sizers
+ self._sizer1 = QtGui.QVBoxLayout(self)
+ self._sizer2 = QtGui.QHBoxLayout()
+ self._sizer1.setSpacing(2)
+ self._sizer1.setContentsMargins(4,4,4,4)
+
+ # Set layout
+ self._sizer1.addLayout(self._sizer2, 0)
+ self._sizer1.addWidget(self._tree, 1)
+ self._sizer2.addWidget(self._sliderIcon, 0)
+ self._sizer2.addWidget(self._slider, 4)
+ self._sizer2.addStretch(1)
+ self._sizer2.addWidget(self._options, 2)
+ #
+ self.setLayout(self._sizer1)
+
+ # Init current-file name
+ self._currentEditorId = 0
+
+ # Bind to events
+ iep.editors.currentChanged.connect(self.onEditorsCurrentChanged)
+ iep.editors.parserDone.connect(self.updateStructure)
+
+ self._options.pressed.connect(self.onOptionsPress)
+ self._options._menu.triggered.connect(self.onOptionMenuTiggered)
+
+ # Start
+ # When the tool is loaded, the editorStack is already done loading
+ # all previous files and selected the appropriate file.
+ self.onOptionsPress() # Create menu now
+ self.onEditorsCurrentChanged()
+
+
+ def onOptionsPress(self):
+ """ Create the menu for the button, Do each time to make sure
+ the checks are right. """
+
+ # Get menu
+ menu = self._options._menu
+ menu.clear()
+
+ for type in ['class', 'def', 'cell', 'todo', 'import', 'attribute']:
+ checked = type in self._config.showTypes
+ action = menu.addAction('Show %s'%type)
+ action.setCheckable(True)
+ action.setChecked(checked)
+
+
+ def onOptionMenuTiggered(self, action):
+ """ The user decides what to show in the structure. """
+
+ # What to show
+ type = action.text().split(' ',1)[1]
+
+ # Swap
+ if type in self._config.showTypes:
+ while type in self._config.showTypes:
+ self._config.showTypes.remove(type)
+ else:
+ self._config.showTypes.append(type)
+
+ # Update
+ self.updateStructure()
+
+
+ def onEditorsCurrentChanged(self):
+ """ Notify that the file is being parsed and make
+ sure that not the structure of a previously selected
+ file is shown. """
+
+ # Get editor and clear list
+ editor = iep.editors.getCurrentEditor()
+ self._tree.clear()
+
+ if editor is None:
+ # Set editor id
+ self._currentEditorId = 0
+
+ if editor is not None:
+ # Set editor id
+ self._currentEditorId = id(editor)
+
+ # Notify
+ text = 'Parsing ' + editor._name + ' ...'
+ thisItem = QtGui.QTreeWidgetItem(self._tree, [text])
+
+ # Try getting the structure right now
+ self.updateStructure()
+
+
+ def onItemClick(self, item):
+ """ Go to the right line in the editor and give focus. """
+
+ # Get editor
+ editor = iep.editors.getCurrentEditor()
+ if not editor:
+ return
+
+ # If item is attribute, get parent
+ if not item.linenr:
+ item = item.parent()
+
+ # Move to line
+ editor.gotoLine(item.linenr)
+
+ # Give focus
+ iep.callLater(editor.setFocus)
+
+
+ def updateStructure(self):
+ """ Updates the tree.
+ """
+
+ # Get editor
+ editor = iep.editors.getCurrentEditor()
+ if not editor:
+ return
+
+ # Something to show
+ result = iep.parser._getResult()
+ if result is None:
+ return
+
+ # Do the ids match?
+ id0, id1, id2 = self._currentEditorId, id(editor), result.editorId
+ if id0 != id1 or id0 != id2:
+ return
+
+ # Get current line number and the structure
+ ln = editor.textCursor().blockNumber()
+ ln += 1 # is ln as in line number area
+
+ # Define colours
+ colours = {'cell':'#007F00', 'class':'#0000FF', 'def':'#007F7F',
+ 'attribute':'#444444', 'import':'#8800BB', 'todo':'#FF3333'}
+
+ # Define what to show
+ showTypes = self._config.showTypes
+
+ # Define to what level to show (now is also a good time to save)
+ showLevel = int( self._slider.value() )
+ self._config.level = showLevel
+
+ # Define function to set items
+ selectedItem = [None]
+ def SetItems(parentItem, fictiveObjects, level):
+ level += 1
+ for object in fictiveObjects:
+ type = object.type
+ if not type in showTypes:
+ continue
+ # Construct text
+ if type=='cell':
+ type = '##'
+ elif type=='attribute':
+ type = 'attr'
+ #
+ if type == 'import':
+ text = "%s (%s)" % (object.name, object.text)
+ elif type=='todo':
+ text = object.name
+ else:
+ text = "%s %s" % (type, object.name)
+ # Create item
+ thisItem = QtGui.QTreeWidgetItem(parentItem, [text])
+ color = QtGui.QColor(colours[object.type])
+ thisItem.setForeground(0, QtGui.QBrush(color))
+ font = thisItem.font(0)
+ font.setBold(True)
+ thisItem.setFont(0, font)
+ thisItem.linenr = object.linenr
+ # Is this the current item?
+ if ln and object.linenr <= ln and object.linenr2 > ln:
+ selectedItem[0] = thisItem
+ # Any children that we should display?
+ if object.children:
+ SetItems(thisItem, object.children, level)
+ # Set visibility
+ thisItem.setExpanded( bool(level < showLevel) )
+
+ # Go
+ self._tree.setUpdatesEnabled(False)
+ self._tree.clear()
+ SetItems(self._tree, result.rootItem.children, 0)
+ self._tree.setUpdatesEnabled(True)
+
+ # Handle selected item
+ selectedItem = selectedItem[0]
+ if selectedItem:
+ selectedItem.setBackground(0, QtGui.QBrush(QtGui.QColor('#CCC')))
+ self._tree.scrollToItem(selectedItem) # ensure visible
diff --git a/iep/tools/iepWebBrowser.py b/iep/tools/iepWebBrowser.py
new file mode 100644
index 0000000..3836abb
--- /dev/null
+++ b/iep/tools/iepWebBrowser.py
@@ -0,0 +1,277 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+import time
+import urllib.request, urllib.parse
+from pyzolib.qt import QtCore, QtGui
+
+imported_qtwebkit = True
+try:
+ from pyzolib.qt import QtWebKit
+except ImportError:
+ imported_qtwebkit = False
+
+import iep
+
+tool_name = "Web browser"
+tool_summary = "A very simple web browser."
+
+
+default_bookmarks = [ 'docs.python.org',
+ 'scipy.org',
+ 'doc.qt.nokia.com/4.5/',
+ 'iep-project.org',
+ 'pyzo.org',
+ ]
+
+
+class WebView(QtGui.QTextBrowser):
+ """ Inherit the webview class to implement zooming using
+ the mouse wheel.
+ """
+
+ loadStarted = QtCore.Signal()
+ loadFinished = QtCore.Signal(bool)
+
+ def __init__(self, parent):
+ QtGui.QTextBrowser.__init__(self, parent)
+
+ # Current url
+ self._url = ''
+ self._history = []
+ self._history2 = []
+
+ # Connect
+ self.anchorClicked.connect(self.load)
+
+
+ def wheelEvent(self, event):
+ # Zooming does not work for this widget
+ if QtCore.Qt.ControlModifier & QtGui.qApp.keyboardModifiers():
+ self.parent().wheelEvent(event)
+ else:
+ QtGui.QTextBrowser.wheelEvent(self, event)
+
+
+ def url(self):
+ return self._url
+
+
+ def _getUrlParts(self):
+ r = urllib.parse.urlparse(self._url)
+ base = r.scheme + '://' + r.netloc
+ return base, r.path, r.fragment
+
+#
+# def loadCss(self, urls=[]):
+# urls.append('http://docs.python.org/_static/default.css')
+# urls.append('http://docs.python.org/_static/pygments.css')
+# text = ''
+# for url in urls:
+# tmp = urllib.request.urlopen(url).read().decode('utf-8')
+# text += '\n' + tmp
+# self.document().setDefaultStyleSheet(text)
+
+
+ def back(self):
+
+ # Get url and update forward history
+ url = self._history.pop()
+ self._history2.append(self._url)
+
+ # Go there
+ url = self._load(url)
+
+
+ def forward(self):
+
+ if not self._history2:
+ return
+
+ # Get url and update forward history
+ url = self._history2.pop()
+ self._history.append(self._url)
+
+ # Go there
+ url = self._load(url)
+
+
+ def load(self, url):
+
+ # Clear forward history
+ self._history2 = []
+
+ # Store current url in history
+ while self._url in self._history:
+ self._history.remove(self._url)
+ self._history.append(self._url)
+
+ # Load
+ url = self._load(url)
+
+
+
+
+ def _load(self, url):
+ """ _load(url)
+ Convert url and load page, returns new url.
+ """
+ # Make url a string
+ if isinstance(url, QtCore.QUrl):
+ url = str(url.toString())
+
+ # Compose relative url to absolute
+ if url.startswith('#'):
+ base, path, frag = self._getUrlParts()
+ url = base + path + url
+ elif not '//' in url:
+ base, path, frag = self._getUrlParts()
+ url = base + '/' + url.lstrip('/')
+
+ # Try loading
+ self.loadStarted.emit()
+ self._url = url
+ try:
+ #print('URL:', url)
+ text = urllib.request.urlopen(url).read().decode('utf-8')
+ self.setHtml(text)
+ self.loadFinished.emit(True)
+ except Exception as err:
+ self.setHtml(str(err))
+ self.loadFinished.emit(False)
+
+ # Set
+ return url
+
+
+class IepWebBrowser(QtGui.QFrame):
+ """ The main window, containing buttons, address bar and
+ browser widget.
+ """
+
+ def __init__(self, parent):
+ QtGui.QFrame.__init__(self, parent)
+
+ # Init config
+ toolId = self.__class__.__name__.lower()
+ self._config = iep.config.tools[toolId]
+ if not hasattr(self._config, 'zoomFactor'):
+ self._config.zoomFactor = 1.0
+ if not hasattr(self._config, 'bookMarks'):
+ self._config.bookMarks = []
+ for item in default_bookmarks:
+ if item not in self._config.bookMarks:
+ self._config.bookMarks.append(item)
+
+ # Get style object (for icons)
+ style = QtGui.QApplication.style()
+
+ # Create some buttons
+ self._back = QtGui.QToolButton(self)
+ self._back.setIcon(style.standardIcon(style.SP_ArrowBack))
+ self._back.setIconSize(QtCore.QSize(16,16))
+ #
+ self._forward = QtGui.QToolButton(self)
+ self._forward.setIcon(style.standardIcon(style.SP_ArrowForward))
+ self._forward.setIconSize(QtCore.QSize(16,16))
+
+ # Create address bar
+ #self._address = QtGui.QLineEdit(self)
+ self._address = QtGui.QComboBox(self)
+ self._address.setEditable(True)
+ self._address.setInsertPolicy(self._address.NoInsert)
+ #
+ for a in self._config.bookMarks:
+ self._address.addItem(a)
+ self._address.setEditText('')
+
+ # Create web view
+ if imported_qtwebkit:
+ self._view = QtWebKit.QWebView(self)
+ else:
+ self._view = WebView(self)
+ #
+# self._view.setZoomFactor(self._config.zoomFactor)
+# settings = self._view.settings()
+# settings.setAttribute(settings.JavascriptEnabled, True)
+# settings.setAttribute(settings.PluginsEnabled, True)
+
+ # Layout
+ self._sizer1 = QtGui.QVBoxLayout(self)
+ self._sizer2 = QtGui.QHBoxLayout()
+ #
+ self._sizer2.addWidget(self._back, 0)
+ self._sizer2.addWidget(self._forward, 0)
+ self._sizer2.addWidget(self._address, 1)
+ #
+ self._sizer1.addLayout(self._sizer2, 0)
+ self._sizer1.addWidget(self._view, 1)
+ #
+ self._sizer1.setSpacing(2)
+ self.setLayout(self._sizer1)
+
+ # Bind signals
+ self._back.clicked .connect(self.onBack)
+ self._forward.clicked .connect(self.onForward)
+ self._address.lineEdit().returnPressed.connect(self.go)
+ self._address.activated.connect(self.go)
+ self._view.loadFinished.connect(self.onLoadEnd)
+ self._view.loadStarted.connect(self.onLoadStart)
+
+ # Start
+ self._view.show()
+ self.go('http://docs.python.org')
+
+
+ def parseAddress(self, address):
+ if not address.startswith('http'):
+ address = 'http://' + address
+ return address#QtCore.QUrl(address, QtCore.QUrl.TolerantMode)
+
+ def go(self, address=None):
+ if not isinstance(address, str):
+ address = self._address.currentText()
+ self._view.load( self.parseAddress(address) )
+
+ def onLoadStart(self):
+ self._address.setEditText('<loading>')
+
+ def onLoadEnd(self, ok):
+ if ok:
+ #url = self._view.url()
+ #address = str(url.toString())
+ if imported_qtwebkit:
+ address = self._view.url().toString()
+ else:
+ address = self._view.url()
+ else:
+ address = '<could not load page>'
+ self._address.setEditText(str(address))
+
+ def onBack(self):
+ self._view.back()
+
+ def onForward(self):
+ self._view.forward()
+
+ def wheelEvent(self, event):
+ if QtCore.Qt.ControlModifier & QtGui.qApp.keyboardModifiers():
+ # Get amount of scrolling
+ degrees = event.delta() / 8.0
+ steps = degrees / 15.0
+ # Set factor
+# factor = self._view.zoomFactor() + steps/10.0
+ if factor < 0.25:
+ factor = 0.25
+ if factor > 4.0:
+ factor = 4.0
+ # Store and apply
+ self._config.zoomFactor = factor
+# self._view.setZoomFactor(factor)
+ else:
+ QtGui.QFrame.wheelEvent(self, event)
+
diff --git a/iep/tools/iepWorkspace.py b/iep/tools/iepWorkspace.py
new file mode 100644
index 0000000..0ce8a7e
--- /dev/null
+++ b/iep/tools/iepWorkspace.py
@@ -0,0 +1,309 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+import sys, os, time
+
+from pyzolib.qt import QtCore, QtGui
+import iep
+
+tool_name = "Workspace"
+tool_summary = "Lists the variables in the current shell's namespace."
+
+
+
+def splitName(name):
+ """ splitName(name)
+ Split an object name in parts, taking dots and indexing into account.
+ """
+ name = name.replace('[', '.[')
+ parts = name.split('.')
+ return [p for p in parts if p]
+
+
+def joinName(parts):
+ """ joinName(parts)
+ Join the parts of an object name, taking dots and indexing into account.
+ """
+ name = '.'.join(parts)
+ return name.replace('.[', '[')
+
+
+class WorkspaceProxy(QtCore.QObject):
+ """ WorkspaceProxy
+
+ A proxy class to handle the asynchonous behaviour of getting information
+ from the shell. The workspace tool asks for a certain name, and this
+ class notifies when new data is available using a qt signal.
+
+ """
+
+ haveNewData = QtCore.Signal()
+
+ def __init__(self):
+ QtCore.QObject.__init__(self)
+
+ # Variables
+ self._variables = []
+
+ # Element to get more info of
+ self._name = ''
+
+ # Bind to events
+ iep.shells.currentShellChanged.connect(self.onCurrentShellChanged)
+ iep.shells.currentShellStateChanged.connect(self.onCurrentShellStateChanged)
+
+ # Initialize
+ self.onCurrentShellStateChanged()
+
+
+
+ def addNamePart(self, part):
+ """ addNamePart(part)
+ Add a part to the name.
+ """
+ parts = splitName(self._name)
+ parts.append(part)
+ self.setName(joinName(parts))
+
+
+ def setName(self, name):
+ """ setName(name)
+ Set the name that we want to know more of.
+ """
+ self._name = name
+
+ shell = iep.shells.getCurrentShell()
+ if shell:
+ future = shell._request.dir2(self._name)
+ future.add_done_callback(self.processResponse)
+
+
+ def goUp(self):
+ """ goUp()
+ Cut the last part off the name.
+ """
+ parts = splitName(self._name)
+ if parts:
+ parts.pop()
+ self.setName(joinName(parts))
+
+
+ def onCurrentShellChanged(self):
+ """ onCurrentShellChanged()
+ When no shell is selected now, update this. In all other cases,
+ the onCurrentShellStateChange will be fired too.
+ """
+ shell = iep.shells.getCurrentShell()
+ if not shell:
+ self._variables = []
+ self.haveNewData.emit()
+
+
+ def onCurrentShellStateChanged(self):
+ """ onCurrentShellStateChanged()
+ Do a request for information!
+ """
+ shell = iep.shells.getCurrentShell()
+ if not shell:
+ # Should never happen I think, but just to be sure
+ self._variables = []
+ elif shell._state.lower() != 'busy':
+ future = shell._request.dir2(self._name)
+ future.add_done_callback(self.processResponse)
+
+
+ def processResponse(self, future):
+ """ processResponse(response)
+ We got a response, update our list and notify the tree.
+ """
+
+ response = []
+
+ # Process future
+ if future.cancelled():
+ pass #print('Introspect cancelled') # No living kernel
+ elif future.exception():
+ print('Introspect-queryDoc-exception: ', future.exception())
+ else:
+ response = future.result()
+
+ self._variables = response
+ self.haveNewData.emit()
+
+
+
+class WorkspaceTree(QtGui.QTreeWidget):
+ """ WorkspaceTree
+
+ The tree that displays the items in the current namespace.
+ I first thought about implementing this using the mode/view
+ framework, but it is so much work and I can't seem to fully
+ understand how it works :(
+
+ The QTreeWidget is so very simple and enables sorting very
+ easily, so I'll stick with that ...
+
+ """
+
+ def __init__(self, parent):
+ QtGui.QTreeWidget.__init__(self, parent)
+
+ # Set header stuff
+ self.setHeaderHidden(False)
+ self.setColumnCount(3)
+ self.setHeaderLabels(['Name', 'Type', 'Repr'])
+ #self.setColumnWidth(0, 100)
+ self.setSortingEnabled(True)
+
+ # Nice rows
+ self.setAlternatingRowColors(True)
+ self.setRootIsDecorated(False)
+
+ # Create proxy
+ self._proxy = WorkspaceProxy()
+ self._proxy.haveNewData.connect(self.fillWorkspace)
+
+ # For menu
+ self.setContextMenuPolicy(QtCore.Qt.DefaultContextMenu)
+ self._menu = QtGui.QMenu()
+ self._menu.triggered.connect(self.contextMenuTriggered)
+
+ # Bind to events
+ self.itemActivated.connect(self.onItemExpand)
+
+
+ def contextMenuEvent(self, event):
+ """ contextMenuEvent(event)
+ Show the context menu.
+ """
+
+ QtGui.QTreeView.contextMenuEvent(self, event)
+
+ # Get if an item is selected
+ item = self.currentItem()
+ if not item:
+ return
+
+ # Create menu
+ self._menu.clear()
+ for a in ['Show namespace', 'Show help', 'Delete']:
+ action = self._menu.addAction(a)
+ parts = splitName(self._proxy._name)
+ parts.append(item.text(0))
+ action._objectName = joinName(parts)
+ action._item = item
+
+ # Show
+ self._menu.popup(QtGui.QCursor.pos()+QtCore.QPoint(3,3))
+
+
+ def contextMenuTriggered(self, action):
+ """ contextMenuTriggered(action)
+ Process a request from the context menu.
+ """
+
+ # Get text
+ req = action.text().lower()
+
+ if 'namespace' in req:
+ # Go deeper
+ self.onItemExpand(action._item)
+
+ elif 'help' in req:
+ # Show help in help tool (if loaded)
+ hw = iep.toolManager.getTool('iepinteractivehelp')
+ if hw:
+ hw.setObjectName(action._objectName)
+
+ elif 'delete' in req:
+ # Delete the variable
+ shell = iep.shells.getCurrentShell()
+ if shell:
+ shell.processLine('del ' + action._objectName)
+
+
+ def onItemExpand(self, item):
+ """ onItemExpand(item)
+ Inspect the attributes of that item.
+ """
+ self._proxy.addNamePart(item.text(0))
+
+
+ def fillWorkspace(self):
+ """ fillWorkspace()
+ Update the workspace tree.
+ """
+
+ # Clear first
+ self.clear()
+
+ # Set name
+ line = self.parent()._line
+ line.setText(self._proxy._name)
+
+
+ # Add elements
+ for des in self._proxy._variables:
+
+ # Get parts
+ parts = des.split(',',4)
+ if len(parts) < 4:
+ continue
+
+ # Pop the 'kind' element
+ kind = parts.pop(2)
+
+ # Create item
+ item = QtGui.QTreeWidgetItem(parts, 0)
+ self.addTopLevelItem(item)
+
+ # Set tooltip
+ tt = '%s: %s' % (parts[0], parts[-1])
+ item.setToolTip(0,tt)
+ item.setToolTip(1,tt)
+ item.setToolTip(2,tt)
+
+
+class IepWorkspace(QtGui.QWidget):
+ """ IepWorkspace
+
+ The main widget for this tool.
+
+ """
+
+ def __init__(self, parent):
+ QtGui.QWidget.__init__(self, parent)
+
+ # Create tool button
+ self._up = QtGui.QToolButton(self)
+ style = QtGui.qApp.style()
+ self._up.setIcon( style.standardIcon(style.SP_ArrowLeft) )
+ self._up.setIconSize(QtCore.QSize(16,16))
+
+ # Create "path" line edit
+ self._line = QtGui.QLineEdit(self)
+ self._line.setReadOnly(True)
+ self._line.setStyleSheet("QLineEdit { background:#ddd; }")
+ self._line.setFocusPolicy(QtCore.Qt.NoFocus)
+
+ # Create tree
+ self._tree = WorkspaceTree(self)
+
+ # Set layout
+ layout = QtGui.QHBoxLayout()
+ layout.addWidget(self._up, 0)
+ layout.addWidget(self._line, 1)
+ #
+ mainLayout = QtGui.QVBoxLayout(self)
+ mainLayout.addLayout(layout, 0)
+ mainLayout.addWidget(self._tree, 1)
+ mainLayout.setSpacing(2)
+ mainLayout.setContentsMargins(4,4,4,4)
+ self.setLayout(mainLayout)
+
+ # Bind up event
+ self._up.pressed.connect(self._tree._proxy.goUp)
diff --git a/iep/util/__init__.py b/iep/util/__init__.py
new file mode 100644
index 0000000..e69de29
diff --git a/iep/util/iepwizard.py b/iep/util/iepwizard.py
new file mode 100644
index 0000000..bffc550
--- /dev/null
+++ b/iep/util/iepwizard.py
@@ -0,0 +1,409 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" iepwizard module
+
+Implements a wizard to help new users get familiar with IEP.
+
+"""
+
+import os
+import re
+
+import iep
+from pyzolib.qt import QtCore, QtGui
+from iep import translate
+
+from iep.util.locale import LANGUAGES, LANGUAGE_SYNONYMS, setLanguage
+
+
+def retranslate(t):
+ """ To allow retranslating after selecting the language.
+ """
+ if hasattr(t, 'original'):
+ return translate('wizard', t.original)
+ else:
+ return t
+
+
+
+class IEPWizard(QtGui.QWizard):
+
+ def __init__(self, parent):
+ QtGui.QWizard.__init__(self, parent)
+
+ # Set some appearance stuff
+ self.setMinimumSize(600, 500)
+ self.setWindowTitle(translate('wizard', 'Getting started with IEP'))
+ self.setWizardStyle(self.ModernStyle)
+ self.setButtonText(self.CancelButton, 'Stop')
+
+ # Set logo
+ pm = QtGui.QPixmap()
+ pm.load(os.path.join(iep.iepDir, 'resources', 'appicons', 'ieplogo48.png'))
+ self.setPixmap(self.LogoPixmap, pm)
+
+ # Define pages
+ klasses = [ IntroWizardPage,
+ TwocomponentsWizardPage, EditorWizardPage,
+ ShellWizardPage1, ShellWizardPage2,
+ RuncodeWizardPage1, RuncodeWizardPage2,
+ ToolsWizardPage1, ToolsWizardPage2,
+ FinalPage]
+
+ # Create pages
+ self._n = len(klasses)
+ for i, klass in enumerate(klasses):
+ self.addPage(klass(self, i))
+
+ def show(self, startPage=None):
+ """ Show the wizard. If startPage is given, open the Wizard at
+ that page. startPage can be an integer or a string that matches
+ the classname of a page.
+ """
+ QtGui.QWizard.show(self)
+
+ # Check startpage
+ if isinstance(startPage, int):
+ pass
+ elif isinstance(startPage, str):
+ for i in range(self._n):
+ page = self.page(i)
+ if page.__class__.__name__.lower() == startPage.lower():
+ startPage = i
+ break
+ else:
+ print('IEP wizard: Could not find start page: %r' % startPage)
+ startPage = None
+ elif startPage is not None:
+ print('IEP wizard: invalid start page: %r' % startPage)
+ startPage = None
+
+ # Go to start page
+ if startPage is not None:
+ for i in range(startPage):
+ self.next()
+
+
+class BaseIEPWizardPage(QtGui.QWizardPage):
+
+ _prefix = translate('wizard', 'Step')
+
+ _title = 'dummy title'
+ _descriptions = []
+ _image_filename = ''
+
+ def __init__(self, parent, i):
+ QtGui.QWizardPage.__init__(self, parent)
+ self._i = i
+
+ # Create label for description
+ self._text_label = QtGui.QLabel(self)
+ self._text_label.setTextFormat(QtCore.Qt.RichText)
+ self._text_label.setWordWrap(True)
+
+ # Create label for image
+ self._comicLabel = QtGui.QLabel(self)
+ pm = QtGui.QPixmap()
+ if 'logo' in self._image_filename:
+ pm.load(os.path.join(iep.iepDir, 'resources', 'appicons', self._image_filename))
+ elif self._image_filename:
+ pm.load(os.path.join(iep.iepDir, 'resources', 'images', self._image_filename))
+ self._comicLabel.setPixmap(pm)
+ self._comicLabel.setAlignment(QtCore.Qt.AlignHCenter | QtCore.Qt.AlignVCenter)
+
+ # Layout
+ theLayout = QtGui.QVBoxLayout(self)
+ self.setLayout(theLayout)
+ #
+ theLayout.addWidget(self._text_label)
+ theLayout.addStretch()
+ theLayout.addWidget(self._comicLabel)
+ theLayout.addStretch()
+
+
+ def initializePage(self):
+
+ # Get prefix
+ i = self._i
+ n = self.wizard()._n - 2 # Dont count the first and last page
+ prefix = ''
+ if i and i <= n:
+ prefix = retranslate(self._prefix) + ' %i/%i: ' % (i, n)
+
+ # Set title
+ self.setTitle(prefix + retranslate(self._title))
+
+ # Parse description
+ # Two description units are separated with BR tags
+ # Emphasis on words is set to italic tags.
+ lines = []
+ descriptions = [retranslate(d).strip() for d in self._descriptions]
+ for description in descriptions:
+ for line in description.splitlines():
+ line = line.strip()
+ line = re.sub(r'\*(.+?)\*', r'<b>\1</b>', line)
+ lines.append(line)
+ lines.append('<br /><br />')
+ lines = lines[:-1]
+
+ # Set description
+ self._text_label.setText('\n'.join(lines))
+
+
+
+class IntroWizardPage(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'Welcome to the Interactive Editor for Python!')
+ _image_filename = 'ieplogo128.png'
+ _descriptions = [
+ translate('wizard', """This wizard helps you get familiarized with the workings of IEP."""),
+
+ translate('wizard', """IEP is a cross-platform Python IDE
+ focused on *interactivity* and *introspection*, which makes it
+ very suitable for scientific computing. Its practical design
+ is aimed at *simplicity* and *efficiency*."""),
+ ]
+
+ def __init__(self, parent, i):
+ BaseIEPWizardPage.__init__(self, parent, i)
+
+ # Create label and checkbox
+ t1 = translate('wizard', "This wizard can be opened using 'Help > IEP wizard'")
+ t2 = translate('wizard', "Show this wizard on startup")
+ self._label_info = QtGui.QLabel(t1, self)
+ self._check_show = QtGui.QCheckBox(t2, self)
+ self._check_show.stateChanged.connect(self._setNewUser)
+
+ # Create language switcher
+ self._langLabel = QtGui.QLabel(translate('wizard', "Select language"), self)
+ #
+ self._langBox = QtGui.QComboBox(self)
+ self._langBox.setEditable(False)
+ # Fill
+ index, theIndex = -1, -1
+ cur = iep.config.settings.language
+ for lang in sorted(LANGUAGES):
+ index += 1
+ self._langBox.addItem(lang)
+ if lang == LANGUAGE_SYNONYMS.get(cur, cur):
+ theIndex = index
+ # Set current index
+ if theIndex >= 0:
+ self._langBox.setCurrentIndex(theIndex)
+ # Bind signal
+ self._langBox.activated.connect(self.onLanguageChange)
+
+ # Init check state
+ if iep.config.state.newUser:
+ self._check_show.setCheckState(QtCore.Qt.Checked)
+
+ # Create sublayout
+ layout = QtGui.QHBoxLayout()
+ layout.addWidget(self._langLabel, 0)
+ layout.addWidget(self._langBox, 0)
+ layout.addStretch(2)
+ self.layout().addLayout(layout)
+
+ # Add to layout
+ self.layout().addSpacing(10)
+ self.layout().addWidget(self._label_info)
+ self.layout().addWidget(self._check_show)
+
+ def _setNewUser(self, newUser):
+ newUser = bool(newUser)
+ self._label_info.setHidden(newUser)
+ iep.config.state.newUser = newUser
+
+ def onLanguageChange(self):
+ languageName = self._langBox.currentText()
+ if iep.config.settings.language == languageName:
+ return
+ # Save new language
+ iep.config.settings.language = languageName
+ setLanguage(iep.config.settings.language)
+ # Notify user
+ text = translate('wizard', """
+ The language has been changed for this wizard.
+ IEP needs to restart for the change to take effect application-wide.
+ """)
+ m = QtGui.QMessageBox(self)
+ m.setWindowTitle(translate("wizard", "Language changed"))
+ m.setText(text)
+ m.setIcon(m.Information)
+ m.exec_()
+
+ # Get props of current wizard
+ geo = self.wizard().geometry()
+ parent = self.wizard().parent()
+ # Close ourself!
+ self.wizard().close()
+ # Start new one
+ w = IEPWizard(parent)
+ w.setGeometry(geo)
+ w.show()
+
+
+
+class TwocomponentsWizardPage(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'IEP consists of two main components')
+ _image_filename = 'iep_two_components.png'
+ _descriptions = [
+ translate('wizard',
+ "You can execute commands directly in the *shell*,"),
+ translate('wizard',
+ "or you can write code in the *editor* and execute that."),
+ ]
+
+
+class EditorWizardPage(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'The editor is where you write your code')
+ _image_filename = 'iep_editor.png'
+ _descriptions = [
+ translate('wizard',
+ """In the *editor*, each open file is represented as a tab. By
+ right-clicking on a tab, files can be run, saved, closed, etc."""),
+ translate('wizard',
+ """The right mouse button also enables one to make a file the
+ *main file* of a project. This file can be recognized by its star
+ symbol, and it enables running the file more easily."""),
+ ]
+
+
+class ShellWizardPage1(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'The shell is where your code gets executed')
+ _image_filename = 'iep_shell1.png'
+ _descriptions = [
+ translate('wizard',
+ """When IEP starts, a default *shell* is created. You can add more
+ shells that run simultaneously, and which may be of different
+ Python versions."""),
+ translate('wizard',
+ """Shells run in a sub-process, such that when it is busy, IEP
+ itself stays responsive, allowing you to keep coding and even
+ run code in another shell."""),
+ ]
+
+
+class ShellWizardPage2(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'Configuring shells')
+ _image_filename = 'iep_shell2.png'
+ _descriptions = [
+ translate('wizard',
+ """IEP can integrate the event loop of five different *GUI toolkits*,
+ thus enabling interactive plotting with e.g. Visvis or Matplotlib."""),
+ translate('wizard',
+ """Via 'Shell > Edit shell configurations', you can edit and add
+ *shell configurations*. This allows you to for example select the
+ initial directory, or use a custom Pythonpath."""),
+ ]
+
+
+class RuncodeWizardPage1(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'Running code')
+ _image_filename = 'iep_run1.png'
+ _descriptions = [
+ translate('wizard',
+ "IEP supports several ways to run source code in the editor. (see the 'Run' menu)."),
+ translate('wizard',
+ """*Run selection:* if there is no selected text, the current line
+ is executed; if the selection is on a single line, the selection
+ is evaluated; if the selection spans multiple lines, IEP will
+ run the the (complete) selected lines."""),
+ translate('wizard',
+ "*Run cell:* a cell is everything between two lines starting with '##'."),
+ translate('wizard',
+ "*Run file:* run all the code in the current file."),
+ translate('wizard',
+ "*Run project main file:* run the code in the current project's main file."),
+ ]
+
+
+class RuncodeWizardPage2(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'Interactive mode vs running as script')
+ _image_filename = ''
+ _descriptions = [
+ translate('wizard',
+ """You can run the current file or the main file normally, or as a script.
+ When run as script, the shell is restared to provide a clean
+ environment. The shell is also initialized differently so that it
+ closely resembles a normal script execution."""),
+ translate('wizard',
+ """In interactive mode, sys.path[0] is an empty string (i.e. the current dir),
+ and sys.argv is set to ['']."""),
+ translate('wizard',
+ """In script mode, __file__ and sys.argv[0] are set to the scripts filename,
+ sys.path[0] and the working dir are set to the directory containing the script."""),
+ ]
+
+
+class ToolsWizardPage1(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'Tools for your convenience')
+ _image_filename = 'iep_tools1.png'
+ _descriptions = [
+ translate('wizard',
+ """Via the *Tools menu*, one can select which tools to use. The tools can
+ be positioned in any way you want, and can also be un-docked."""),
+ translate('wizard',
+ """Note that the tools system is designed such that it's easy to
+ create your own tools. Look at the online wiki for more information,
+ or use one of the existing tools as an example."""),
+ ]
+
+
+class ToolsWizardPage2(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'Recommended tools')
+ _image_filename = 'iep_tools2.png'
+ _descriptions = [
+ translate('wizard',
+ """We especially recommend the following tools:"""),
+ translate('wizard',
+ """The *Source structure tool* gives an outline of the source code."""),
+ translate('wizard',
+ """The *File browser tool* helps keep an overview of all files
+ in a directory. To manage your projects, click the star icon."""),
+ ]
+
+
+class FinalPage(BaseIEPWizardPage):
+
+ _title = translate('wizard', 'Get coding!')
+ _image_filename = 'ieplogo128.png'
+ _descriptions = [
+ translate('wizard',
+ """This concludes the IEP wizard. Now, get coding and have fun!"""),
+ ]
+
+
+# def smooth_images():
+# """ This was used to create the images from their raw versions.
+# """
+#
+# import os
+# import visvis as vv
+# import scipy as sp
+# import scipy.ndimage
+# for fname in os.listdir('images'):
+# im = vv.imread(os.path.join('images', fname))
+# for i in range(im.shape[2]):
+# im[:,:,i] = sp.ndimage.gaussian_filter(im[:,:,i], 0.7)
+# #fname = fname.replace('.png', '.jpg')
+# print(fname)
+# vv.imwrite(fname, im[::2,::2,:])
+
+
+if __name__ == '__main__':
+ w = IEPWizard(None)
+ w.show()
+
\ No newline at end of file
diff --git a/iep/util/locale.py b/iep/util/locale.py
new file mode 100644
index 0000000..7ff58cc
--- /dev/null
+++ b/iep/util/locale.py
@@ -0,0 +1,285 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013, the IEP development team
+#
+# IEP is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" iep.util.locale
+Module for locale stuff like language and translations.
+"""
+
+import os, sys, time
+from pyzolib.qt import QtCore, QtGui
+
+import iep
+
+
+# Define supported languages. The key defines the name as shown to the
+# user. The value is passed to create a Locale object. From the local
+# object we obtain the name for the .tr file.
+LANGUAGES = {
+ 'English (US)': QtCore.QLocale.C,
+ # == (QtCore.QLocale.English, QtCore.QLocale.UnitedStates),
+ #'English (UK)': (QtCore.QLocale.English, QtCore.QLocale.UnitedKingdom),
+ 'Dutch': QtCore.QLocale.Dutch,
+ 'Spanish': QtCore.QLocale.Spanish,
+ 'Catalan': QtCore.QLocale.Catalan,
+ 'French': QtCore.QLocale.French,
+ 'Portuguese': QtCore.QLocale.Portuguese,
+ 'German': QtCore.QLocale.German,
+ 'Russian': QtCore.QLocale.Russian, # not updated for 3.4
+ # Languages for which the is a .tr file, but no translations available yet:
+ # 'Simplified Chinese': QtCore.QLocale.Chinese,
+ # 'Slovak': QtCore.QLocale.Slovak,
+ }
+
+
+LANGUAGE_SYNONYMS = { None: 'English (US)',
+ '': 'English (US)',
+ 'English': 'English (US)'}
+
+
+def getLocale(languageName):
+ """ getLocale(languageName)
+ Get the QtCore.QLocale object for the given language (as a string).
+ """
+
+ # Apply synonyms
+ languageName = LANGUAGE_SYNONYMS.get(languageName, languageName)
+
+ # Select language in qt terms
+ qtLanguage = LANGUAGES.get(languageName, None)
+ if qtLanguage is None:
+ raise ValueError('Unknown language')
+
+ # Return locale
+ if isinstance(qtLanguage, tuple):
+ return QtCore.QLocale(*qtLanguage)
+ else:
+ return QtCore.QLocale(qtLanguage)
+
+
+def setLanguage(languageName):
+ """ setLanguage(languageName)
+ Set the language for the app. Loads qt and iep translations.
+ Returns the QLocale instance to pass to the main widget.
+ """
+
+ # Get locale
+ locale = getLocale(languageName)
+
+ # Get paths were language files are
+ qtTransPath = str(QtCore.QLibraryInfo.location(
+ QtCore.QLibraryInfo.TranslationsPath))
+ iepTransPath = os.path.join(iep.iepDir, 'resources', 'translations')
+
+ # Get possible names for language files
+ # (because Qt's .tr files may not have the language component.)
+ localeName1 = locale.name()
+ localeName2 = localeName1.split('_')[0]
+
+ # Uninstall translators
+ if not hasattr(QtCore, '_translators'):
+ QtCore._translators = []
+ for trans in QtCore._translators:
+ QtGui.QApplication.removeTranslator(trans)
+
+ # The default language
+ if localeName1 == 'C':
+ return locale
+
+ # Set Qt translations
+ # Note that the translator instances must be stored
+ # Note that the load() method is very forgiving with the file name
+ for what, where in [('qt', qtTransPath),('iep', iepTransPath)]:
+ trans = QtCore.QTranslator()
+ # Try loading both names
+ for localeName in [localeName1, localeName2]:
+ success = trans.load(what + '_' + localeName + '.tr', where)
+ if success:
+ QtGui.QApplication.installTranslator(trans)
+ QtCore._translators.append(trans)
+ print('loading %s %s: ok' % (what, languageName))
+ break
+ else:
+ print('loading %s %s: failed' % (what, languageName))
+
+ # Done
+ return locale
+
+
+
+class Translation(str):
+ """ Derives from str class. The translate function returns an instance
+ of this class and assigns extra atrributes:
+ * original: the original text passed to the translation
+ * tt: the tooltip text
+ * key: the original text without tooltip (used by menus as a key)
+
+ We adopt a simple system to include tooltip text in the same
+ translation as the label text. By including ":::" in the text,
+ the text after that identifier is considered the tooltip.
+ The text returned by the translate function is always the
+ string without tooltip, but the text object has an attribute
+ "tt" that stores the tooltip text. In this way, if you do not
+ use this feature or do not know about this feature, everything
+ keeps working as expected.
+ """
+ pass
+
+
+def _splitMainAndTt(s):
+ if ':::' in s:
+ parts = s.split(':::', 1)
+ return parts[0].rstrip(), parts[1].lstrip()
+ else:
+ return s, ''
+
+
+def translate(context, text, disambiguation=None):
+ """ translate(context, text, disambiguation=None)
+ The translate function used throughout IEP.
+ """
+ # Get translation and split tooltip
+ newtext = QtCore.QCoreApplication.translate(context, text, disambiguation)
+ s, tt = _splitMainAndTt(newtext)
+ # Create translation object (string with extra attributes)
+ translation = Translation(s)
+ translation.original = text
+ translation.tt = tt
+ translation.key = _splitMainAndTt(text)[0].strip()
+ return translation
+
+
+
+## Development tools
+import subprocess
+
+LHELP = """
+Language help - info for translaters
+
+For translating, you will need a set of working Qt language tools:
+pyside-lupdate, linguist, lrelease. On Windows, these should come
+with your PySide installation. On (Ubuntu) Linux, you can install
+these with 'sudo apt-get install pyside-tools qt4-dev-tools'.
+
+You also need to run IEP from source as checked out from the repo
+(e.g. by running ieplauncher.py).
+
+To create a new language:
+ * the file 'iep/util/locale.py' should be edited to add the language
+ to the LANGUAGES dict
+ * run 'linguist(your_lang)', this will raise an erro, but it will show
+ the name of the .tr file
+ * the file 'iep/iep.pro' should be edited to include the new .tr file
+ * run 'lupdate()' to create the .tr file
+ * run 'linguist(your_lang)' again to initialize the .tr file.
+
+To update a language:
+ * run 'lupdate()'
+ * run 'linguist(your_lang)'
+ * make all the translations and save
+ * run lrelease() and restart IEP to see translations
+ * repeat if necessary
+
+"""
+
+def lhelp():
+ """ lhelp()
+ Print help text on using the language tools.
+ """
+ print(LHELP)
+
+
+def linguist(languageName):
+ """ linguist(languageName)
+ Open linguist with the language file as specified by lang. The
+ languageName can be one of the fields as visible in the language
+ list in the menu. This function is intended for translators.
+ """
+ # Get locale
+ locale = getLocale(languageName)
+
+ # Get file to open
+ fname = 'iep_{}.tr'.format(locale.name())
+ filename = os.path.join(iep.iepDir, 'resources', 'translations', fname)
+ if not os.path.isfile(filename):
+ raise ValueError('Could not find {}'.format(filename))
+
+ # Get Command for linguist
+ pysideDir = os.path.abspath(os.path.dirname(iep.QtCore.__file__))
+ ISWIN = sys.platform.startswith('win')
+ exe_ = 'linguist' + '.exe' * ISWIN
+ exe = os.path.join(pysideDir, exe_)
+ if not os.path.isfile(exe):
+ exe = exe_
+
+ # Spawn process
+ return subprocess.Popen([exe , filename])
+
+
+def lupdate():
+ """ For developers. From iep.pro create the .tr files
+ """
+ # Get file to open
+ fname = 'iep.pro'
+ filename = os.path.realpath(os.path.join(iep.iepDir, '..', fname))
+ if not os.path.isfile(filename):
+ raise ValueError('Could not find {}. This function must run from the source repo.'.format(fname))
+
+ # Get Command for python lupdate
+ pysideDir = os.path.abspath(os.path.dirname(iep.QtCore.__file__))
+ ISWIN = sys.platform.startswith('win')
+ exe_ = 'pyside-lupdate' + '.exe' * ISWIN
+ exe = os.path.join(pysideDir, exe_)
+ if not os.path.isfile(exe):
+ exe = exe_
+
+ # Spawn process
+ cmd = [exe, '-noobsolete', '-verbose', filename]
+ p = subprocess.Popen(cmd, shell=False, stdout=subprocess.PIPE, stderr=subprocess.STDOUT)
+ while p.poll() is None:
+ time.sleep(0.1)
+ output = p.stdout.read().decode('utf-8')
+ if p.returncode:
+ raise RuntimeError('lupdate failed (%i): %s' % (p.returncode, output))
+ else:
+ print(output)
+
+
+def lrelease():
+ """ For developers. From iep.pro and the .tr files, create the .qm files.
+ """
+ # Get file to open
+ fname = 'iep.pro'
+ filename = os.path.realpath(os.path.join(iep.iepDir, '..', fname))
+ if not os.path.isfile(filename):
+ raise ValueError('Could not find {}. This function must run from the source repo.'.format(fname))
+
+ # Get Command for lrelease
+ pysideDir = os.path.abspath(os.path.dirname(iep.QtCore.__file__))
+ ISWIN = sys.platform.startswith('win')
+ exe_ = 'lrelease' + '.exe' * ISWIN
+ exe = os.path.join(pysideDir, exe_)
+ if not os.path.isfile(exe):
+ exe = exe_
+
+ # Spawn process
+ cmd = [exe, filename]
+ p = subprocess.Popen(cmd, shell=False, stdout=subprocess.PIPE, stderr=subprocess.STDOUT)
+ while p.poll() is None:
+ time.sleep(0.1)
+ output = p.stdout.read().decode('utf-8')
+ if p.returncode:
+ raise RuntimeError('lrelease failed (%i): %s' % (p.returncode, output))
+ else:
+ print(output)
+
+
+if __name__ == '__main__':
+ # Print names of translator files
+
+ print('Language data files:')
+ for key in LANGUAGES:
+ s = '{}: {}'.format(key, getLocale(key).name()+'.tr')
+ print(s)
diff --git a/iep/yoton/__init__.py b/iep/yoton/__init__.py
new file mode 100644
index 0000000..c953b7e
--- /dev/null
+++ b/iep/yoton/__init__.py
@@ -0,0 +1,95 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+
+"""
+Yoton is a Python package that provides a simple interface
+to communicate between two or more processes.
+
+Yoton is ...
+ * lightweight
+ * written in pure Python
+ * without dependencies (except Python)
+ * available on Python version >= 2.4, including Python 3
+ * cross-platform
+ * pretty fast
+
+"""
+
+# Import stuff from misc and events
+from yoton.misc import UID, str, bytes
+from yoton.events import Signal, Timer, app
+
+# Inject app function in yoton namespace for convenience
+call_later = app.call_later
+process_events = app.process_events
+start_event_loop = app.start_event_loop
+stop_event_loop = app.stop_event_loop
+embed_event_loop = app.embed_event_loop
+
+# Import more
+from yoton.core import Package
+from yoton.connection import Connection, ConnectionCollection
+from yoton.connection_tcp import TcpConnection
+from yoton.context import Context
+from yoton.clientserver import RequestServer, do_request
+from yoton.channels import *
+
+
+# Set yoton version
+__version__ = '2.2'
+
+
+# Define convenience class
+class SimpleSocket(Context):
+ """ SimpleSocket()
+
+ A simple socket has an API similar to a BSD socket. This socket
+ sends whole text messages from one end to the other.
+
+ This class subclasses the Yoton.Context class, which makes setting
+ up this socket very easy.
+
+ Example
+ -------
+ # One end
+ s = SimpleSocket()
+ s.bind('localhost:test')
+ s.send("Hi")
+
+ # Other end
+ s = SimpleSocket()
+ s.connect('localhost:test')
+ print(s.recv())
+
+ """
+
+ def __init__(self, verbose=False):
+ Context.__init__(self, verbose)
+
+ # Create channels
+ self._cs = PubChannel(self, 'text')
+ self._cr = SubChannel(self, 'text')
+
+ def send(self, s):
+ """ send(message)
+
+ Send a text message. The message is queued and send
+ over the socket by the IO-thread.
+
+ """
+ self._cs.send(s)
+
+ def recv(self, block=None):
+ """ recv(block=None):
+
+ Read a text from the channel. What was send as one message is
+ always received as one message.
+
+ If the channel is closed and all messages are read, returns ''.
+
+ """
+ return self._cr.recv(block)
diff --git a/iep/yoton/channels/__init__.py b/iep/yoton/channels/__init__.py
new file mode 100644
index 0000000..f690c45
--- /dev/null
+++ b/iep/yoton/channels/__init__.py
@@ -0,0 +1,21 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+"""
+
+The channel classes represent the mechanism for the user to send
+messages into the network and receive messages from it. A channel
+needs a context to function; the context represents a node in the
+network.
+
+"""
+
+from yoton.channels.message_types import MessageType, TEXT, BINARY, OBJECT
+from yoton.channels.channels_base import BaseChannel
+from yoton.channels.channels_pubsub import PubChannel, SubChannel, select_sub_channel
+from yoton.channels.channels_reqrep import ReqChannel, RepChannel, Future, TimeoutError, CancelledError
+from yoton.channels.channels_state import StateChannel
+from yoton.channels.channels_file import FileWrapper
diff --git a/iep/yoton/channels/channels_base.py b/iep/yoton/channels/channels_base.py
new file mode 100644
index 0000000..6c134a7
--- /dev/null
+++ b/iep/yoton/channels/channels_base.py
@@ -0,0 +1,365 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module yoton.channels.channels_base
+
+Defines the base channel class and the MessageType class.
+
+"""
+
+import time
+import threading
+
+import yoton
+from yoton.misc import basestring, bytes, str
+from yoton.misc import Property, getErrorMsg, slot_hash, PackageQueue
+from yoton.core import Package
+from yoton.context import Context
+from yoton.channels.message_types import MessageType, BINARY, TEXT, OBJECT
+
+
+class BaseChannel(object):
+ """ BaseChannel(context, slot_base, message_type=yoton.TEXT)
+
+ Abstract class for all channels.
+
+ Parameters
+ ----------
+ context : yoton.Context instance
+ The context that this channel uses to send messages in a network.
+ slot_base : string
+ The base slot name. The channel appends an extension to indicate
+ message type and messaging pattern to create the final slot name.
+ The final slot is used to connect channels at different contexts
+ in a network
+ message_type : yoton.MessageType instance
+ (default is yoton.TEXT)
+ Object to convert messages to bytes and bytes to messages.
+ Users can create their own message_type class to enable
+ communicating any type of message they want.
+
+ Details
+ -------
+ Messages send via a channel are delivered asynchronically to the
+ corresponding channels.
+
+ All channels are associated with a context and can be used to send
+ messages to other channels in the network. Each channel is also
+ associated with a slot, which is a string that represents a kind
+ of address. A message send by a channel at slot X can only be received
+ by a channel with slot X.
+
+ Note that the channel appends an extension
+ to the user-supplied slot name, that represents the message type
+ and messaging pattern of the channel. In this way, it is prevented
+ that for example a PubChannel can communicate with a RepChannel.
+
+ """
+
+ def __init__(self, context, slot_base, message_type=None):
+
+ # Store context
+ if not isinstance(context, Context):
+ raise ValueError('Context not valid.')
+ self._context = context
+
+ # Check message type
+ if message_type is None:
+ message_type = TEXT
+ if isinstance(message_type, type) and issubclass(message_type, MessageType):
+ message_type = message_type()
+ if isinstance(message_type, MessageType):
+ message_type = message_type
+ else:
+ raise ValueError('message_type should be a MessageType instance.')
+
+ # Store message type and conversion methods
+ self._message_type_instance = message_type
+ self.message_from_bytes = message_type.message_from_bytes
+ self.message_to_bytes = message_type.message_to_bytes
+
+ # Queue for incoming trafic (not used for pure sending channels)
+ self._q_in = PackageQueue(*context._queue_params)
+
+ # For sending channels: to lock the channel for sending
+ self._send_condition = threading.Condition()
+ self._is_send_locked = 0 # "True" is the timeout time
+
+ # Signal for receiving data
+ self._received_signal = yoton.events.Signal()
+ self._posted_received_event = False
+
+ # Channels can be closed
+ self._closed = False
+
+ # Event driven mode
+ self._run_mode = 0
+
+ # Init slots
+ self._init_slots(slot_base)
+
+
+ def _init_slots(self, slot_base):
+ """ _init_slots(slot_base)
+
+ Called from __init__ to initialize the slots and perform all checks.
+
+ """
+
+ # Check if slot is string
+ if not isinstance(slot_base, basestring):
+ raise ValueError('slot_base must be a string.')
+
+ # Get full slot names, init byte versions
+ slots_t = []
+ slots_h = []
+
+ # Get extension for message type and messaging pattern
+ ext_type = self._message_type_instance.message_type_name()
+ ext_patterns = self._messaging_patterns() # (incoming, outgoing)
+
+ # Normalize and check slot names
+ for ext_pattern in ext_patterns:
+ if not ext_pattern:
+ slots_t.append(None)
+ slots_h.append(0)
+ continue
+ # Get full name
+ slot = slot_base + '.' + ext_type + '.' + ext_pattern
+ # Store text version
+ slots_t.append(slot)
+ # Strip and make lowercase
+ slot = slot.strip().lower()
+ # Hash
+ slots_h.append(slot_hash(slot))
+
+ # Store slots
+ self._slot_out = slots_t[0]
+ self._slot_in = slots_t[1]
+ self._slot_out_h = slots_h[0]
+ self._slot_in_h = slots_h[1]
+
+ # Register slots (warn if neither slot is valid)
+ if self._slot_out_h:
+ self._context._register_sending_channel(self, self._slot_out_h, self._slot_out)
+ if self._slot_in_h:
+ self._context._register_receiving_channel(self, self._slot_in_h, self._slot_in)
+ if not self._slot_out_h and not self._slot_in_h:
+ raise ValueError('This channel does not have valid slots.')
+
+
+ def _messaging_patterns(self):
+ """ _messaging_patterns()
+
+ Implement to return a string that specifies the pattern
+ for sending and receiving, respecitively.
+
+ """
+ raise NotImplementedError()
+
+
+ def close(self):
+ """ close()
+
+ Close the channel, i.e. unregisters this channel at the context.
+ A closed channel cannot be reused.
+
+ Future attempt to send() messages will result in an IOError
+ being raised. Messages currently in the channel's queue can
+ still be recv()'ed, but no new messages will be delivered at
+ this channel.
+
+ """
+ # We keep a reference to the context, otherwise we need locks
+ # The context clears the reference to this channel when unregistering.
+ self._closed = True
+ self._context._unregister_channel(self)
+
+
+ def _send(self, message, dest_id=0, dest_seq=0):
+ """ _send(message, dest_id=0, dest_seq=0)
+
+ Sends a message of raw bytes without checking whether they're bytes.
+ Optionally, dest_id and dest_seq represent the message that
+ this message replies to. These are used for the request/reply
+ pattern.
+
+ Returns the package that will be send (or None). The context
+ will set _source_id on the package right before
+ sending it away.
+
+ """
+
+ # Check if still open
+ if self._closed:
+ className = self.__class__.__name__
+ raise IOError("Cannot send from closed %s %i." % (className, id(self)))
+
+
+ if message:
+ # If send_locked, wait at most one second
+ if self._is_send_locked:
+ self._send_condition.acquire()
+ try:
+ self._send_condition.wait(1.0) # wait for notify
+ finally:
+ self._send_condition.release()
+ if time.time() > self._is_send_locked:
+ self._is_send_locked = 0
+ # Push it on the queue as a package
+ slot = self._slot_out_h
+ cid = self._context._id
+ p = Package(message, slot, cid, 0, dest_id, dest_seq, 0)
+ self._context._send_package(p)
+ # Return package
+ return p
+ else:
+ return None
+
+
+ def _recv(self, block):
+ """ _recv(block)
+
+ Receive a package (or None).
+
+ """
+
+ if block is True:
+ # Block for 0.25 seconds so that KeyboardInterrupt works
+ while not self._closed:
+ try:
+ return self._q_in.pop(0.25)
+ except self._q_in.Empty:
+ continue
+
+ else:
+ # Block normal
+ try:
+ return self._q_in.pop(block)
+ except self._q_in.Empty:
+ return None
+
+
+ def _set_send_lock(self, value):
+ """ _set_send_lock(self, value)
+
+ Set or unset the blocking for the _send() method.
+
+ """
+ # Set send lock variable. We adopt a timeout (10s) just in case
+ # the SubChannel that locks the PubChannel gets disconnected and
+ # is unable to unlock it.
+ if value:
+ self._is_send_locked = time.time() + 10.0
+ else:
+ self._is_send_locked = 0
+ # Notify any threads that are waiting in _send()
+ if not value:
+ self._send_condition.acquire()
+ try:
+ self._send_condition.notifyAll()
+ finally:
+ self._send_condition.release()
+
+
+ ## How packages are inserted in this channel for receiving
+
+
+ def _inject_package(self, package):
+ """ _inject_package(package)
+
+ Same as _recv_package, but by definition do not block.
+ _recv_package is overloaded in SubChannel. _inject_package is not.
+
+ """
+ self._q_in.push(package)
+ self._maybe_emit_received()
+
+
+ def _recv_package(self, package):
+ """ _recv_package(package)
+
+ Put package in the queue.
+
+ """
+ self._q_in.push(package)
+ self._maybe_emit_received()
+
+
+ def _maybe_emit_received(self):
+ """ _maybe_emit_received()
+
+ We want to emit a signal, but in such a way that multiple
+ arriving packages result in a single emit. This methods
+ only posts an event if it has not been done, or if the previous
+ event has been handled.
+
+ """
+ if not self._posted_received_event:
+ self._posted_received_event = True
+ event = yoton.events.Event(self._emit_received)
+ yoton.app.post_event(event)
+
+
+ def _emit_received(self):
+ """ _emit_received()
+
+ Emits the "received" signal. This method is called once new data
+ has been received. However, multiple arrived messages may
+ result in a single call to this method. There is also no
+ guarantee that recv() has not been called in the mean time.
+
+ Also sets the variabele so that a new event for this may be
+ created. This method is called from the event loop.
+
+ """
+ self._posted_received_event = False # Reset
+ self.received.emit_now(self)
+
+
+ # Received property sits on the BaseChannel because is is used by almost
+ # all channels. Note that PubChannels never emit this signal as they
+ # catch status messages from the SubChannel by overloading _recv_package().
+ @property
+ def received(self):
+ """ Signal that is emitted when new data is received. Multiple
+ arrived messages may result in a single call to this method.
+ There is no guarantee that recv() has not been called in the
+ mean time. The signal is emitted with the channel instance
+ as argument.
+ """
+ return self._received_signal
+
+
+ ## Properties
+
+
+ @property
+ def pending(self):
+ """ Get the number of pending incoming messages.
+ """
+ return len(self._q_in)
+
+
+ @property
+ def closed(self):
+ """ Get whether the channel is closed.
+ """
+ return self._closed
+
+
+ @property
+ def slot_outgoing(self):
+ """ Get the outgoing slot name.
+ """
+ return self._slot_out
+
+
+ @property
+ def slot_incoming(self):
+ """ Get the incoming slot name.
+ """
+ return self._slot_in
diff --git a/iep/yoton/channels/channels_file.py b/iep/yoton/channels/channels_file.py
new file mode 100644
index 0000000..97aedc7
--- /dev/null
+++ b/iep/yoton/channels/channels_file.py
@@ -0,0 +1,165 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module yoton.channels.file
+
+Defines a class that can be used to wrap a channel to give it
+a file like interface.
+
+"""
+
+import sys
+from yoton.misc import basestring, bytes, str, long
+from yoton.channels import PubChannel, SubChannel
+
+PY2 = sys.version_info[0] == 2
+
+
+class FileWrapper:
+ """ FileWrapper(channel, chunksize=0, echo=None)
+
+ Class that wraps a PubChannel or SubChannel instance to provide
+ a file-like interface by implementing methods such as read() and
+ write(), and other stuff specified in:
+ [[http://docs.python.org/library/stdtypes.html#bltin-file-objects]]
+
+ The file wrapper also splits messages into smaller messages if they
+ are above the chunksize (only if chunksize > 0).
+
+ On Python 2, the read methods return str (utf-8 encoded Unicode).
+
+ """
+
+ # Our file-like objects should not implement:
+ # explicitly stated: fileno, isatty
+ # don't seem to make sense: readlines, seek, tell, truncate, errors,
+ # mode, name,
+
+ def __init__(self, channel, chunksize=0, echo=None):
+ if not isinstance(channel, (PubChannel, SubChannel)):
+ raise ValueError('FileWrapper needs a PubChannel or SubChannel.')
+ if echo is not None:
+ if not isinstance(echo, PubChannel):
+ raise ValueError('FileWrapper echo needs to be a PubChannel.')
+
+ self._channel = channel
+ self._chunksize = int(chunksize)
+ self._echo = echo
+
+
+ @property
+ def encoding(self):
+ """ The encoding used to encode strings to bytes and vice versa.
+ """
+ return 'UTF-8'
+
+
+ @property
+ def closed(self):
+ """ Get whether the file is closed.
+ """
+ return self._channel._closed
+
+
+ def flush(self):
+ """ flush()
+
+ Wait here until all messages have been send.
+
+ """
+ context = self._channel._context.flush()
+
+
+ @property
+ def newlines(self):
+ """ The type of newlines used. Returns None; we never know what the
+ other end could be sending!
+ """
+ return None
+
+
+ # this is for the print statement to keep track spacing stuff
+ def _set_softspace(self, value):
+ self._softspace = bool(value)
+ def _get_softspace(self):
+ return hasattr(self, '_softspace') and self._softspace
+ softspace = property(_get_softspace, _set_softspace, None, '')
+
+
+ def read(self, block=None):
+ """ read(block=None)
+
+ Alias for recv().
+
+ """
+ res = self._channel.recv(block)
+ if res and self._echo is not None:
+ self._echo.send(res)
+ if PY2:
+ return res.encode('utf-8')
+ else:
+ return res
+
+
+ def write(self, message):
+ """ write(message)
+
+ Uses channel.send() to send the message over the Yoton network.
+ The message is partitioned in smaller parts if it is larger than
+ the chunksize.
+
+ """
+ chunkSize = self._chunksize
+ if chunkSize > 0:
+ for i in range(0, len(message), chunkSize):
+ self._channel.send( message[i:i+chunkSize] )
+ else:
+ self._channel.send(message)
+
+
+ def writelines(self, lines):
+ """ writelines(lines)
+
+ Write a sequence of messages to the channel.
+
+ """
+ for line in lines:
+ self._channel.send(line)
+
+
+ def readline(self, size=0):
+ """ readline(size=0)
+
+ Read one string that was send as one from the other end (always
+ in blocking mode). A newline character is appended if it does not
+ end with one.
+
+ If size is given, returns only up to that many characters, the rest
+ of the message is thrown away.
+
+ """
+
+ # Get line
+ line = self._channel.recv(True)
+
+ # Echo
+ if line and self._echo is not None:
+ self._echo.send(line)
+
+ # Make sure it ends with newline
+ if not line.endswith('\n'):
+ line += '\n'
+
+ # Decrease size?
+ if size:
+ line = line[:size]
+
+ # Done
+ if PY2:
+ return line.encode('utf-8')
+ else:
+ return line
+
diff --git a/iep/yoton/channels/channels_pubsub.py b/iep/yoton/channels/channels_pubsub.py
new file mode 100644
index 0000000..135ac70
--- /dev/null
+++ b/iep/yoton/channels/channels_pubsub.py
@@ -0,0 +1,409 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module yoton.channels.channels_pubsub
+
+Defines the channel classes for the pub/sub pattern.
+
+"""
+
+import time
+import sys
+
+import yoton
+from yoton.misc import basestring, bytes, str, xrange
+from yoton.misc import Property, getErrorMsg
+from yoton.channels import BaseChannel
+from yoton.core import Package
+
+QUEUE_NULL = 0
+QUEUE_OK = 1
+QUEUE_FULL = 2
+
+
+class PubChannel(BaseChannel):
+ """ PubChannel(context, slot_base, message_type=yoton.TEXT)
+
+ The publish part of the publish/subscribe messaging pattern.
+ Sent messages are received by all yoton.SubChannel instances with
+ the same slot.
+
+ There are no limitations for this channel if events are not processed.
+
+ Parameters
+ ----------
+ context : yoton.Context instance
+ The context that this channel uses to send messages in a network.
+ slot_base : string
+ The base slot name. The channel appends an extension to indicate
+ message type and messaging pattern to create the final slot name.
+ The final slot is used to connect channels at different contexts
+ in a network
+ message_type : yoton.MessageType instance
+ (default is yoton.TEXT)
+ Object to convert messages to bytes and bytes to messages.
+ Users can create their own message_type class to let channels
+ any type of message they want.
+
+ """
+
+ def __init__(self, *args, **kwargs):
+ BaseChannel.__init__(self, *args, **kwargs)
+ self._source_set = set()
+
+
+ def _messaging_patterns(self):
+ return 'pub-sub', 'sub-pub'
+
+
+ def send(self, message):
+ """ send(message)
+
+ Send a message over the channel. What is send as one
+ message will also be received as one message.
+
+ The message is queued and delivered to all corresponding
+ SubChannels (i.e. with the same slot) in the network.
+
+ """
+ self._send( self.message_to_bytes(message) )
+
+
+ def _recv_package(self, package):
+ """ Overloaded to set blocking mode.
+ Do not call _maybe_emit_received(), a PubChannel never emits
+ the "received" signal.
+ """
+
+ message = package._data.decode('utf-8')
+ source_id = package._source_id
+
+ # Keep track of who's queues are full
+ if message == 'full':
+ self._source_set.add(source_id)
+ else:
+ self._source_set.discard(source_id)
+
+ # Set lock if there is a channel with a full queue,
+ # Unset if there are none
+ if self._source_set:
+ self._set_send_lock(True)
+ #sys.stderr.write('setting lock\n')
+ else:
+ self._set_send_lock(False)
+ #sys.stderr.write('unsetting lock\n')
+
+
+
+class SubChannel(BaseChannel):
+ """ SubChannel(context, slot_base, message_type=yoton.TEXT)
+
+ The subscribe part of the publish/subscribe messaging pattern.
+ Received messages were sent by a yoton.PubChannel instance at the
+ same slot.
+
+ This channel can be used as an iterator, which yields all pending
+ messages. The function yoton.select_sub_channel can
+ be used to synchronize multiple SubChannel instances.
+
+ If no events being processed this channel works as normal, except
+ that the received signal will not be emitted, and sync mode will
+ not work.
+
+ Parameters
+ ----------
+ context : yoton.Context instance
+ The context that this channel uses to send messages in a network.
+ slot_base : string
+ The base slot name. The channel appends an extension to indicate
+ message type and messaging pattern to create the final slot name.
+ The final slot is used to connect channels at different contexts
+ in a network
+ message_type : yoton.MessageType instance
+ (default is yoton.TEXT)
+ Object to convert messages to bytes and bytes to messages.
+ Users can create their own message_type class to let channels
+ any type of message they want.
+
+ """
+
+ def __init__(self, *args, **kwargs):
+ BaseChannel.__init__(self, *args, **kwargs)
+
+ # To detect when to block the sending side
+ self._queue_status = QUEUE_NULL
+ self._queue_status_timeout = 0
+ self._HWM = 32
+ self._LWM = 16
+
+ # Automatically check queue status when new data
+ # enters the system
+ self.received.bind(self._check_queue_status)
+
+
+ def _messaging_patterns(self):
+ return 'sub-pub', 'pub-sub'
+
+
+ def __iter__(self):
+ return self
+
+
+ def __next__(self): # Python 3.x
+ m = self.recv(False)
+ if m:
+ return m
+ else:
+ raise StopIteration()
+
+
+ def next(self): # Python 2.x
+ """ next()
+
+ Return the next message, or raises StopIteration if non available.
+
+ """
+ return self.__next__()
+
+
+ ## For sync mode
+
+ def set_sync_mode(self, value):
+ """ set_sync_mode(value)
+
+ Set or unset the SubChannel in sync mode. When in sync mode, all
+ channels that send messages to this channel are blocked if
+ the queue for this SubChannel reaches a certain size.
+
+ This feature can be used to limit the rate of senders if the consumer
+ (i.e. the one that calls recv()) cannot keep up with processing
+ the data.
+
+ This feature requires the yoton event loop to run at the side
+ of the SubChannel (not necessary for the yoton.PubChannel side).
+
+ """
+ value = bool(value)
+
+ # First reset block status if necessary
+ if self._queue_status == QUEUE_FULL:
+ self._send_block_message_to_senders('ok')
+
+ # Set new queue status flag
+ if value:
+ self._queue_status = QUEUE_OK
+ else:
+ self._queue_status = QUEUE_NULL
+
+
+ def _send_block_message_to_senders(self, what):
+ """ _send_block_message_to_senders(what)
+
+ Send a message to the PubChannel side to make it block/unblock.
+
+ """
+
+ # Check
+ if not self._context.connection_count:
+ return
+
+ # Send
+ try:
+ self._send(what.encode('utf-8'))
+ except IOError:
+ # If self._closed
+ self._check_queue_status = QUEUE_NULL
+
+
+ def _check_queue_status(self, dummy=None):
+ """ _check_queue_status()
+
+ Check the queue status. Returns immediately unless this receiving
+ channel runs in sync mode.
+
+ If the queue is above a certain size, will send out a package that
+ will make the sending side block. If the queue is below a certain
+ size, will send out a package that will make the sending side unblock.
+
+ """
+
+ if self._queue_status == QUEUE_NULL:
+ return
+ elif len(self._q_in) > self._HWM:
+ if self._queue_status == QUEUE_OK:
+ self._queue_status = QUEUE_FULL
+ self._queue_status_timeout = time.time() + 4.0
+ self._send_block_message_to_senders('full')
+ elif len(self._q_in) < self._LWM:
+ if self._queue_status == QUEUE_FULL:
+ self._queue_status = QUEUE_OK
+ self._queue_status_timeout = time.time() + 4.0
+ self._send_block_message_to_senders('ok')
+
+ # Resend every so often. After 10s the PubChannel will unlock itself
+ if self._queue_status_timeout < time.time():
+ self._queue_status_timeout = time.time() + 4.0
+ if self._queue_status == QUEUE_OK:
+ self._send_block_message_to_senders('ok')
+ else:
+ self._send_block_message_to_senders('full')
+
+
+ ## Receive methods
+
+
+ def recv(self, block=True):
+ """ recv(block=True)
+
+ Receive a message from the channel. What was send as one
+ message is also received as one message.
+
+ If block is False, returns empty message if no data is available.
+ If block is True, waits forever until data is available.
+ If block is an int or float, waits that many seconds.
+ If the channel is closed, returns empty message.
+
+ """
+
+ # Check queue status, maybe we need to block the sender
+ self._check_queue_status()
+
+ # Get package
+ package = self._recv(block)
+
+ # Return message content or None
+ if package is not None:
+ return self.message_from_bytes(package._data)
+ else:
+ return self.message_from_bytes(bytes())
+
+
+ def recv_all(self):
+ """ recv_all()
+
+ Receive a list of all pending messages. The list can be empty.
+
+ """
+
+ # Check queue status, maybe we need to block the sender
+ self._check_queue_status()
+
+ # Pop all messages and return as a list
+ pop = self._q_in.pop
+ packages = [pop() for i in xrange(len(self._q_in))]
+ return [self.message_from_bytes(p._data) for p in packages]
+
+
+ def recv_selected(self):
+ """ recv_selected()
+
+ Receive a list of messages. Use only after calling
+ yoton.select_sub_channel with this channel as one of the arguments.
+
+ The returned messages are all received before the first pending
+ message in the other SUB-channels given to select_sub_channel.
+
+ The combination of this method and the function select_sub_channel
+ enables users to combine multiple SUB-channels in a way that
+ preserves the original order of the messages.
+
+ """
+
+ # No need to check queue status, we've done that in the
+ # _get_pending_sequence_numbers() method
+
+ # Prepare
+ q = self._q_in
+ ref_seq = self._ref_seq
+ popped = []
+
+ # Pop all messages that have sequence number lower than reference
+ try:
+ for i in xrange(len(q)):
+ part = q.pop()
+ if part._recv_seq > ref_seq:
+ q.insert(part) # put back in queue
+ break
+ else:
+ popped.append(part)
+ except IndexError:
+ pass
+
+ # Done; return messages
+ return [self.message_from_bytes(p._data) for p in popped]
+
+
+ def _get_pending_sequence_numbers(self):
+ """ _get_pending_sequence_numbers()
+
+ Get the sequence numbers of the first and last pending messages.
+ Returns (-1,-1) if no messages are pending.
+
+ Used by select_sub_channel() to determine which channel should
+ be read from first and what the reference sequence number is.
+
+ """
+
+ # Check queue status, maybe we need to block the sender
+ self._check_queue_status()
+
+ # Peek
+ try:
+ q = self._q_in
+ return q.peek(0)._recv_seq, q.peek(-1)._recv_seq + 1
+ except IndexError:
+ return -1, -1
+
+
+
+def select_sub_channel(*args):
+ """ select_sub_channel(channel1, channel2, ...)
+
+ Returns the channel that has the oldest pending message of all
+ given yoton.SubCannel instances. Returns None if there are no pending
+ messages.
+
+ This function can be used to read from SubCannels instances in the
+ order that the messages were send.
+
+ After calling this function, use channel.recv_selected() to obtain
+ all messages that are older than any pending messages in the other
+ given channels.
+
+ """
+
+ # Init
+ smallest_seq1 = 99999999999999999999999999
+ smallest_seq2 = 99999999999999999999999999
+ first_channel = None
+
+ # For each channel ...
+ for channel in args:
+
+ # Check if channel is of right type
+ if not isinstance(channel, SubChannel):
+ raise ValueError('select_sub_channel() only accepts SUB channels.')
+
+ # Get and check sequence
+ seq1, seq2 = channel._get_pending_sequence_numbers()
+ if seq1 >= 0:
+ if seq1 < smallest_seq1:
+ # Cannot go beyond number of packages in queue,
+ # or than seq1 of earlier selected channel.
+ smallest_seq2 = min(smallest_seq1, smallest_seq2, seq2)
+ # Store
+ smallest_seq1 = seq1
+ first_channel = channel
+ else:
+ # The first_channel cannot go beyond the 1st package in THIS queue
+ smallest_seq2 = min(smallest_seq2, seq1)
+
+ # Set flag at channel and return
+ if first_channel:
+ first_channel._ref_seq = smallest_seq2
+ return first_channel
+ else:
+ return None
diff --git a/iep/yoton/channels/channels_reqrep.py b/iep/yoton/channels/channels_reqrep.py
new file mode 100644
index 0000000..28283bb
--- /dev/null
+++ b/iep/yoton/channels/channels_reqrep.py
@@ -0,0 +1,916 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module yoton.channels.channels_reqprep
+
+Defines the channel classes for the req/rep pattern.
+
+"""
+
+import time
+import threading
+
+import yoton
+from yoton.misc import basestring, bytes, str
+from yoton.misc import Property, getErrorMsg
+from yoton.channels import BaseChannel, OBJECT
+
+
+# For the req/rep channels to negotiate (simple load balancing)
+REQREP_SEQ_REF = 2**63
+
+# Define object to recognize errors
+ERROR_OBJECT = 'yoton_ERROR_HANDLING_REQUEST'
+
+
+# Define exceoptions
+class TimeoutError(Exception):
+ pass
+class CancelledError(Exception):
+ pass
+# # Try loading the exceptions from the concurrency framework
+# # (or maybe not; it makes yoton less lightweight)
+# try:
+# from concurrent.futures import TimeoutError, CancelledError
+# except ImportError:
+# pass
+
+
+
+class Future(object):
+ """ Future(req_channel, req, request_id)
+
+ The Future object represents the future result of a request done at
+ a yoton.ReqChannel.
+
+ It enables:
+ * checking whether the request is done.
+ * getting the result or the exception raised during handling the request.
+ * canceling the request (if it is not yet running)
+ * registering callbacks to handle the result when it is available
+
+ """
+
+ def __init__(self, req_channel, req, request_id):
+
+ # For being a Future object
+ self._result = None
+ self._status = 0 # 0:waiting, 1:running, 2:canceled, 3:error, 4:success
+ self._callbacks = []
+
+ # For handling req/rep
+ self._req_channel = req_channel
+ self._req = req
+ self._request_id = request_id
+ self._rep = bytes()
+ self._replier = 0
+
+ # For resending
+ self._first_send_time = time.time()
+ self._next_send_time = self._first_send_time + 0.5
+ self._auto_cancel_timeout = 10.0
+
+
+ def _send(self, msg):
+ """ _send(msg)
+
+ For sending pre-request messages 'req?', 'req-'.
+
+ """
+ msg = msg.encode('utf-8')
+ try:
+ self._req_channel._send(msg, 0, self._request_id+REQREP_SEQ_REF)
+ except IOError:
+ # if self._closed, will call _send again, and catch IOerror,
+ # which will result in one more call to cancel().
+ self.cancel()
+
+
+ def _resend_if_necessary(self):
+ """ _resend_if_necessary()
+
+ Resends the pre-request message if we have not done so for the last
+ 0.5 second.
+
+ This will also auto-cancel the message if it is resend over 20 times.
+
+ """
+ timetime = time.time()
+ if self._status != 0:
+ pass
+ elif timetime > self._first_send_time + self._auto_cancel_timeout:
+ self.cancel()
+ elif timetime > self._next_send_time:
+ self._send('req?')
+ self._next_send_time = timetime + 0.5
+
+
+ def set_auto_cancel_timeout(self, timeout):
+ """ set_auto_cancel_timeout(timeout):
+
+ Set the timeout after which the call is automatically cancelled
+ if it is not done yet. By default, this value is 10 seconds.
+
+ If timeout is None, there is no limit to the wait time.
+
+ """
+ if timeout is None:
+ timeout = 999999999999999999.0
+ if timeout > 0:
+ self._auto_cancel_timeout = float(timeout)
+ else:
+ raise ValueError('A timeout cannot be negative')
+
+
+ def cancel(self):
+ """ cancel()
+
+ Attempt to cancel the call. If the call is currently being executed
+ and cannot be cancelled then the method will return False, otherwise
+ the call will be cancelled and the method will return True.
+
+ """
+
+ if self._status == 1:
+ # Running, cannot cancel
+ return False
+ elif self._status == 0:
+ # Cancel now
+ self._status = 2
+ self._send('req-')
+ for fn in self._callbacks:
+ yoton.call_later(fn, 0, self)
+ return True
+ else:
+ # Already done or canceled
+ return True
+
+
+ def cancelled(self):
+ """ cancelled()
+
+ Return True if the call was successfully cancelled.
+
+ """
+ return self._status == 2
+
+
+ def running(self):
+ """ running()
+
+ Return True if the call is currently being executed and cannot be
+ cancelled.
+
+ """
+ return self._status == 1
+
+
+ def done(self):
+ """ done()
+
+ Return True if the call was successfully cancelled or finished running.
+
+ """
+ return self._status in [2,3,4]
+
+
+ def _wait(self, timeout):
+ """ _wait(timeout)
+
+ Wait for the request to be handled for the specified amount of time.
+ While waiting, the ReqChannel local event loop is called so that
+ pre-request messages can be exchanged.
+
+ """
+
+ # No timout means a veeeery long timeout
+ if timeout is None:
+ timeout = 999999999999999999.0
+
+ # Receive packages untill we receive the one we want,
+ # or untill time runs out
+ timestamp = time.time() + timeout
+ while (self._status < 2) and (time.time() < timestamp):
+ self._req_channel._process_events_local()
+ time.sleep(0.01) # 10 ms
+
+
+ def result(self, timeout=None):
+ """ result(timeout=None)
+
+ Return the value returned by the call. If the call hasn’t yet
+ completed then this method will wait up to timeout seconds. If
+ the call hasn’t completed in timeout seconds, then a TimeoutError
+ will be raised. timeout can be an int or float. If timeout is not
+ specified or None, there is no limit to the wait time.
+
+ If the future is cancelled before completing then CancelledError
+ will be raised.
+
+ If the call raised, this method will raise the same exception.
+
+ """
+
+ # Wait
+ self._wait(timeout)
+
+ # Return or raise error
+ if self._status < 2 :
+ raise TimeoutError('Result unavailable within the specified time.')
+ elif self._status == 2:
+ raise CancelledError('Result unavailable because request was cancelled.')
+ elif self._status == 3:
+ raise self._result
+ else:
+ return self._result
+
+
+ def result_or_cancel(self, timeout=1.0):
+ """ result_or_cancel(timeout=1.0)
+
+ Return the value returned by the call. If the call hasn’t yet
+ completed then this method will wait up to timeout seconds. If
+ the call hasn’t completed in timeout seconds, then the call is
+ cancelled and the method will return None.
+
+ """
+
+ # Wait
+ self._wait(timeout)
+
+ # Return
+ if self._status == 4:
+ return self._result
+ else:
+ self.cancel()
+ return None
+
+
+ def exception(self, timeout=None):
+ """ exception(timeout)
+
+ Return the exception raised by the call. If the call hasn’t yet
+ completed then this method will wait up to timeout seconds. If
+ the call hasn’t completed in timeout seconds, then a TimeoutError
+ will be raised. timeout can be an int or float. If timeout is not
+ specified or None, there is no limit to the wait time.
+
+ If the future is cancelled before completing then CancelledError
+ will be raised.
+
+ If the call completed without raising, None is returned.
+
+ """
+
+ # Wait
+ self._wait(timeout)
+
+ # Return or raise error
+ if self._status < 2 :
+ raise TimeoutError('Exception unavailable within the specified time.')
+ elif self._status == 2:
+ raise CancelledError('Exception unavailable because request was cancelled.')
+ elif self._status == 3:
+ return self._result
+ else:
+ return None # no exception
+
+
+ def add_done_callback(self, fn):
+ """ add_done_callback(fn)
+
+ Attaches the callable fn to the future. fn will be called, with
+ the future as its only argument, when the future is cancelled or
+ finishes running.
+
+ Added callables are called in the order that they were added. If
+ the callable raises a Exception subclass, it will be logged and
+ ignored. If the callable raises a BaseException subclass, the
+ behavior is undefined.
+
+ If the future has already completed or been cancelled, fn will be
+ called immediately.
+
+ """
+
+ # Check
+ if not hasattr(fn, '__call__'):
+ raise ValueError('add_done_callback expects a callable.')
+
+ # Add
+ if self.done():
+ yoton.call_later(fn, 0, self)
+ else:
+ self._callbacks.append(fn)
+
+
+ def set_running_or_notify_cancel(self):
+ """ set_running_or_notify_cancel()
+
+ This method should only be called by Executor implementations before
+ executing the work associated with the Future and by unit tests.
+
+ If the method returns False then the Future was cancelled, i.e.
+ Future.cancel() was called and returned True.
+
+ If the method returns True then the Future was not cancelled and
+ has been put in the running state, i.e. calls to Future.running()
+ will return True.
+
+ This method can only be called once and cannot be called after
+ Future.set_result() or Future.set_exception() have been called.
+
+ """
+
+ if self._status == 2:
+ return False
+ elif self._status == 0:
+ self._status = 1
+ return True
+ else:
+ raise RuntimeError('set_running_or_notify_cancel should be called when in a clear state.')
+
+
+ def set_result(self, result):
+ """ set_result(result)
+
+ Sets the result of the work associated with the Future to result.
+ This method should only be used by Executor implementations and
+ unit tests.
+
+ """
+
+ # Set result if indeed in running state
+ if self._status == 1:
+ self._result = result
+ self._status = 4
+ for fn in self._callbacks:
+ yoton.call_later(fn, 0, self)
+
+
+ def set_exception(self, exception):
+ """ set_exception(exception)
+
+ Sets the result of the work associated with the Future to the
+ Exception exception. This method should only be used by Executor
+ implementations and unit tests.
+
+ """
+
+ # Check
+ if isinstance(exception, basestring):
+ exception = Exception(exception)
+ if not isinstance(exception, Exception):
+ raise ValueError('exception must be an Exception instance.')
+
+ # Set result if indeed in running state
+ if self._status == 1:
+ self._result = exception
+ self._status = 3
+ for fn in self._callbacks:
+ yoton.call_later(fn, 0, self)
+
+
+class ReqChannel(BaseChannel):
+ """ ReqChannel(context, slot_base)
+
+ The request part of the request/reply messaging pattern.
+ A ReqChannel instance sends request and receive the corresponding
+ replies. The requests are replied by a yoton.RepChannel instance.
+
+ This class adopts req/rep in a remote procedure call (RPC) scheme.
+ The handling of the result is done using a yoton.Future object, which
+ follows the approach specified in PEP 3148. Note that for the use
+ of callbacks, the yoton event loop must run.
+
+ Basic load balancing is performed by first asking all potential
+ repliers whether they can handle a request. The actual request
+ is then send to the first replier to respond.
+
+ Parameters
+ ----------
+ context : yoton.Context instance
+ The context that this channel uses to send messages in a network.
+ slot_base : string
+ The base slot name. The channel appends an extension to indicate
+ message type and messaging pattern to create the final slot name.
+ The final slot is used to connect channels at different contexts
+ in a network
+
+ Usage
+ -----
+ One performs a call on a virtual method of this object. The actual
+ method is executed by the yoton.RepChannel instance. The method can be
+ called with normal and keyword arguments, which can be (a
+ combination of): None, bool, int, float, string, list, tuple, dict.
+
+ Example
+ -------
+ # Fast, but process is idling when waiting for the response.
+ reply = req.add(3,4).result(2.0) # Wait two seconds
+
+ # Asynchronous processing, but no waiting.
+ def reply_handler(future):
+ ... # Handle reply
+ future = req.add(3,4)
+ future.add_done_callback(reply_handler)
+
+ """
+
+ # Notes on load balancing:
+ #
+ # Firstly, each request has an id. Which is an integer number
+ # which is increased at each new request. The id is send via
+ # the dest_seq. For pre-request messages an offset is added
+ # to recognize these meta-messages.
+ #
+ # We use an approach I call pre-request. The req channel sends
+ # a pre-request to all repliers (on the same slot) asking whether
+ # they want to handle a request. The content is 'req?' and the
+ # dest_seq is the request-id + offset.
+ #
+ # The repliers collects and queues all pre-requests. It will then
+ # send a reply to acknowledge the first received pre-request. The
+ # content is 'req!' and dest_seq is again request-id + offset.
+ #
+ # The replier is now in a state of waiting for the actual request.
+ # It will not acknowledge pre-requests, but keeps queing them.
+ #
+ # Upon receiving the acknowledge, the requester sends (directed
+ # at only the first replier to acknowledge) the real request.
+ # The content is the real request and dest_seq is the request-id.
+ # Right after this, a pre-request cancel message is sent to all
+ # repliers. The content is 'req-' and dest_seq is request-id + offset.
+ #
+ # When a replier receives a pre-request cancel message, it will
+ # remove the pre-request from the list. If this cancels the
+ # request it was currently waiting for, the replier will go back
+ # to its default state, and acknowledge the first next pre-request
+ # in the queue.
+ #
+ # When the replier answers a request, it will go back to its default
+ # state, and acknowledge the first next pre-request in the queue.
+ # The replier tries to answer as quickly to pre-requests as possible.
+ #
+ # On the request channel, a dictionary of request items is maintained.
+ # Each item has an attribute specifying whether a replier has
+ # acknowledged it (and which one).
+
+
+ def __init__(self, context, slot_base):
+ BaseChannel.__init__(self, context, slot_base, OBJECT)
+
+ # Queue with pending requests
+ self._request_items = {}
+
+ # Timeout
+ self._next_recheck_time = time.time() + 0.2
+
+ # Counter
+ self._request_counter = 0
+
+ # The req channel is always in event driven mode
+ self._run_mode = 1
+
+ # Bind signals to process the events for this channel
+ # Bind to "received" signal for quick response and a timer
+ # so we can resend requests if we do not receive anything.
+ self.received.bind(self._process_events_local)
+ self._timer = yoton.events.Timer(0.5, False)
+ self._timer.bind(self._process_events_local)
+ self._timer.start()
+
+
+ def _messaging_patterns(self):
+ return 'req-rep', 'rep-req'
+
+
+ def __getattr__(self, name):
+ if name.startswith('_'):
+ return object.__getattribute__(self, name)
+ try:
+ return object.__getattribute__(self, name)
+ except AttributeError:
+ def proxy_function(*args, **kwargs):
+ return self._handle_request(name, *args, **kwargs)
+ return proxy_function
+
+
+ def _handle_request(self, name, *args, **kwargs):
+ """ _handle_request(request, callback, **kwargs)
+
+ Post a request. This creates a Future instance and stores
+ it. A message is send asking any repliers to respond.
+
+ The actual request will be send when a reply to our pre-request
+ is received. This all hapens in the yoton event loop.
+
+ """
+
+ # Create request object
+ request = name, args, kwargs
+
+ # Check and convert request message
+ bb = self.message_to_bytes(request)
+
+ # Get new request id
+ request_id = self._request_counter = self._request_counter + 1
+
+ # Create new item for this request and store under the request id
+ item = Future(self, bb, request_id)
+ self._request_items[request_id] = item
+
+ # Send pre-request (ask repliers who want to reply to a request)
+ item._send('req?')
+
+ # Return the Future instance
+ return item
+
+
+ def _resend_requests(self):
+ """ _resend_requests()
+
+ See if we should resend our older requests. Periodically calling
+ this method enables doing a request while the replier is not yet
+ attached to the network.
+
+ This also allows the Future objects to cancel themselves if it
+ takes too long.
+
+ """
+ for request_id in [key for key in self._request_items.keys()]:
+ item = self._request_items[request_id]
+ # Remove items that are really old
+ if item.cancelled():
+ self._request_items.pop(request_id)
+ else:
+ item._resend_if_necessary()
+
+
+ def _recv_item(self):
+ """ _recv_item()
+
+ Receive item. If a reply is send that is an acknowledgement
+ of a replier that it wants to handle our request, the
+ correpsonding request is send to that replier.
+
+ This is a kind of mini-event loop thingy that should be
+ called periodically to keep things going.
+
+ """
+
+ # Receive package
+ package = self._recv(False)
+ if not package:
+ return
+
+ # Get the package reply id and sequence number
+ dest_id = package._dest_id
+ request_id = package._dest_seq
+
+ # Check dest_id
+ if not dest_id:
+ return # We only want messages that are directed directly at us
+ elif dest_id != self._context._id:
+ return # This should not happen; context should make sure
+
+ if request_id > REQREP_SEQ_REF:
+ # We received a reply to us asking who can handle the request.
+ # Get item, send actual request. We set the replier to indicate
+ # that this request is being handled, and we can any further
+ # acknowledgements from other repliers.
+ request_id -= REQREP_SEQ_REF
+ item = self._request_items.get(request_id, None)
+
+ if item and not item._replier:
+ # Status now changes to "running" canceling is not possible
+ ok = item.set_running_or_notify_cancel()
+ if not ok:
+ return
+
+ # Send actual request to specific replier
+ try:
+ self._send(item._req, package._source_id, request_id)
+ except IOError:
+ pass # Channel closed, will auto-cancel at item._send()
+ item._replier = package._source_id # mark as being processed
+
+ # Send pre-request-cancel message to everyone
+ item._send('req-')
+
+ elif request_id > 0:
+ # We received a reply to an actual request
+
+ # Get item, remove from queue, set reply, return
+ item = self._request_items.pop(request_id, None)
+ if item:
+ item._rep = package._data
+ return item
+
+
+ def _process_events_local(self, dummy=None):
+ """ _process_events_local()
+
+ Process events only for this object. Used by _handle_now().
+
+ """
+
+ # Check periodically if we should resend (or clean up) old requests
+ if time.time() > self._next_recheck_time:
+ self._resend_requests()
+ self._next_recheck_time = time.time() + 0.1
+
+ # Process all received messages
+ while self.pending:
+ item = self._recv_item()
+ if item:
+ reply = self.message_from_bytes(item._rep)
+ if isinstance(reply, tuple) and len(reply)==2 and reply[0]==ERROR_OBJECT:
+ item.set_exception(reply[1])
+ else:
+ item.set_result(reply)
+
+
+
+class RepChannel(BaseChannel):
+ """ RepChannel(context, slot_base)
+
+ The reply part of the request/reply messaging pattern.
+ A RepChannel instance receives request and sends the corresponding
+ replies. The requests are send from a yoton.ReqChannel instance.
+
+ This class adopts req/rep in a remote procedure call (RPC) scheme.
+
+ To use a RepChannel, subclass this class and implement the methods
+ that need to be available. The reply should be (a combination of)
+ None, bool, int, float, string, list, tuple, dict.
+
+ This channel needs to be set to event or thread mode to function
+ (in the first case yoton events need to be processed too).
+ To stop handling events again, use set_mode('off').
+
+ Parameters
+ ----------
+ context : yoton.Context instance
+ The context that this channel uses to send messages in a network.
+ slot_base : string
+ The base slot name. The channel appends an extension to indicate
+ message type and messaging pattern to create the final slot name.
+ The final slot is used to connect channels at different contexts
+ in a network
+
+ """
+
+ def __init__(self, context, slot_base):
+ BaseChannel.__init__(self, context, slot_base, OBJECT)
+
+ # Pending pre-requests
+ self._pre_requests = []
+
+ # Current pre-request and time that it was acknowledged
+ self._pre_request = None
+ self._pre_request_time = 0
+
+ # Create thread
+ self._thread = ThreadForReqChannel(self)
+
+ # Create timer (do not start)
+ self._timer = yoton.events.Timer(2.0, False)
+ self._timer.bind(self._process_events_local)
+
+ # By default, the replier is off
+ self._run_mode = 0
+
+
+ def _messaging_patterns(self):
+ return 'rep-req', 'req-rep'
+
+
+ # Node that setters for normal and event_driven mode are specified in
+ # channels_base.py
+ def set_mode(self, mode):
+ """ set_mode(mode)
+
+ Set the replier to its operating mode, or turn it off.
+
+ Modes:
+ * 0 or 'off': do not process requests
+ * 1 or 'event': use the yoton event loop to process requests
+ * 2 or 'thread': process requests in a separate thread
+
+ """
+
+ if isinstance(mode, basestring):
+ mode = mode.lower()
+
+ if mode in [0, 'off']:
+ self._run_mode = 0
+ elif mode in [1, 'event', 'event-driven']:
+ self._run_mode = 1
+ self.received.bind(self._process_events_local)
+ self._timer.start()
+ elif mode in [2, 'thread', 'thread-driven']:
+ self._run_mode = 2
+ if not self._thread.isAlive():
+ self._thread.start()
+ else:
+ raise ValueError('Invalid mode for ReqChannel instance.')
+
+
+ def _handle_request(self, message):
+ """ _handle_request(message)
+
+ This method is called for each request, and should return
+ a reply. The message contains the name of the method to call,
+ this function calls that method.
+
+ """
+ # Get name and args
+ name, args, kwargs = message
+
+ # Get function
+ if not hasattr(self, name):
+ raise RuntimeError("Method '%s' not implemented." % name)
+ else:
+ func = getattr(self, name)
+
+ # Call
+ return func(*args, **kwargs)
+
+
+ def _acknowledge_next_pre_request(self):
+
+ # Cancel current pre-request ourselves if it takes too long.
+ # Failsafe, only for if resetting by requester fails somehow.
+ if time.time() - self._pre_request_time > 10.0:
+ self._pre_request = None
+
+ # Send any pending pre requests
+ if self._pre_requests and not self._pre_request:
+
+ # Set current pre-request and its ack time
+ package = self._pre_requests.pop(0)
+ self._pre_request = package
+ self._pre_request_time = time.time()
+
+ # Send acknowledgement
+ msg = 'req!'.encode('utf-8')
+ try:
+ self._send(msg, package._source_id, package._dest_seq)
+ except IOError:
+ pass # Channel closed, nothing we can do about that
+ #
+ #print 'ack', self._context.id, package._dest_seq-REQREP_SEQ_REF
+
+
+ def _replier_iteration(self, package):
+ """ _replier_iteration()
+
+ Do one iteration: process one request.
+
+ """
+
+ # Get request id
+ request_id = package._dest_seq
+
+ if request_id > REQREP_SEQ_REF:
+ # Pre-request stuff
+
+ # Remove offset
+ request_id -= REQREP_SEQ_REF
+
+ # Get action and pre request id
+ action = package._data.decode('utf-8')
+
+ # Remove pre-request from pending requests in case of both actions:
+ # Cancel pending pre-request, prevent stacking of the same request.
+ for prereq in [prereq for prereq in self._pre_requests]:
+ if ( package._source_id == prereq._source_id and
+ package._dest_seq == prereq._dest_seq):
+ self._pre_requests.remove(prereq)
+
+ if action == 'req-':
+ # Cancel current pre-request
+ if ( self._pre_request and
+ package._source_id == self._pre_request._source_id and
+ package._dest_seq == self._pre_request._dest_seq):
+ self._pre_request = None
+
+ elif action == 'req?':
+ # New pre-request
+ self._pre_requests.append(package)
+
+ else:
+ # We are asked to handle an actual request
+
+ # We can reset the state
+ self._pre_request = None
+
+ # Get request
+ request = self.message_from_bytes(package._data)
+
+ # Get reply
+ try:
+ reply = self._handle_request(request)
+ except Exception:
+ reply = ERROR_OBJECT, getErrorMsg()
+ print('yoton.RepChannel: error handling request:')
+ print(reply[1])
+
+ # Send reply
+ if True:
+ try:
+ bb = self.message_to_bytes(reply)
+ self._send(bb, package._source_id, request_id)
+ except IOError:
+ pass # Channel is closed
+ except Exception:
+ # Probably wrong type of reply returned by handle_request()
+ print('Warning: request could not be send:')
+ print(getErrorMsg())
+
+
+ def _process_events_local(self, dummy=None):
+ """ _process_events_local()
+
+ Called when a message (or more) has been received.
+
+ """
+
+ # If closed, unregister from signal and stop the timer
+ if self.closed or self._run_mode!=1:
+ self.received.unbind(self._process_events_local)
+ self._timer.stop()
+
+ # Iterate while we receive data
+ while True:
+ package = self._recv(False)
+ if package:
+ self._replier_iteration(package)
+ self._acknowledge_next_pre_request()
+ else:
+ # We always enter this the last time
+ self._acknowledge_next_pre_request()
+ return
+
+
+ def echo(self, arg1, sleep=0.0):
+ """ echo(arg1, sleep=0.0)
+
+ Default procedure that can be used for testing. It returns
+ a tuple (first_arg, context_id)
+
+ """
+ time.sleep(sleep)
+ return arg1, hex(self._context.id)
+
+
+
+class ThreadForReqChannel(threading.Thread):
+ """ ThreadForReqChannel(channel)
+
+ Thread to run a RepChannel in threaded mode.
+
+ """
+
+ def __init__(self, channel):
+ threading.Thread.__init__(self)
+
+ # Check channel
+ if not isinstance(channel, RepChannel):
+ raise ValueError('The given channel must be a REP channel.')
+
+ # Store channel
+ self._channel = channel
+
+ # Make deamon
+ self.setDaemon(True)
+
+
+ def run(self):
+ """ run()
+
+ The handler's main loop.
+
+ """
+
+ # Get ref to channel. Remove ref from instance
+ channel = self._channel
+ del self._channel
+
+ while True:
+
+ # Stop?
+ if channel.closed or channel._run_mode!=2:
+ break
+
+ # Wait for data (blocking, look Rob, without spinlocks :)
+ package = channel._recv(2.0)
+ if package:
+ channel._replier_iteration(package)
+ channel._acknowledge_next_pre_request()
+ else:
+ channel._acknowledge_next_pre_request()
diff --git a/iep/yoton/channels/channels_state.py b/iep/yoton/channels/channels_state.py
new file mode 100644
index 0000000..2dcec49
--- /dev/null
+++ b/iep/yoton/channels/channels_state.py
@@ -0,0 +1,139 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module yoton.channels.channels_state
+
+Defines the channel class for state.
+
+"""
+
+from yoton.misc import basestring, bytes, str, long
+from yoton.misc import Property
+from yoton.channels import BaseChannel
+
+
+class StateChannel(BaseChannel):
+ """ StateChannel(context, slot_base, message_type=yoton.TEXT)
+
+ Channel class for the state messaging pattern. A state is synchronized
+ over all state channels of the same slot. Each channel can
+ send (i.e. set) the state and recv (i.e. get) the current state.
+ Note however, that if two StateChannel instances set the state
+ around the same time, due to the network delay, it is undefined
+ which one sets the state the last.
+
+ The context will automatically call this channel's send_last()
+ method when a new context enters the network.
+
+ The recv() call is always non-blocking and always returns the last
+ received message: i.e. the current state.
+
+ There are no limitations for this channel if events are not
+ processed, except that the received signal is not emitted.
+
+ Parameters
+ ----------
+ context : yoton.Context instance
+ The context that this channel uses to send messages in a network.
+ slot_base : string
+ The base slot name. The channel appends an extension to indicate
+ message type and messaging pattern to create the final slot name.
+ The final slot is used to connect channels at different contexts
+ in a network
+ message_type : yoton.MessageType instance
+ (default is yoton.TEXT)
+ Object to convert messages to bytes and bytes to messages.
+ Users can create their own message_type class to let channels
+ any type of message they want.
+
+ """
+
+ def __init__(self, *args, **kwargs):
+ BaseChannel.__init__(self, *args, **kwargs)
+
+ # Variables to hold the current state. We use only the message
+ # as a reference, so we dont need a lock.
+ # The package is used to make _recv() function more or less,
+ # and to be able to determine if a state was set (because the
+ # message may be set to None)
+ self._current_package = None
+ self._current_message = self.message_from_bytes(bytes())
+
+
+ def _messaging_patterns(self):
+ return 'state', 'state'
+
+
+ def send(self, message):
+ """ send(message)
+
+ Set the state of this channel.
+
+ The state-message is queued and send over the socket by the IO-thread.
+ Zero-length messages are ignored.
+
+ """
+ # Send message only if it is different from the current state
+ # set current_message by unpacking the send binary. This ensures
+ # that if someone does this, things still go well:
+ # a = [1,2,3]
+ # status.send(a)
+ # a.append(4)
+ # status.send(a)
+ if message != self._current_message:
+ self._current_package = self._send( self.message_to_bytes(message) )
+ self._current_message = self.message_from_bytes(self._current_package._data)
+
+
+ def send_last(self):
+ """ send_last()
+
+ Resend the last message.
+
+ """
+ if self._current_package is not None:
+ self._send( self.message_to_bytes(self._current_message) )
+
+
+ def recv(self, block=False):
+ """ recv(block=False)
+
+ Get the state of the channel. Always non-blocking. Returns the
+ most up to date state.
+
+ """
+ return self._current_message
+
+
+ def _recv_package(self, package):
+ """ _recv_package(package)
+
+ Bypass queue and just store it in a variable.
+
+ """
+ self._current_message = self.message_from_bytes(package._data)
+ self._current_package = package
+ #
+ self._maybe_emit_received()
+
+
+ def _inject_package(self, package):
+ """ Non-blocking version of recv_package. Does the same.
+ """
+ self._current_message = self.message_from_bytes(package._data)
+ self._current_package = package
+ #
+ self._maybe_emit_received()
+
+
+ def _recv(self, block=None):
+ """ _recv(block=None)
+
+ Returns the last received or send set package. The package
+ may not reflect the current state.
+
+ """
+ return self._current_package
diff --git a/iep/yoton/channels/message_types.py b/iep/yoton/channels/message_types.py
new file mode 100644
index 0000000..d6ac604
--- /dev/null
+++ b/iep/yoton/channels/message_types.py
@@ -0,0 +1,318 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module yoton.channels.message_types
+
+Defines a few basic message_types for the channels. A MessageType object
+defines how a message of that type should be converted to bytes and
+vice versa.
+
+The Packer and Unpacker classes for the ObjectMessageType are based on
+the xdrrpc Python module by Rob Reilink and Windel Bouwman.
+
+"""
+
+import sys
+import struct
+from yoton.misc import bytes, basestring, long
+
+# To decode P2k strings that are not unicode
+if sys.__stdin__ and sys.__stdin__.encoding:
+ STDINENC = sys.__stdin__.encoding
+elif sys.stdin and sys.stdin.encoding:
+ STDINENC = sys.stdin.encoding
+else:
+ STDINENC = 'utf-8'
+
+
+class MessageType(object):
+ """ MessageType()
+
+ Instances of this class are used to convert messages to bytes and
+ bytes to messages.
+
+ Users can easily inherit from this class to make channels work for
+ user specific message types. Three methods should be overloaded:
+ * message_to_bytes() - given a message, returns bytes
+ * message_from_bytes() - given bytes, returns the message
+ * message_type_name() - a string (for example 'text', 'array')
+
+ The message_type_name() method is used by the channel to add an
+ extension to the slot name, such that only channels of the same
+ message type (well, with the same message type name) can connect.
+
+ """
+
+ def message_to_bytes(self, message):
+ raise NotImplementedError()
+
+ def message_from_bytes(self, bb):
+ raise NotImplementedError()
+
+ def message_type_name(self):
+ raise NotImplementedError()
+
+
+
+class BinaryMessageType(MessageType):
+ """ BinaryMessageType()
+
+ To let channels handle binary messages.
+ Available as yoton.BINARY.
+
+ """
+
+ def message_type_name(self):
+ return 'bin'
+
+
+ def message_to_bytes(self, message):
+ if not isinstance(message, bytes):
+ raise ValueError("Binary channel requires byte messages.")
+ return message
+
+
+ def message_from_bytes(self, bb):
+ return bb
+
+
+
+class TextMessageType(MessageType):
+ """ BinaryMessageType()
+
+ To let channels handle Unicode text messages.
+ Available as yoton.TEXT.
+
+ """
+
+ def message_type_name(self):
+ return 'txt'
+
+ def message_to_bytes(self, message):
+
+ # Check
+ if not isinstance(message, basestring):
+ raise ValueError("Text channel requires string messages.")
+
+ # If using py2k and the string is not unicode, make unicode first
+ # by try encoding using UTF-8. When a piece of code stored
+ # in a unicode string is executed, str objects are utf-8 encoded.
+ # Otherwise they are encoded using __stdin__.encoding. In specific
+ # cases, a non utf-8 encoded str might be succesfully encoded
+ # using utf-8, but this is rare. Since I would not
+ # know how to tell the encoding beforehand, we'll take our
+ # chances... Note that in IEP (for which this package was created,
+ # all executed code is unicode, so str instrances are always
+ # utf-8 encoded.
+ if isinstance(message, bytes):
+ try:
+ message = message.decode('utf-8')
+ except UnicodeError:
+ try:
+ message = message.decode(STDINENC)
+ except UnicodeError:
+ # Probably not really a string then?
+ message = repr(message)
+
+ # Encode and send
+ return message.encode('utf-8')
+
+
+ def message_from_bytes(self, bb):
+ return bb.decode('utf-8')
+
+
+
+class ObjectMessageType(MessageType):
+ """ ObjectMessageType()
+
+ To let channels handle messages consisting of any of the following
+ Python objects: None, bool, int, float, string, list, tuple, dict.
+ Available as yoton.OBJECT.
+
+ """
+
+ def message_type_name(self):
+ return 'obj'
+
+ def message_to_bytes(self, message):
+ packer = Packer()
+ packer.pack_object(message)
+ return packer.get_buffer()
+
+ def message_from_bytes(self, bb):
+ if bb:
+ unpacker = Unpacker(bb)
+ return unpacker.unpack_object()
+ else:
+ return None
+
+
+
+# Formats
+_FMT_TYPE = '<B'
+_FMT_BOOL = '<B'
+_FMT_INT = '<q'
+_FMT_FLOAT = '<d'
+
+# Types
+_TYPE_NONE = ord('n')
+_TYPE_BOOL = ord('b')
+_TYPE_INT = ord('i')
+_TYPE_FLOAT = ord('f')
+_TYPE_STRING = ord('s')
+_TYPE_LIST = ord('l')
+_TYPE_TUPLE = ord('t')
+_TYPE_DICT = ord('d')
+
+
+class Packer:
+
+ # Note that while xdrlib uses StringIO/BytesIO, this approach using
+ # a list is actually faster.
+
+ def __init__(self):
+ self._buf = []
+
+ def get_buffer(self):
+ return bytes().join(self._buf)
+
+ def write(self, bb):
+ self._buf.append(bb)
+
+ def write_number(self, n):
+ if n < 255:
+ self.write( struct.pack('<B', n) )
+ else:
+ self.write( struct.pack('<B', 255) )
+ self.write( struct.pack('<Q', n) )
+
+ def pack_object(self, object):
+
+ if object is None:
+ self.write( struct.pack(_FMT_TYPE, _TYPE_NONE) )
+ elif isinstance(object, bool):
+ self.write( struct.pack(_FMT_TYPE, _TYPE_BOOL) )
+ self.write( struct.pack(_FMT_BOOL, object) )
+ elif isinstance(object, (int, long)):
+ self.write( struct.pack(_FMT_TYPE, _TYPE_INT) )
+ self.write( struct.pack(_FMT_INT, object) )
+ elif isinstance(object, float):
+ self.write( struct.pack(_FMT_TYPE, _TYPE_FLOAT) )
+ self.write( struct.pack(_FMT_FLOAT, object) )
+ elif isinstance(object, basestring):
+ bb = object.encode('utf-8')
+ self.write( struct.pack(_FMT_TYPE, _TYPE_STRING) )
+ self.write_number(len(bb))
+ self.write( bb )
+ elif isinstance(object, list):
+ self.write( struct.pack(_FMT_TYPE, _TYPE_LIST) )
+ self.write_number(len(object))
+ for value in object:
+ self.pack_object(value) # call recursive
+ elif isinstance(object, tuple):
+ self.write( struct.pack(_FMT_TYPE, _TYPE_TUPLE) )
+ self.write_number(len(object))
+ for value in object:
+ self.pack_object(value) # call recursive
+ elif isinstance(object, dict):
+ self.write( struct.pack(_FMT_TYPE, _TYPE_DICT) )
+ self.write_number(len(object))
+ # call recursive
+ for key in object:
+ self.pack_object(key)
+ self.pack_object(object[key])
+ else:
+ raise ValueError("Unsupported type: %s" % repr(type(object)))
+
+
+class Unpacker:
+
+ def __init__(self, data):
+ self._buf = data
+ self._pos = 0
+
+ def read(self, n):
+ i1 = self._pos
+ i2 = self._pos + n
+ if i2 > len(self._buf):
+ raise EOFError
+ else:
+ self._pos = i2
+ return self._buf[i1:i2]
+
+ def read_number(self):
+ n, = struct.unpack('<B', self.read(1))
+ if n == 255:
+ n, = struct.unpack('<Q', self.read(8))
+ return n
+
+ def unpack(self, fmt, n):
+ i1 = self._pos
+ i2 = self._pos + n
+ if i2 > len(self._buf):
+ raise EOFError
+ else:
+ self._pos = i2
+ data = self._buf[i1:i2]
+ return struct.unpack(fmt, data)[0]
+
+ def unpack_object(self):
+
+ object_type = self.unpack(_FMT_TYPE, 1)
+
+ if object_type == _TYPE_NONE:
+ return None
+ elif object_type == _TYPE_BOOL:
+ return bool( self.unpack(_FMT_BOOL, 1) )
+ elif object_type == _TYPE_INT:
+ return self.unpack(_FMT_INT, 8)
+ elif object_type == _TYPE_FLOAT:
+ return self.unpack(_FMT_FLOAT, 8)
+ elif object_type == _TYPE_STRING:
+ n = self.read_number()
+ return self.read(n).decode('utf-8')
+ elif object_type == _TYPE_LIST:
+ object = []
+ for i in range(self.read_number()):
+ object.append( self.unpack_object() )
+ return object
+ elif object_type == _TYPE_TUPLE:
+ object = []
+ for i in range(self.read_number()):
+ object.append( self.unpack_object() )
+ return tuple(object)
+ elif object_type == _TYPE_DICT:
+ object = {}
+ for i in range(self.read_number()):
+ key = self.unpack_object()
+ object[key] = self.unpack_object()
+ return object
+ else:
+ raise ValueError("Unsupported type: %s" % repr(object_type))
+
+
+# Define constants
+TEXT = TextMessageType()
+BINARY = BinaryMessageType()
+OBJECT = ObjectMessageType()
+
+
+if __name__ == '__main__':
+ # Test
+
+ s = {}
+ s['foo'] = 3
+ s['bar'] = 9
+ s['empty'] = []
+ s[(2,'aa',3)] = ['pretty', ('nice', 'eh'), 4]
+
+ bb = OBJECT.message_to_bytes(s)
+ s2 = OBJECT.message_from_bytes(bb)
+ print(s)
+ print(s2)
+
+
\ No newline at end of file
diff --git a/iep/yoton/clientserver.py b/iep/yoton/clientserver.py
new file mode 100644
index 0000000..b1a1d9f
--- /dev/null
+++ b/iep/yoton/clientserver.py
@@ -0,0 +1,321 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" yoton.clientserver.py
+
+Yoton comes with a small framework to setup a request-reply pattern
+using a client-server model (over a non-persistent connection),
+similar to telnet. This allows one process to easily ask small pieces
+of information from another process.
+
+To create a server, create a class that inherits from
+yoton.RequestServer and implement its handle_request() method.
+
+A client process can simply use the yoton.do_request function.
+Example: ``yoton.do_request('www.google.com:80', 'GET http/1.1\\r\\n')``
+
+The client server model is implemented using one function and one class:
+yoton.do_request and yoton.RequestServer.
+
+Details
+-------
+
+The server implements a request/reply pattern by listening at a socket.
+Similar to telnet, each request is handled using a connection
+and the socket is closed after the response is send.
+
+The request server can setup to run in the main thread, or can be started
+using its own thread. In the latter case, one can easily create multiple
+servers in a single process, that listen on different ports.
+
+"""
+
+import os, sys, time
+import socket
+import threading
+from select import select # to determine wheter a socket can receive data
+
+from yoton.misc import basestring, bytes, str, long
+from yoton.misc import split_address, getErrorMsg
+from yoton.core import send_all, recv_all
+
+
+class RequestServer(threading.Thread):
+ """ RequestServer(address, async=False, verbose=0)
+
+ Setup a simple server that handles requests similar to a telnet server,
+ or asyncore. Starting the server using run() will run the server in
+ the calling thread. Starting the server using start() will run the
+ server in a separate thread.
+
+ To create a server, subclass this class and re-implement the
+ handle_request method. It accepts a request and should return a
+ reply. This server assumes utf-8 encoded messages.
+
+ Parameters
+ ----------
+ address : str
+ Should be of the shape hostname:port.
+ async : bool
+ If True, handles each incoming connection in a separate thread.
+ This might be advantageous if a the handle_request() method
+ takes a long time to execute.
+ verbose : bool
+ If True, print a message each time a connection is accepted.
+
+ Notes on hostname
+ -----------------
+ The hostname can be:
+ * The IP address, or the string hostname of this computer.
+ * 'localhost': the connections is only visible from this computer.
+ Also some low level networking layers are bypassed, which results
+ in a faster connection. The other context should also connect to
+ 'localhost'.
+ * 'publichost': the connection is visible by other computers on the
+ same network.
+
+ """
+
+ def __init__(self, address, async=False, verbose=0):
+ threading.Thread.__init__(self)
+
+ # Store whether to handle requests asynchronously
+ self._async = async
+
+ # Verbosity
+ self._verbose = verbose
+
+ # Determine host and port (assume tcp)
+ protocol, host, port = split_address(address)
+
+ # Create socket. Apply SO_REUSEADDR when binding, so that a
+ # improperly closed socket on the same port will not prevent
+ # us connecting.
+ s = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+ s.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1)
+
+ # Bind (can raise error is port is not available)
+ s.bind((host,port))
+
+ # Store socket instance
+ self._bsd_socket = s
+
+ # To stop serving
+ self._stop_me = False
+
+ # Make deamon
+ self.setDaemon(True)
+
+
+ def start(self):
+ """ start()
+ Start the server in a separate thread.
+ """
+ self._stop_me = False
+ threading.Thread.start(self)
+
+
+ def stop(self):
+ """ stop()
+ Stop the server.
+ """
+ self._stop_me = True
+
+
+ def run(self):
+ """ run()
+ The server's main loop.
+ """
+
+ # Get socket instance
+ s = self._bsd_socket
+
+ # Notify
+ hostname, port = s.getsockname()
+ if self._verbose:
+ print('Yoton: hosting at %s, port %i' % (hostname, port))
+
+ # Tell the socket it is a host, accept multiple
+ s.listen(1)
+
+ # Set timeout so that we can check _stop_me from time to time
+ self._bsd_socket.settimeout(0.25)
+
+ # Enter main loop
+ while not self._stop_me:
+ try:
+ s, addr = self._bsd_socket.accept()
+ except socket.timeout:
+ pass
+ except InterruptedError:
+ pass
+ else:
+ # Show handling?
+ if self._verbose:
+ print('handling request from: '+str(addr))
+ # Handle request
+ if self._async :
+ rh = SocketHandler(self, s)
+ rh.start()
+ else:
+ self._handle_connection(s)
+
+ # Close down
+ try:
+ self._bsd_socket.close()
+ except socket.error:
+ pass
+
+
+ def _handle_connection(self, s):
+ """ _handle_connection(s)
+ Handle an incoming connection.
+ """
+ try:
+ self._really_handle_connection(s)
+ except Exception:
+ print('Error handling request:')
+ print(getErrorMsg())
+
+
+ def _really_handle_connection(self, s):
+ """ _really_handle_connection(s)
+ Really handle an incoming connection.
+ """
+ # Get request
+ request = recv_all(s, True)
+ if request is None:
+ return
+
+ # Get reply
+ reply = self.handle_request(request)
+
+ # Test
+ if not isinstance(reply, basestring):
+ raise ValueError('handle_request() should return a string.')
+
+ # Send reply
+ send_all(s, reply, True)
+
+ # Close the socket
+ try:
+ s.close()
+ except socket.error:
+ pass
+
+ def handle_request(self, request):
+ """ handle_request(request)
+
+ Return a reply, given the request. Overload this method to create
+ a server.
+
+ De standard implementation echos the request, waits one second
+ when receiving 'wait' and stop the server when receiving 'stop'.
+
+ """
+ # Special cases
+ if request == 'wait':
+ time.sleep(1.0)
+ elif request == 'stop':
+ self._stop_me = True
+
+ # Echo
+ return 'Requested: ' + request
+
+
+class SocketHandler(threading.Thread):
+ """ SocketHandler(server, s)
+ Simple thread that handles a connection.
+ """
+ def __init__(self, server, s):
+ threading.Thread.__init__(self)
+ self._server = server
+ self._bsd_socket = s
+
+ def run(self):
+ self._server._handle_connection(self._bsd_socket)
+
+
+
+def do_request(address, request, timeout=-1):
+ """ do_request(address, request, timeout=-1)
+
+ Do a request at the server at the specified address. The server can
+ be a yoton.RequestServer, or any other server listening on a socket
+ and following a REQ/REP pattern, such as html or telnet. For example:
+ ``html = do_request('www.google.com:80', 'GET http/1.1\\r\\n')``
+
+ Parameters
+ ----------
+ address : str
+ Should be of the shape hostname:port.
+ request : string
+ The request to make.
+ timeout : float
+ If larger than 0, will wait that many seconds for the respons, and
+ return None if timed out.
+
+ Notes on hostname
+ -----------------
+ The hostname can be:
+ * The IP address, or the string hostname of this computer.
+ * 'localhost': the connections is only visible from this computer.
+ Also some low level networking layers are bypassed, which results
+ in a faster connection. The other context should also connect to
+ 'localhost'.
+ * 'publichost': the connection is visible by other computers on the
+ same network.
+
+ """
+
+ # Determine host (assume tcp)
+ protocol, host, port = split_address(address)
+
+ # Check request
+ if not isinstance(request, basestring):
+ raise ValueError('request should be a string.')
+
+ # Check timeout
+ if timeout is None:
+ timeout = -1
+
+ # Create socket and connect
+ s = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+ try:
+ s.connect((host,port))
+ except socket.error:
+ raise RuntimeError('No server is listening at the given port.')
+
+ # Send request
+ send_all(s, request, True)
+
+ # Receive reply
+ reply = recv_all(s, timeout)
+
+ # Close socket
+ try:
+ s.close()
+ except socket.error:
+ pass
+
+ # Done
+ return reply
+
+
+if __name__ == '__main__':
+
+ class Lala(RequestServer):
+ def handle_request(self, req):
+ print('REQ:',repr(req))
+ return "The current time is %i" % time.time()
+
+ s = Lala('localhost:test', 0, 1)
+ s.start()
+ if False:
+ print(do_request('localhost:test', 'wait', 5))
+ for i in range(10):
+ print(do_request('localhost:test', 'hi'+str(i)))
+ # do_request('localhost:test', 'wait'); do_request('localhost:test', 'hi');
diff --git a/iep/yoton/connection.py b/iep/yoton/connection.py
new file mode 100644
index 0000000..e2aa5c5
--- /dev/null
+++ b/iep/yoton/connection.py
@@ -0,0 +1,437 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import os
+import sys
+import time
+import threading
+
+import yoton
+from yoton.misc import basestring, bytes, str
+from yoton.misc import Property, getErrorMsg, UID
+
+
+# Minimum timout
+TIMEOUT_MIN = 0.5
+
+# For the status
+STATUS_CLOSED = 0
+STATUS_CLOSING = 1
+STATUS_WAITING = 2
+STATUS_HOSTING = 3
+STATUS_CONNECTED = 4
+
+STATUSMAP = ['closed', 'closing', 'waiting', 'hosting', 'connected', ]
+
+# Reasons to stop the connection
+STOP_DEFAULT_REASON = 'Closed on command.'
+STOP_UNSPECIFIED_PROBLEM = 'Unspecified problem'
+STOP_INVALID_REASON = 'Invalid stop reason specified (must be string).'
+STOP_TIMEOUT = "Connection timed out." # Can be used by user
+STOP_HANDSHAKE_TIMEOUT = "Handshake timed out."
+STOP_HANDSHAKE_FAILED = "Handshake failed."
+STOP_HANDSHAKE_SELF = "Handshake failed (context cannot connect to self)."
+STOP_CLOSED_FROM_THERE = "Closed from other end."
+
+
+
+class ConnectionCollection(list):
+ """ ContextConnectionCollection()
+
+ A list class that allows indexing using the name of the required
+ Connection instance.
+
+ """
+
+ def __getitem__(self, key):
+ if isinstance(key, basestring):
+ if not key:
+ raise KeyError('An empty string is not a valid key.')
+ for c in self:
+ if c.name == key:
+ return c
+ else:
+ raise KeyError('No connection know by the name %s' % key)
+ else:
+ return list.__getitem__(self, key)
+
+
+
+class Connection(object):
+ """ Connection(context, name='')
+
+ Abstract base class for a connection between two Context objects.
+ This base class defines the full interface; subclasses only need
+ to implement a few private methods.
+
+ The connection classes are intended as a simple interface for the
+ user, for example to query port number, and be notified of timeouts
+ and closing of the connection.
+
+ All connection instances are intended for one-time use. To make
+ a new connection, instantiate a new Connection object. After
+ instantiation, either _bind() or _connect() should be called.
+
+ """
+
+ def __init__(self, context, name=''):
+
+ # Store context and name
+ self._context = context
+ self._name = name
+
+ # Init hostname and port
+ self._hostname1 = ''
+ self._hostname2 = ''
+ self._port1 = 0
+ self._port2 = 0
+
+ # Init id and pid of target context (set during handshake)
+ # We can easily retrieve our own id and pid; no need to store
+ self._id2 = 0
+ self._pid2 = 0
+
+ # Timeout value (if no data is received for this long,
+ # the timedout signal is fired). Because we do not know the timeout
+ # that the other side uses, we apply a minimum timeout.
+ self._timeout = TIMEOUT_MIN
+
+ # Create signals
+ self._timedout_signal = yoton.Signal()
+ self._closed_signal = yoton.Signal()
+
+ # Lock to make setting and getting the status thread safe
+ self._lock = threading.RLock()
+
+ # Init variables to disconnected state
+ self._set_status(0)
+
+
+ ## Properties
+
+
+ @property
+ def hostname1(self):
+ """ Get the hostname corresponding to this end of the connection.
+ """
+ return self._hostname1
+
+
+ @property
+ def hostname2(self):
+ """ Get the hostname for the other end of this connection.
+ Is empty string if not connected.
+ """
+ return self._hostname2
+
+
+ @property
+ def port1(self):
+ """ Get the port number corresponding to this end of the connection.
+ When binding, use this port to connect the other context.
+ """
+ return self._port1
+
+
+ @property
+ def port2(self):
+ """ Get the port number for the other end of the connection.
+ Is zero when not connected.
+ """
+ return self._port2
+
+
+ @property
+ def id1(self):
+ """ The id of the context on this side of the connection.
+ """
+ return self._context._id
+
+
+ @property
+ def id2(self):
+ """ The id of the context on the other side of the connection.
+ """
+ return self._id2
+
+
+ @property
+ def pid1(self):
+ """ The pid of the context on this side of the connection.
+ (hint: os.getpid())
+ """
+ return os.getpid()
+
+
+ @property
+ def pid2(self):
+ """ The pid of the context on the other side of the connection.
+ """
+ return self._pid2
+
+
+ @property
+ def is_alive(self):
+ """ Get whether this connection instance is alive (i.e. either
+ waiting or connected, and not in the process of closing).
+ """
+ self._lock.acquire()
+ try:
+ return self._status >= 2
+ finally:
+ self._lock.release()
+
+
+ @property
+ def is_connected(self):
+ """ Get whether this connection instance is connected.
+ """
+ self._lock.acquire()
+ try:
+ return self._status >= 3
+ finally:
+ self._lock.release()
+
+
+ @property
+ def is_waiting(self):
+ """ Get whether this connection instance is waiting for a connection.
+ This is the state after using bind() and before another context
+ connects to it.
+ """
+ self._lock.acquire()
+ try:
+ return self._status == 2
+ finally:
+ self._lock.release()
+
+
+ @property
+ def closed(self):
+ """ Signal emitted when the connection closes. The first argument
+ is the ContextConnection instance, the second argument is the
+ reason for the disconnection (as a string).
+ """
+ return self._closed_signal
+
+
+ @Property
+ def timeout():
+ """ Set/get the amount of seconds that no data is received from
+ the other side after which the timedout signal is emitted.
+ """
+ def fget(self):
+ return self._timeout
+ def fset(self, value):
+ if not isinstance(value, (int,float)):
+ raise ValueError('timeout must be a number.')
+ if value < TIMEOUT_MIN:
+ raise ValueError('timeout must be at least %1.2f.' % TIMEOUT_MIN)
+ self._timeout = value
+ return locals()
+
+
+ @property
+ def timedout(self):
+ """ This signal is emitted when no data has been received for
+ over 'timeout' seconds. This can mean that the connection is unstable,
+ or that the other end is running extension code.
+
+ Handlers are called with two arguments: the ContextConnection
+ instance, and a boolean. The latter is True when the connection
+ times out, and False when data is received again.
+ """
+ return self._timedout_signal
+
+
+ @Property
+ def name():
+ """ Set/get the name that this connection is known by. This name
+ can be used to obtain the instance using the Context.connections
+ property. The name can be used in networks in which each context
+ has a particular role, to easier distinguish between the different
+ connections. Other than that, the name has no function.
+ """
+ def fget(self):
+ return self._name
+ def fset(self, value):
+ if not isinstance(value, basestring):
+ raise ValueError('name must be a string.')
+ self._name = value
+ return locals()
+
+
+ ## Public methods
+
+
+ def flush(self, timeout=3.0):
+ """ flush(timeout=3.0)
+
+ Wait until all pending packages are send. An error
+ is raised when the timeout passes while doing so.
+
+ """
+ return self._flush(timeout)
+
+
+ def close(self, reason=None):
+ """ close(reason=None)
+
+ Close the connection, disconnecting the two contexts and
+ stopping all trafic. If the connection was waiting for a
+ connection, it stops waiting.
+
+ Optionally, a reason for closing can be specified. A closed
+ connection cannot be reused.
+
+ """
+
+ # No reason, user invoked close
+ if reason is None:
+ reason = STOP_DEFAULT_REASON
+
+ # If already closed or closing, do nothing
+ if self._status in [STATUS_CLOSED, STATUS_CLOSING]:
+ return
+
+ # Go!
+ return self._general_close_method(reason, True)
+
+
+ def close_on_problem(self, reason=None):
+ """ close_on_problem(reason=None)
+
+ Disconnect the connection, stopping all trafic. If it was
+ waiting for a connection, we stop waiting.
+
+ Optionally, a reason for stopping can be specified. This is highly
+ recommended in case the connection is closed due to a problem.
+
+ In contrast to the normal close() method, this method does not
+ try to notify the other end of the closing.
+
+ """
+
+ # No reason, some unspecified problem
+ if reason is None:
+ reason = STOP_UNSPECIFIED_PROBLEM
+
+ # If already closed (status==0), do nothing
+ if self._status == STATUS_CLOSED:
+ return
+
+ # If a connecion problem occurs during closing, we close the connection
+ # so that flush will not block.
+ # The closing that is now in progress will emit the event, so we
+ # do not need to go into the _general_close_method().
+ if self._status == STATUS_CLOSING:
+ self._set_status(STATUS_CLOSED)
+ return
+
+ # Go!
+ return self._general_close_method(reason, False)
+
+
+ def _general_close_method(self, reason, send_stop_message):
+ """ general close method used by both close() and close_on_problem()
+ """
+
+ # Remember current status. Set status to closing, which means that
+ # the connection is still alive but cannot be closed again.
+ old_status = self._status
+ self._set_status(STATUS_CLOSING)
+
+ # Check reason
+ if not isinstance(reason, basestring):
+ reason = STOP_INVALID_REASON
+
+ # Tell other end to close?
+ if send_stop_message and self.is_connected:
+ self._notify_other_end_of_closing()
+
+ # Close socket and set attributes to None
+ self._set_status(STATUS_CLOSED)
+
+ # Notify user, but only once
+ self.closed.emit(self, reason)
+
+ # Notify user ++
+ if self._context._verbose:
+ tmp = STATUSMAP[old_status]
+ print("Yoton: %s connection closed: %s" % (tmp, reason))
+# if True:
+# tmp = STATUSMAP[old_status]
+# sys.__stdout__.write("Yoton: %s connection closed: %s" % (tmp, reason))
+# sys.__stdout__.flush()
+
+
+ ## Methods to overload
+
+ def _bind(self, hostname, port, max_tries):
+ raise NotImplemented()
+
+ def _connect(self, hostname, port, timeout):
+ raise NotImplemented()
+
+ def _flush(self, timeout):
+ raise NotImplemented()
+
+ def _notify_other_end_of_closing(self):
+ raise NotImplemented()
+
+ def _send_package(self, package):
+ raise NotImplemented()
+
+ def _inject_package(self, package):
+ raise NotImplemented()
+
+ def _set_status(self, status):
+ """ Used to change the status. Subclasses can reimplement this
+ to get the desired behavior.
+ """
+ self._lock.acquire()
+ try:
+
+ # Store status
+ self._status = status
+
+ # Notify user ++
+ if (status > 0) and self._context._verbose:
+ action = STATUSMAP[status]
+ print("Yoton: %s at %s:%s." % (action, self._hostname1, self._port1))
+
+ finally:
+ self._lock.release()
+
+
+## More ideas for connections
+
+class InterConnection(Connection):
+ """ InterConnection(context, hostname, port, name='')
+
+ Not implemented.
+
+ Communication between two processes on the same machine can also
+ be implemented via a memory mapped file or a pype. Would there
+ be an advantage over the TcpConnection?
+
+
+ """
+ pass
+
+
+
+class UDPConnection(Connection):
+ """ UDPConnection(context, hostname, port, name='')
+
+ Not implemented.
+
+ Communication can also be done over UDP, but need protocol on top
+ of UDP to make the connection robust. Is there a reason to implement
+ this if we have Tcp?
+
+ """
+ pass
diff --git a/iep/yoton/connection_itc.py b/iep/yoton/connection_itc.py
new file mode 100644
index 0000000..15a8d5e
--- /dev/null
+++ b/iep/yoton/connection_itc.py
@@ -0,0 +1,33 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import sys
+import time
+
+import yoton
+from yoton.misc import basestring, bytes, str
+from yoton.misc import Property, getErrorMsg, UID
+from yoton.misc import PackageQueue
+
+from yoton.connection import Connection, TIMEOUT_MIN
+from yoton.connection import STATUS_CLOSED, STATUS_WAITING, STATUS_HOSTING
+from yoton.connection import STATUS_CONNECTED, STATUS_CLOSING
+
+
+class ItcConnection(Connection):
+ """ ItcConnection(context, hostname, port, name='')
+
+ Not implemented .
+
+ The inter-thread-communication connection class implements a
+ connection between two contexts that are in the same process.
+ Two instances of this class are connected using a weak reference.
+ In case one of the ends is cleaned up by the garbadge collector,
+ the other end will close the connection.
+
+ """
+ pass
+ # todo: implement me
diff --git a/iep/yoton/connection_tcp.py b/iep/yoton/connection_tcp.py
new file mode 100644
index 0000000..dc3a279
--- /dev/null
+++ b/iep/yoton/connection_tcp.py
@@ -0,0 +1,739 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import os
+import sys
+import time
+import socket
+import threading
+
+import yoton
+from yoton.misc import basestring, bytes, str
+from yoton.misc import Property, getErrorMsg, UID
+from yoton.misc import PackageQueue, TinyPackageQueue
+from yoton.core import Package, PACKAGE_HEARTBEAT, PACKAGE_CLOSE, EINTR
+from yoton.core import can_send, can_recv, send_all, recv_all, HEADER_SIZE
+
+from yoton.connection import Connection, TIMEOUT_MIN
+from yoton.connection import STATUS_CLOSED, STATUS_WAITING, STATUS_HOSTING
+from yoton.connection import STATUS_CONNECTED, STATUS_CLOSING
+
+# Note that time.sleep(0) yields the current thread's timeslice to any
+# other >= priority thread in the process, but is otherwise equivalent 0 delay.
+
+
+# Reasons to stop the connection
+STOP_SOCKET_ERROR = "Socket error." # the error message is appended
+STOP_EOF = "Other end dropped the connection."
+STOP_HANDSHAKE_TIMEOUT = "Handshake timed out."
+STOP_HANDSHAKE_FAILED = "Handshake failed."
+STOP_HANDSHAKE_SELF = "Handshake failed (context cannot connect to self)."
+STOP_CLOSED_FROM_THERE = "Closed from other end."
+STOP_LOST_TRACK = "Lost track of the stream."
+STOP_THREAD_ERROR = "Error in io thread."
+
+# Use a relatively small buffer size, to keep the channels better in sync
+SOCKET_BUFFERS_SIZE = 10*1024
+
+
+class TcpConnection(Connection):
+ """ TcpConnection(context, name='')
+
+ The TcpConnection class implements a connection between two
+ contexts that are in differenr processes or on different machines
+ connected via the internet.
+
+ This class handles the low-level communication for the context.
+ A ContextConnection instance wraps a single BSD socket for its
+ communication, and uses TCP/IP as the underlying communication
+ protocol. A persisten connection is used (the BSD sockets stay
+ connected). This allows to better distinguish between connection
+ problems and timeouts caused by the other side being busy.
+
+ """
+
+ def __init__(self, context, name=''):
+
+ # Variables to hold threads
+ self._sendingThread = None
+ self._receivingThread = None
+
+ # Create queue for outgoing packages.
+ self._qout = TinyPackageQueue(64, *context._queue_params)
+
+ # Init normally (calls _set_status(0)
+ Connection.__init__(self, context, name)
+
+
+ def _set_status(self, status, bsd_socket=None):
+ """ _connected(status, bsd_socket=None)
+
+ This method is called when a connection is made.
+
+ Private method to apply the bsd_socket.
+ Sets the socket and updates the status.
+ Also instantiates the IO threads.
+
+ """
+
+ # Lock the connection while we change its status
+ self._lock.acquire()
+
+ # Update hostname and port number; for hosting connections the port
+ # may be different if max_tries > 0. Each client connection will be
+ # assigned a different ephemeral port number.
+ # http://www.tcpipguide.com/free/t_TCPPortsConnectionsandConnectionIdentification-2.htm
+ # Also get hostname and port for other end
+ if bsd_socket is not None:
+ if True:
+ self._hostname1, self._port1 = bsd_socket.getsockname()
+ if status != STATUS_WAITING:
+ self._hostname2, self._port2 = bsd_socket.getpeername()
+
+ # Set status as normal
+ Connection._set_status(self, status)
+
+ try:
+
+ if status in [STATUS_HOSTING, STATUS_CONNECTED]:
+ # Really connected
+
+ # Store socket
+ self._bsd_socket = bsd_socket
+
+ # Set socket to blocking. Needed explicitly on Windows
+ # One of these things it takes you hours to find out ...
+ bsd_socket.setblocking(1)
+
+ # Create and start io threads
+ self._sendingThread = SendingThread(self)
+ self._receivingThread = ReceivingThread(self)
+ #
+ self._sendingThread.start()
+ self._receivingThread.start()
+
+ if status == 0:
+
+ # Close bsd socket
+ try:
+ self._bsd_socket.shutdown()
+ except Exception:
+ pass
+ try:
+ self._bsd_socket.close()
+ except Exception:
+ pass
+ self._bsd_socket = None
+
+ # Remove references to threads
+ self._sendingThread = None
+ self._receivingThread = None
+
+ finally:
+ self._lock.release()
+
+
+ def _bind(self, hostname, port, max_tries=1):
+ """ Bind the bsd socket. Launches a dedicated thread that waits
+ for incoming connections and to do the handshaking procedure.
+ """
+
+ # Create socket.
+ s = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+
+ # Set buffer size to be fairly small (less than 10 packages)
+ s.setsockopt(socket.SOL_SOCKET, socket.SO_SNDBUF, SOCKET_BUFFERS_SIZE)
+ s.setsockopt(socket.SOL_SOCKET, socket.SO_RCVBUF, SOCKET_BUFFERS_SIZE)
+
+ # Apply SO_REUSEADDR when binding, so that an improperly closed
+ # socket on the same port will not prevent us from connecting.
+ # It also allows a connection to bind at the same port number,
+ # but only after the previous binding connection has connected
+ # (and has closed the listen-socket).
+ #
+ # SO_REUSEADDR means something different on win32 than it does
+ # for Linux sockets. To get the intended behavior on Windows,
+ # we don't have to do anything. Also see:
+ # * http://msdn.microsoft.com/en-us/library/ms740621%28VS.85%29.aspx
+ # * http://twistedmatrix.com/trac/ticket/1151
+ # * http://www.tcpipguide.com/free/t_TCPPortsConnectionsandConnectionIdentification-2.htm
+ if not sys.platform.startswith('win'):
+ s.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1)
+
+ # Try all ports in the specified range
+ for port2 in range(port, port+max_tries):
+ try:
+ s.bind((hostname,port2))
+ break
+ except Exception:
+ # Raise the socket exception if we were asked to try
+ # just one port. Otherwise just try the next
+ if max_tries == 1:
+ raise
+ continue
+ else:
+ # We tried all ports without success
+ tmp = str(max_tries)
+ tmp = "Could not bind to any of the " + tmp + " ports tried."
+ raise IOError(tmp)
+
+ # Tell the socket it is a host, backlog of zero
+ s.listen(0)
+
+ # Set connected (status 1: waiting for connection)
+ # Will be called with status 2 by the hostThread on success
+ self._set_status(STATUS_WAITING, s)
+
+ # Start thread to wait for a connection
+ # (keep reference so the thread-object stays alive)
+ self._hostThread = HostThread(self, s)
+ self._hostThread.start()
+
+
+ def _connect(self, hostname, port, timeout=1.0):
+ """ Connect to a bound socket.
+ """
+
+ # Create socket
+ s = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+
+ # Set buffer size to be fairly small (less than 10 packages)
+ s.setsockopt(socket.SOL_SOCKET, socket.SO_SNDBUF, SOCKET_BUFFERS_SIZE)
+ s.setsockopt(socket.SOL_SOCKET, socket.SO_RCVBUF, SOCKET_BUFFERS_SIZE)
+
+ # Refuse rediculously low timeouts
+ if timeout<= 0.01:
+ timeout = 0.01
+
+ # Try to connect
+ ok = False
+ timestamp = time.time() + timeout
+ while not ok and time.time()<timestamp:
+ try:
+ s.connect((hostname, port))
+ ok = True
+ except socket.error:
+ pass
+ except socket.timeout:
+ pass
+ time.sleep(timeout/100.0)
+
+ # Did it work?
+ if not ok:
+ type, value, tb = sys.exc_info()
+ del tb
+ err = str(value)
+ raise IOError("Cannot connect to %s on %i: %s" % (hostname, port, err))
+
+ # Shake hands
+ h = HandShaker(s)
+ success, info = h.shake_hands_as_client(self.id1)
+
+ # Problem?
+ if not success:
+ self._set_status(0)
+ if not info:
+ info = 'problem during handshake'
+ raise IOError('Could not connect: '+ info)
+
+ # Store id
+ self._id2, self._pid2 = info
+
+ # Set connected (status 3: connected as client)
+ self._set_status(STATUS_CONNECTED, s)
+
+
+ def _notify_other_end_of_closing(self):
+ """ Send PACKAGE_CLOSE.
+ """
+ self._qout.push(PACKAGE_CLOSE)
+ try:
+ self.flush(1.0)
+ except Exception:
+ pass # Well, we tried ...
+
+
+ def _flush(self, timeout=5.0):
+ """ Put a dummy message on the queue and spinlock until
+ the thread has popped it from the queue.
+ """
+
+ # Check
+ if not self.is_connected:
+ RuntimeError('Cannot flush if not connected.')
+
+ # Put dummy package on the queue
+ self._qout.push(PACKAGE_HEARTBEAT)
+
+ # Wait for the queue to empty. If it is, the heart beat package
+ # may not been send yet, but every package befor it is.
+ timestamp = time.time() + timeout
+ while self.is_connected and not self._qout.empty():
+ time.sleep(0.01)
+ if time.time() > timestamp:
+ raise RuntimeError('Sending the packages timed out.')
+
+
+ def _send_package(self, package):
+ """ Put package on the queue, where the sending thread will
+ pick it up.
+ """
+ self._qout.push(package)
+
+
+ def _inject_package(self, package):
+ """ Put package in queue, but bypass potential blocking.
+ """
+ self._qout._q.append(package)
+
+
+
+class HostThread(threading.Thread):
+ """ HostThread(context_connection, bds_socket)
+
+ The host thread is used by the ContextConnection when hosting a
+ connection. This thread waits for another context to connect
+ to it, and then performs the handshaking procedure.
+
+ When a successful connection is made, the context_connection's
+ _connected() method is called and this thread then exits.
+
+ """
+
+ def __init__(self, context_connection, bsd_socket):
+ threading.Thread.__init__(self)
+
+ # Store connection and socket
+ self._context_connection = context_connection
+ self._bsd_host_socket = bsd_socket
+
+ # Make deamon
+ self.setDaemon(True)
+
+
+ def run(self):
+ """ run()
+
+ The main loop. Waits for a connection and performs handshaking
+ if successfull.
+
+ """
+
+ # Try making a connection until success or the context is stopped
+ while self._context_connection.is_waiting:
+
+ # Wait for connection
+ s = self._wait_for_connection()
+ if not s:
+ continue
+
+ # Check if not closed in the mean time
+ if not self._context_connection.is_waiting:
+ break
+
+ # Do handshaking
+ hs = HandShaker(s)
+ success, info = hs.shake_hands_as_host(self._context_connection.id1)
+ if success:
+ self._context_connection._id2 = info[0]
+ self._context_connection._pid2 = info[1]
+ else:
+ print('Yoton: Handshake failed: '+info)
+ continue
+
+ # Success!
+ # Close hosting socket, thereby enabling rebinding at the same port
+ self._bsd_host_socket.close()
+ # Update the status of the connection
+ self._context_connection._set_status(STATUS_HOSTING, s)
+ # Break out of the loop
+ break
+
+ # Remove ref
+ del self._context_connection
+ del self._bsd_host_socket
+
+
+ def _wait_for_connection(self):
+ """ _wait_for_connection()
+
+ The thread will wait here until someone connects. When a
+ connections is made, the new socket is returned.
+
+ """
+
+ # Set timeout so that we can check _stop_me from time to time
+ self._bsd_host_socket.settimeout(0.25)
+
+ # Wait
+ while self._context_connection.is_waiting:
+ try:
+ s, addr = self._bsd_host_socket.accept()
+ return s # Return the new socket
+ except socket.timeout:
+ pass
+ except socket.error:
+ # Skip errors caused by interruptions.
+ type, value, tb = sys.exc_info()
+ del tb
+ if value.errno != EINTR:
+ raise
+
+
+
+class HandShaker:
+ """ HandShaker(bsd_socket)
+
+ Class that performs the handshaking procedure for Tcp connections.
+
+ Essentially, the connecting side starts by sending 'YOTON!'
+ followed by its id as a hex string. The hosting side responds
+ with the same message (but with a different id).
+
+ This process is very similar to a client/server pattern (both
+ messages are also terminated with '\r\n'). This is done such that
+ if for example a web client tries to connect, a sensible error
+ message can be returned. Or when a ContextConnection tries to connect
+ to a web server, it will be able to determine the error gracefully.
+
+ """
+
+ def __init__(self, bsd_socket):
+
+ # Store bsd socket
+ self._bsd_socket = bsd_socket
+
+
+ def shake_hands_as_host(self, id):
+ """ _shake_hands_as_host(id)
+
+ As the host, we wait for the client to ask stuff, so when
+ for example a http client connects, we can stop the connection.
+
+ Returns (success, info), where info is the id of the context at
+ the other end, or the error message in case success is False.
+
+ """
+
+ # Make our message with id and pid
+ message = 'YOTON!%s.%i' % (UID(id).get_hex(), os.getpid())
+
+ # Get request
+ request = self._recv_during_handshaking()
+
+ if not request:
+ return False, STOP_HANDSHAKE_TIMEOUT
+ elif request.startswith('YOTON!'):
+ # Get id
+ try:
+ tmp = request[6:].split('.',1) # partition not in Python24
+ id2_str, pid2_str = tmp[0], tmp[1]
+ id2, pid2 = int(id2_str, 16), int(pid2_str, 10)
+ except Exception:
+ self._send_during_handshaking('ERROR: could not parse id.')
+ return False, STOP_HANDSHAKE_FAILED
+ # Respond and return
+ error = self._send_during_handshaking(message)
+ if id == id2:
+ return False, STOP_HANDSHAKE_SELF
+ else:
+ return True, (id2, pid2)
+ else:
+ # Client is not yoton
+ self._send_during_handshaking('ERROR: this is Yoton.')
+ return False, STOP_HANDSHAKE_FAILED
+
+
+ def shake_hands_as_client(self, id):
+ """ _shake_hands_as_client(id)
+
+ As the client, we ask the host whether it is a Yoton context
+ and whether the channels we want to support are all right.
+
+ Returns (success, info), where info is the id of the context at
+ the other end, or the error message in case success is False.
+
+ """
+
+ # Make our message with id and pif
+ message = 'YOTON!%s.%i' % (UID(id).get_hex(), os.getpid())
+
+ # Do request
+ error = self._send_during_handshaking(message)
+
+ # Get response
+ response = self._recv_during_handshaking()
+
+ # Process
+ if not response:
+ return False, STOP_HANDSHAKE_TIMEOUT
+ elif response.startswith('YOTON!'):
+ # Get id
+ try:
+ tmp = response[6:].split('.',1) # Partition not in Python24
+ id2_str, pid2_str = tmp[0], tmp[1]
+ id2, pid2 = int(id2_str, 16), int(pid2_str, 10)
+ except Exception:
+ return False, STOP_HANDSHAKE_FAILED
+ if id == id2:
+ return False, STOP_HANDSHAKE_SELF
+ else:
+ return True, (id2, pid2)
+ else:
+ return False, STOP_HANDSHAKE_FAILED
+
+
+ def _send_during_handshaking(self, text, shutdown=False):
+ return send_all(self._bsd_socket, text+'\r\n', shutdown)
+
+
+ def _recv_during_handshaking(self):
+ return recv_all(self._bsd_socket, 2.0, True)
+
+
+
+class BaseIOThread(threading.Thread):
+ """ The base class for the sending and receiving IO threads.
+ Implements some common functionality.
+ """
+
+ def __init__(self, context_connection):
+ threading.Thread.__init__(self)
+
+ # Thread will "destruct" when the interpreter shuts down
+ self.setDaemon(True)
+
+ # Store (temporarily) the ref to the context connection
+ # Also of bsd_socket, because it might be removed before the
+ # thread is well up and running.
+ self._context_connection = context_connection
+ self._bsd_socket = context_connection._bsd_socket
+
+
+ def run(self):
+ """ Method to prepare to enter main loop. There is a try-except here
+ to catch exceptions caused by interpreter shutdown.
+ """
+
+ # Get ref to context connection but make sure the ref
+ # if not stored if the thread stops
+ context_connection = self._context_connection
+ bsd_socket = self._bsd_socket
+ del self._context_connection
+ del self._bsd_socket
+
+ try:
+ # Run and handle exceptions if someting goes wrong
+ self.run2(context_connection, bsd_socket)
+ except Exception:
+ # An error while handling an exception, most probably
+ #interpreter shutdown
+ pass
+
+
+ def run2(self, context_connection, bsd_socket):
+ """ Method to enter main loop. There is a try-except here to
+ catch exceptions in the main loop (such as socket errors and
+ errors due to bugs in the code.
+ """
+
+ # Get classname to use in messages
+ className = 'yoton.' + self.__class__.__name__
+
+ # Define function to write errors
+ def writeErr(err):
+ sys.__stderr__.write(str(err)+'\n')
+ sys.__stderr__.flush()
+
+ try:
+
+ # Enter mainloop
+ stop_reason = self._run(context_connection, bsd_socket)
+
+ # Was there a specific reason to stop?
+ if stop_reason:
+ context_connection.close_on_problem(stop_reason)
+ else:
+ pass # Stopped because the connection is gone (already stopped)
+
+ except socket.error:
+ # Socket error. Can happen if the other end closed not so nice
+ # Do get the socket error message and pass it on.
+ msg = STOP_SOCKET_ERROR + getErrorMsg()
+ context_connection.close_on_problem('%s, %s' % (className, msg))
+
+ except Exception:
+ # Else: woops, an error!
+ errmsg = getErrorMsg()
+ msg = STOP_THREAD_ERROR + errmsg
+ context_connection.close_on_problem('%s, %s' % (className, msg))
+ writeErr('Exception in %s.' % className)
+ writeErr(errmsg)
+
+
+
+class SendingThread(BaseIOThread):
+ """ The thread that reads packages from the queue and sends them over
+ the socket. It uses a timeout while reading from the queue, so it can
+ send heart beat packages if no packages are send.
+ """
+
+ def _run(self, context_connection, bsd_socket):
+ """ The main loop. Get package from queue, send package to socket.
+ """
+
+ timeout = 0.5*TIMEOUT_MIN
+ queue = context_connection._qout
+ socket_send = bsd_socket.send
+ socket_sendall = bsd_socket.sendall
+
+
+ while True:
+ time.sleep(0) # Be nice
+
+ # Get package from the queue. Use heartbeat package
+ # if there have been no packages for a too long time
+ try:
+ package = queue.pop(timeout)
+ except queue.Empty:
+ # Use heartbeat package then
+ package = PACKAGE_HEARTBEAT
+ # Should we stop?
+ if not context_connection.is_connected:
+ return None # No need for a stop message
+
+ # Process the package in parts to avoid data copying (header+data)
+ for part in package.parts():
+ socket_sendall(part)
+
+
+class ReceivingThread(BaseIOThread):
+ """ The thread that reads packages from the socket and passes them to
+ the kernel. It uses select() to see if data is available on the socket.
+ This allows using a timeout without putting the socket in timeout mode.
+
+ If the timeout has expired, the timedout event for the connection is
+ emitted.
+
+ Upon receiving a package, the _recv_package() method of the context
+ is called, so this thread will eventually dispose the package in
+ one or more queues (of the channel or of another connection).
+
+ """
+
+ def _run(self, context_connection, bsd_socket):
+ """ The main loop. Get package from socket, deposit package in queue(s).
+ """
+
+ # Short names in local namespace avoid dictionary lookups
+ socket_recv = bsd_socket.recv
+ recv_package = context_connection._context._recv_package
+ package_from_header = Package.from_header
+ HS = HEADER_SIZE
+
+ # Variable to keep track if we emitted a timedout signal
+ timedOut = False
+
+
+ while True:
+ time.sleep(0) # Be nice
+
+ # Use select call on a timeout to test if data is available
+ while True:
+ try:
+ ok = can_recv(bsd_socket, context_connection._timeout)
+ except Exception:
+ # select() has it's share of weird errors
+ raise socket.error('select(): ' + getErrorMsg())
+ if ok:
+ # Set timedout ex?
+ if timedOut:
+ timedOut = False
+ context_connection.timedout.emit(context_connection, False)
+ # Exit from loop
+ break
+ else:
+ # Should we stop?
+ if not context_connection.is_connected:
+ return # No need for a stop message
+ # Should we do a timeout?
+ if not timedOut:
+ timedOut = True
+ context_connection.timedout.emit(context_connection, True)
+ # Continue in loop
+ continue
+
+ # Get package
+ package = self._getPackage(socket_recv, HS, package_from_header)
+ if package is None:
+ continue
+ elif isinstance(package, basestring):
+ return package # error msg
+
+ # Let context handle package further (but happens in this thread)
+ try:
+ recv_package(package, context_connection)
+ except Exception:
+ print("Error depositing package in ReceivingThread.")
+ print(getErrorMsg())
+
+
+ def _getPackage(self, socket_recv, HS, package_from_header):
+ """ Get exactly one package from the socket. Blocking.
+ """
+
+ # Get header and instantiate package object from it
+ try:
+ header = self._recv_n_bytes(socket_recv, HS)
+ except EOFError:
+ return STOP_EOF
+ package, size = package_from_header(header)
+
+ # Does it look like a good package?
+ if not package:
+ return STOP_LOST_TRACK
+
+ if size == 0:
+ # A special package! (or someone sending a
+ # package with no content, which is discarted)
+ if package._source_seq == 0:
+ pass # Heart beat
+ elif package._source_seq == 1:
+ return STOP_CLOSED_FROM_THERE
+ return None
+
+ else:
+ # Get package data
+ try:
+ package._data = self._recv_n_bytes(socket_recv, size)
+ except EOFError:
+ return STOP_EOF
+ return package
+
+
+ def _recv_n_bytes(self, socket_recv, n):
+ """ Receive exactly n bytes from the socket.
+ """
+
+ # First round
+ data = socket_recv(n)
+ if len(data) == 0:
+ raise EOFError()
+
+ # How many more do we need? For small n, we probably only need 1 round
+ n -= len(data)
+ if n==0:
+ return data # We're lucky!
+
+ # Else, we need more than one round
+ parts = [data]
+ while n:
+ data = socket_recv(n)
+ parts.append(data)
+ n -= len(data)
+
+ # Return combined data of multiple rounds
+ return bytes().join(parts)
diff --git a/iep/yoton/context.py b/iep/yoton/context.py
new file mode 100644
index 0000000..62e2068
--- /dev/null
+++ b/iep/yoton/context.py
@@ -0,0 +1,557 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module yoton.context
+
+Defines the context class.
+
+"""
+
+import os, sys, time
+import threading
+
+from yoton import core
+from yoton import connection
+
+from yoton.misc import basestring, bytes, str, xrange, split_address
+from yoton.misc import Property, getErrorMsg, UID, PackageQueue
+from yoton.core import Package, BUF_MAX_LEN
+from yoton.core import SLOT_CONTEXT
+
+from yoton.connection import ConnectionCollection, Connection
+from yoton.connection_tcp import TcpConnection
+from yoton.connection_itc import ItcConnection
+
+
+class Context(object):
+ """ Context(verbose=0, queue_params=None)
+
+ A context represents a node in the network. It can connect to
+ multiple other contexts (using a yoton.Connection.
+ These other contexts can be in
+ another process on the same machine, or on another machine
+ connected via a network or the internet.
+
+ This class represents a context that can be used by channel instances
+ to communicate to other channels in the network. (Thus the name.)
+
+ The context is the entity that queue routes the packages produced
+ by the channels to the other context in the network, where
+ the packages are distributed to the right channels. A context queues
+ packages while it is not connected to any other context.
+
+ If messages are send on a channel registered at this context while
+ the context is not connected, the messages are stored by the
+ context and will be send to the first connecting context.
+
+ Example 1
+ ---------
+ # Create context and bind to a port on localhost
+ context = yoton.Context()
+ context.bind('localhost:11111')
+ # Create a channel and send a message
+ pub = yoton.PubChannel(context, 'test')
+ pub.send('Hello world!')
+
+ Example 2
+ ---------
+ # Create context and connect to the port on localhost
+ context = yoton.Context()
+ context.connect('localhost:11111')
+ # Create a channel and receive a message
+ sub = yoton.SubChannel(context, 'test')
+ print(sub.recv() # Will print 'Hello world!'
+
+ Queue params
+ ------------
+ The queue_params parameter allows one to specify the package queues
+ used in the system. It is recommended to use the same parameters
+ for every context in the network. The value of queue_params should
+ be a 2-element tuple specifying queue size and discard mode. The
+ latter can be 'old' (default) or 'new', meaning that if the queue
+ is full, either the oldest or newest messages are discarted.
+
+ """
+
+ def __init__(self, verbose=0, queue_params=None):
+
+ # Whether or not to write status information
+ self._verbose = verbose
+
+ # Store queue parameters
+ if queue_params is None:
+ queue_params = BUF_MAX_LEN, 'old'
+ if not (isinstance(queue_params, tuple) and len(queue_params) == 2):
+ raise ValueError('queue_params should be a 2-element tuple.')
+ self._queue_params = queue_params
+
+ # Create unique key to identify this context
+ self._id = UID().get_int()
+
+ # Channels currently registered. Maps slots to channel instance.
+ self._sending_channels = {}
+ self._receiving_channels = {}
+
+ # The list of connections
+ self._connections = []
+ self._connections_lock = threading.RLock()
+
+ # Queue used during startup to collect packages
+ # This queue is also subject to the _connections_lock
+ self._startupQueue = PackageQueue(*queue_params)
+
+ # For numbering and routing the packages
+ self._send_seq = 0
+ self._recv_seq = 0
+ self._source_map = {}
+
+
+ def close(self):
+ """ close()
+
+ Close the context in a nice way, by closing all connections
+ and all channels.
+
+ Closing a connection means disconnecting two contexts. Closing
+ a channel means disasociating a channel from its context.
+ Unlike connections and channels, a Context instance can be reused
+ after closing (although this might not always the best strategy).
+
+ """
+
+ # Close all connections (also the waiting connections!)
+ for c in self.connections_all:
+ c.close('Closed by the context.')
+
+ # Close all channels
+ self.close_channels()
+
+
+ def close_channels(self):
+ """ close_channels()
+
+ Close all channels associated with this context. This does
+ not close the connections. See also close().
+
+ """
+
+ # Get all channels
+ channels1 = [c for c in self._sending_channels.values()]
+ channels2 = [c for c in self._receiving_channels.values()]
+
+ # Close all channels
+ for c in set(channels1+channels2):
+ c.close()
+
+
+ ## Properties
+
+ @property
+ def connections_all(self):
+ """ Get a list of all Connection instances currently
+ associated with this context, including pending connections
+ (connections waiting for another end to connect).
+ In addition to normal list indexing, the connections objects can be
+ queried from this list using their name.
+ """
+
+ # Lock
+ self._connections_lock.acquire()
+ try:
+ return [c for c in self._connections if c.is_alive]
+ finally:
+ self._connections_lock.release()
+
+
+ @property
+ def connections(self):
+ """ Get a list of the Connection instances currently
+ active for this context.
+ In addition to normal list indexing, the connections objects can be
+ queried from this list using their name.
+ """
+ # Lock
+ self._connections_lock.acquire()
+
+ try:
+
+ # Clean up any dead connections
+ copy = ConnectionCollection()
+ to_remove = []
+ for c in self._connections:
+ if not c.is_alive:
+ to_remove.append(c)
+ elif c.is_connected:
+ copy.append(c)
+
+ # Clean
+ for c in to_remove:
+ self._connections.remove(c)
+
+ # Return copy
+ return copy
+
+ finally:
+ self._connections_lock.release()
+
+
+ @property
+ def connection_count(self):
+ """ Get the number of connected contexts. Can be used as a boolean
+ to check if the context is connected to any other context.
+ """
+ return len(self.connections)
+
+
+ @property
+ def id(self):
+ """ The 8-byte UID of this context.
+ """
+ return self._id
+
+
+ ## Public methods
+
+
+ def bind(self, address, max_tries=1, name=''):
+ """ bind(address, max_tries=1, name='')
+
+ Setup a connection with another Context, by being the host.
+ This method starts a thread that waits for incoming connections.
+ Error messages are printed when an attemped connect fails. the
+ thread keeps trying until a successful connection is made, or until
+ the connection is closed.
+
+ Returns a Connection instance that represents the
+ connection to the other context. These connection objects
+ can also be obtained via the Context.connections property.
+
+ Parameters
+ ----------
+ address : str
+ Should be of the shape hostname:port. The port should be an
+ integer number between 1024 and 2**16. If port does not
+ represent a number, a valid port number is created using a
+ hash function.
+ max_tries : int
+ The number of ports to try; starting from the given port,
+ subsequent ports are tried until a free port is available.
+ The final port can be obtained using the 'port' property of
+ the returned Connection instance.
+ name : string
+ The name for the created Connection instance. It can
+ be used as a key in the connections property.
+
+ Notes on hostname
+ -----------------
+ The hostname can be:
+ * The IP address, or the string hostname of this computer.
+ * 'localhost': the connections is only visible from this computer.
+ Also some low level networking layers are bypassed, which results
+ in a faster connection. The other context should also connect to
+ 'localhost'.
+ * 'publichost': the connection is visible by other computers on the
+ same network. Optionally an integer index can be appended if
+ the machine has multiple IP addresses (see socket.gethostbyname_ex).
+
+ """
+
+ # Trigger cleanup of closed connections
+ self.connections
+
+ # Split address in protocol, real hostname and port number
+ protocol, hostname, port = split_address(address)
+
+ # Based on protocol, instantiate connection class (currently only tcp)
+ if False:#protocol == 'itc':
+ connection = ItcConnection(self, name)
+ else:
+ connection = TcpConnection(self, name)
+
+ # Bind connection
+ connection._bind(hostname, port, max_tries)
+
+ # Save connection instance
+ self._connections_lock.acquire()
+ try:
+ # Push packages from startup queue
+ while len(self._startupQueue):
+ connection._inject_package(self._startupQueue.pop())
+ # Add connection object to list of connections
+ self._connections.append(connection)
+ finally:
+ self._connections_lock.release()
+
+ # Return Connection instance
+ return connection
+
+
+ def connect(self, address, timeout=1.0, name=''):
+ """ connect(self, address, timeout=1.0, name='')
+
+ Setup a connection with another context, by connection to a
+ hosting context. An error is raised when the connection could
+ not be made.
+
+ Returns a Connection instance that represents the
+ connection to the other context. These connection objects
+ can also be obtained via the Context.connections property.
+
+ Parameters
+ ----------
+ address : str
+ Should be of the shape hostname:port. The port should be an
+ integer number between 1024 and 2**16. If port does not
+ represent a number, a valid port number is created using a
+ hash function.
+ max_tries : int
+ The number of ports to try; starting from the given port,
+ subsequent ports are tried until a free port is available.
+ The final port can be obtained using the 'port' property of
+ the returned Connection instance.
+ name : string
+ The name for the created Connection instance. It can
+ be used as a key in the connections property.
+
+ Notes on hostname
+ -----------------
+ The hostname can be:
+ * The IP address, or the string hostname of this computer.
+ * 'localhost': the connection is only visible from this computer.
+ Also some low level networking layers are bypassed, which results
+ in a faster connection. The other context should also host as
+ 'localhost'.
+ * 'publichost': the connection is visible by other computers on the
+ same network. Optionally an integer index can be appended if
+ the machine has multiple IP addresses (see socket.gethostbyname_ex).
+
+ """
+
+ # Trigger cleanup of closed connections
+ self.connections
+
+ # Split address in protocol, real hostname and port number
+ protocol, hostname, port = split_address(address)
+
+ # Based on protocol, instantiate connection class (currently only tcp)
+ if False:#protocol == 'itc':
+ connection = ItcConnection(self, name)
+ else:
+ connection = TcpConnection(self, name)
+
+ # Create new connection and connect it
+ connection._connect(hostname, port, timeout)
+
+ # Save connection instance
+ self._connections_lock.acquire()
+ try:
+ # Push packages from startup queue
+ while self._startupQueue:
+ connection._inject_package(self._startupQueue.pop())
+ # Add connection object to list of connections
+ self._connections.append(connection)
+ finally:
+ self._connections_lock.release()
+
+ # Send message in the network to signal a new connection
+ bb = 'NEW_CONNECTION'.encode('utf-8')
+ p = Package(bb, SLOT_CONTEXT, self._id, 0,0,0,0)
+ self._send_package(p)
+
+ # Return Connection instance
+ return connection
+
+
+ def flush(self, timeout=5.0):
+ """ flush(timeout=5.0)
+
+ Wait until all pending messages are send. This will flush all
+ messages posted from the calling thread. However, it is not
+ guaranteed that no new messages are posted from another thread.
+
+ Raises an error when the flushing times out.
+
+ """
+ # Flush all connections
+ for c in self.connections:
+ c.flush(timeout)
+
+ # Done (backward compatibility)
+ return True
+
+
+ ## Private methods used by the Channel classes
+
+
+ def _register_sending_channel(self, channel, slot, slotname=''):
+ """ _register_sending_channel(channel, slot, slotname='')
+
+ The channel objects use this method to register themselves
+ at a particular slot.
+
+ """
+
+ # Check if this slot is free
+ if slot in self._sending_channels:
+ raise ValueError("Slot not free: " + str(slotname))
+
+ # Register
+ self._sending_channels[slot] = channel
+
+
+ def _register_receiving_channel(self, channel, slot, slotname=''):
+ """ _register_receiving_channel(channel, slot, slotname='')
+
+ The channel objects use this method to register themselves
+ at a particular slot.
+
+ """
+
+ # Check if this slot is free
+ if slot in self._receiving_channels:
+ raise ValueError("Slot not free: " + str(slotname))
+
+ # Register
+ self._receiving_channels[slot] = channel
+
+
+ def _unregister_channel(self, channel):
+ """ _unregister_channel(channel)
+
+ Unregisters the given channel. That channel can no longer
+ receive messages, and should no longer send messages.
+
+ """
+ for D in [self._receiving_channels, self._sending_channels]:
+ for key in [key for key in D.keys()]:
+ if D[key] == channel:
+ D.pop(key)
+
+
+ ## Private methods to pass packages between context and io-threads
+
+
+ def _send_package(self, package):
+ """ _send_package(package)
+
+ Used by the channels to send a package into the network.
+ This method routes the package to all currentlt connected
+ connections. If there are none, the packages is queued at
+ the context.
+
+ """
+
+ # Add number
+ self._send_seq += 1
+ package._source_seq = self._send_seq
+
+ # Send to all connections, or queue if there are none
+ self._connections_lock.acquire()
+ try:
+ ok = False
+ for c in self._connections:
+ if c.is_alive: # Waiting or connected
+ c._send_package(package)
+ ok = True
+ # Should we queue the package?
+ if not ok:
+ self._startupQueue.push(package)
+ finally:
+ self._connections_lock.release()
+
+
+ def _recv_package(self, package, connection):
+ """ _recv_package(package, connection)
+
+ Used by the connections to receive a package at this
+ context. The package is distributed to all connections
+ except the calling one. The package is also distributed
+ to the right channel (if applicable).
+
+ """
+
+ # Get slot
+ slot = package._slot
+
+ # Init what to do with the package
+ send_further = False
+ deposit_here = False
+
+ # Get what to do with the package
+ last_seq = self._source_map.get(package._source_id, 0)
+ if last_seq < package._source_seq:
+ # Update source map
+ self._source_map[package._source_id] = package._source_seq
+ if package._dest_id == 0:
+ # Add to both lists, first attach seq nr
+ self._recv_seq += 1
+ package._recv_seq = self._recv_seq
+ send_further, deposit_here = True, True
+ elif package._dest_id == self._id:
+ # Add only to process list, first attach seq nr
+ self._recv_seq += 1
+ package._recv_seq = self._recv_seq
+ deposit_here = True
+ else:
+ # Send package to connected nodes
+ send_further = True
+
+
+ # Send package to other context (over all alive connections)
+ if send_further:
+ self._connections_lock.acquire()
+ try:
+ for c in self._connections:
+ if c is connection or not c.is_alive:
+ continue
+ c._send_package(package)
+ finally:
+ self._connections_lock.release()
+
+
+ # Process package here or pass to channel
+ if deposit_here:
+ if slot == SLOT_CONTEXT:
+ # Context-to-context messaging;
+ # A slot starting with a space reprsents the context
+ self._recv_context_package(package)
+ else:
+ # Give package to a channel (if applicable)
+ channel = self._receiving_channels.get(slot, None)
+ if channel is not None:
+ channel._recv_package(package)
+
+
+ def _recv_context_package(self, package):
+ """ _recv_context_package(package)
+
+ Process a package addressed at the context itself. This is how
+ the context handles higher-level connection tasks.
+
+ """
+
+ # Get message: context messages are always utf-8 encoded strings
+ message = package._data.decode('utf-8')
+
+ if message == 'CLOSE_CONNECTION':
+ # Close the connection. Check which one of our connections is
+ # connected with the context that send this message.
+ self._connections_lock.acquire()
+ try:
+ for c in self.connections:
+ if c.is_connected and c.id2 == package._source_id:
+ c.close(connection.STOP_CLOSED_FROM_THERE, False)
+ finally:
+ self._connections_lock.release()
+
+ elif message == 'NEW_CONNECTION':
+ # Resend all status channels
+ for channel in self._sending_channels.values():
+ if hasattr(channel, '_current_message') and hasattr(channel, 'send_last'):
+ channel.send_last()
+
+ else:
+ print('Yoton: Received unknown context message: '+message)
diff --git a/iep/yoton/core.py b/iep/yoton/core.py
new file mode 100644
index 0000000..194de3c
--- /dev/null
+++ b/iep/yoton/core.py
@@ -0,0 +1,309 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+import time
+import sys
+import struct
+import socket
+import threading
+import select # to determine wheter a socket can receive data
+
+import yoton
+from yoton.misc import basestring, bytes, str
+from yoton.misc import Property, getErrorMsg
+
+
+## Constants
+
+# Error code for interruptions
+try:
+ from errno import EINTR
+except ImportError:
+ EINTR = None
+
+# Queue size
+BUF_MAX_LEN = 10000
+
+# Define buffer size. For recv 4096 or 8192 chunk size is recommended.
+# For sending, in principle as large as possible, but prevent too much
+# message copying.
+BUFFER_SIZE_IN = 2**13
+BUFFER_SIZE_OUT = 1*2**20
+
+# Reserved slots (slot 0 does not exist, so we can test "if slot: ")
+# The actual slots start counting from 8.
+# SLOT_TEST = 3 -> Deprecated
+SLOT_CONTEXT = 2
+SLOT_DUMMY = 1
+
+# Struct header packing
+HEADER_FORMAT = '<QQQQQQQ'
+HEADER_SIZE = struct.calcsize(HEADER_FORMAT)
+
+# Constant for control bytes
+CONTROL_BYTES = struct.unpack('<Q', 'YOTON '.encode('utf-8'))[0]
+
+
+## Helper functions
+
+
+def can_send(s, timeout=0.0):
+ """ can_send(bsd_socket, timeout=0.0)
+
+ Given a socket, uses select() to determine whether it can be used
+ for sending. This function can deal with system interrupts.
+
+ """
+ while True:
+ try:
+ can_recv, can_send, tmp = select.select([], [s], [], timeout)
+ break
+ except select.error:
+ # Skip errors caused by interruptions.
+ type, value, tb = sys.exc_info()
+ del tb
+ if value.args[0] != EINTR:
+ raise
+ return bool(can_send)
+
+
+def can_recv(s, timeout=0.0):
+ """ can_recv(bsd_socket, timeout=0.0)
+
+ Given a socket, uses select() to determine whether it can be used
+ for receiving. This function can deal with system interrupts.
+
+ """
+ while True:
+ try:
+ can_recv, can_send, tmp = select.select([s], [], [], timeout)
+ break
+ except select.error:
+ # Skip errors caused by interruptions.
+ type, value, tb = sys.exc_info()
+ del tb
+ if value.args[0] != EINTR:
+ raise
+ return bool(can_recv)
+
+
+def send_all(s, text, stutdown_after_sending=True):
+ """ send_all(socket, text, stutdown_after_sending=True)
+
+ Send all text to the socket. Used during handshaking and in
+ the clientserver module.
+
+ If stutdown_after_sending, the socket is shut down. Some protocols
+ rely on this.
+
+ It is made sure that the text ends with a CRLF double-newline code.
+
+ """
+
+ # Ensure closing chars
+ if not text.endswith('\r\n'):
+ text += '\r\n'
+
+ # Make bytes
+ bb = text.encode('utf-8')
+
+ # Send all bytes
+ try:
+ n = s.sendall(bb)
+ except socket.error:
+ return -1 # Socket closed down badly
+
+ # Shutdown connection nicely from here
+ if stutdown_after_sending:
+ try:
+ s.shutdown(socket.SHUT_WR)
+ except socket.error:
+ pass
+
+
+def recv_all(s, timeout=-1, end_at_crlf=True):
+ """ recv_all(socket, timeout=-1, end_at_crlf=True)
+
+ Receive text from the socket (untill socket receiving is shut down).
+ Used during handshaking and in the clientserver module.
+
+ If end_at_crlf, a message is also ended at a CRLF double-newline code,
+ and a shutdown is not necessary. This takes a tiny bit longer.
+
+ """
+
+ # Init parts (start with one byte, such that len(parts) is always >= 2
+ parts = [' '.encode('ascii'),]
+
+ # Determine number of bytes to get per recv
+ nbytesToGet = BUFFER_SIZE_IN
+ if end_at_crlf:
+ nbytesToGet = 1
+
+ # Set end bytes
+ end_bytes = '\r\n'.encode('ascii')
+
+ # Set max time
+ if timeout <= 0:
+ timeout = 2**32
+ maxtime = time.time() + timeout
+
+ # Receive data
+ while True:
+
+ # Receive if we can
+ if can_recv(s):
+
+ # Get part
+ try:
+ part = s.recv(nbytesToGet)
+ parts.append(part)
+ except socket.error:
+ return None # Socket closed down badly
+
+ # Detect end by shutdown (EOF)
+ if not part:
+ break
+
+ # Detect end by \r\n
+ if end_at_crlf and (parts[-2] + parts[-1]).endswith(end_bytes):
+ break
+
+ else:
+ # Sleep
+ time.sleep(0.01)
+
+ # Check time
+ if time.time() > maxtime:
+ return (bytes().join(parts[1:])).decode('utf-8','ignore')
+
+ # Combine parts (discared first (dummy) part)
+ bb = bytes().join(parts[1:])
+
+ # Try returning as Unicode
+ try:
+ return bb.decode('utf-8','ignore')
+ except UnicodeError:
+ return '<UnicodeError>'
+
+
+## Package class
+
+
+class Package(object):
+ """ Package(data, slot, source_id, source_seq, dest_id, dest_seq, recv_seq)
+
+ Represents a package of bytes to be send from one Context instance
+ to another. A package consists of a header and the encoded message.
+
+ To make this class as fast as reasonably possible, its interface
+ is rather minimalistic and few convenience stuff is implemented.
+
+ Parameters
+ ----------
+ data : bytes
+ The message itself.
+ slot : long
+ The slot at which the package is directed. The integer is a hash of
+ a string slot name.
+ source_id : long
+ The id of the context that sent this package.
+ source_seq : long
+ The sequence number of this package, counted at the sending context.
+ Together with source_id, this fully identifies a package.
+ dest_id : long (default 0)
+ The id of the package that this package replies to.
+ dest_seq : long (default 0)
+ The sequence number of the package that this package replies to.
+ recv_seq : long (default 0)
+ The sequence number of this package counted at the receiving context.
+ This is used to synchronize channels.
+
+ When send, the header is composed of four control bytes, the slot,
+ the source_id, source_seq, dest_id and dest_seq.
+
+ Notes
+ -----
+ A package should always have content. Packages without content are only
+ used for low-level communication between two ContextConnection instances.
+ The source_seq is then used as the signal. All other package attributes
+ are ignored.
+
+ """
+
+ # The __slots__ makes instances of this class consume < 20% of memory
+ # Note that this only works for new style classes.
+ # This is important because many packages can exist at the same time
+ # if a receiver cant keep up with a sender. Further, although Python's
+ # garbage collector collects the objects after they're "consumed",
+ # it does not release the memory, because it hopes to reuse it in
+ # an efficient way later.
+ __slots__ = [ '_data', '_slot',
+ '_source_id', '_source_seq',
+ '_dest_id', '_dest_seq',
+ '_recv_seq']
+
+ def __init__(self, data, slot,
+ source_id, source_seq, dest_id, dest_seq, recv_seq):
+ self._data = data
+ self._slot = slot
+ #
+ self._source_id = source_id
+ self._source_seq = source_seq
+ self._dest_id = dest_id
+ self._dest_seq = dest_seq
+ self._recv_seq = recv_seq
+
+
+ def parts(self):
+ """ parts()
+
+ Get list of bytes that represents this package.
+ By not concatenating the header and content parts,
+ we prevent unnecesary copying of data.
+
+ """
+
+ # Obtain header
+ L = len(self._data)
+ header = struct.pack(HEADER_FORMAT, CONTROL_BYTES, self._slot,
+ self._source_id, self._source_seq,
+ self._dest_id, self._dest_seq,
+ L)
+
+ # Return header and message
+ return header, self._data
+
+
+ def __str__(self):
+ """ Representation of the package. Mainly for debugging. """
+ return 'At slot %i: %s' % (self._slot, repr(self._data))
+
+
+ @classmethod
+ def from_header(cls, header):
+ """ from_header(header)
+
+ Create a package (without data) from the header of a message.
+ Returns (package, data_length). If the header is invalid (checked
+ using the four control bytes) this method returns (None, None).
+
+ """
+ # Unpack
+ tmp = struct.unpack(HEADER_FORMAT, header)
+ CTRL, slot, source_id, source_seq, dest_id, dest_seq, L = tmp
+ # Create package
+ p = Package(None, slot, source_id, source_seq, dest_id, dest_seq, 0)
+ # Return
+ if CTRL == CONTROL_BYTES:
+ return p, L
+ else:
+ return None, None
+
+
+# Constant Package instances (source_seq represents the signal)
+PACKAGE_HEARTBEAT = Package(bytes(), SLOT_DUMMY, 0, 0, 0, 0, 0)
+PACKAGE_CLOSE = Package(bytes(), SLOT_DUMMY, 0, 1, 0, 0, 0)
diff --git a/iep/yoton/events.py b/iep/yoton/events.py
new file mode 100644
index 0000000..09dcf11
--- /dev/null
+++ b/iep/yoton/events.py
@@ -0,0 +1,644 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+# This code is loosely based on the event system of Visvis and on the
+# signals system of Qt.
+
+# Note: Python has a buildin module (sched) that does some of the things
+# here. Hoever, only since Python3.3 is this buildin functionality
+# thread safe. And we need thread safety!
+
+""" Module yoton.events
+
+Yoton comes with a simple event system to enable event-driven applications.
+
+All channels are capable of running without the event system, but some
+channels have limitations. See the documentation of the channels for
+more information. Note that signals only work if events are processed.
+
+"""
+
+import os, sys, time
+import threading
+import weakref
+
+import yoton
+from yoton.misc import Property, getErrorMsg, PackageQueue
+
+
+
+class CallableObject(object):
+ """ CallableObject(callable)
+
+ A class to hold a callable. If it is a plain function, its reference
+ is held (because it might be a closure). If it is a method, we keep
+ the function name and a weak reference to the object. In this way,
+ having for instance a signal bound to a method, the object is not
+ prevented from being cleaned up.
+
+ """
+ __slots__ = ['_ob', '_func'] # Use __slots__ to reduce memory footprint
+
+ def __init__(self, c):
+
+ # Check
+ if not hasattr(c, '__call__'):
+ raise ValueError('Error: given callback is not callable.')
+
+ # Store funcion and object
+ if hasattr(c, '__self__'):
+ # Method, store object and method name
+ self._ob = weakref.ref(c.__self__)
+ self._func = c.__func__.__name__
+ elif hasattr(c, 'im_self'):
+ # Method in older Python
+ self._ob = weakref.ref(c.im_self)
+ self._func = c.im_func.__name__
+ else:
+ # Plain function
+ self._func = c
+ self._ob = None
+
+ def isdead(self):
+ """ Get whether the weak ref is dead.
+ """
+ if self._ob:
+ # Method
+ return self._ob() is None
+ else:
+ return False
+
+ def compare(self, other):
+ """ compare this instance with another.
+ """
+ if self._ob and other._ob:
+ return (self._ob() is other._ob()) and (self._func == other._func)
+ elif not (self._ob or other._ob):
+ return self._func == other._func
+ else:
+ return False
+
+ def __str__(self):
+ return self._func.__str__()
+
+ def call(self, *args, **kwargs):
+ """ call(*args, **kwargs)
+ Call the callable. Exceptions are caught and printed.
+ """
+ if self.isdead():
+ return
+
+ # Get function
+ try:
+ if self._ob:
+ func = getattr(self._ob(), self._func)
+ else:
+ func = self._func
+ except Exception:
+ return
+
+ # Call it
+ try:
+ return func(*args, **kwargs)
+ except Exception:
+ print('Exception while handling event:')
+ print(getErrorMsg())
+
+
+
+class Event(object):
+ """ Event(callable, *args, **kwargs)
+
+ An Event instance represents something that is going to be done.
+ It consists of a callable and arguments to call it with.
+
+ Instances of this class populate the event queue.
+
+ """
+ __slots__ = ['_callable', '_args', '_kwargs', '_timeout']
+ def __init__(self, callable, *args, **kwargs):
+ if isinstance(callable, CallableObject):
+ self._callable = callable
+ else:
+ self._callable = CallableObject(callable)
+ self._args = args
+ self._kwargs = kwargs
+
+ def dispatch(self):
+ """ dispatch()
+ Call the callable with the arguments and keyword-arguments specified
+ at initialization.
+ """
+ self._callable.call(*self._args, **self._kwargs)
+
+ def _on_timeout(self):
+ """ This is what theTimerThread calls.
+ """
+ app.post_event(self)
+
+
+
+class Signal:
+ """ Signal()
+
+ The purpose of a signal is to provide an interface to bind/unbind
+ to events and to fire them.
+
+ One can bind() or unbind() a callable to the signal. When emitted, an
+ event is created for each bound handler. Therefore, the event loop
+ must run for signals to work.
+
+ Some signals call the handlers using additional arguments to
+ specify specific information.
+
+ """
+
+ def __init__(self):
+ self._handlers = []
+
+ @property
+ def type(self):
+ """ The type (__class__) of this event.
+ """
+ return self.__class__
+
+
+ def bind(self, func):
+ """ bind(func)
+
+ Add an eventhandler to this event.
+
+ The callback/handler (func) must be a callable. It is called
+ with one argument: the event instance, which can contain
+ additional information about the event.
+
+ """
+
+ # make callable object (checks whether func is callable)
+ cnew = CallableObject(func)
+
+ # check -> warn
+ for c in self._handlers:
+ if cnew.compare(c):
+ print("Warning: handler %s already present for %s" %(func, self))
+ return
+
+ # add the handler
+ self._handlers.append(cnew)
+
+
+ def unbind(self, func=None):
+ """ unbind(func=None)
+
+ Unsubscribe a handler, If func is None, remove all handlers.
+
+ """
+ if func is None:
+ self._handlers[:] = []
+ else:
+ cref = CallableObject(func)
+ for c in [c for c in self._handlers]:
+ # remove if callable matches func or object is destroyed
+ if c.compare(cref) or c.isdead():
+ self._handlers.remove( c )
+
+
+ def emit(self, *args, **kwargs):
+ """ emit(*args, **kwargs)
+
+ Emit the signal, calling all bound callbacks with *args and **kwargs.
+ An event is queues for each callback registered to this signal.
+ Therefore it is safe to call this method from another thread.
+
+ """
+
+ # Add an event for each callback
+ toremove = []
+ for func in self._handlers:
+ if func.isdead():
+ toremove.append(func)
+ else:
+ event = Event(func, *args, **kwargs)
+ app.post_event(event)
+
+ # Remove dead ones
+ for func in toremove:
+ self._handlers.remove(func)
+
+
+ def emit_now(self, *args, **kwargs):
+ """ emit_now(*args, **kwargs)
+
+ Emit the signal *now*. All handlers are called from the calling
+ thread. Beware, this should only be done from the same thread
+ that runs the event loop.
+
+ """
+
+ # Add an event for each callback
+ toremove = []
+ for func in self._handlers:
+ if func.isdead():
+ toremove.append(func)
+ else:
+ func.call(*args, **kwargs)
+
+ # Remove dead ones
+ for func in toremove:
+ self._handlers.remove(func)
+
+
+
+class TheTimerThread(threading.Thread):
+ """ TheTimerThread is a singleton thread that is used by all timers
+ and delayed events to wait for a while (in a separate thread) and then
+ post an event to the event-queue. By sharing a single thread timers
+ stay lightweight and there is no time spend on initializing or tearing
+ down threads. The downside is that when there are a lot of timers running
+ at the same time, adding a timer may become a bit inefficient because
+ the registered objects must be sorted each time an object is added.
+ """
+ def __init__(self):
+ threading.Thread.__init__(self)
+ self.setDaemon(True)
+ self._exit = False
+ self._timers = []
+ self._somethingChanged = False
+ self._condition = threading.Condition(threading.Lock())
+
+ def stop(self, timeout=1.0):
+ self._exit = True
+ self._condition.acquire()
+ try:
+ self._condition.notify()
+ finally:
+ self._condition.release()
+ self.join(timeout)
+
+ def add(self, timer):
+ """ add(timer)
+ Add item to the list of objects to track. The object should
+ have a _timeout attribute, representing the time.time() at which
+ it runs out, and an _on_timeout() method to call when it does.
+ """
+ # Check
+ if not (hasattr(timer, '_timeout') and hasattr(timer, '_on_timeout')):
+ raise ValueError('Cannot add this object to theTimerThread.')
+ # Add item
+ self._condition.acquire()
+ try:
+ if timer not in self._timers:
+ self._timers.append(timer)
+ self._sort()
+ self._somethingChanged = True
+ self._condition.notify()
+ finally:
+ self._condition.release()
+
+ def _sort(self):
+ self._timers = sorted(self._timers,
+ key=lambda x: x._timeout, reverse=True)
+
+ def discard(self, timer):
+ """Stop the timer if it hasn't finished yet"""
+ self._condition.acquire()
+ try:
+ if timer in self._timers:
+ self._timers.remove(timer)
+ self._somethingChanged = True
+ self._condition.notify()
+ finally:
+ self._condition.release()
+
+ def run(self):
+ self._condition.acquire()
+ try:
+ self._mainloop()
+ finally:
+ self._condition.release()
+
+ def _mainloop(self):
+ while not self._exit:
+
+ # Set flag
+ self._somethingChanged = False
+
+ # Wait here, in wait() the undelying lock is released
+ if self._timers:
+ timer = self._timers[-1]
+ timeout = timer._timeout - time.time()
+ if timeout > 0:
+ self._condition.wait(timeout)
+ else:
+ timer = None
+ self._condition.wait()
+
+ # Here the lock has been re-acquired. Take action?
+ if self._exit:
+ break
+ if (timer is not None) and (not self._somethingChanged):
+ if timer._on_timeout():
+ self._sort() # Keep and resort
+ else:
+ self._timers.pop() # Pop
+
+# Instantiate and start the single timer thread
+# We can do this as long as we do not wait for the threat, and the threat
+# does not do any imports:
+# http://docs.python.org/library/threading.html#importing-in-threaded-code
+theTimerThread = TheTimerThread()
+theTimerThread.start()
+
+
+
+class Timer(Signal):
+ """ Timer(interval=1.0, oneshot=True)
+
+ Timer class. You can bind callbacks to the timer. The timer is
+ fired when it runs out of time.
+
+ Parameters
+ ----------
+ interval : number
+ The interval of the timer in seconds.
+ oneshot : bool
+ Whether the timer should do a single shot, or run continuously.
+
+ """
+
+ def __init__(self, interval=1.0, oneshot=True):
+ Signal.__init__(self)
+
+ # store Timer specific properties
+ self.interval = interval
+ self.oneshot = oneshot
+ #
+ self._timeout = 0
+
+
+ @Property
+ def interval():
+ """ Set/get the timer's interval in seconds.
+ """
+ def fget(self):
+ return self._interval
+ def fset(self, value):
+ if not isinstance(value, (int, float)):
+ raise ValueError('interval must be a float or integer.')
+ if value <= 0:
+ raise ValueError('interval must be larger than 0.')
+ self._interval = float(value)
+ return locals()
+
+
+ @Property
+ def oneshot():
+ """ Set/get whether this is a oneshot timer. If not is runs
+ continuously.
+ """
+ def fget(self):
+ return self._oneshot
+ def fset(self, value):
+ self._oneshot = bool(value)
+ return locals()
+
+
+ @property
+ def running(self):
+ """ Get whether the timer is running.
+ """
+ return self._timeout > 0
+
+
+ def start(self, interval=None, oneshot=None):
+ """ start(interval=None, oneshot=None)
+
+ Start the timer. If interval or oneshot are not given,
+ their current values are used.
+
+ """
+ # set properties?
+ if interval is not None:
+ self.interval = interval
+ if oneshot is not None:
+ self.oneshot = oneshot
+
+ # put on
+ self._timeout = time.time() + self.interval
+ theTimerThread.add(self)
+
+
+ def stop(self):
+ """ stop()
+
+ Stop the timer from running.
+
+ """
+ theTimerThread.discard(self)
+ self._timeout = 0
+
+
+ def _on_timeout(self):
+ """ Method to call when the timer finishes. Called from
+ event-loop-thread.
+ """
+
+ # Emit signal
+ self.emit()
+ #print('timer timeout', self.oneshot)
+ # Do we need to stop it now, or restart it
+ if self.oneshot:
+ # This timer instance is removed from the list of Timers
+ # when the timeout is reached.
+ self._timeout = 0
+ return False
+ else:
+ # keep in the thread
+ self._timeout = time.time() + self.interval
+ return True
+
+
+
+class YotonApplication(object):
+ """ YotonApplication
+
+ Represents the yoton application and contains functions for
+ the event system. Multiple instances can be created, they will
+ all operate on the same event queue and share attributes
+ (because these are on the class, not on the instance).
+
+ One instance of this class is always accesible via yoton.app.
+ For convenience, several of its methods are also accessible
+ directly from the yoton module namespace.
+
+ """
+
+ # Event queues
+ _event_queue = PackageQueue(10000, 'new')
+
+ # Flag to stop event loop
+ _stop_event_loop = False
+
+ # Flag to signal whether we are in an event loop
+ # Can be set externally if the event loop is hijacked.
+ _in_event_loop = False
+
+ # To allow other event loops to embed the yoton event loop
+ _embedding_callback1 = None # The reference
+ _embedding_callback2 = None # Used in post_event
+
+
+ def call_later(self, func, timeout=0.0, *args, **kwargs):
+ """ call_later(func, timeout=0.0, *args, **kwargs)
+
+ Call the given function after the specified timeout.
+
+ Parameters
+ ----------
+ func : callable
+ The function to call.
+ timeout : number
+ The time to wait in seconds. If zero, the event is put on the event
+ queue. If negative, the event will be put at the front of the event
+ queue, so that it's processed asap.
+ args : arguments
+ The arguments to call func with.
+ kwargs: keyword arguments.
+ The keyword arguments to call func with.
+
+ """
+
+ # Wrap the object in an event
+ event = Event(func, *args, **kwargs)
+
+ # Put it in the queue
+ if timeout > 0:
+ self.post_event_later(event, timeout)
+ elif timeout < 0:
+ self.post_event_asap(event) # priority event
+ else:
+ self.post_event(event)
+
+
+ def post_event(self, event):
+ """ post_event(events)
+
+ Post an event to the event queue.
+
+ """
+ YotonApplication._event_queue.push(event)
+ #
+ if YotonApplication._embedding_callback2 is not None:
+ YotonApplication._embedding_callback2 = None
+ YotonApplication._embedding_callback1()
+
+
+ def post_event_asap(self, event):
+ """ post_event_asap(event)
+
+ Post an event to the event queue. Handle as soon as possible;
+ putting it in front of the queue.
+
+ """
+ YotonApplication._event_queue.insert(event)
+ #
+ if YotonApplication._embedding_callback2 is not None:
+ YotonApplication._embedding_callback2 = None
+ YotonApplication._embedding_callback1()
+
+
+ def post_event_later(self, event, delay):
+ """ post_event_later(event, delay)
+
+ Post an event to the event queue, but with a certain delay.
+
+ """
+ event._timeout = time.time() + delay
+ theTimerThread.add(event)
+ # Calls post_event in due time
+
+
+ def process_events(self, block=False):
+ """ process_events(block=False)
+
+ Process all yoton events currently in the queue.
+ This function should be called periodically
+ in order to keep the yoton event system running.
+
+ block can be False (no blocking), True (block), or a float
+ blocking for maximally 'block' seconds.
+
+ """
+ # Reset callback for the embedding event loop
+ YotonApplication._embedding_callback2 = YotonApplication._embedding_callback1
+
+ # Process events
+ try:
+ while True:
+ event = YotonApplication._event_queue.pop(block)
+ event.dispatch()
+ block = False # Proceed until there are now more events
+ except PackageQueue.Empty:
+ pass
+
+
+ def start_event_loop(self):
+ """ start_event_loop()
+
+ Enter an event loop that keeps calling yoton.process_events().
+ The event loop can be stopped using stop_event_loop().
+
+ """
+
+ # Dont go if we are in an event loop
+ if YotonApplication._in_event_loop:
+ return
+
+ # Set flags
+ YotonApplication._stop_event_loop = False
+ YotonApplication._in_event_loop = True
+
+ try:
+ # Keep blocking for 3 seconds so a keyboardinterrupt still works
+ while not YotonApplication._stop_event_loop:
+ self.process_events(3.0)
+ finally:
+ # Unset flag
+ YotonApplication._in_event_loop = False
+
+
+ def stop_event_loop(self):
+ """ stop_event_loop()
+
+ Stops the event loop if it is running.
+
+ """
+ if not YotonApplication._stop_event_loop:
+ # Signal stop
+ YotonApplication._stop_event_loop = True
+ # Push an event so that process_events() unblocks
+ def dummy(): pass
+ self.post_event(Event(dummy))
+
+
+ def embed_event_loop(self, callback):
+ """ embed_event_loop(callback)
+
+ Embed the yoton event loop in another event loop. The given callback
+ is called whenever a new yoton event is created. The callback
+ should create an event in the other event-loop, which should
+ lead to a call to the process_events() method. The given callback
+ should be thread safe.
+
+ Use None as an argument to disable the embedding.
+
+ """
+ YotonApplication._embedding_callback1 = callback
+ YotonApplication._embedding_callback2 = callback
+
+
+# Instantiate an application object
+app = YotonApplication()
diff --git a/iep/yoton/misc.py b/iep/yoton/misc.py
new file mode 100644
index 0000000..999ae50
--- /dev/null
+++ b/iep/yoton/misc.py
@@ -0,0 +1,603 @@
+# -*- coding: utf-8 -*-
+# Copyright (C) 2013 Almar Klein
+#
+# Yoton is distributed under the terms of the (new) BSD License.
+# The full license can be found in 'license.txt'.
+
+""" Module yoton.misc
+
+Defines a few basic constants, classes and functions.
+
+Most importantly, it defines a couple of specific buffer classes that
+are used for the low-level messaging.
+
+"""
+
+import os, sys, time
+import struct
+import socket
+import threading
+import random
+from collections import deque
+
+
+# Version dependent defs
+V2 = sys.version_info[0] == 2
+if V2:
+ D = __builtins__
+ if not isinstance(D, dict):
+ D = D.__dict__
+ bytes = D['str']
+ str = D['unicode']
+ xrange = D['xrange']
+ basestring = basestring
+ long = long
+else:
+ basestring = str # to check if instance is string
+ bytes, str = bytes, str
+ long = int # for the port
+ xrange = range
+
+
+def Property(function):
+ """ Property(function)
+
+ A property decorator which allows to define fget, fset and fdel
+ inside the function.
+
+ Note that the class to which this is applied must inherit from object!
+ Code based on an example posted by Walker Hale:
+ http://code.activestate.com/recipes/410698/#c6
+
+ """
+
+ # Define known keys
+ known_keys = 'fget', 'fset', 'fdel', 'doc'
+
+ # Get elements for defining the property. This should return a dict
+ func_locals = function()
+ if not isinstance(func_locals, dict):
+ raise RuntimeError('Property function should "return locals()".')
+
+ # Create dict with kwargs for property(). Init doc with docstring.
+ D = {'doc': function.__doc__}
+
+ # Copy known keys. Check if there are invalid keys
+ for key in func_locals.keys():
+ if key in known_keys:
+ D[key] = func_locals[key]
+ else:
+ raise RuntimeError('Invalid Property element: %s' % key)
+
+ # Done
+ return property(**D)
+
+
+def getErrorMsg():
+ """ getErrorMsg()
+ Return a string containing the error message. This is usefull, because
+ there is no uniform way to catch exception objects in Python 2.x and
+ Python 3.x.
+ """
+
+ # Get traceback info
+ type, value, tb = sys.exc_info()
+
+ # Store for debugging?
+ if True:
+ sys.last_type = type
+ sys.last_value = value
+ sys.last_traceback = tb
+
+ # Print
+ err = ''
+ try:
+ if not isinstance(value, (OverflowError, SyntaxError, ValueError)):
+ while tb:
+ err = "line %i of %s." % (
+ tb.tb_frame.f_lineno, tb.tb_frame.f_code.co_filename)
+ tb = tb.tb_next
+ finally:
+ del tb
+ return str(value) + "\n" + err
+
+
+def slot_hash(name):
+ """ slot_hash(name)
+
+ Given a string (the slot name) returns a number between 8 and 2**64-1
+ (just small enough to fit in a 64 bit unsigned integer). The number
+ is used as a slot id.
+
+ Slots 0-7 are reseved slots.
+
+ """
+ fac = 0xd2d84a61
+ val = 0
+ offset = 8
+ for c in name:
+ val += ( val>>3 ) + ( ord(c)*fac )
+ val += (val>>3) + (len(name)*fac)
+ return offset + (val % (2**64-offset))
+
+
+def port_hash(name):
+ """ port_hash(name)
+
+ Given a string, returns a port number between 49152 and 65535.
+ (2**14 (16384) different posibilities)
+ This range is the range for dynamic and/or private ports
+ (ephemeral ports) specified by iana.org.
+ The algorithm is deterministic, thus providing a way to map names
+ to port numbers.
+
+ """
+ fac = 0xd2d84a61
+ val = 0
+ for c in name:
+ val += ( val>>3 ) + ( ord(c)*fac )
+ val += (val>>3) + (len(name)*fac)
+ return 49152 + (val % 2**14)
+
+
+def split_address(address):
+ """ split_address(address) -> (protocol, hostname, port)
+
+ Split address in protocol, hostname and port. The address has the
+ following format: "protocol://hostname:port". If the protocol is
+ omitted, TCP is assumed.
+
+ The hostname is the name or ip-address of the computer to connect to.
+ One can use "localhost" for a connection that bypasses some
+ network layers (and is not visible from the outside). One can use
+ "publichost" for a connection at the current computers IP address
+ that is visible from the outside.
+
+ The port can be an integer, or a sting. In the latter case the integer
+ port number is calculated using a hash. One can also use "portname+offset"
+ to specify an integer offset for the port number.
+
+ """
+
+ # Check
+ if not isinstance(address, basestring):
+ raise ValueError("Address should be a string.")
+ if not ":" in address:
+ raise ValueError("Address should be in format 'host:port'.")
+
+ # Is the protocol explicitly defined (zeromq compatibility)
+ protocol = ''
+ if '://' in address:
+ # Get protocol and stripped address
+ tmp = address.split('://',1)
+ protocol = tmp[0].lower()
+ address = tmp[1]
+ if not protocol:
+ protocol = 'tcp'
+
+ # Split
+ tmp = address.split(':',1)
+ host, port = tuple(tmp)
+
+ # Process host
+ if host.lower() == 'localhost':
+ host = '127.0.0.1'
+ if host.lower() == 'publichost':
+ host = 'publichost' + '0'
+ if host.lower().startswith('publichost') and host[10:] in '0123456789':
+ index = int(host[10:])
+ hostname = socket.gethostname()
+ tmp = socket.gethostbyname_ex(hostname)
+ try:
+ host = tmp[2][index] # This resolves to 127.0.1.1 on some Linuxes
+ except IndexError:
+ raise ValueError('Invalid index (%i) in public host addresses.' % index)
+
+ # Process port
+ try:
+ port = int(port)
+ except ValueError:
+ # Convert to int, using a hash
+
+ # Is there an offset?
+ offset = 0
+ if "+" in port:
+ tmp = port.split('+',1)
+ port, offset = tuple(tmp)
+ try:
+ offset = int(offset)
+ except ValueError:
+ raise ValueError("Invalid offset in address")
+
+ # Convert
+ port = port_hash(port) + offset
+
+ # Check port
+ #if port < 1024 or port > 2**16:
+ # raise ValueError("The port must be in the range [1024, 2^16>.")
+ if port > 2**16:
+ raise ValueError("The port must be in the range [0, 2^16>.")
+
+ # Done
+ return protocol, host, port
+
+
+class UID:
+ """ UID
+
+ Represents an 8-byte (64 bit) Unique Identifier.
+
+ """
+
+ _last_timestamp = 0
+
+ def __init__(self, id=None):
+ # Create nr consisting of two parts
+ if id is None:
+ self._nr = self._get_time_int() << 32
+ self._nr += self._get_random_int()
+ elif isinstance(id, (int, long)):
+ self._nr = id
+ else:
+ raise ValueError('The id given to UID() should be an int.')
+
+ def __repr__(self):
+ h = self.get_hex()
+ return "<UID %s-%s>" % (h[:8], h[8:])
+
+ def get_hex(self):
+ """ get_hex()
+
+ Get the hexadecimal representation of this UID. The returned
+ string is 16 characters long.
+
+ """
+ h = hex(self._nr)
+ h = h[2:].rstrip('L')
+ h = h.ljust(2*8, '0')
+ return h
+
+ def get_bytes(self):
+ """ get_bytes()
+
+ Get the UID as bytes.
+
+ """
+ return struct.pack('<Q', self._nr)
+
+ def get_int(self):
+ """ get_int()
+
+ Get the UID as a 64 bit (long) integer.
+
+ """
+ return self._nr
+
+ def _get_random_int(self):
+ return random.randrange(0xffffffff)
+
+ def _get_time_int(self):
+ # Get time stamp in steps of miliseconds
+ timestamp = int(time.time() * 1000)
+ # Increase by one if the same as last time
+ if timestamp <= UID._last_timestamp:
+ timestamp = UID._last_timestamp + 1
+ # Store for next time
+ UID._last_timestamp = timestamp
+ # Truncate to 4 bytes. If the time goes beyond the integer limit, we just
+ # restart counting. With this setup, the cycle is almost 25 days
+ timestamp = timestamp & 0xffffffff
+ # Don't allow 0
+ if timestamp == 0:
+ timestamp += 1
+ UID._last_timestamp += 1
+ return timestamp
+
+
+
+class PackageQueue(object):
+ """ PackageQueue(N, discard_mode='old')
+
+ A queue implementation that can be used in blocking and non-blocking
+ mode and allows peeking. The queue has a limited size. The user
+ can specify whether old or new messages should be discarted.
+
+ Uses a deque object for the queue and a threading.Condition for
+ the blocking.
+
+ """
+
+ class Empty(Exception):
+ def __init__(self):
+ Exception.__init__(self, 'pop from an empty PackageQueue')
+ pass
+
+
+ def __init__(self, N, discard_mode='old'):
+
+ # Instantiate queue and condition
+ self._q = deque()
+ self._condition = threading.Condition()
+
+ # Store max number of elements in queue
+ self._maxlen = int(N)
+
+ # Store discard mode as integer
+ discard_mode = discard_mode.lower()
+ if discard_mode == 'old':
+ self._discard_mode = 1
+ elif discard_mode == 'new':
+ self._discard_mode = 2
+ else:
+ raise ValueError('Invalid discard mode.')
+
+
+ def full(self):
+ """ full()
+
+ Returns True if the number of elements is at its maximum right now.
+ Note that in theory, another thread might pop an element right
+ after this function returns.
+
+ """
+ return len(self) >= self._maxlen
+
+
+ def empty(self):
+ """ empty()
+
+ Returns True if the number of elements is zero right now. Note
+ that in theory, another thread might add an element right
+ after this function returns.
+
+ """
+ return len(self) == 0
+
+
+ def push(self, x):
+ """ push(item)
+
+ Add an item to the queue. If the queue is full, the oldest
+ item in the queue, or the given item is discarted.
+
+ """
+
+ condition = self._condition
+ condition.acquire()
+ try:
+ q = self._q
+
+ if len(q) < self._maxlen:
+ # Add now and notify any waiting threads in get()
+ q.append(x)
+ condition.notify() # code at wait() procedes
+ else:
+ # Full, either discard or pop (no need to notify)
+ if self._discard_mode == 1:
+ q.popleft() # pop old
+ q.append(x)
+ elif self._discard_mode == 2:
+ pass # Simply do not add
+
+ finally:
+ condition.release()
+
+
+ def insert(self, x):
+ """ insert(x)
+
+ Insert an item at the front of the queue. A call to pop() will
+ get this item first. This should be used in rare circumstances
+ to give an item priority. This method never causes items to
+ be discarted.
+
+ """
+
+ condition = self._condition
+ condition.acquire()
+ try:
+ self._q.appendleft(x)
+ condition.notify() # code at wait() procedes
+ finally:
+ condition.release()
+
+
+ def pop(self, block=True):
+ """ pop(block=True)
+
+ Pop the oldest item from the queue. If there are no items in the
+ queue:
+ * the calling thread is blocked until an item is available
+ (if block=True, default);
+ * an PackageQueue.Empty exception is raised (if block=False);
+ * the calling thread is blocked for 'block' seconds (if block
+ is a float).
+
+ """
+
+ condition = self._condition
+ condition.acquire()
+ try:
+ q = self._q
+
+ if not block:
+ # Raise empty if no items in the queue
+ if not len(q):
+ raise self.Empty()
+ elif block is True:
+ # Wait for notify (awakened does not guarantee len(q)>0)
+ while not len(q):
+ condition.wait()
+ elif isinstance(block, float):
+ # Wait if no items, then raise error if still no items
+ if not len(q):
+ condition.wait(block)
+ if not len(q):
+ raise self.Empty()
+ else:
+ raise ValueError('Invalid value for block in PackageQueue.pop().')
+
+ # Return item
+ return q.popleft()
+
+ finally:
+ condition.release()
+
+
+ def peek(self, index=0):
+ """ peek(index=0)
+
+ Get an item from the queue without popping it. index=0 gets the
+ oldest item, index=-1 gets the newest item. Note that index access
+ slows to O(n) time in the middle of the queue (due to the undelying
+ deque object).
+
+ Raises an IndexError if the index is out of range.
+
+ """
+ return self._q[index]
+
+
+ def __len__(self):
+ return self._q.__len__()
+
+
+ def clear(self):
+ """ clear()
+
+ Remove all items from the queue.
+
+ """
+
+ self._condition.acquire()
+ try:
+ self._q.clear()
+ finally:
+ self._condition.release()
+
+
+
+class TinyPackageQueue(PackageQueue):
+ """ TinyPackageQueue(N1, N2, discard_mode='old', timeout=1.0)
+
+ A queue implementation that can be used in blocking and non-blocking
+ mode and allows peeking. The queue has a tiny-size (N1). When this size
+ is reached, a call to push() blocks for up to timeout seconds. The
+ real size (N2) is the same as in the PackageQueue class.
+
+ The tinysize mechanism can be used to semi-synchronize a consumer
+ and a producer, while still having a small queue and without having
+ the consumer fully block.
+
+ Uses a deque object for the queue and a threading.Condition for
+ the blocking.
+
+ """
+
+ def __init__(self, N1, N2, discard_mode='old', timeout=1.0):
+ PackageQueue.__init__(self, N2, discard_mode)
+
+ # Store limit above which the push() method will block
+ self._tinylen = int(N1)
+
+ # Store timeout
+ self._timeout = timeout
+
+
+ def push(self, x):
+ """ push(item)
+
+ Add an item to the queue. If the queue has >= n1 values,
+ this function will block timeout seconds, or until an item is
+ popped from another thread.
+
+ """
+
+ condition = self._condition
+ condition.acquire()
+ try:
+ q = self._q
+ lq = len(q)
+
+ if lq < self._tinylen:
+ # We are on safe side. Wake up any waiting threads if queue was empty
+ q.append(x)
+ condition.notify() # pop() at wait() procedes
+ elif lq < self._maxlen:
+ # The queue is above its limit, but not full
+ condition.wait(self._timeout)
+ q.append(x)
+ else:
+ # Full, either discard or pop (no need to notify)
+ if self._discard_mode == 1:
+ q.popleft() # pop old
+ q.append(x)
+ elif self._discard_mode == 2:
+ pass # Simply do not add
+
+ finally:
+ condition.release()
+
+
+ def pop(self, block=True):
+ """ pop(block=True)
+
+ Pop the oldest item from the queue. If there are no items in the
+ queue:
+ * the calling thread is blocked until an item is available
+ (if block=True, default);
+ * a PackageQueue.Empty exception is raised (if block=False);
+ * the calling thread is blocked for 'block' seconds (if block
+ is a float).
+
+ """
+
+ condition = self._condition
+ condition.acquire()
+ try:
+ q = self._q
+
+ if not block:
+ # Raise empty if no items in the queue
+ if not len(q):
+ raise self.Empty()
+ elif block is True:
+ # Wait for notify (awakened does not guarantee len(q)>0)
+ while not len(q):
+ condition.wait()
+ elif isinstance(block, float):
+ # Wait if no items, then raise error if still no items
+ if not len(q):
+ condition.wait(block)
+ if not len(q):
+ raise self.Empty()
+ else:
+ raise ValueError('Invalid value for block in PackageQueue.pop().')
+
+
+ # Notify if this pop would reduce the length below the threshold
+ if len(q) <= self._tinylen:
+ condition.notifyAll() # wait() procedes
+
+ # Return item
+ return q.popleft()
+
+ finally:
+ condition.release()
+
+
+ def clear(self):
+ """ clear()
+
+ Remove all items from the queue.
+
+ """
+
+ self._condition.acquire()
+ try:
+ lq = len(self._q)
+ self._q.clear()
+ if lq >= self._tinylen:
+ self._condition.notify()
+ finally:
+ self._condition.release()
diff --git a/iep/yotonloader.py b/iep/yotonloader.py
new file mode 100644
index 0000000..e78188f
--- /dev/null
+++ b/iep/yotonloader.py
@@ -0,0 +1,15 @@
+""" This is a bit awkward, but yoton is a package that is designed to
+work from Python 2.4 to Python 3.x. As such, it does not have relative
+imports and must be imported as an absolute package. That is what this
+module does...
+"""
+
+import os
+import sys
+
+# Import yoton
+sys.path.insert(0, os.path.dirname(__file__))
+import yoton
+
+# Reset
+sys.path.pop(0)
diff --git a/setup.cfg b/setup.cfg
new file mode 100644
index 0000000..861a9f5
--- /dev/null
+++ b/setup.cfg
@@ -0,0 +1,5 @@
+[egg_info]
+tag_build =
+tag_date = 0
+tag_svn_revision = 0
+
diff --git a/setup.py b/setup.py
new file mode 100644
index 0000000..ecc9c64
--- /dev/null
+++ b/setup.py
@@ -0,0 +1,83 @@
+# -*- coding: utf-8 -*-
+
+""" Setup script for the IEP package.
+"""
+
+
+import os
+
+try:
+ from setuptools import setup
+except ImportError:
+ from distutils.core import setup
+
+
+name = 'iep'
+description = 'the interactive editor for Python'
+
+
+# Get version and docstring
+__version__ = None
+__doc__ = ''
+docStatus = 0 # Not started, in progress, done
+initFile = os.path.join(os.path.dirname(__file__), 'iep', '__init__.py')
+for line in open(initFile).readlines():
+ if (line.startswith('__version__')):
+ exec(line.strip())
+ elif line.startswith('"""'):
+ if docStatus == 0:
+ docStatus = 1
+ line = line.lstrip('"')
+ elif docStatus == 1:
+ docStatus = 2
+ if docStatus == 1:
+ __doc__ += line
+
+
+setup(
+ name = name,
+ version = __version__,
+ author = 'Almar Klein',
+ author_email = 'almar.klein at gmail.com',
+ license = '(new) BSD',
+
+ url = 'http://www.iep-project.org',
+ download_url = 'http://www.iep-project.org/downloads.html',
+ keywords = "Python interactive IDE Qt science",
+ description = description,
+ long_description = __doc__,
+
+ platforms = 'any',
+ provides = ['iep'],
+ install_requires = ['pyzolib'], # and 'PySide' or 'PyQt4'
+
+ packages = ['iep', 'iep.iepcore', 'iep.iepkernel', 'iep.util',
+ 'iep.tools', 'iep.tools.iepFileBrowser',
+ 'iep.codeeditor', 'iep.codeeditor.parsers', 'iep.codeeditor.extensions',
+ 'iep.yoton', 'iep.yoton.channels',
+ ],
+ package_dir = {'iep': 'iep'},
+ package_data = {'iep': ['license.txt', 'contributors.txt',
+ 'resources/*.*',
+ 'resources/icons/*.*', 'resources/appicons/*.*',
+ 'resources/images/*.*', 'resources/fonts/*.*',
+ 'resources/translations/*.*']},
+ zip_safe = False,
+
+ classifiers = [
+ 'Development Status :: 5 - Production/Stable',
+ 'Intended Audience :: Science/Research',
+ 'Intended Audience :: Education',
+ 'Intended Audience :: Developers',
+ 'Topic :: Scientific/Engineering',
+ 'Topic :: Software Development',
+ 'License :: OSI Approved :: BSD License',
+ 'Operating System :: MacOS :: MacOS X',
+ 'Operating System :: Microsoft :: Windows',
+ 'Operating System :: POSIX',
+ 'Programming Language :: Python :: 3',
+ ],
+
+ entry_points = {'console_scripts': ['iep = ieplauncher',],
+ },
+ )
--
Alioth's /usr/local/bin/git-commit-notice on /srv/git.debian.org/git/debian-science/packages/iep.git
More information about the debian-science-commits
mailing list